summaryrefslogtreecommitdiff
path: root/identity/aidl/default/libeic
diff options
context:
space:
mode:
authorDavid Zeuthen <zeuthen@google.com>2020-10-16 11:27:24 -0400
committerDavid Zeuthen <zeuthen@google.com>2021-01-23 13:35:57 -0500
commit49f2d2558ac417d090dfae9c78ab372d71e5140c (patch)
treebe240ccdfb0fa1e45aa03648cb385ff7ce82d84f /identity/aidl/default/libeic
parenteafa06164d1e1bafbe20562d540ab5420bb0f825 (diff)
Identity Credential changes for Android 12
- Add IIdentityCredential.deleteCredentialWithChallenge() - Deprecate IIdentityCredential.deleteCredential() - Add IIdentityCredential.proveOwership() - Add IIdentityCredential.updateCredential() - Add ProofOfBinding CBOR to AuthenticationKey X.509 certificate - Document which API versions new methods/features appeared in. - Mention need to declare android.hardware.identity_credential system feature (w/ feature version number) and do this for the default implementation. Bug: 170146643 Test: atest VtsHalIdentityTargetTest Change-Id: Ib47c7caa5f3d6fff6919f019eee44a735dba9cf8
Diffstat (limited to 'identity/aidl/default/libeic')
-rw-r--r--identity/aidl/default/libeic/EicCbor.c9
-rw-r--r--identity/aidl/default/libeic/EicCbor.h11
-rw-r--r--identity/aidl/default/libeic/EicOps.h7
-rw-r--r--identity/aidl/default/libeic/EicPresentation.c148
-rw-r--r--identity/aidl/default/libeic/EicPresentation.h21
-rw-r--r--identity/aidl/default/libeic/EicProvisioning.c93
-rw-r--r--identity/aidl/default/libeic/EicProvisioning.h23
7 files changed, 288 insertions, 24 deletions
diff --git a/identity/aidl/default/libeic/EicCbor.c b/identity/aidl/default/libeic/EicCbor.c
index ec049b1c0d..fe131eb8b7 100644
--- a/identity/aidl/default/libeic/EicCbor.c
+++ b/identity/aidl/default/libeic/EicCbor.c
@@ -17,6 +17,7 @@
#include "EicCbor.h"
void eicCborInit(EicCbor* cbor, uint8_t* buffer, size_t bufferSize) {
+ eicMemSet(cbor, '\0', sizeof(EicCbor));
cbor->size = 0;
cbor->bufferSize = bufferSize;
cbor->buffer = buffer;
@@ -26,6 +27,7 @@ void eicCborInit(EicCbor* cbor, uint8_t* buffer, size_t bufferSize) {
void eicCborInitHmacSha256(EicCbor* cbor, uint8_t* buffer, size_t bufferSize,
const uint8_t* hmacKey, size_t hmacKeySize) {
+ eicMemSet(cbor, '\0', sizeof(EicCbor));
cbor->size = 0;
cbor->bufferSize = bufferSize;
cbor->buffer = buffer;
@@ -33,6 +35,10 @@ void eicCborInitHmacSha256(EicCbor* cbor, uint8_t* buffer, size_t bufferSize,
eicOpsHmacSha256Init(&cbor->digester.hmacSha256, hmacKey, hmacKeySize);
}
+void eicCborEnableSecondaryDigesterSha256(EicCbor* cbor, EicSha256Ctx* sha256) {
+ cbor->secondaryDigesterSha256 = sha256;
+}
+
void eicCborFinal(EicCbor* cbor, uint8_t digest[EIC_SHA256_DIGEST_SIZE]) {
switch (cbor->digestType) {
case EIC_CBOR_DIGEST_TYPE_SHA256:
@@ -53,6 +59,9 @@ void eicCborAppend(EicCbor* cbor, const uint8_t* data, size_t size) {
eicOpsHmacSha256Update(&cbor->digester.hmacSha256, data, size);
break;
}
+ if (cbor->secondaryDigesterSha256 != NULL) {
+ eicOpsSha256Update(cbor->secondaryDigesterSha256, data, size);
+ }
if (cbor->size >= cbor->bufferSize) {
cbor->size += size;
diff --git a/identity/aidl/default/libeic/EicCbor.h b/identity/aidl/default/libeic/EicCbor.h
index 4686b38447..9c0f531e4a 100644
--- a/identity/aidl/default/libeic/EicCbor.h
+++ b/identity/aidl/default/libeic/EicCbor.h
@@ -53,6 +53,9 @@ typedef struct {
EicHmacSha256Ctx hmacSha256;
} digester;
+ // The secondary digester, may be unset.
+ EicSha256Ctx* secondaryDigesterSha256;
+
// The buffer used for building up CBOR or NULL if bufferSize is 0.
uint8_t* buffer;
} EicCbor;
@@ -70,6 +73,14 @@ void eicCborInit(EicCbor* cbor, uint8_t* buffer, size_t bufferSize);
void eicCborInitHmacSha256(EicCbor* cbor, uint8_t* buffer, size_t bufferSize,
const uint8_t* hmacKey, size_t hmacKeySize);
+/* Enables a secondary digester.
+ *
+ * May be enabled midway through processing, this can be used to e.g. calculate
+ * a digest of Sig_structure (for COSE_Sign1) and a separate digest of its
+ * payload.
+ */
+void eicCborEnableSecondaryDigesterSha256(EicCbor* cbor, EicSha256Ctx* sha256);
+
/* Finishes building CBOR and returns the digest. */
void eicCborFinal(EicCbor* cbor, uint8_t digest[EIC_SHA256_DIGEST_SIZE]);
diff --git a/identity/aidl/default/libeic/EicOps.h b/identity/aidl/default/libeic/EicOps.h
index da4dabf879..d4fcf0e1bb 100644
--- a/identity/aidl/default/libeic/EicOps.h
+++ b/identity/aidl/default/libeic/EicOps.h
@@ -207,14 +207,17 @@ bool eicOpsCreateCredentialKey(uint8_t privateKey[EIC_P256_PRIV_KEY_SIZE], const
// Generate an X.509 certificate for the key identified by |publicKey| which
// must be of the form returned by eicOpsCreateEcKey().
//
+// If proofOfBinding is not NULL, it will be included as an OCTET_STRING
+// X.509 extension at OID 1.3.6.1.4.1.11129.2.1.26.
+//
// The certificate will be signed by the key identified by |signingKey| which
// must be of the form returned by eicOpsCreateEcKey().
//
bool eicOpsSignEcKey(const uint8_t publicKey[EIC_P256_PUB_KEY_SIZE],
const uint8_t signingKey[EIC_P256_PRIV_KEY_SIZE], unsigned int serial,
const char* issuerName, const char* subjectName, time_t validityNotBefore,
- time_t validityNotAfter, uint8_t* cert,
- size_t* certSize); // inout
+ time_t validityNotAfter, const uint8_t* proofOfBinding,
+ size_t proofOfBindingSize, uint8_t* cert, size_t* certSize); // inout
// Uses |privateKey| to create an ECDSA signature of some data (the SHA-256 must
// be given by |digestOfData|). Returns the signature in |signature|.
diff --git a/identity/aidl/default/libeic/EicPresentation.c b/identity/aidl/default/libeic/EicPresentation.c
index d3f5556f66..5e9a280d09 100644
--- a/identity/aidl/default/libeic/EicPresentation.c
+++ b/identity/aidl/default/libeic/EicPresentation.c
@@ -19,13 +19,28 @@
#include <inttypes.h>
bool eicPresentationInit(EicPresentation* ctx, bool testCredential, const char* docType,
- const uint8_t encryptedCredentialKeys[80]) {
- uint8_t credentialKeys[52];
+ const uint8_t* encryptedCredentialKeys,
+ size_t encryptedCredentialKeysSize) {
+ uint8_t credentialKeys[86];
+ bool expectPopSha256 = false;
+
+ // For feature version 202009 it's 52 bytes long and for feature version 202101 it's 86
+ // bytes (the additional data is the ProofOfProvisioning SHA-256). We need
+ // to support loading all feature versions.
+ //
+ if (encryptedCredentialKeysSize == 52 + 28) {
+ /* do nothing */
+ } else if (encryptedCredentialKeysSize == 86 + 28) {
+ expectPopSha256 = true;
+ } else {
+ eicDebug("Unexpected size %zd for encryptedCredentialKeys", encryptedCredentialKeysSize);
+ return false;
+ }
eicMemSet(ctx, '\0', sizeof(EicPresentation));
if (!eicOpsDecryptAes128Gcm(eicOpsGetHardwareBoundKey(testCredential), encryptedCredentialKeys,
- 80,
+ encryptedCredentialKeysSize,
// DocType is the additionalAuthenticatedData
(const uint8_t*)docType, eicStrLen(docType), credentialKeys)) {
eicDebug("Error decrypting CredentialKeys");
@@ -34,25 +49,42 @@ bool eicPresentationInit(EicPresentation* ctx, bool testCredential, const char*
// It's supposed to look like this;
//
+ // Feature version 202009:
+ //
// CredentialKeys = [
// bstr, ; storageKey, a 128-bit AES key
- // bstr ; credentialPrivKey, the private key for credentialKey
+ // bstr, ; credentialPrivKey, the private key for credentialKey
// ]
//
- // where storageKey is 16 bytes and credentialPrivateKey is 32 bytes.
+ // Feature version 202101:
//
- // So the first two bytes will be 0x82 0x50 indicating resp. an array of two elements
- // and a bstr of 16 elements. Sixteen bytes later (offset 18 and 19) there will be
- // a bstr of 32 bytes. It's encoded as two bytes 0x58 and 0x20.
+ // CredentialKeys = [
+ // bstr, ; storageKey, a 128-bit AES key
+ // bstr, ; credentialPrivKey, the private key for credentialKey
+ // bstr ; proofOfProvisioning SHA-256
+ // ]
//
- if (credentialKeys[0] != 0x82 || credentialKeys[1] != 0x50 || credentialKeys[18] != 0x58 ||
- credentialKeys[19] != 0x20) {
+ // where storageKey is 16 bytes, credentialPrivateKey is 32 bytes, and proofOfProvisioning
+ // SHA-256 is 32 bytes.
+ //
+ if (credentialKeys[0] != (expectPopSha256 ? 0x83 : 0x82) || // array of two or three elements
+ credentialKeys[1] != 0x50 || // 16-byte bstr
+ credentialKeys[18] != 0x58 || credentialKeys[19] != 0x20) { // 32-byte bstr
eicDebug("Invalid CBOR for CredentialKeys");
return false;
}
+ if (expectPopSha256) {
+ if (credentialKeys[52] != 0x58 || credentialKeys[53] != 0x20) { // 32-byte bstr
+ eicDebug("Invalid CBOR for CredentialKeys");
+ return false;
+ }
+ }
eicMemCpy(ctx->storageKey, credentialKeys + 2, EIC_AES_128_KEY_SIZE);
eicMemCpy(ctx->credentialPrivateKey, credentialKeys + 20, EIC_P256_PRIV_KEY_SIZE);
ctx->testCredential = testCredential;
+ if (expectPopSha256) {
+ eicMemCpy(ctx->proofOfProvisioningSha256, credentialKeys + 54, EIC_SHA256_DIGEST_SIZE);
+ }
return true;
}
@@ -61,6 +93,35 @@ bool eicPresentationGenerateSigningKeyPair(EicPresentation* ctx, const char* doc
uint8_t signingKeyBlob[60]) {
uint8_t signingKeyPriv[EIC_P256_PRIV_KEY_SIZE];
uint8_t signingKeyPub[EIC_P256_PUB_KEY_SIZE];
+ uint8_t cborBuf[64];
+
+ // Generate the ProofOfBinding CBOR to include in the X.509 certificate in
+ // IdentityCredentialAuthenticationKeyExtension CBOR. This CBOR is defined
+ // by the following CDDL
+ //
+ // ProofOfBinding = [
+ // "ProofOfBinding",
+ // bstr, // Contains the SHA-256 of ProofOfProvisioning
+ // ]
+ //
+ // This array may grow in the future if other information needs to be
+ // conveyed.
+ //
+ // The bytes of ProofOfBinding is is represented as an OCTET_STRING
+ // and stored at OID 1.3.6.1.4.1.11129.2.1.26.
+ //
+
+ EicCbor cbor;
+ eicCborInit(&cbor, cborBuf, sizeof cborBuf);
+ eicCborAppendArray(&cbor, 2);
+ eicCborAppendString(&cbor, "ProofOfBinding");
+ eicCborAppendByteString(&cbor, ctx->proofOfProvisioningSha256, EIC_SHA256_DIGEST_SIZE);
+ if (cbor.size > sizeof(cborBuf)) {
+ eicDebug("Exceeded buffer size");
+ return false;
+ }
+ const uint8_t* proofOfBinding = cborBuf;
+ size_t proofOfBindingSize = cbor.size;
if (!eicOpsCreateEcKey(signingKeyPriv, signingKeyPub)) {
eicDebug("Error creating signing key");
@@ -73,7 +134,8 @@ bool eicPresentationGenerateSigningKeyPair(EicPresentation* ctx, const char* doc
if (!eicOpsSignEcKey(signingKeyPub, ctx->credentialPrivateKey, 1,
"Android Identity Credential Key", // issuer CN
"Android Identity Credential Authentication Key", // subject CN
- validityNotBefore, validityNotAfter, publicKeyCert, publicKeyCertSize)) {
+ validityNotBefore, validityNotAfter, proofOfBinding, proofOfBindingSize,
+ publicKeyCert, publicKeyCertSize)) {
eicDebug("Error creating certificate for signing key");
return false;
}
@@ -674,7 +736,8 @@ bool eicPresentationFinishRetrieval(EicPresentation* ctx, uint8_t* digestToBeMac
}
bool eicPresentationDeleteCredential(EicPresentation* ctx, const char* docType,
- size_t proofOfDeletionCborSize,
+ const uint8_t* challenge, size_t challengeSize,
+ bool includeChallenge, size_t proofOfDeletionCborSize,
uint8_t signatureOfToBeSigned[EIC_ECDSA_P256_SIGNATURE_SIZE]) {
EicCbor cbor;
@@ -712,9 +775,12 @@ bool eicPresentationDeleteCredential(EicPresentation* ctx, const char* docType,
eicCborBegin(&cbor, EIC_CBOR_MAJOR_TYPE_BYTE_STRING, proofOfDeletionCborSize);
// Finally, the CBOR that we're actually signing.
- eicCborAppendArray(&cbor, 3);
+ eicCborAppendArray(&cbor, includeChallenge ? 4 : 3);
eicCborAppendString(&cbor, "ProofOfDeletion");
eicCborAppendString(&cbor, docType);
+ if (includeChallenge) {
+ eicCborAppendByteString(&cbor, challenge, challengeSize);
+ }
eicCborAppendBool(&cbor, ctx->testCredential);
uint8_t cborSha256[EIC_SHA256_DIGEST_SIZE];
@@ -726,3 +792,59 @@ bool eicPresentationDeleteCredential(EicPresentation* ctx, const char* docType,
return true;
}
+
+bool eicPresentationProveOwnership(EicPresentation* ctx, const char* docType, bool testCredential,
+ const uint8_t* challenge, size_t challengeSize,
+ size_t proofOfOwnershipCborSize,
+ uint8_t signatureOfToBeSigned[EIC_ECDSA_P256_SIGNATURE_SIZE]) {
+ EicCbor cbor;
+
+ eicCborInit(&cbor, NULL, 0);
+
+ // What we're going to sign is the COSE ToBeSigned structure which
+ // looks like the following:
+ //
+ // Sig_structure = [
+ // context : "Signature" / "Signature1" / "CounterSignature",
+ // body_protected : empty_or_serialized_map,
+ // ? sign_protected : empty_or_serialized_map,
+ // external_aad : bstr,
+ // payload : bstr
+ // ]
+ //
+ eicCborAppendArray(&cbor, 4);
+ eicCborAppendString(&cbor, "Signature1");
+
+ // The COSE Encoded protected headers is just a single field with
+ // COSE_LABEL_ALG (1) -> COSE_ALG_ECSDA_256 (-7). For simplicitly we just
+ // hard-code the CBOR encoding:
+ static const uint8_t coseEncodedProtectedHeaders[] = {0xa1, 0x01, 0x26};
+ eicCborAppendByteString(&cbor, coseEncodedProtectedHeaders,
+ sizeof(coseEncodedProtectedHeaders));
+
+ // We currently don't support Externally Supplied Data (RFC 8152 section 4.3)
+ // so external_aad is the empty bstr
+ static const uint8_t externalAad[0] = {};
+ eicCborAppendByteString(&cbor, externalAad, sizeof(externalAad));
+
+ // For the payload, the _encoded_ form follows here. We handle this by simply
+ // opening a bstr, and then writing the CBOR. This requires us to know the
+ // size of said bstr, ahead of time.
+ eicCborBegin(&cbor, EIC_CBOR_MAJOR_TYPE_BYTE_STRING, proofOfOwnershipCborSize);
+
+ // Finally, the CBOR that we're actually signing.
+ eicCborAppendArray(&cbor, 4);
+ eicCborAppendString(&cbor, "ProofOfOwnership");
+ eicCborAppendString(&cbor, docType);
+ eicCborAppendByteString(&cbor, challenge, challengeSize);
+ eicCborAppendBool(&cbor, testCredential);
+
+ uint8_t cborSha256[EIC_SHA256_DIGEST_SIZE];
+ eicCborFinal(&cbor, cborSha256);
+ if (!eicOpsEcDsa(ctx->credentialPrivateKey, cborSha256, signatureOfToBeSigned)) {
+ eicDebug("Error signing proofOfDeletion");
+ return false;
+ }
+
+ return true;
+}
diff --git a/identity/aidl/default/libeic/EicPresentation.h b/identity/aidl/default/libeic/EicPresentation.h
index d79896212e..7cad068772 100644
--- a/identity/aidl/default/libeic/EicPresentation.h
+++ b/identity/aidl/default/libeic/EicPresentation.h
@@ -31,6 +31,8 @@ extern "C" {
#define EIC_PRESENTATION_MAX_READER_PUBLIC_KEY_SIZE 65
typedef struct {
+ int featureLevel;
+
uint8_t storageKey[EIC_AES_128_KEY_SIZE];
uint8_t credentialPrivateKey[EIC_P256_PRIV_KEY_SIZE];
@@ -79,12 +81,17 @@ typedef struct {
// SHA-256 for AdditionalData, updated for each entry.
uint8_t additionalDataSha256[EIC_SHA256_DIGEST_SIZE];
+ // SHA-256 of ProofOfProvisioning. Set to NUL-bytes or initialized from CredentialKeys data
+ // if credential was created with feature version 202101 or later.
+ uint8_t proofOfProvisioningSha256[EIC_SHA256_DIGEST_SIZE];
+
size_t expectedCborSizeAtEnd;
EicCbor cbor;
} EicPresentation;
bool eicPresentationInit(EicPresentation* ctx, bool testCredential, const char* docType,
- const uint8_t encryptedCredentialKeys[80]);
+ const uint8_t* encryptedCredentialKeys,
+ size_t encryptedCredentialKeysSize);
bool eicPresentationGenerateSigningKeyPair(EicPresentation* ctx, const char* docType, time_t now,
uint8_t* publicKeyCert, size_t* publicKeyCertSize,
@@ -219,9 +226,19 @@ bool eicPresentationFinishRetrieval(EicPresentation* ctx, uint8_t* digestToBeMac
// where content is set to the ProofOfDeletion CBOR.
//
bool eicPresentationDeleteCredential(EicPresentation* ctx, const char* docType,
- size_t proofOfDeletionCborSize,
+ const uint8_t* challenge, size_t challengeSize,
+ bool includeChallenge, size_t proofOfDeletionCborSize,
uint8_t signatureOfToBeSigned[EIC_ECDSA_P256_SIGNATURE_SIZE]);
+// The data returned in |signatureOfToBeSigned| contains the ECDSA signature of
+// the ToBeSigned CBOR from RFC 8051 "4.4. Signing and Verification Process"
+// where content is set to the ProofOfOwnership CBOR.
+//
+bool eicPresentationProveOwnership(EicPresentation* ctx, const char* docType, bool testCredential,
+ const uint8_t* challenge, size_t challengeSize,
+ size_t proofOfOwnershipCborSize,
+ uint8_t signatureOfToBeSigned[EIC_ECDSA_P256_SIGNATURE_SIZE]);
+
#ifdef __cplusplus
}
#endif
diff --git a/identity/aidl/default/libeic/EicProvisioning.c b/identity/aidl/default/libeic/EicProvisioning.c
index f16605cfad..3b4148e571 100644
--- a/identity/aidl/default/libeic/EicProvisioning.c
+++ b/identity/aidl/default/libeic/EicProvisioning.c
@@ -26,10 +26,84 @@ bool eicProvisioningInit(EicProvisioning* ctx, bool testCredential) {
return true;
}
+bool eicProvisioningInitForUpdate(EicProvisioning* ctx, bool testCredential, const char* docType,
+ const uint8_t* encryptedCredentialKeys,
+ size_t encryptedCredentialKeysSize) {
+ uint8_t credentialKeys[86];
+
+ // For feature version 202009 it's 52 bytes long and for feature version 202101 it's 86
+ // bytes (the additional data is the ProofOfProvisioning SHA-256). We need
+ // to support loading all feature versions.
+ //
+ bool expectPopSha256 = false;
+ if (encryptedCredentialKeysSize == 52 + 28) {
+ /* do nothing */
+ } else if (encryptedCredentialKeysSize == 86 + 28) {
+ expectPopSha256 = true;
+ } else {
+ eicDebug("Unexpected size %zd for encryptedCredentialKeys", encryptedCredentialKeysSize);
+ return false;
+ }
+
+ eicMemSet(ctx, '\0', sizeof(EicProvisioning));
+ ctx->testCredential = testCredential;
+
+ if (!eicOpsDecryptAes128Gcm(eicOpsGetHardwareBoundKey(testCredential), encryptedCredentialKeys,
+ encryptedCredentialKeysSize,
+ // DocType is the additionalAuthenticatedData
+ (const uint8_t*)docType, eicStrLen(docType), credentialKeys)) {
+ eicDebug("Error decrypting CredentialKeys");
+ return false;
+ }
+
+ // It's supposed to look like this;
+ //
+ // Feature version 202009:
+ //
+ // CredentialKeys = [
+ // bstr, ; storageKey, a 128-bit AES key
+ // bstr, ; credentialPrivKey, the private key for credentialKey
+ // ]
+ //
+ // Feature version 202101:
+ //
+ // CredentialKeys = [
+ // bstr, ; storageKey, a 128-bit AES key
+ // bstr, ; credentialPrivKey, the private key for credentialKey
+ // bstr ; proofOfProvisioning SHA-256
+ // ]
+ //
+ // where storageKey is 16 bytes, credentialPrivateKey is 32 bytes, and proofOfProvisioning
+ // SHA-256 is 32 bytes.
+ //
+ if (credentialKeys[0] != (expectPopSha256 ? 0x83 : 0x82) || // array of two or three elements
+ credentialKeys[1] != 0x50 || // 16-byte bstr
+ credentialKeys[18] != 0x58 || credentialKeys[19] != 0x20) { // 32-byte bstr
+ eicDebug("Invalid CBOR for CredentialKeys");
+ return false;
+ }
+ if (expectPopSha256) {
+ if (credentialKeys[52] != 0x58 || credentialKeys[53] != 0x20) { // 32-byte bstr
+ eicDebug("Invalid CBOR for CredentialKeys");
+ return false;
+ }
+ }
+ eicMemCpy(ctx->storageKey, credentialKeys + 2, EIC_AES_128_KEY_SIZE);
+ eicMemCpy(ctx->credentialPrivateKey, credentialKeys + 20, EIC_P256_PRIV_KEY_SIZE);
+ // Note: We don't care about the previous ProofOfProvisioning SHA-256
+ ctx->isUpdate = true;
+ return true;
+}
+
bool eicProvisioningCreateCredentialKey(EicProvisioning* ctx, const uint8_t* challenge,
size_t challengeSize, const uint8_t* applicationId,
size_t applicationIdSize, uint8_t* publicKeyCert,
size_t* publicKeyCertSize) {
+ if (ctx->isUpdate) {
+ eicDebug("Cannot create CredentialKey on update");
+ return false;
+ }
+
if (!eicOpsCreateCredentialKey(ctx->credentialPrivateKey, challenge, challengeSize,
applicationId, applicationIdSize, ctx->testCredential,
publicKeyCert, publicKeyCertSize)) {
@@ -96,6 +170,9 @@ bool eicProvisioningStartPersonalization(EicProvisioning* ctx, int accessControl
eicCborBegin(&ctx->cbor, EIC_CBOR_MAJOR_TYPE_BYTE_STRING, expectedProofOfProvisioningSize);
ctx->expectedCborSizeAtEnd = expectedProofOfProvisioningSize + ctx->cbor.size;
+ eicOpsSha256Init(&ctx->proofOfProvisioningDigester);
+ eicCborEnableSecondaryDigesterSha256(&ctx->cbor, &ctx->proofOfProvisioningDigester);
+
eicCborAppendArray(&ctx->cbor, 5);
eicCborAppendString(&ctx->cbor, "ProofOfProvisioning");
eicCborAppendString(&ctx->cbor, docType);
@@ -260,14 +337,23 @@ bool eicProvisioningFinishAddingEntries(
}
bool eicProvisioningFinishGetCredentialData(EicProvisioning* ctx, const char* docType,
- uint8_t encryptedCredentialKeys[80]) {
+ uint8_t* encryptedCredentialKeys,
+ size_t* encryptedCredentialKeysSize) {
EicCbor cbor;
- uint8_t cborBuf[52];
+ uint8_t cborBuf[86];
+
+ if (*encryptedCredentialKeysSize < 86 + 28) {
+ eicDebug("encryptedCredentialKeysSize is %zd which is insufficient");
+ return false;
+ }
eicCborInit(&cbor, cborBuf, sizeof(cborBuf));
- eicCborAppendArray(&cbor, 2);
+ eicCborAppendArray(&cbor, 3);
eicCborAppendByteString(&cbor, ctx->storageKey, EIC_AES_128_KEY_SIZE);
eicCborAppendByteString(&cbor, ctx->credentialPrivateKey, EIC_P256_PRIV_KEY_SIZE);
+ uint8_t popSha256[EIC_SHA256_DIGEST_SIZE];
+ eicOpsSha256Final(&ctx->proofOfProvisioningDigester, popSha256);
+ eicCborAppendByteString(&cbor, popSha256, EIC_SHA256_DIGEST_SIZE);
if (cbor.size > sizeof(cborBuf)) {
eicDebug("Exceeded buffer size");
return false;
@@ -285,6 +371,7 @@ bool eicProvisioningFinishGetCredentialData(EicProvisioning* ctx, const char* do
eicDebug("Error encrypting CredentialKeys");
return false;
}
+ *encryptedCredentialKeysSize = cbor.size + 28;
return true;
}
diff --git a/identity/aidl/default/libeic/EicProvisioning.h b/identity/aidl/default/libeic/EicProvisioning.h
index 836d16e444..f064787b1b 100644
--- a/identity/aidl/default/libeic/EicProvisioning.h
+++ b/identity/aidl/default/libeic/EicProvisioning.h
@@ -31,7 +31,7 @@ extern "C" {
#define EIC_MAX_NUM_ACCESS_CONTROL_PROFILE_IDS 32
typedef struct {
- // Set by eicCreateCredentialKey.
+ // Set by eicCreateCredentialKey() OR eicProvisioningInitForUpdate()
uint8_t credentialPrivateKey[EIC_P256_PRIV_KEY_SIZE];
int numEntryCounts;
@@ -43,6 +43,7 @@ typedef struct {
size_t curEntrySize;
size_t curEntryNumBytesReceived;
+ // Set by eicProvisioningInit() OR eicProvisioningInitForUpdate()
uint8_t storageKey[EIC_AES_128_KEY_SIZE];
size_t expectedCborSizeAtEnd;
@@ -50,13 +51,23 @@ typedef struct {
// SHA-256 for AdditionalData, updated for each entry.
uint8_t additionalDataSha256[EIC_SHA256_DIGEST_SIZE];
+ // Digester just for ProofOfProvisioning (without Sig_structure).
+ EicSha256Ctx proofOfProvisioningDigester;
+
EicCbor cbor;
bool testCredential;
+
+ // Set to true if this is an update.
+ bool isUpdate;
} EicProvisioning;
bool eicProvisioningInit(EicProvisioning* ctx, bool testCredential);
+bool eicProvisioningInitForUpdate(EicProvisioning* ctx, bool testCredential, const char* docType,
+ const uint8_t* encryptedCredentialKeys,
+ size_t encryptedCredentialKeysSize);
+
bool eicProvisioningCreateCredentialKey(EicProvisioning* ctx, const uint8_t* challenge,
size_t challengeSize, const uint8_t* applicationId,
size_t applicationIdSize, uint8_t* publicKeyCert,
@@ -107,14 +118,18 @@ bool eicProvisioningFinishAddingEntries(
// CredentialKeys = [
// bstr, ; storageKey, a 128-bit AES key
// bstr ; credentialPrivKey, the private key for credentialKey
+// bstr ; SHA-256(ProofOfProvisioning)
// ]
//
+// for feature version 202101. For feature version 202009 the third field was not present.
+//
// Since |storageKey| is 16 bytes and |credentialPrivKey| is 32 bytes, the
-// encoded CBOR for CredentialKeys is 52 bytes and consequently
-// |encryptedCredentialKeys| will be 52 + 28 = 80 bytes.
+// encoded CBOR for CredentialKeys is 86 bytes and consequently
+// |encryptedCredentialKeys| will be no longer than 86 + 28 = 114 bytes.
//
bool eicProvisioningFinishGetCredentialData(EicProvisioning* ctx, const char* docType,
- uint8_t encryptedCredentialKeys[80]);
+ uint8_t* encryptedCredentialKeys,
+ size_t* encryptedCredentialKeysSize);
#ifdef __cplusplus
}