summaryrefslogtreecommitdiff
diff options
context:
space:
mode:
-rw-r--r--METADATA3
-rw-r--r--apex/permission/framework/Android.bp5
-rw-r--r--apex/permission/service/Android.bp1
-rw-r--r--cmds/sm/src/com/android/commands/sm/Sm.java7
-rw-r--r--config/OWNERS6
-rw-r--r--core/api/current.txt27
-rw-r--r--core/api/module-lib-current.txt16
-rw-r--r--core/api/system-current.txt288
-rw-r--r--core/api/test-current.txt10
-rw-r--r--core/java/android/annotation/RequiresFeature.java13
-rw-r--r--core/java/android/app/ContextImpl.java39
-rw-r--r--core/java/android/app/OWNERS3
-rw-r--r--core/java/android/app/admin/DevicePolicyManager.java59
-rw-r--r--core/java/android/apphibernation/AppHibernationManager.java79
-rw-r--r--core/java/android/apphibernation/IAppHibernationService.aidl26
-rw-r--r--core/java/android/content/Context.java41
-rw-r--r--core/java/android/content/ContextWrapper.java29
-rw-r--r--core/java/android/content/pm/PackageManager.java32
-rw-r--r--core/java/android/graphics/fonts/OWNERS1
-rw-r--r--core/java/android/net/ConnectivityManager.java120
-rw-r--r--core/java/android/net/IConnectivityManager.aidl9
-rw-r--r--core/java/android/net/INetworkPolicyManager.aidl1
-rw-r--r--core/java/android/net/INetworkStatsService.aidl2
-rw-r--r--core/java/android/net/IQosCallback.aidl34
-rw-r--r--core/java/android/net/IpSecManager.java95
-rw-r--r--core/java/android/net/Network.java2
-rw-r--r--core/java/android/net/NetworkAgent.java115
-rw-r--r--core/java/android/net/NetworkCapabilities.java4
-rw-r--r--core/java/android/net/NetworkIdentity.java16
-rw-r--r--core/java/android/net/NetworkPolicyManager.java16
-rw-r--r--core/java/android/net/NetworkReleasedException.java32
-rw-r--r--core/java/android/net/NetworkRequest.java4
-rw-r--r--core/java/android/net/NetworkUtils.java8
-rw-r--r--core/java/android/net/ProxyInfo.java2
-rw-r--r--core/java/android/net/QosCallback.java91
-rw-r--r--core/java/android/net/QosCallbackConnection.java128
-rw-r--r--core/java/android/net/QosCallbackException.java110
-rw-r--r--core/java/android/net/QosFilter.java75
-rw-r--r--core/java/android/net/QosFilterParcelable.aidl21
-rw-r--r--core/java/android/net/QosFilterParcelable.java113
-rw-r--r--core/java/android/net/QosSession.aidl21
-rw-r--r--core/java/android/net/QosSession.java136
-rw-r--r--core/java/android/net/QosSessionAttributes.java30
-rw-r--r--core/java/android/net/QosSocketFilter.java166
-rw-r--r--core/java/android/net/QosSocketInfo.aidl21
-rw-r--r--core/java/android/net/QosSocketInfo.java154
-rw-r--r--core/java/android/net/SocketLocalAddressChangedException.java32
-rw-r--r--core/java/android/net/SocketNotBoundException.java32
-rw-r--r--core/java/android/net/VpnInfo.aidl (renamed from core/java/com/android/internal/net/VpnInfo.aidl)2
-rw-r--r--core/java/android/net/VpnInfo.java (renamed from core/java/com/android/internal/net/VpnInfo.java)41
-rw-r--r--core/java/android/net/vcn/VcnConfig.java18
-rw-r--r--core/java/android/net/vcn/VcnGatewayConnectionConfig.java142
-rw-r--r--core/java/android/net/vcn/VcnManager.java1
-rwxr-xr-xcore/java/android/os/Build.java1
-rw-r--r--core/java/android/os/storage/OWNERS7
-rw-r--r--core/java/android/se/omapi/SEService.java25
-rw-r--r--core/java/android/service/resumeonreboot/IResumeOnRebootService.aidl25
-rw-r--r--core/java/android/service/resumeonreboot/ResumeOnRebootService.java164
-rw-r--r--core/java/android/util/FeatureFlagUtils.java2
-rw-r--r--core/java/android/util/OWNERS3
-rw-r--r--core/java/android/uwb/AngleMeasurement.java2
-rw-r--r--core/java/android/uwb/AngleOfArrivalMeasurement.java20
-rw-r--r--core/java/android/uwb/DistanceMeasurement.java2
-rw-r--r--core/java/android/uwb/RangingMeasurement.java2
-rw-r--r--core/java/android/uwb/RangingReport.java2
-rw-r--r--core/java/android/uwb/RangingSession.java2
-rw-r--r--core/java/android/uwb/UwbAddress.java2
-rw-r--r--core/java/android/uwb/UwbManager.java2
-rw-r--r--core/java/com/android/internal/app/OWNERS2
-rw-r--r--core/java/com/android/internal/graphics/fonts/OWNERS1
-rw-r--r--core/jni/android_net_NetUtils.cpp27
-rw-r--r--core/res/AndroidManifest.xml9
-rw-r--r--core/sysprop/WatchdogProperties.sysprop9
-rw-r--r--core/sysprop/api/com.android.sysprop.watchdog-latest.txt4
-rw-r--r--core/tests/bugreports/src/com/android/os/bugreports/tests/BugreportManagerTest.java12
-rw-r--r--core/tests/coretests/src/android/app/OWNERS5
-rw-r--r--core/tests/coretests/src/android/app/people/OWNERS1
-rw-r--r--core/tests/coretests/src/android/content/pm/OWNERS3
-rw-r--r--core/tests/coretests/src/android/text/format/DateIntervalFormatTest.java16
-rw-r--r--core/tests/coretests/src/android/text/format/FormatterTest.java2
-rw-r--r--core/tests/coretests/src/android/text/format/RelativeDateTimeFormatterTest.java4
-rw-r--r--core/tests/uwbtests/src/android/uwb/AngleOfArrivalMeasurementTest.java8
-rw-r--r--core/tests/uwbtests/src/android/uwb/UwbTestUtils.java4
-rw-r--r--data/etc/OWNERS3
-rw-r--r--identity/java/android/security/identity/CredstoreIdentityCredential.java86
-rw-r--r--identity/java/android/security/identity/CredstoreIdentityCredentialStore.java1
-rw-r--r--identity/java/android/security/identity/CredstoreWritableIdentityCredential.java10
-rw-r--r--identity/java/android/security/identity/IdentityCredential.java155
-rw-r--r--identity/java/android/security/identity/IdentityCredentialStore.java14
-rw-r--r--keystore/java/android/security/Authorization.java2
-rw-r--r--keystore/java/android/security/keystore2/AndroidKeyStoreECPublicKey.java5
-rw-r--r--keystore/java/android/security/keystore2/AndroidKeyStorePublicKey.java8
-rw-r--r--keystore/java/android/security/keystore2/AndroidKeyStoreRSAPublicKey.java7
-rw-r--r--libs/androidfw/LocaleDataTables.cpp195
-rw-r--r--libs/androidfw/ResourceTypes.cpp9
-rw-r--r--packages/Connectivity/framework/Android.bp29
-rw-r--r--packages/Connectivity/framework/src/com/android/connectivity/aidl/INetworkAgent.aidl49
-rw-r--r--packages/Connectivity/framework/src/com/android/connectivity/aidl/INetworkAgentRegistry.aidl41
-rw-r--r--packages/DynamicSystemInstallationService/src/com/android/dynsystem/BootCompletedReceiver.java17
-rw-r--r--packages/DynamicSystemInstallationService/src/com/android/dynsystem/VerificationActivity.java13
-rw-r--r--packages/SystemUI/Android.bp2
-rw-r--r--services/OWNERS5
-rw-r--r--services/core/Android.bp3
-rw-r--r--services/core/java/com/android/server/ConnectivityService.java734
-rw-r--r--services/core/java/com/android/server/DynamicSystemService.java24
-rw-r--r--services/core/java/com/android/server/StorageManagerService.java6
-rw-r--r--services/core/java/com/android/server/VcnManagementService.java61
-rw-r--r--services/core/java/com/android/server/Watchdog.java4
-rw-r--r--services/core/java/com/android/server/apphibernation/AppHibernationService.java349
-rw-r--r--services/core/java/com/android/server/apphibernation/AppHibernationShellCommand.java109
-rw-r--r--services/core/java/com/android/server/compat/CompatChange.java68
-rw-r--r--services/core/java/com/android/server/compat/CompatConfig.java112
-rw-r--r--services/core/java/com/android/server/connectivity/NetworkAgentInfo.java52
-rw-r--r--services/core/java/com/android/server/connectivity/QosCallbackAgentConnection.java192
-rw-r--r--services/core/java/com/android/server/connectivity/QosCallbackTracker.java277
-rw-r--r--services/core/java/com/android/server/connectivity/Vpn.java11
-rw-r--r--services/core/java/com/android/server/hdmi/HdmiCecLocalDeviceAudioSystem.java1
-rw-r--r--services/core/java/com/android/server/locksettings/LockSettingsStorage.java23
-rw-r--r--services/core/java/com/android/server/locksettings/RebootEscrowManager.java28
-rw-r--r--services/core/java/com/android/server/locksettings/RebootEscrowProviderServerBasedImpl.java202
-rw-r--r--services/core/java/com/android/server/locksettings/ResumeOnRebootServiceProvider.java249
-rw-r--r--services/core/java/com/android/server/net/NetworkPolicyManagerInternal.java5
-rw-r--r--services/core/java/com/android/server/net/NetworkPolicyManagerService.java35
-rw-r--r--services/core/java/com/android/server/net/NetworkStatsFactory.java2
-rw-r--r--services/core/java/com/android/server/net/NetworkStatsService.java2
-rw-r--r--services/core/java/com/android/server/os/BugreportManagerServiceImpl.java7
-rw-r--r--services/core/java/com/android/server/pm/ModuleInfoProvider.java2
-rw-r--r--services/core/java/com/android/server/security/OWNERS4
-rw-r--r--services/core/java/com/android/server/vcn/UnderlyingNetworkTracker.java6
-rw-r--r--services/core/java/com/android/server/vcn/VcnGatewayConnection.java275
-rw-r--r--services/core/xsd/Android.bp12
-rw-r--r--services/core/xsd/platform-compat/OWNERS (renamed from services/core/xsd/platform-compat-schema/OWNERS)0
-rw-r--r--services/core/xsd/platform-compat/config/platform-compat-config.xsd (renamed from services/core/xsd/platform-compat-config.xsd)0
-rw-r--r--services/core/xsd/platform-compat/config/schema/current.txt (renamed from services/core/xsd/platform-compat-schema/current.txt)0
-rw-r--r--services/core/xsd/platform-compat/config/schema/last_current.txt (renamed from services/core/xsd/platform-compat-schema/last_current.txt)0
-rw-r--r--services/core/xsd/platform-compat/config/schema/last_removed.txt (renamed from services/core/xsd/platform-compat-schema/last_removed.txt)0
-rw-r--r--services/core/xsd/platform-compat/config/schema/removed.txt (renamed from services/core/xsd/platform-compat-schema/removed.txt)0
-rw-r--r--services/core/xsd/platform-compat/overrides/platform-compat-overrides.xsd55
-rw-r--r--services/core/xsd/platform-compat/overrides/schema/current.txt51
-rw-r--r--services/core/xsd/platform-compat/overrides/schema/last_current.txt0
-rw-r--r--services/core/xsd/platform-compat/overrides/schema/last_removed.txt0
-rw-r--r--services/core/xsd/platform-compat/overrides/schema/removed.txt1
-rw-r--r--services/java/com/android/server/SystemServer.java11
-rw-r--r--services/tests/servicestests/src/com/android/server/apphibernation/AppHibernationServiceTest.java168
-rw-r--r--services/tests/servicestests/src/com/android/server/compat/CompatConfigTest.java88
-rw-r--r--services/tests/servicestests/src/com/android/server/devicepolicy/DevicePolicyManagerTest.java53
-rw-r--r--services/tests/servicestests/src/com/android/server/hdmi/HdmiCecLocalDeviceAudioSystemTest.java9
-rw-r--r--services/tests/servicestests/src/com/android/server/locksettings/LockSettingsStorageTestable.java5
-rw-r--r--services/tests/servicestests/src/com/android/server/locksettings/RebootEscrowManagerTests.java102
-rw-r--r--services/tests/servicestests/src/com/android/server/locksettings/RebootEscrowProviderServerBasedImplTests.java145
-rw-r--r--services/tests/servicestests/src/com/android/server/locksettings/ResumeOnRebootServiceProviderTests.java111
-rw-r--r--services/tests/servicestests/src/com/android/server/net/NetworkPolicyManagerServiceTest.java1
-rw-r--r--services/tests/shortcutmanagerutils/OWNERS1
-rw-r--r--telephony/java/android/telephony/CarrierConfigManager.java33
-rw-r--r--telephony/java/android/telephony/DataFailCause.java5
-rw-r--r--telephony/java/android/telephony/ImsiEncryptionInfo.java4
-rw-r--r--telephony/java/android/telephony/PreciseDisconnectCause.java2
-rw-r--r--telephony/java/android/telephony/RadioInterfaceCapabilities.java53
-rw-r--r--telephony/java/android/telephony/TelephonyManager.java34
-rw-r--r--telephony/java/android/telephony/data/DataCallResponse.java47
-rw-r--r--telephony/java/android/telephony/data/DataService.java19
-rw-r--r--telephony/java/android/telephony/data/EpsBearerQosSessionAttributes.aidl19
-rw-r--r--telephony/java/android/telephony/data/EpsBearerQosSessionAttributes.java234
-rw-r--r--telephony/java/android/telephony/data/IDataService.aidl3
-rw-r--r--telephony/java/android/telephony/data/SliceInfo.aidl20
-rw-r--r--telephony/java/android/telephony/data/SliceInfo.java342
-rw-r--r--telephony/java/android/telephony/ims/SipMessage.java18
-rw-r--r--telephony/java/com/android/internal/telephony/ITelephony.aidl13
-rw-r--r--telephony/java/com/android/internal/telephony/RILConstants.java1
-rw-r--r--test-mock/api/current.txt1
-rw-r--r--test-mock/src/android/test/mock/MockContext.java5
-rw-r--r--tests/PlatformCompatGating/src/com/android/tests/gating/PlatformCompatCommandNotInstalledTest.kt8
-rw-r--r--tests/net/integration/src/com/android/server/net/integrationtests/ConnectivityServiceIntegrationTest.kt9
-rw-r--r--tests/net/integration/util/com/android/server/NetworkAgentWrapper.java73
-rw-r--r--tests/net/java/android/net/NetworkTemplateTest.kt1
-rw-r--r--tests/net/java/android/net/QosSocketFilterTest.java75
-rw-r--r--tests/net/java/com/android/server/ConnectivityServiceTest.java174
-rw-r--r--tests/net/java/com/android/server/connectivity/LingerMonitorTest.java3
-rw-r--r--tests/net/java/com/android/server/net/NetworkStatsBaseTest.java9
-rw-r--r--tests/net/java/com/android/server/net/NetworkStatsFactoryTest.java2
-rw-r--r--tests/net/java/com/android/server/net/NetworkStatsServiceTest.java74
-rw-r--r--tests/utils/testutils/java/com/android/internal/util/test/BroadcastInterceptingContext.java6
-rw-r--r--tests/vcn/java/android/net/vcn/VcnGatewayConnectionConfigTest.java20
-rw-r--r--tests/vcn/java/com/android/server/VcnManagementServiceTest.java68
-rw-r--r--tests/vcn/java/com/android/server/vcn/VcnGatewayConnectionDisconnectedStateTest.java84
-rw-r--r--tests/vcn/java/com/android/server/vcn/VcnGatewayConnectionDisconnectingStateTest.java71
-rw-r--r--tests/vcn/java/com/android/server/vcn/VcnGatewayConnectionTestBase.java120
-rw-r--r--tests/vcn/java/com/android/server/vcn/VcnTestUtils.java44
-rw-r--r--tools/stringslint/stringslint.py12
-rwxr-xr-xtools/stringslint/stringslint_sha.sh2
190 files changed, 8053 insertions, 809 deletions
diff --git a/METADATA b/METADATA
index d97975ca3b99..95577d8df535 100644
--- a/METADATA
+++ b/METADATA
@@ -1,3 +1,4 @@
third_party {
- license_type: NOTICE
+ # would be NOTICE save for libs/usb/tests/accessorytest/f_accessory.h
+ license_type: RESTRICTED
}
diff --git a/apex/permission/framework/Android.bp b/apex/permission/framework/Android.bp
index c0560f61460f..1a2d5d5412ed 100644
--- a/apex/permission/framework/Android.bp
+++ b/apex/permission/framework/Android.bp
@@ -26,7 +26,10 @@ java_sdk_library {
defaults: ["framework-module-defaults"],
// Restrict access to implementation library.
- impl_library_visibility: ["//frameworks/base/apex/permission:__subpackages__"],
+ impl_library_visibility: [
+ "//frameworks/base/apex/permission:__subpackages__",
+ "//packages/modules/Permission:__subpackages__",
+ ],
srcs: [
":framework-permission-sources",
diff --git a/apex/permission/service/Android.bp b/apex/permission/service/Android.bp
index 6e04edfe02f1..cc6f2019a253 100644
--- a/apex/permission/service/Android.bp
+++ b/apex/permission/service/Android.bp
@@ -27,6 +27,7 @@ java_sdk_library {
"//frameworks/base/apex/permission/tests",
"//frameworks/base/services/tests/mockingservicestests",
"//frameworks/base/services/tests/servicestests",
+ "//packages/modules/Permission/tests",
],
srcs: [
":service-permission-sources",
diff --git a/cmds/sm/src/com/android/commands/sm/Sm.java b/cmds/sm/src/com/android/commands/sm/Sm.java
index 405d6f6f5f63..dc2868a59840 100644
--- a/cmds/sm/src/com/android/commands/sm/Sm.java
+++ b/cmds/sm/src/com/android/commands/sm/Sm.java
@@ -20,6 +20,7 @@ import android.os.IVoldTaskListener;
import android.os.PersistableBundle;
import android.os.RemoteException;
import android.os.ServiceManager;
+import android.os.SystemProperties;
import android.os.storage.DiskInfo;
import android.os.storage.IStorageManager;
import android.os.storage.StorageManager;
@@ -30,6 +31,8 @@ import java.util.concurrent.CompletableFuture;
public final class Sm {
private static final String TAG = "Sm";
+ private static final String ANDROID_VOLD_APP_DATA_ISOLATION_ENABLED_PROPERTY =
+ "persist.sys.vold_app_data_isolation_enabled";
IStorageManager mSm;
@@ -256,6 +259,10 @@ public final class Sm {
}
public void runDisableAppDataIsolation() throws RemoteException {
+ if (!SystemProperties.getBoolean(
+ ANDROID_VOLD_APP_DATA_ISOLATION_ENABLED_PROPERTY, false)) {
+ throw new IllegalStateException("Storage app data isolation is not enabled.");
+ }
final String pkgName = nextArg();
final int pid = Integer.parseInt(nextArg());
final int userId = Integer.parseInt(nextArg());
diff --git a/config/OWNERS b/config/OWNERS
index d59c6f2d72ba..001038d139c4 100644
--- a/config/OWNERS
+++ b/config/OWNERS
@@ -4,5 +4,11 @@ include /ZYGOTE_OWNERS
per-file hiddenapi-* = andreionea@google.com, mathewi@google.com, satayev@google.com
+# art-team@ manages the boot image profiles
+per-file boot-* = calin@google.com, mathieuc@google.com, ngeoffray@google.com
+per-file dirty-image-objects = calin@google.com, mathieuc@google.com, ngeoffray@google.com
+per-file generate-preloaded-classes.sh = calin@google.com, mathieuc@google.com, ngeoffray@google.com
+per-file preloaded-classes* = calin@google.com, mathieuc@google.com, ngeoffray@google.com
+
# Escalations:
per-file hiddenapi-* = bdc@google.com, narayan@google.com
diff --git a/core/api/current.txt b/core/api/current.txt
index 07df8b37c7a8..acd3389de620 100644
--- a/core/api/current.txt
+++ b/core/api/current.txt
@@ -10145,6 +10145,7 @@ package android.content {
method public void sendOrderedBroadcast(@NonNull android.content.Intent, @Nullable String, @Nullable String, @Nullable android.content.BroadcastReceiver, @Nullable android.os.Handler, int, @Nullable String, @Nullable android.os.Bundle);
method @RequiresPermission("android.permission.INTERACT_ACROSS_USERS") public abstract void sendOrderedBroadcastAsUser(@RequiresPermission android.content.Intent, android.os.UserHandle, @Nullable String, android.content.BroadcastReceiver, @Nullable android.os.Handler, int, @Nullable String, @Nullable android.os.Bundle);
method @Deprecated @RequiresPermission(android.Manifest.permission.BROADCAST_STICKY) public abstract void sendStickyBroadcast(@RequiresPermission android.content.Intent);
+ method @Deprecated @RequiresPermission(android.Manifest.permission.BROADCAST_STICKY) public void sendStickyBroadcast(@NonNull @RequiresPermission android.content.Intent, @Nullable android.os.Bundle);
method @Deprecated @RequiresPermission(allOf={"android.permission.INTERACT_ACROSS_USERS", android.Manifest.permission.BROADCAST_STICKY}) public abstract void sendStickyBroadcastAsUser(@RequiresPermission android.content.Intent, android.os.UserHandle);
method @Deprecated @RequiresPermission(android.Manifest.permission.BROADCAST_STICKY) public abstract void sendStickyOrderedBroadcast(@RequiresPermission android.content.Intent, android.content.BroadcastReceiver, @Nullable android.os.Handler, int, @Nullable String, @Nullable android.os.Bundle);
method @Deprecated @RequiresPermission(allOf={"android.permission.INTERACT_ACROSS_USERS", android.Manifest.permission.BROADCAST_STICKY}) public abstract void sendStickyOrderedBroadcastAsUser(@RequiresPermission android.content.Intent, android.os.UserHandle, android.content.BroadcastReceiver, @Nullable android.os.Handler, int, @Nullable String, @Nullable android.os.Bundle);
@@ -12127,6 +12128,8 @@ package android.content.pm {
field public static final String FEATURE_GAMEPAD = "android.hardware.gamepad";
field public static final String FEATURE_HIFI_SENSORS = "android.hardware.sensor.hifi_sensors";
field public static final String FEATURE_HOME_SCREEN = "android.software.home_screen";
+ field public static final String FEATURE_IDENTITY_CREDENTIAL_HARDWARE = "android.hardware.identity_credential";
+ field public static final String FEATURE_IDENTITY_CREDENTIAL_HARDWARE_DIRECT_ACCESS = "android.hardware.identity_credential_direct_access";
field public static final String FEATURE_INPUT_METHODS = "android.software.input_methods";
field public static final String FEATURE_IPSEC_TUNNELS = "android.software.ipsec_tunnels";
field public static final String FEATURE_IRIS = "android.hardware.biometrics.iris";
@@ -12213,7 +12216,7 @@ package android.content.pm {
field @Deprecated public static final int GET_DISABLED_UNTIL_USED_COMPONENTS = 32768; // 0x8000
field public static final int GET_GIDS = 256; // 0x100
field public static final int GET_INSTRUMENTATION = 16; // 0x10
- field public static final int GET_INTENT_FILTERS = 32; // 0x20
+ field @Deprecated public static final int GET_INTENT_FILTERS = 32; // 0x20
field public static final int GET_META_DATA = 128; // 0x80
field public static final int GET_PERMISSIONS = 4096; // 0x1000
field public static final int GET_PROVIDERS = 8; // 0x8
@@ -25083,6 +25086,8 @@ package android.net {
method public void applyTransportModeTransform(@NonNull java.net.Socket, int, @NonNull android.net.IpSecTransform) throws java.io.IOException;
method public void applyTransportModeTransform(@NonNull java.net.DatagramSocket, int, @NonNull android.net.IpSecTransform) throws java.io.IOException;
method public void applyTransportModeTransform(@NonNull java.io.FileDescriptor, int, @NonNull android.net.IpSecTransform) throws java.io.IOException;
+ method @RequiresPermission("android.permission.MANAGE_IPSEC_TUNNELS") public void applyTunnelModeTransform(@NonNull android.net.IpSecManager.IpSecTunnelInterface, int, @NonNull android.net.IpSecTransform) throws java.io.IOException;
+ method @NonNull @RequiresPermission("android.permission.MANAGE_IPSEC_TUNNELS") public android.net.IpSecManager.IpSecTunnelInterface createIpSecTunnelInterface(@NonNull android.net.Network) throws java.io.IOException, android.net.IpSecManager.ResourceUnavailableException;
method @NonNull public android.net.IpSecManager.UdpEncapsulationSocket openUdpEncapsulationSocket(int) throws java.io.IOException, android.net.IpSecManager.ResourceUnavailableException;
method @NonNull public android.net.IpSecManager.UdpEncapsulationSocket openUdpEncapsulationSocket() throws java.io.IOException, android.net.IpSecManager.ResourceUnavailableException;
method public void removeTransportModeTransforms(@NonNull java.net.Socket) throws java.io.IOException;
@@ -25092,6 +25097,12 @@ package android.net {
field public static final int DIRECTION_OUT = 1; // 0x1
}
+ public static final class IpSecManager.IpSecTunnelInterface implements java.lang.AutoCloseable {
+ method @RequiresPermission("android.permission.MANAGE_IPSEC_TUNNELS") public void addAddress(@NonNull java.net.InetAddress, int) throws java.io.IOException;
+ method public void close();
+ method @RequiresPermission("android.permission.MANAGE_IPSEC_TUNNELS") public void removeAddress(@NonNull java.net.InetAddress, int) throws java.io.IOException;
+ }
+
public static final class IpSecManager.ResourceUnavailableException extends android.util.AndroidException {
}
@@ -35888,6 +35899,9 @@ package android.se.omapi {
method @NonNull public String getVersion();
method public boolean isConnected();
method public void shutdown();
+ field public static final String ACTION_SECURE_ELEMENT_STATE_CHANGED = "android.se.omapi.action.SECURE_ELEMENT_STATE_CHANGED";
+ field public static final String EXTRA_READER_NAME = "android.se.omapi.extra.READER_NAME";
+ field public static final String EXTRA_READER_STATE = "android.se.omapi.extra.READER_STATE";
}
public static interface SEService.OnConnectedListener {
@@ -36070,15 +36084,20 @@ package android.security.identity {
public abstract class IdentityCredential {
method @NonNull public abstract java.security.KeyPair createEphemeralKeyPair();
method @NonNull public abstract byte[] decryptMessageFromReader(@NonNull byte[]) throws android.security.identity.MessageDecryptionException;
+ method @NonNull public byte[] delete(@NonNull byte[]);
method @NonNull public abstract byte[] encryptMessageToReader(@NonNull byte[]);
method @NonNull public abstract java.util.Collection<java.security.cert.X509Certificate> getAuthKeysNeedingCertification();
method @NonNull public abstract int[] getAuthenticationDataUsageCount();
method @NonNull public abstract java.util.Collection<java.security.cert.X509Certificate> getCredentialKeyCertificateChain();
method @NonNull public abstract android.security.identity.ResultData getEntries(@Nullable byte[], @NonNull java.util.Map<java.lang.String,java.util.Collection<java.lang.String>>, @Nullable byte[], @Nullable byte[]) throws android.security.identity.EphemeralPublicKeyNotFoundException, android.security.identity.InvalidReaderSignatureException, android.security.identity.InvalidRequestMessageException, android.security.identity.NoAuthenticationKeyAvailableException, android.security.identity.SessionTranscriptMismatchException;
+ method @NonNull public byte[] proveOwnership(@NonNull byte[]);
method public abstract void setAllowUsingExhaustedKeys(boolean);
+ method public void setAllowUsingExpiredKeys(boolean);
method public abstract void setAvailableAuthenticationKeys(int, int);
method public abstract void setReaderEphemeralPublicKey(@NonNull java.security.PublicKey) throws java.security.InvalidKeyException;
- method public abstract void storeStaticAuthenticationData(@NonNull java.security.cert.X509Certificate, @NonNull byte[]) throws android.security.identity.UnknownAuthenticationKeyException;
+ method @Deprecated public abstract void storeStaticAuthenticationData(@NonNull java.security.cert.X509Certificate, @NonNull byte[]) throws android.security.identity.UnknownAuthenticationKeyException;
+ method public void storeStaticAuthenticationData(@NonNull java.security.cert.X509Certificate, @NonNull java.time.Instant, @NonNull byte[]) throws android.security.identity.UnknownAuthenticationKeyException;
+ method @NonNull public byte[] update(@NonNull android.security.identity.PersonalizationData);
}
public class IdentityCredentialException extends java.lang.Exception {
@@ -36088,7 +36107,7 @@ package android.security.identity {
public abstract class IdentityCredentialStore {
method @NonNull public abstract android.security.identity.WritableIdentityCredential createCredential(@NonNull String, @NonNull String) throws android.security.identity.AlreadyPersonalizedException, android.security.identity.DocTypeNotSupportedException;
- method @Nullable public abstract byte[] deleteCredentialByName(@NonNull String);
+ method @Deprecated @Nullable public abstract byte[] deleteCredentialByName(@NonNull String);
method @Nullable public abstract android.security.identity.IdentityCredential getCredentialByName(@NonNull String, int) throws android.security.identity.CipherSuiteNotSupportedException;
method @Nullable public static android.security.identity.IdentityCredentialStore getDirectAccessInstance(@NonNull android.content.Context);
method @Nullable public static android.security.identity.IdentityCredentialStore getInstance(@NonNull android.content.Context);
@@ -39577,6 +39596,7 @@ package android.telephony {
field public static final String KEY_RTT_DOWNGRADE_SUPPORTED_BOOL = "rtt_downgrade_supported_bool";
field public static final String KEY_RTT_SUPPORTED_BOOL = "rtt_supported_bool";
field public static final String KEY_RTT_SUPPORTED_FOR_VT_BOOL = "rtt_supported_for_vt_bool";
+ field public static final String KEY_RTT_SUPPORTED_WHILE_ROAMING_BOOL = "rtt_supported_while_roaming_bool";
field public static final String KEY_RTT_UPGRADE_SUPPORTED_BOOL = "rtt_upgrade_supported_bool";
field public static final String KEY_SHOW_4G_FOR_3G_DATA_ICON_BOOL = "show_4g_for_3g_data_icon_bool";
field public static final String KEY_SHOW_4G_FOR_LTE_DATA_ICON_BOOL = "show_4g_for_lte_data_icon_bool";
@@ -40252,6 +40272,7 @@ package android.telephony {
field public static final int SERVICE_OPTION_OUT_OF_ORDER = 34; // 0x22
field public static final int SIGNAL_LOST = -3; // 0xfffffffd
field public static final int SIM_CARD_CHANGED = 2043; // 0x7fb
+ field public static final int SLICE_REJECTED = 2252; // 0x8cc
field public static final int SYNCHRONIZATION_FAILURE = 2184; // 0x888
field public static final int TEST_LOOPBACK_REGULAR_DEACTIVATION = 2196; // 0x894
field public static final int TETHERED_CALL_ACTIVE = -6; // 0xfffffffa
diff --git a/core/api/module-lib-current.txt b/core/api/module-lib-current.txt
index c19dd4ca4a8e..061d4ccbc473 100644
--- a/core/api/module-lib-current.txt
+++ b/core/api/module-lib-current.txt
@@ -10,6 +10,18 @@ package android.app {
package android.net {
+ public class ConnectivityManager {
+ method @RequiresPermission(anyOf={android.Manifest.permission.MANAGE_TEST_NETWORKS, android.Manifest.permission.NETWORK_STACK}) public void simulateDataStall(int, long, @NonNull android.net.Network, @NonNull android.os.PersistableBundle);
+ }
+
+ public static final class IpSecManager.UdpEncapsulationSocket implements java.lang.AutoCloseable {
+ method public int getResourceId();
+ }
+
+ public final class NetworkCapabilities implements android.os.Parcelable {
+ field public static final int TRANSPORT_TEST = 7; // 0x7
+ }
+
public final class TcpRepairWindow {
ctor public TcpRepairWindow(int, int, int, int, int, int);
field public final int maxWindow;
@@ -44,6 +56,10 @@ package android.os {
method public final void markVintfStability();
}
+ public static class Build.VERSION {
+ field public static final int FIRST_SDK_INT;
+ }
+
public interface Parcelable {
method public default int getStability();
}
diff --git a/core/api/system-current.txt b/core/api/system-current.txt
index 34e950defb6a..b4d60168ba91 100644
--- a/core/api/system-current.txt
+++ b/core/api/system-current.txt
@@ -44,6 +44,7 @@ package android {
field public static final String BIND_PHONE_ACCOUNT_SUGGESTION_SERVICE = "android.permission.BIND_PHONE_ACCOUNT_SUGGESTION_SERVICE";
field public static final String BIND_PRINT_RECOMMENDATION_SERVICE = "android.permission.BIND_PRINT_RECOMMENDATION_SERVICE";
field public static final String BIND_RESOLVER_RANKER_SERVICE = "android.permission.BIND_RESOLVER_RANKER_SERVICE";
+ field public static final String BIND_RESUME_ON_REBOOT_SERVICE = "android.permission.BIND_RESUME_ON_REBOOT_SERVICE";
field public static final String BIND_RUNTIME_PERMISSION_PRESENTER_SERVICE = "android.permission.BIND_RUNTIME_PERMISSION_PRESENTER_SERVICE";
field public static final String BIND_SETTINGS_SUGGESTIONS_SERVICE = "android.permission.BIND_SETTINGS_SUGGESTIONS_SERVICE";
field public static final String BIND_SOUND_TRIGGER_DETECTION_SERVICE = "android.permission.BIND_SOUND_TRIGGER_DETECTION_SERVICE";
@@ -1411,6 +1412,15 @@ package android.app.usage {
}
+package android.apphibernation {
+
+ public final class AppHibernationManager {
+ method public boolean isHibernating(@NonNull String);
+ method public void setHibernating(@NonNull String, boolean);
+ }
+
+}
+
package android.bluetooth {
public final class BluetoothA2dp implements android.bluetooth.BluetoothProfile {
@@ -1707,6 +1717,7 @@ package android.content {
method @RequiresPermission(android.Manifest.permission.INTERACT_ACROSS_USERS) public abstract void sendBroadcastAsUser(@RequiresPermission android.content.Intent, android.os.UserHandle, @Nullable String, @Nullable android.os.Bundle);
method public abstract void sendOrderedBroadcast(@NonNull android.content.Intent, @Nullable String, @Nullable android.os.Bundle, @Nullable android.content.BroadcastReceiver, @Nullable android.os.Handler, int, @Nullable String, @Nullable android.os.Bundle);
method @RequiresPermission(android.Manifest.permission.INTERACT_ACROSS_USERS) public void startActivityAsUser(@NonNull @RequiresPermission android.content.Intent, @NonNull android.os.UserHandle);
+ field public static final String APP_HIBERNATION_SERVICE = "app_hibernation";
field public static final String APP_INTEGRITY_SERVICE = "app_integrity";
field public static final String APP_PREDICTION_SERVICE = "app_prediction";
field public static final String BACKUP_SERVICE = "backup";
@@ -6020,6 +6031,7 @@ package android.net {
method @Deprecated @RequiresPermission(android.Manifest.permission.TETHER_PRIVILEGED) public void getLatestTetheringEntitlementResult(int, boolean, @NonNull java.util.concurrent.Executor, @NonNull android.net.ConnectivityManager.OnTetheringEntitlementResultListener);
method @Deprecated @RequiresPermission(anyOf={android.Manifest.permission.TETHER_PRIVILEGED, android.Manifest.permission.WRITE_SETTINGS}) public boolean isTetheringSupported();
method @RequiresPermission(anyOf={android.net.NetworkStack.PERMISSION_MAINLINE_NETWORK_STACK, android.Manifest.permission.NETWORK_FACTORY}) public int registerNetworkProvider(@NonNull android.net.NetworkProvider);
+ method public void registerQosCallback(@NonNull android.net.QosSocketInfo, @NonNull android.net.QosCallback, @NonNull java.util.concurrent.Executor);
method @Deprecated @RequiresPermission(android.Manifest.permission.TETHER_PRIVILEGED) public void registerTetheringEventCallback(@NonNull java.util.concurrent.Executor, @NonNull android.net.ConnectivityManager.OnTetheringEventCallback);
method @RequiresPermission(android.net.NetworkStack.PERMISSION_MAINLINE_NETWORK_STACK) public void requestNetwork(@NonNull android.net.NetworkRequest, int, int, @NonNull android.os.Handler, @NonNull android.net.ConnectivityManager.NetworkCallback);
method @RequiresPermission(anyOf={android.Manifest.permission.NETWORK_AIRPLANE_MODE, android.Manifest.permission.NETWORK_SETTINGS, android.Manifest.permission.NETWORK_SETUP_WIZARD, android.Manifest.permission.NETWORK_STACK}) public void setAirplaneMode(boolean);
@@ -6029,6 +6041,7 @@ package android.net {
method @Deprecated @RequiresPermission(android.Manifest.permission.TETHER_PRIVILEGED) public void startTethering(int, boolean, android.net.ConnectivityManager.OnStartTetheringCallback, android.os.Handler);
method @Deprecated @RequiresPermission(android.Manifest.permission.TETHER_PRIVILEGED) public void stopTethering(int);
method @RequiresPermission(anyOf={android.net.NetworkStack.PERMISSION_MAINLINE_NETWORK_STACK, android.Manifest.permission.NETWORK_FACTORY}) public void unregisterNetworkProvider(@NonNull android.net.NetworkProvider);
+ method public void unregisterQosCallback(@NonNull android.net.QosCallback);
method @Deprecated @RequiresPermission(android.Manifest.permission.TETHER_PRIVILEGED) public void unregisterTetheringEventCallback(@NonNull android.net.ConnectivityManager.OnTetheringEventCallback);
field public static final String EXTRA_CAPTIVE_PORTAL_PROBE_SPEC = "android.net.extra.CAPTIVE_PORTAL_PROBE_SPEC";
field public static final String EXTRA_CAPTIVE_PORTAL_USER_AGENT = "android.net.extra.CAPTIVE_PORTAL_USER_AGENT";
@@ -6118,15 +6131,11 @@ package android.net {
}
public final class IpSecManager {
- method @RequiresPermission(android.Manifest.permission.MANAGE_IPSEC_TUNNELS) public void applyTunnelModeTransform(@NonNull android.net.IpSecManager.IpSecTunnelInterface, int, @NonNull android.net.IpSecTransform) throws java.io.IOException;
- method @NonNull @RequiresPermission(android.Manifest.permission.MANAGE_IPSEC_TUNNELS) public android.net.IpSecManager.IpSecTunnelInterface createIpSecTunnelInterface(@NonNull java.net.InetAddress, @NonNull java.net.InetAddress, @NonNull android.net.Network) throws java.io.IOException, android.net.IpSecManager.ResourceUnavailableException;
+ method @Deprecated @NonNull @RequiresPermission(android.Manifest.permission.MANAGE_IPSEC_TUNNELS) public android.net.IpSecManager.IpSecTunnelInterface createIpSecTunnelInterface(@NonNull java.net.InetAddress, @NonNull java.net.InetAddress, @NonNull android.net.Network) throws java.io.IOException, android.net.IpSecManager.ResourceUnavailableException;
}
public static final class IpSecManager.IpSecTunnelInterface implements java.lang.AutoCloseable {
- method @RequiresPermission(android.Manifest.permission.MANAGE_IPSEC_TUNNELS) public void addAddress(@NonNull java.net.InetAddress, int) throws java.io.IOException;
- method public void close();
method @NonNull public String getInterfaceName();
- method @RequiresPermission(android.Manifest.permission.MANAGE_IPSEC_TUNNELS) public void removeAddress(@NonNull java.net.InetAddress, int) throws java.io.IOException;
}
public static class IpSecTransform.Builder {
@@ -6222,6 +6231,8 @@ package android.net {
method public void onAddKeepalivePacketFilter(int, @NonNull android.net.KeepalivePacketData);
method public void onAutomaticReconnectDisabled();
method public void onNetworkUnwanted();
+ method public void onQosCallbackRegistered(int, @NonNull android.net.QosFilter);
+ method public void onQosCallbackUnregistered(int);
method public void onRemoveKeepalivePacketFilter(int);
method public void onSaveAcceptUnvalidated(boolean);
method public void onSignalStrengthThresholdsUpdated(@NonNull int[]);
@@ -6232,6 +6243,9 @@ package android.net {
method public final void sendLinkProperties(@NonNull android.net.LinkProperties);
method public final void sendNetworkCapabilities(@NonNull android.net.NetworkCapabilities);
method public final void sendNetworkScore(@IntRange(from=0, to=99) int);
+ method public final void sendQosCallbackError(int, int);
+ method public final void sendQosSessionAvailable(int, int, @NonNull android.telephony.data.EpsBearerQosSessionAttributes);
+ method public final void sendQosSessionLost(int, int);
method public final void sendSocketKeepaliveEvent(int, int);
method public final void setUnderlyingNetworks(@Nullable java.util.List<android.net.Network>);
method public void unregister();
@@ -6318,6 +6332,9 @@ package android.net {
method public abstract void onRequestScores(android.net.NetworkKey[]);
}
+ public class NetworkReleasedException extends java.lang.Exception {
+ }
+
public class NetworkRequest implements android.os.Parcelable {
method @Nullable public String getRequestorPackageName();
method public int getRequestorUid();
@@ -6390,6 +6407,47 @@ package android.net {
ctor public NetworkStats.Entry(@Nullable String, int, int, int, int, int, int, long, long, long, long, long);
}
+ public abstract class QosCallback {
+ ctor public QosCallback();
+ method public void onError(@NonNull android.net.QosCallbackException);
+ method public void onQosSessionAvailable(@NonNull android.net.QosSession, @NonNull android.net.QosSessionAttributes);
+ method public void onQosSessionLost(@NonNull android.net.QosSession);
+ }
+
+ public static class QosCallback.QosCallbackRegistrationException extends java.lang.RuntimeException {
+ }
+
+ public final class QosCallbackException extends java.lang.Exception {
+ }
+
+ public abstract class QosFilter {
+ method @NonNull public abstract android.net.Network getNetwork();
+ method public abstract boolean matchesLocalAddress(@NonNull java.net.InetAddress, int, int);
+ }
+
+ public final class QosSession implements android.os.Parcelable {
+ ctor public QosSession(int, int);
+ method public int describeContents();
+ method public int getSessionId();
+ method public int getSessionType();
+ method public long getUniqueId();
+ method public void writeToParcel(@NonNull android.os.Parcel, int);
+ field @NonNull public static final android.os.Parcelable.Creator<android.net.QosSession> CREATOR;
+ field public static final int TYPE_EPS_BEARER = 1; // 0x1
+ }
+
+ public interface QosSessionAttributes {
+ }
+
+ public final class QosSocketInfo implements android.os.Parcelable {
+ ctor public QosSocketInfo(@NonNull android.net.Network, @NonNull java.net.Socket) throws java.io.IOException;
+ method public int describeContents();
+ method @NonNull public java.net.InetSocketAddress getLocalSocketAddress();
+ method @NonNull public android.net.Network getNetwork();
+ method public void writeToParcel(@NonNull android.os.Parcel, int);
+ field @NonNull public static final android.os.Parcelable.Creator<android.net.QosSocketInfo> CREATOR;
+ }
+
public final class RouteInfo implements android.os.Parcelable {
ctor public RouteInfo(@Nullable android.net.IpPrefix, @Nullable java.net.InetAddress, @Nullable String, int);
ctor public RouteInfo(@Nullable android.net.IpPrefix, @Nullable java.net.InetAddress, @Nullable String, int, int);
@@ -6435,6 +6493,12 @@ package android.net {
field public static final int SUCCESS = 0; // 0x0
}
+ public class SocketLocalAddressChangedException extends java.lang.Exception {
+ }
+
+ public class SocketNotBoundException extends java.lang.Exception {
+ }
+
public final class StaticIpConfiguration implements android.os.Parcelable {
ctor public StaticIpConfiguration();
ctor public StaticIpConfiguration(@Nullable android.net.StaticIpConfiguration);
@@ -9007,6 +9071,18 @@ package android.service.resolver {
}
+package android.service.resumeonreboot {
+
+ public abstract class ResumeOnRebootService extends android.app.Service {
+ ctor public ResumeOnRebootService();
+ method @Nullable public android.os.IBinder onBind(@Nullable android.content.Intent);
+ method @NonNull public abstract byte[] onUnwrap(@NonNull byte[]) throws java.io.IOException;
+ method @NonNull public abstract byte[] onWrap(@NonNull byte[], long) throws java.io.IOException;
+ field public static final String SERVICE_INTERFACE = "android.service.resumeonreboot.ResumeOnRebootService";
+ }
+
+}
+
package android.service.settings.suggestions {
public final class Suggestion implements android.os.Parcelable {
@@ -10638,6 +10714,7 @@ package android.telephony.data {
method public int getPduSessionId();
method public int getProtocolType();
method public long getRetryDurationMillis();
+ method @Nullable public android.telephony.data.SliceInfo getSliceInfo();
method @Deprecated public int getSuggestedRetryTime();
method public void writeToParcel(android.os.Parcel, int);
field @NonNull public static final android.os.Parcelable.Creator<android.telephony.data.DataCallResponse> CREATOR;
@@ -10672,6 +10749,7 @@ package android.telephony.data {
method @NonNull public android.telephony.data.DataCallResponse.Builder setPduSessionId(int);
method @NonNull public android.telephony.data.DataCallResponse.Builder setProtocolType(int);
method @NonNull public android.telephony.data.DataCallResponse.Builder setRetryDurationMillis(long);
+ method @NonNull public android.telephony.data.DataCallResponse.Builder setSliceInfo(@Nullable android.telephony.data.SliceInfo);
method @Deprecated @NonNull public android.telephony.data.DataCallResponse.Builder setSuggestedRetryTime(int);
}
@@ -10744,7 +10822,7 @@ package android.telephony.data {
method public void setDataProfile(@NonNull java.util.List<android.telephony.data.DataProfile>, boolean, @NonNull android.telephony.data.DataServiceCallback);
method public void setInitialAttachApn(@NonNull android.telephony.data.DataProfile, boolean, @NonNull android.telephony.data.DataServiceCallback);
method public void setupDataCall(int, @NonNull android.telephony.data.DataProfile, boolean, boolean, int, @Nullable android.net.LinkProperties, @NonNull android.telephony.data.DataServiceCallback);
- method public void setupDataCall(int, @NonNull android.telephony.data.DataProfile, boolean, boolean, int, @Nullable android.net.LinkProperties, @IntRange(from=0, to=15) int, @NonNull android.telephony.data.DataServiceCallback);
+ method public void setupDataCall(int, @NonNull android.telephony.data.DataProfile, boolean, boolean, int, @Nullable android.net.LinkProperties, @IntRange(from=0, to=15) int, @Nullable android.telephony.data.SliceInfo, @NonNull android.telephony.data.DataServiceCallback);
method public void startHandover(int, @NonNull android.telephony.data.DataServiceCallback);
}
@@ -10765,6 +10843,19 @@ package android.telephony.data {
field public static final int RESULT_SUCCESS = 0; // 0x0
}
+ public final class EpsBearerQosSessionAttributes implements android.os.Parcelable android.net.QosSessionAttributes {
+ method @NonNull public static android.telephony.data.EpsBearerQosSessionAttributes create(@NonNull android.os.Parcel);
+ method public int describeContents();
+ method public long getGuaranteedDownlinkBitRate();
+ method public long getGuaranteedUplinkBitRate();
+ method public long getMaxDownlinkBitRate();
+ method public long getMaxUplinkBitRate();
+ method public int getQci();
+ method @NonNull public java.util.List<java.net.InetSocketAddress> getRemoteAddresses();
+ method public void writeToParcel(@NonNull android.os.Parcel, int);
+ field @NonNull public static final android.os.Parcelable.Creator<android.telephony.data.EpsBearerQosSessionAttributes> CREATOR;
+ }
+
public abstract class QualifiedNetworksService extends android.app.Service {
ctor public QualifiedNetworksService();
method @NonNull public abstract android.telephony.data.QualifiedNetworksService.NetworkAvailabilityProvider onCreateNetworkAvailabilityProvider(int);
@@ -10779,6 +10870,32 @@ package android.telephony.data {
method public final void updateQualifiedNetworkTypes(int, @NonNull java.util.List<java.lang.Integer>);
}
+ public final class SliceInfo implements android.os.Parcelable {
+ method public int describeContents();
+ method @IntRange(from=android.telephony.data.SliceInfo.MIN_SLICE_DIFFERENTIATOR, to=android.telephony.data.SliceInfo.MAX_SLICE_DIFFERENTIATOR) public int getMappedHplmnSliceDifferentiator();
+ method public int getMappedHplmnSliceServiceType();
+ method @IntRange(from=android.telephony.data.SliceInfo.MIN_SLICE_DIFFERENTIATOR, to=android.telephony.data.SliceInfo.MAX_SLICE_DIFFERENTIATOR) public int getSliceDifferentiator();
+ method public int getSliceServiceType();
+ method public void writeToParcel(@NonNull android.os.Parcel, int);
+ field @NonNull public static final android.os.Parcelable.Creator<android.telephony.data.SliceInfo> CREATOR;
+ field public static final int MAX_SLICE_DIFFERENTIATOR = 16777214; // 0xfffffe
+ field public static final int MIN_SLICE_DIFFERENTIATOR = -1; // 0xffffffff
+ field public static final int SLICE_DIFFERENTIATOR_NO_SLICE = -1; // 0xffffffff
+ field public static final int SLICE_SERVICE_TYPE_EMBB = 1; // 0x1
+ field public static final int SLICE_SERVICE_TYPE_MIOT = 3; // 0x3
+ field public static final int SLICE_SERVICE_TYPE_NONE = 0; // 0x0
+ field public static final int SLICE_SERVICE_TYPE_URLLC = 2; // 0x2
+ }
+
+ public static final class SliceInfo.Builder {
+ ctor public SliceInfo.Builder();
+ method @NonNull public android.telephony.data.SliceInfo build();
+ method @NonNull public android.telephony.data.SliceInfo.Builder setMappedHplmnSliceDifferentiator(@IntRange(from=android.telephony.data.SliceInfo.MIN_SLICE_DIFFERENTIATOR, to=android.telephony.data.SliceInfo.MAX_SLICE_DIFFERENTIATOR) int);
+ method @NonNull public android.telephony.data.SliceInfo.Builder setMappedHplmnSliceServiceType(int);
+ method @NonNull public android.telephony.data.SliceInfo.Builder setSliceDifferentiator(@IntRange(from=android.telephony.data.SliceInfo.MIN_SLICE_DIFFERENTIATOR, to=android.telephony.data.SliceInfo.MAX_SLICE_DIFFERENTIATOR) int);
+ method @NonNull public android.telephony.data.SliceInfo.Builder setSliceServiceType(int);
+ }
+
}
package android.telephony.euicc {
@@ -11811,6 +11928,7 @@ package android.telephony.ims {
ctor public SipMessage(@NonNull String, @NonNull String, @NonNull byte[]);
method public int describeContents();
method @NonNull public byte[] getContent();
+ method @NonNull public byte[] getEncodedMessage();
method @NonNull public String getHeaderSection();
method @NonNull public String getStartLine();
method public void writeToParcel(@NonNull android.os.Parcel, int);
@@ -12248,6 +12366,164 @@ package android.util {
}
+package android.uwb {
+
+ public final class AngleMeasurement implements android.os.Parcelable {
+ method public int describeContents();
+ method @FloatRange(from=0.0, to=1.0) public double getConfidenceLevel();
+ method @FloatRange(from=0.0, to=3.141592653589793) public double getErrorRadians();
+ method @FloatRange(from=-3.141592653589793, to=3.141592653589793) public double getRadians();
+ method public void writeToParcel(@NonNull android.os.Parcel, int);
+ field @NonNull public static final android.os.Parcelable.Creator<android.uwb.AngleMeasurement> CREATOR;
+ }
+
+ public static final class AngleMeasurement.Builder {
+ ctor public AngleMeasurement.Builder();
+ method @NonNull public android.uwb.AngleMeasurement build();
+ method @NonNull public android.uwb.AngleMeasurement.Builder setConfidenceLevel(double);
+ method @NonNull public android.uwb.AngleMeasurement.Builder setErrorRadians(double);
+ method @NonNull public android.uwb.AngleMeasurement.Builder setRadians(double);
+ }
+
+ public final class AngleOfArrivalMeasurement implements android.os.Parcelable {
+ method public int describeContents();
+ method @Nullable public android.uwb.AngleMeasurement getAltitude();
+ method @NonNull public android.uwb.AngleMeasurement getAzimuth();
+ method public void writeToParcel(@NonNull android.os.Parcel, int);
+ field @NonNull public static final android.os.Parcelable.Creator<android.uwb.AngleOfArrivalMeasurement> CREATOR;
+ }
+
+ public static final class AngleOfArrivalMeasurement.Builder {
+ ctor public AngleOfArrivalMeasurement.Builder();
+ method @NonNull public android.uwb.AngleOfArrivalMeasurement build();
+ method @NonNull public android.uwb.AngleOfArrivalMeasurement.Builder setAltitude(@NonNull android.uwb.AngleMeasurement);
+ method @NonNull public android.uwb.AngleOfArrivalMeasurement.Builder setAzimuth(@NonNull android.uwb.AngleMeasurement);
+ }
+
+ public final class DistanceMeasurement implements android.os.Parcelable {
+ method public int describeContents();
+ method @FloatRange(from=0.0, to=1.0) public double getConfidenceLevel();
+ method public double getErrorMeters();
+ method public double getMeters();
+ method public void writeToParcel(@NonNull android.os.Parcel, int);
+ field @NonNull public static final android.os.Parcelable.Creator<android.uwb.DistanceMeasurement> CREATOR;
+ }
+
+ public static final class DistanceMeasurement.Builder {
+ ctor public DistanceMeasurement.Builder();
+ method @NonNull public android.uwb.DistanceMeasurement build();
+ method @NonNull public android.uwb.DistanceMeasurement.Builder setConfidenceLevel(double);
+ method @NonNull public android.uwb.DistanceMeasurement.Builder setErrorMeters(double);
+ method @NonNull public android.uwb.DistanceMeasurement.Builder setMeters(double);
+ }
+
+ public final class RangingMeasurement implements android.os.Parcelable {
+ method public int describeContents();
+ method @Nullable public android.uwb.AngleOfArrivalMeasurement getAngleOfArrivalMeasurement();
+ method @Nullable public android.uwb.DistanceMeasurement getDistanceMeasurement();
+ method public long getElapsedRealtimeNanos();
+ method @NonNull public android.uwb.UwbAddress getRemoteDeviceAddress();
+ method public int getStatus();
+ method public void writeToParcel(@NonNull android.os.Parcel, int);
+ field @NonNull public static final android.os.Parcelable.Creator<android.uwb.RangingMeasurement> CREATOR;
+ field public static final int RANGING_STATUS_FAILURE_OUT_OF_RANGE = 1; // 0x1
+ field public static final int RANGING_STATUS_FAILURE_UNKNOWN_ERROR = -1; // 0xffffffff
+ field public static final int RANGING_STATUS_SUCCESS = 0; // 0x0
+ }
+
+ public static final class RangingMeasurement.Builder {
+ ctor public RangingMeasurement.Builder();
+ method @NonNull public android.uwb.RangingMeasurement build();
+ method @NonNull public android.uwb.RangingMeasurement.Builder setAngleOfArrivalMeasurement(@NonNull android.uwb.AngleOfArrivalMeasurement);
+ method @NonNull public android.uwb.RangingMeasurement.Builder setDistanceMeasurement(@NonNull android.uwb.DistanceMeasurement);
+ method @NonNull public android.uwb.RangingMeasurement.Builder setElapsedRealtimeNanos(long);
+ method @NonNull public android.uwb.RangingMeasurement.Builder setRemoteDeviceAddress(@NonNull android.uwb.UwbAddress);
+ method @NonNull public android.uwb.RangingMeasurement.Builder setStatus(int);
+ }
+
+ public final class RangingReport implements android.os.Parcelable {
+ method public int describeContents();
+ method @NonNull public java.util.List<android.uwb.RangingMeasurement> getMeasurements();
+ method public void writeToParcel(@NonNull android.os.Parcel, int);
+ field @NonNull public static final android.os.Parcelable.Creator<android.uwb.RangingReport> CREATOR;
+ }
+
+ public static final class RangingReport.Builder {
+ ctor public RangingReport.Builder();
+ method @NonNull public android.uwb.RangingReport.Builder addMeasurement(@NonNull android.uwb.RangingMeasurement);
+ method @NonNull public android.uwb.RangingReport.Builder addMeasurements(@NonNull java.util.List<android.uwb.RangingMeasurement>);
+ method @NonNull public android.uwb.RangingReport build();
+ }
+
+ public final class RangingSession implements java.lang.AutoCloseable {
+ method public void close();
+ method public void reconfigure(@NonNull android.os.PersistableBundle);
+ method public void start(@NonNull android.os.PersistableBundle);
+ method public void stop();
+ }
+
+ public static interface RangingSession.Callback {
+ method public void onClosed(int, @NonNull android.os.PersistableBundle);
+ method public void onOpenFailed(int, @NonNull android.os.PersistableBundle);
+ method public void onOpened(@NonNull android.uwb.RangingSession);
+ method public void onReconfigureFailed(int, @NonNull android.os.PersistableBundle);
+ method public void onReconfigured(@NonNull android.os.PersistableBundle);
+ method public void onReportReceived(@NonNull android.uwb.RangingReport);
+ method public void onStartFailed(int, @NonNull android.os.PersistableBundle);
+ method public void onStarted(@NonNull android.os.PersistableBundle);
+ method public void onStopFailed(int, @NonNull android.os.PersistableBundle);
+ method public void onStopped();
+ field public static final int REASON_BAD_PARAMETERS = 3; // 0x3
+ field public static final int REASON_GENERIC_ERROR = 4; // 0x4
+ field public static final int REASON_LOCAL_REQUEST = 1; // 0x1
+ field public static final int REASON_MAX_SESSIONS_REACHED = 5; // 0x5
+ field public static final int REASON_PROTOCOL_SPECIFIC_ERROR = 7; // 0x7
+ field public static final int REASON_REMOTE_REQUEST = 2; // 0x2
+ field public static final int REASON_SYSTEM_POLICY = 6; // 0x6
+ field public static final int REASON_UNKNOWN = 0; // 0x0
+ }
+
+ public final class UwbAddress implements android.os.Parcelable {
+ method public int describeContents();
+ method @NonNull public static android.uwb.UwbAddress fromBytes(@NonNull byte[]);
+ method public int size();
+ method @NonNull public byte[] toBytes();
+ method public void writeToParcel(@NonNull android.os.Parcel, int);
+ field @NonNull public static final android.os.Parcelable.Creator<android.uwb.UwbAddress> CREATOR;
+ field public static final int EXTENDED_ADDRESS_BYTE_LENGTH = 8; // 0x8
+ field public static final int SHORT_ADDRESS_BYTE_LENGTH = 2; // 0x2
+ }
+
+ public final class UwbManager {
+ method public long elapsedRealtimeResolutionNanos();
+ method public int getAngleOfArrivalSupport();
+ method public int getMaxRemoteDevicesPerInitiatorSession();
+ method public int getMaxRemoteDevicesPerResponderSession();
+ method public int getMaxSimultaneousSessions();
+ method @NonNull public android.os.PersistableBundle getSpecificationInfo();
+ method @NonNull public java.util.List<java.lang.Integer> getSupportedChannelNumbers();
+ method @NonNull public java.util.Set<java.lang.Integer> getSupportedPreambleCodeIndices();
+ method public boolean isRangingSupported();
+ method @NonNull public AutoCloseable openRangingSession(@NonNull android.os.PersistableBundle, @NonNull java.util.concurrent.Executor, @NonNull android.uwb.RangingSession.Callback);
+ method public void registerAdapterStateCallback(@NonNull java.util.concurrent.Executor, @NonNull android.uwb.UwbManager.AdapterStateCallback);
+ method public void unregisterAdapterStateCallback(@NonNull android.uwb.UwbManager.AdapterStateCallback);
+ field public static final int ANGLE_OF_ARRIVAL_SUPPORT_TYPE_2D = 2; // 0x2
+ field public static final int ANGLE_OF_ARRIVAL_SUPPORT_TYPE_3D_HEMISPHERICAL = 3; // 0x3
+ field public static final int ANGLE_OF_ARRIVAL_SUPPORT_TYPE_3D_SPHERICAL = 4; // 0x4
+ field public static final int ANGLE_OF_ARRIVAL_SUPPORT_TYPE_NONE = 1; // 0x1
+ }
+
+ public static interface UwbManager.AdapterStateCallback {
+ method public void onStateChanged(boolean, int);
+ field public static final int STATE_CHANGED_REASON_ALL_SESSIONS_CLOSED = 1; // 0x1
+ field public static final int STATE_CHANGED_REASON_ERROR_UNKNOWN = 4; // 0x4
+ field public static final int STATE_CHANGED_REASON_SESSION_STARTED = 0; // 0x0
+ field public static final int STATE_CHANGED_REASON_SYSTEM_BOOT = 3; // 0x3
+ field public static final int STATE_CHANGED_REASON_SYSTEM_POLICY = 2; // 0x2
+ }
+
+}
+
package android.view {
public abstract class Window {
diff --git a/core/api/test-current.txt b/core/api/test-current.txt
index 715a099fca4f..546e72b8f834 100644
--- a/core/api/test-current.txt
+++ b/core/api/test-current.txt
@@ -980,10 +980,6 @@ package android.media.tv {
package android.net {
- public class ConnectivityManager {
- method @RequiresPermission(anyOf={android.Manifest.permission.MANAGE_TEST_NETWORKS, android.Manifest.permission.NETWORK_STACK}) public void simulateDataStall(int, long, @NonNull android.net.Network, @NonNull android.os.PersistableBundle);
- }
-
public class EthernetManager {
method public void setIncludeTestInterfaces(boolean);
}
@@ -992,11 +988,6 @@ package android.net {
field public static final int INVALID_SECURITY_PARAMETER_INDEX = 0; // 0x0
}
- public final class NetworkCapabilities implements android.os.Parcelable {
- method public int[] getCapabilities();
- field public static final int TRANSPORT_TEST = 7; // 0x7
- }
-
public class NetworkStack {
method public static void setServiceForTest(@Nullable android.os.IBinder);
}
@@ -1735,7 +1726,6 @@ package android.util {
method public static java.util.Map<java.lang.String,java.lang.String> getAllFeatureFlags();
method public static boolean isEnabled(android.content.Context, String);
method public static void setEnabled(android.content.Context, String, boolean);
- field public static final String DYNAMIC_SYSTEM = "settings_dynamic_system";
field public static final String FFLAG_OVERRIDE_PREFIX = "sys.fflag.override.";
field public static final String FFLAG_PREFIX = "sys.fflag.";
field public static final String HEARING_AID_SETTINGS = "settings_bluetooth_hearing_aid";
diff --git a/core/java/android/annotation/RequiresFeature.java b/core/java/android/annotation/RequiresFeature.java
index fc93f03d76cf..08861d42be39 100644
--- a/core/java/android/annotation/RequiresFeature.java
+++ b/core/java/android/annotation/RequiresFeature.java
@@ -30,7 +30,6 @@ import java.lang.annotation.Target;
* Denotes that the annotated element requires one or more device features. This
* is used to auto-generate documentation.
*
- * @see PackageManager#hasSystemFeature(String)
* @hide
*/
@Retention(SOURCE)
@@ -38,8 +37,16 @@ import java.lang.annotation.Target;
public @interface RequiresFeature {
/**
* The name of the device feature that is required.
- *
- * @see PackageManager#hasSystemFeature(String)
*/
String value();
+
+ /**
+ * Defines the name of the method that should be called to check whether the feature is
+ * available, using the same signature format as javadoc. The feature checking method can have
+ * multiple parameters, but the feature name parameter must be of type String and must also be
+ * the first String-type parameter.
+ * <p>
+ * By default, the enforcement is {@link PackageManager#hasSystemFeature(String)}.
+ */
+ String enforcement() default("android.content.pm.PackageManager#hasSystemFeature");
}
diff --git a/core/java/android/app/ContextImpl.java b/core/java/android/app/ContextImpl.java
index 602b835a03f8..12c9cd90222a 100644
--- a/core/java/android/app/ContextImpl.java
+++ b/core/java/android/app/ContextImpl.java
@@ -1428,6 +1428,45 @@ class ContextImpl extends Context {
}
}
+ /**
+ * <p>Perform a {@link #sendBroadcast(Intent)} that is "sticky," meaning the
+ * Intent you are sending stays around after the broadcast is complete,
+ * so that others can quickly retrieve that data through the return
+ * value of {@link #registerReceiver(BroadcastReceiver, IntentFilter)}. In
+ * all other ways, this behaves the same as
+ * {@link #sendBroadcast(Intent)}.
+ *
+ * @deprecated Sticky broadcasts should not be used. They provide no security (anyone
+ * can access them), no protection (anyone can modify them), and many other problems.
+ * The recommended pattern is to use a non-sticky broadcast to report that <em>something</em>
+ * has changed, with another mechanism for apps to retrieve the current value whenever
+ * desired.
+ *
+ * @param intent The Intent to broadcast; all receivers matching this
+ * Intent will receive the broadcast, and the Intent will be held to
+ * be re-broadcast to future receivers.
+ * @param options (optional) Additional sending options, generated from a
+ * {@link android.app.BroadcastOptions}.
+ *
+ * @see #sendBroadcast(Intent)
+ * @see #sendStickyOrderedBroadcast(Intent, BroadcastReceiver, Handler, int, String, Bundle)
+ */
+ @Override
+ @Deprecated
+ public void sendStickyBroadcast(@NonNull Intent intent, @Nullable Bundle options) {
+ warnIfCallingFromSystemProcess();
+ String resolvedType = intent.resolveTypeIfNeeded(getContentResolver());
+ try {
+ intent.prepareToLeaveProcess(this);
+ ActivityManager.getService().broadcastIntentWithFeature(
+ mMainThread.getApplicationThread(), getAttributionTag(), intent, resolvedType,
+ null, Activity.RESULT_OK, null, null, null, AppOpsManager.OP_NONE, options,
+ false, true, getUserId());
+ } catch (RemoteException e) {
+ throw e.rethrowFromSystemServer();
+ }
+ }
+
@Override
@Deprecated
public void sendStickyOrderedBroadcast(Intent intent,
diff --git a/core/java/android/app/OWNERS b/core/java/android/app/OWNERS
index 60bfac566879..afa1560420f7 100644
--- a/core/java/android/app/OWNERS
+++ b/core/java/android/app/OWNERS
@@ -50,6 +50,9 @@ per-file *StatusBar* = file:/packages/SystemUI/OWNERS
# ResourcesManager
per-file ResourcesManager = rtmitchell@google.com, toddke@google.com
+# VoiceInteraction
+per-file *VoiceInteract* = file:/core/java/android/service/voice/OWNERS
+
# Wallpaper
per-file *Wallpaper* = file:/core/java/android/service/wallpaper/OWNERS
diff --git a/core/java/android/app/admin/DevicePolicyManager.java b/core/java/android/app/admin/DevicePolicyManager.java
index 9acf675615a6..69d387994568 100644
--- a/core/java/android/app/admin/DevicePolicyManager.java
+++ b/core/java/android/app/admin/DevicePolicyManager.java
@@ -85,8 +85,10 @@ import android.security.keystore.StrongBoxUnavailableException;
import android.service.restrictions.RestrictionsReceiver;
import android.telephony.TelephonyManager;
import android.telephony.data.ApnSetting;
+import android.text.TextUtils;
import android.util.ArraySet;
import android.util.Log;
+import android.util.Pair;
import com.android.internal.annotations.VisibleForTesting;
import com.android.internal.net.NetworkUtilsInternal;
@@ -4524,30 +4526,10 @@ public class DevicePolicyManager {
if (!proxySpec.type().equals(Proxy.Type.HTTP)) {
throw new IllegalArgumentException();
}
- InetSocketAddress sa = (InetSocketAddress)proxySpec.address();
- String hostName = sa.getHostName();
- int port = sa.getPort();
- StringBuilder hostBuilder = new StringBuilder();
- hostSpec = hostBuilder.append(hostName)
- .append(":").append(Integer.toString(port)).toString();
- if (exclusionList == null) {
- exclSpec = "";
- } else {
- StringBuilder listBuilder = new StringBuilder();
- boolean firstDomain = true;
- for (String exclDomain : exclusionList) {
- if (!firstDomain) {
- listBuilder = listBuilder.append(",");
- } else {
- firstDomain = false;
- }
- listBuilder = listBuilder.append(exclDomain.trim());
- }
- exclSpec = listBuilder.toString();
- }
- if (android.net.Proxy.validate(hostName, Integer.toString(port), exclSpec)
- != android.net.Proxy.PROXY_VALID)
- throw new IllegalArgumentException();
+ final Pair<String, String> proxyParams =
+ getProxyParameters(proxySpec, exclusionList);
+ hostSpec = proxyParams.first;
+ exclSpec = proxyParams.second;
}
return mService.setGlobalProxy(admin, hostSpec, exclSpec);
} catch (RemoteException e) {
@@ -4558,6 +4540,35 @@ public class DevicePolicyManager {
}
/**
+ * Build HTTP proxy parameters for {@link IDevicePolicyManager#setGlobalProxy}.
+ * @throws IllegalArgumentException Invalid proxySpec
+ * @hide
+ */
+ @VisibleForTesting
+ public Pair<String, String> getProxyParameters(Proxy proxySpec, List<String> exclusionList) {
+ InetSocketAddress sa = (InetSocketAddress) proxySpec.address();
+ String hostName = sa.getHostName();
+ int port = sa.getPort();
+ final List<String> trimmedExclList;
+ if (exclusionList == null) {
+ trimmedExclList = Collections.emptyList();
+ } else {
+ trimmedExclList = new ArrayList<>(exclusionList.size());
+ for (String exclDomain : exclusionList) {
+ trimmedExclList.add(exclDomain.trim());
+ }
+ }
+ final ProxyInfo info = ProxyInfo.buildDirectProxy(hostName, port, trimmedExclList);
+ // The hostSpec is built assuming that there is a specified port and hostname,
+ // but ProxyInfo.isValid() accepts 0 / empty as unspecified: also reject them.
+ if (port == 0 || TextUtils.isEmpty(hostName) || !info.isValid()) {
+ throw new IllegalArgumentException();
+ }
+
+ return new Pair<>(hostName + ":" + port, TextUtils.join(",", trimmedExclList));
+ }
+
+ /**
* Set a network-independent global HTTP proxy. This is not normally what you want for typical
* HTTP proxies - they are generally network dependent. However if you're doing something
* unusual like general internal filtering this may be useful. On a private network where the
diff --git a/core/java/android/apphibernation/AppHibernationManager.java b/core/java/android/apphibernation/AppHibernationManager.java
new file mode 100644
index 000000000000..8f1934c7b77a
--- /dev/null
+++ b/core/java/android/apphibernation/AppHibernationManager.java
@@ -0,0 +1,79 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.apphibernation;
+
+import android.annotation.NonNull;
+import android.annotation.SystemApi;
+import android.annotation.SystemService;
+import android.content.Context;
+import android.os.RemoteException;
+import android.os.ServiceManager;
+
+/**
+ * This class provides an API surface for system apps to manipulate the app hibernation
+ * state of a package for the user provided in the context.
+ * @hide
+ */
+@SystemApi
+@SystemService(Context.APP_HIBERNATION_SERVICE)
+public final class AppHibernationManager {
+ private static final String TAG = "AppHibernationManager";
+ private final Context mContext;
+ private final IAppHibernationService mIAppHibernationService;
+
+ /**
+ * Creates a new instance.
+ *
+ * @param context The current context associated with the user
+ *
+ * @hide
+ */
+ public AppHibernationManager(@NonNull Context context) {
+ mContext = context;
+ mIAppHibernationService = IAppHibernationService.Stub.asInterface(
+ ServiceManager.getService(Context.APP_HIBERNATION_SERVICE));
+ }
+
+ /**
+ * Returns true if the package is hibernating, false otherwise.
+ *
+ * @hide
+ */
+ @SystemApi
+ public boolean isHibernating(@NonNull String packageName) {
+ try {
+ return mIAppHibernationService.isHibernating(packageName, mContext.getUserId());
+ } catch (RemoteException e) {
+ throw e.rethrowFromSystemServer();
+ }
+ }
+
+ /**
+ * Set whether the package is hibernating.
+ *
+ * @hide
+ */
+ @SystemApi
+ public void setHibernating(@NonNull String packageName, boolean isHibernating) {
+ try {
+ mIAppHibernationService.setHibernating(packageName, mContext.getUserId(),
+ isHibernating);
+ } catch (RemoteException e) {
+ throw e.rethrowFromSystemServer();
+ }
+ }
+}
diff --git a/core/java/android/apphibernation/IAppHibernationService.aidl b/core/java/android/apphibernation/IAppHibernationService.aidl
new file mode 100644
index 000000000000..db57ecb73051
--- /dev/null
+++ b/core/java/android/apphibernation/IAppHibernationService.aidl
@@ -0,0 +1,26 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.apphibernation;
+
+/**
+ * Binder interface to communicate with AppHibernationService.
+ * @hide
+ */
+interface IAppHibernationService {
+ boolean isHibernating(String packageName, int userId);
+ void setHibernating(String packageName, int userId, boolean isHibernating);
+} \ No newline at end of file
diff --git a/core/java/android/content/Context.java b/core/java/android/content/Context.java
index e0813cc83b1d..9c8856650ae0 100644
--- a/core/java/android/content/Context.java
+++ b/core/java/android/content/Context.java
@@ -2602,6 +2602,36 @@ public abstract class Context {
public abstract void sendStickyBroadcast(@RequiresPermission Intent intent);
/**
+ * <p>Perform a {@link #sendBroadcast(Intent)} that is "sticky," meaning the
+ * Intent you are sending stays around after the broadcast is complete,
+ * so that others can quickly retrieve that data through the return
+ * value of {@link #registerReceiver(BroadcastReceiver, IntentFilter)}. In
+ * all other ways, this behaves the same as
+ * {@link #sendBroadcast(Intent)}.
+ *
+ * @deprecated Sticky broadcasts should not be used. They provide no security (anyone
+ * can access them), no protection (anyone can modify them), and many other problems.
+ * The recommended pattern is to use a non-sticky broadcast to report that <em>something</em>
+ * has changed, with another mechanism for apps to retrieve the current value whenever
+ * desired.
+ *
+ * @param intent The Intent to broadcast; all receivers matching this
+ * Intent will receive the broadcast, and the Intent will be held to
+ * be re-broadcast to future receivers.
+ * @param options (optional) Additional sending options, generated from a
+ * {@link android.app.BroadcastOptions}.
+ *
+ * @see #sendBroadcast(Intent)
+ * @see #sendStickyOrderedBroadcast(Intent, BroadcastReceiver, Handler, int, String, Bundle)
+ */
+ @Deprecated
+ @RequiresPermission(android.Manifest.permission.BROADCAST_STICKY)
+ public void sendStickyBroadcast(@RequiresPermission @NonNull Intent intent,
+ @Nullable Bundle options) {
+ throw new RuntimeException("Not implemented. Must override in a subclass.");
+ }
+
+ /**
* <p>Version of {@link #sendStickyBroadcast} that allows you to
* receive data back from the broadcast. This is accomplished by
* supplying your own BroadcastReceiver when calling, which will be
@@ -4509,6 +4539,17 @@ public abstract class Context {
public static final String PERMISSION_CONTROLLER_SERVICE = "permission_controller";
/**
+ * Use with {@link #getSystemService(String) to retrieve an
+ * {@link android.apphibernation.AppHibernationManager}} for
+ * communicating with the hibernation service.
+ * @hide
+ *
+ * @see #getSystemService(String)
+ */
+ @SystemApi
+ public static final String APP_HIBERNATION_SERVICE = "app_hibernation";
+
+ /**
* Use with {@link #getSystemService(String)} to retrieve an
* {@link android.app.backup.IBackupManager IBackupManager} for communicating
* with the backup mechanism.
diff --git a/core/java/android/content/ContextWrapper.java b/core/java/android/content/ContextWrapper.java
index 5bdd521e92dd..e351c244b04c 100644
--- a/core/java/android/content/ContextWrapper.java
+++ b/core/java/android/content/ContextWrapper.java
@@ -617,6 +617,35 @@ public class ContextWrapper extends Context {
mBase.sendStickyBroadcast(intent);
}
+ /**
+ * <p>Perform a {@link #sendBroadcast(Intent)} that is "sticky," meaning the
+ * Intent you are sending stays around after the broadcast is complete,
+ * so that others can quickly retrieve that data through the return
+ * value of {@link #registerReceiver(BroadcastReceiver, IntentFilter)}. In
+ * all other ways, this behaves the same as
+ * {@link #sendBroadcast(Intent)}.
+ *
+ * @deprecated Sticky broadcasts should not be used. They provide no security (anyone
+ * can access them), no protection (anyone can modify them), and many other problems.
+ * The recommended pattern is to use a non-sticky broadcast to report that <em>something</em>
+ * has changed, with another mechanism for apps to retrieve the current value whenever
+ * desired.
+ *
+ * @param intent The Intent to broadcast; all receivers matching this
+ * Intent will receive the broadcast, and the Intent will be held to
+ * be re-broadcast to future receivers.
+ * @param options (optional) Additional sending options, generated from a
+ * {@link android.app.BroadcastOptions}.
+ *
+ * @see #sendBroadcast(Intent)
+ * @see #sendStickyOrderedBroadcast(Intent, BroadcastReceiver, Handler, int, String, Bundle)
+ */
+ @Override
+ @Deprecated
+ public void sendStickyBroadcast(@NonNull Intent intent, @Nullable Bundle options) {
+ mBase.sendStickyBroadcast(intent, options);
+ }
+
@Override
@Deprecated
public void sendStickyOrderedBroadcast(
diff --git a/core/java/android/content/pm/PackageManager.java b/core/java/android/content/pm/PackageManager.java
index 00f5fb95768f..31beb6e6a565 100644
--- a/core/java/android/content/pm/PackageManager.java
+++ b/core/java/android/content/pm/PackageManager.java
@@ -299,7 +299,10 @@ public abstract class PackageManager {
/**
* {@link PackageInfo} flag: return information about the
* intent filters supported by the activity.
+ *
+ * @deprecated The platform does not support getting {@link IntentFilter}s for the package.
*/
+ @Deprecated
public static final int GET_INTENT_FILTERS = 0x00000020;
/**
@@ -2122,6 +2125,35 @@ public abstract class PackageManager {
/**
* Feature for {@link #getSystemAvailableFeatures} and
+ * {@link #hasSystemFeature(String, int)}: If this feature is supported, the device supports
+ * {@link android.security.identity.IdentityCredentialStore} implemented in secure hardware
+ * at the given feature version.
+ *
+ * <p>Known feature versions include:
+ * <ul>
+ * <li><code>202009</code>: corresponds to the features included in the Identity Credential
+ * API shipped in Android 11.
+ * <li><code>202101</code>: corresponds to the features included in the Identity Credential
+ * API shipped in Android 12.
+ * </ul>
+ */
+ @SdkConstant(SdkConstantType.FEATURE)
+ public static final String FEATURE_IDENTITY_CREDENTIAL_HARDWARE =
+ "android.hardware.identity_credential";
+
+ /**
+ * Feature for {@link #getSystemAvailableFeatures} and
+ * {@link #hasSystemFeature(String, int)}: If this feature is supported, the device supports
+ * {@link android.security.identity.IdentityCredentialStore} implemented in secure hardware
+ * with direct access at the given feature version.
+ * See {@link #FEATURE_IDENTITY_CREDENTIAL_HARDWARE} for known feature versions.
+ */
+ @SdkConstant(SdkConstantType.FEATURE)
+ public static final String FEATURE_IDENTITY_CREDENTIAL_HARDWARE_DIRECT_ACCESS =
+ "android.hardware.identity_credential_direct_access";
+
+ /**
+ * Feature for {@link #getSystemAvailableFeatures} and
* {@link #hasSystemFeature}: The device supports one or more methods of
* reporting current location.
*/
diff --git a/core/java/android/graphics/fonts/OWNERS b/core/java/android/graphics/fonts/OWNERS
new file mode 100644
index 000000000000..18486af9d12c
--- /dev/null
+++ b/core/java/android/graphics/fonts/OWNERS
@@ -0,0 +1 @@
+include /graphics/java/android/graphics/fonts/OWNERS
diff --git a/core/java/android/net/ConnectivityManager.java b/core/java/android/net/ConnectivityManager.java
index ce0ed5bc0553..d107261ab2d4 100644
--- a/core/java/android/net/ConnectivityManager.java
+++ b/core/java/android/net/ConnectivityManager.java
@@ -19,6 +19,7 @@ import static android.net.IpSecManager.INVALID_RESOURCE_ID;
import static android.net.NetworkRequest.Type.LISTEN;
import static android.net.NetworkRequest.Type.REQUEST;
import static android.net.NetworkRequest.Type.TRACK_DEFAULT;
+import static android.net.QosCallback.QosCallbackRegistrationException;
import android.annotation.CallbackExecutor;
import android.annotation.IntDef;
@@ -29,7 +30,6 @@ import android.annotation.SdkConstant;
import android.annotation.SdkConstant.SdkConstantType;
import android.annotation.SystemApi;
import android.annotation.SystemService;
-import android.annotation.TestApi;
import android.app.PendingIntent;
import android.compat.annotation.UnsupportedAppUsage;
import android.content.Context;
@@ -4823,6 +4823,8 @@ public class ConnectivityManager {
/**
* Simulates a Data Stall for the specified Network.
*
+ * <p>This method should only be used for tests.
+ *
* <p>The caller must be the owner of the specified Network.
*
* @param detectionMethod The detection method used to identify the Data Stall.
@@ -4832,7 +4834,7 @@ public class ConnectivityManager {
* @throws SecurityException if the caller is not the owner of the given network.
* @hide
*/
- @TestApi
+ @SystemApi(client = SystemApi.Client.MODULE_LIBRARIES)
@RequiresPermission(anyOf = {android.Manifest.permission.MANAGE_TEST_NETWORKS,
android.Manifest.permission.NETWORK_STACK})
public void simulateDataStall(int detectionMethod, long timestampMillis,
@@ -4848,4 +4850,118 @@ public class ConnectivityManager {
Log.d(TAG, "setOemNetworkPreference called with preference: "
+ preference.toString());
}
+
+ @NonNull
+ private final List<QosCallbackConnection> mQosCallbackConnections = new ArrayList<>();
+
+ /**
+ * Registers a {@link QosSocketInfo} with an associated {@link QosCallback}. The callback will
+ * receive available QoS events related to the {@link Network} and local ip + port
+ * specified within socketInfo.
+ * <p/>
+ * The same {@link QosCallback} must be unregistered before being registered a second time,
+ * otherwise {@link QosCallbackRegistrationException} is thrown.
+ * <p/>
+ * This API does not, in itself, require any permission if called with a network that is not
+ * restricted. However, the underlying implementation currently only supports the IMS network,
+ * which is always restricted. That means non-preinstalled callers can't possibly find this API
+ * useful, because they'd never be called back on networks that they would have access to.
+ *
+ * @throws SecurityException if {@link QosSocketInfo#getNetwork()} is restricted and the app is
+ * missing CONNECTIVITY_USE_RESTRICTED_NETWORKS permission.
+ * @throws QosCallback.QosCallbackRegistrationException if qosCallback is already registered.
+ * @throws RuntimeException if the app already has too many callbacks registered.
+ *
+ * Exceptions after the time of registration is passed through
+ * {@link QosCallback#onError(QosCallbackException)}. see: {@link QosCallbackException}.
+ *
+ * @param socketInfo the socket information used to match QoS events
+ * @param callback receives qos events that satisfy socketInfo
+ * @param executor The executor on which the callback will be invoked. The provided
+ * {@link Executor} must run callback sequentially, otherwise the order of
+ * callbacks cannot be guaranteed.
+ *
+ * @hide
+ */
+ @SystemApi
+ public void registerQosCallback(@NonNull final QosSocketInfo socketInfo,
+ @NonNull final QosCallback callback,
+ @CallbackExecutor @NonNull final Executor executor) {
+ Objects.requireNonNull(socketInfo, "socketInfo must be non-null");
+ Objects.requireNonNull(callback, "callback must be non-null");
+ Objects.requireNonNull(executor, "executor must be non-null");
+
+ try {
+ synchronized (mQosCallbackConnections) {
+ if (getQosCallbackConnection(callback) == null) {
+ final QosCallbackConnection connection =
+ new QosCallbackConnection(this, callback, executor);
+ mQosCallbackConnections.add(connection);
+ mService.registerQosSocketCallback(socketInfo, connection);
+ } else {
+ Log.e(TAG, "registerQosCallback: Callback already registered");
+ throw new QosCallbackRegistrationException();
+ }
+ }
+ } catch (final RemoteException e) {
+ Log.e(TAG, "registerQosCallback: Error while registering ", e);
+
+ // The same unregister method method is called for consistency even though nothing
+ // will be sent to the ConnectivityService since the callback was never successfully
+ // registered.
+ unregisterQosCallback(callback);
+ e.rethrowFromSystemServer();
+ } catch (final ServiceSpecificException e) {
+ Log.e(TAG, "registerQosCallback: Error while registering ", e);
+ unregisterQosCallback(callback);
+ throw convertServiceException(e);
+ }
+ }
+
+ /**
+ * Unregisters the given {@link QosCallback}. The {@link QosCallback} will no longer receive
+ * events once unregistered and can be registered a second time.
+ * <p/>
+ * If the {@link QosCallback} does not have an active registration, it is a no-op.
+ *
+ * @param callback the callback being unregistered
+ *
+ * @hide
+ */
+ @SystemApi
+ public void unregisterQosCallback(@NonNull final QosCallback callback) {
+ Objects.requireNonNull(callback, "The callback must be non-null");
+ try {
+ synchronized (mQosCallbackConnections) {
+ final QosCallbackConnection connection = getQosCallbackConnection(callback);
+ if (connection != null) {
+ connection.stopReceivingMessages();
+ mService.unregisterQosCallback(connection);
+ mQosCallbackConnections.remove(connection);
+ } else {
+ Log.d(TAG, "unregisterQosCallback: Callback not registered");
+ }
+ }
+ } catch (final RemoteException e) {
+ Log.e(TAG, "unregisterQosCallback: Error while unregistering ", e);
+ e.rethrowFromSystemServer();
+ }
+ }
+
+ /**
+ * Gets the connection related to the callback.
+ *
+ * @param callback the callback to look up
+ * @return the related connection
+ */
+ @Nullable
+ private QosCallbackConnection getQosCallbackConnection(final QosCallback callback) {
+ for (final QosCallbackConnection connection : mQosCallbackConnections) {
+ // Checking by reference here is intentional
+ if (connection.getCallback() == callback) {
+ return connection;
+ }
+ }
+ return null;
+ }
}
diff --git a/core/java/android/net/IConnectivityManager.aidl b/core/java/android/net/IConnectivityManager.aidl
index 47c7a1af029b..719783163ab9 100644
--- a/core/java/android/net/IConnectivityManager.aidl
+++ b/core/java/android/net/IConnectivityManager.aidl
@@ -20,6 +20,8 @@ import android.app.PendingIntent;
import android.net.ConnectionInfo;
import android.net.ConnectivityDiagnosticsManager;
import android.net.IConnectivityDiagnosticsCallback;
+import android.net.IQosCallback;
+import android.net.ISocketKeepaliveCallback;
import android.net.LinkProperties;
import android.net.Network;
import android.net.NetworkAgentConfig;
@@ -27,9 +29,10 @@ import android.net.NetworkCapabilities;
import android.net.NetworkInfo;
import android.net.NetworkRequest;
import android.net.NetworkState;
-import android.net.ISocketKeepaliveCallback;
import android.net.ProxyInfo;
import android.net.UidRange;
+import android.net.VpnInfo;
+import android.net.QosSocketInfo;
import android.os.Bundle;
import android.os.IBinder;
import android.os.INetworkActivityListener;
@@ -41,7 +44,6 @@ import android.os.ResultReceiver;
import com.android.connectivity.aidl.INetworkAgent;
import com.android.internal.net.LegacyVpnInfo;
import com.android.internal.net.VpnConfig;
-import com.android.internal.net.VpnInfo;
import com.android.internal.net.VpnProfile;
/**
@@ -239,4 +241,7 @@ interface IConnectivityManager
void unregisterNetworkActivityListener(in INetworkActivityListener l);
boolean isDefaultNetworkActive();
+
+ void registerQosSocketCallback(in QosSocketInfo socketInfo, in IQosCallback callback);
+ void unregisterQosCallback(in IQosCallback callback);
}
diff --git a/core/java/android/net/INetworkPolicyManager.aidl b/core/java/android/net/INetworkPolicyManager.aidl
index 792e5b410afc..29a3fdf59e8b 100644
--- a/core/java/android/net/INetworkPolicyManager.aidl
+++ b/core/java/android/net/INetworkPolicyManager.aidl
@@ -81,4 +81,5 @@ interface INetworkPolicyManager {
void factoryReset(String subscriber);
boolean isUidNetworkingBlocked(int uid, boolean meteredNetwork);
+ boolean isUidRestrictedOnMeteredNetworks(int uid);
}
diff --git a/core/java/android/net/INetworkStatsService.aidl b/core/java/android/net/INetworkStatsService.aidl
index 1a3dc974480c..d5aede71011f 100644
--- a/core/java/android/net/INetworkStatsService.aidl
+++ b/core/java/android/net/INetworkStatsService.aidl
@@ -23,11 +23,11 @@ import android.net.NetworkState;
import android.net.NetworkStats;
import android.net.NetworkStatsHistory;
import android.net.NetworkTemplate;
+import android.net.VpnInfo;
import android.net.netstats.provider.INetworkStatsProvider;
import android.net.netstats.provider.INetworkStatsProviderCallback;
import android.os.IBinder;
import android.os.Messenger;
-import com.android.internal.net.VpnInfo;
/** {@hide} */
interface INetworkStatsService {
diff --git a/core/java/android/net/IQosCallback.aidl b/core/java/android/net/IQosCallback.aidl
new file mode 100644
index 000000000000..91c75759f85c
--- /dev/null
+++ b/core/java/android/net/IQosCallback.aidl
@@ -0,0 +1,34 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.net;
+
+import android.os.Bundle;
+import android.net.QosSession;
+import android.telephony.data.EpsBearerQosSessionAttributes;
+
+/**
+ * AIDL interface for QosCallback
+ *
+ * @hide
+ */
+oneway interface IQosCallback
+{
+ void onQosEpsBearerSessionAvailable(in QosSession session,
+ in EpsBearerQosSessionAttributes attributes);
+ void onQosSessionLost(in QosSession session);
+ void onError(in int type);
+}
diff --git a/core/java/android/net/IpSecManager.java b/core/java/android/net/IpSecManager.java
index d83715c692f7..60923f5ea8c6 100644
--- a/core/java/android/net/IpSecManager.java
+++ b/core/java/android/net/IpSecManager.java
@@ -15,6 +15,8 @@
*/
package android.net;
+import static android.annotation.SystemApi.Client.MODULE_LIBRARIES;
+
import static com.android.internal.util.Preconditions.checkNotNull;
import android.annotation.NonNull;
@@ -628,7 +630,7 @@ public final class IpSecManager {
}
/** @hide */
- @VisibleForTesting
+ @SystemApi(client = MODULE_LIBRARIES)
public int getResourceId() {
return mResourceId;
}
@@ -705,7 +707,7 @@ public final class IpSecManager {
}
/**
- * This class represents an IpSecTunnelInterface
+ * This class represents an IpSecTunnelInterface.
*
* <p>IpSecTunnelInterface objects track tunnel interfaces that serve as
* local endpoints for IPsec tunnels.
@@ -714,9 +716,7 @@ public final class IpSecManager {
* applied to provide IPsec security to packets sent through the tunnel. While a tunnel
* cannot be used in standalone mode within Android, the higher layers may use the tunnel
* to create Network objects which are accessible to the Android system.
- * @hide
*/
- @SystemApi
public static final class IpSecTunnelInterface implements AutoCloseable {
private final String mOpPackageName;
private final IIpSecService mService;
@@ -727,23 +727,26 @@ public final class IpSecManager {
private String mInterfaceName;
private int mResourceId = INVALID_RESOURCE_ID;
- /** Get the underlying SPI held by this object. */
+ /**
+ * Get the underlying SPI held by this object.
+ *
+ * @hide
+ */
+ @SystemApi
@NonNull
public String getInterfaceName() {
return mInterfaceName;
}
/**
- * Add an address to the IpSecTunnelInterface
+ * Add an address to the IpSecTunnelInterface.
*
* <p>Add an address which may be used as the local inner address for
* tunneled traffic.
*
* @param address the local address for traffic inside the tunnel
* @param prefixLen length of the InetAddress prefix
- * @hide
*/
- @SystemApi
@RequiresFeature(PackageManager.FEATURE_IPSEC_TUNNELS)
@RequiresPermission(android.Manifest.permission.MANAGE_IPSEC_TUNNELS)
public void addAddress(@NonNull InetAddress address, int prefixLen) throws IOException {
@@ -758,15 +761,13 @@ public final class IpSecManager {
}
/**
- * Remove an address from the IpSecTunnelInterface
+ * Remove an address from the IpSecTunnelInterface.
*
- * <p>Remove an address which was previously added to the IpSecTunnelInterface
+ * <p>Remove an address which was previously added to the IpSecTunnelInterface.
*
* @param address to be removed
* @param prefixLen length of the InetAddress prefix
- * @hide
*/
- @SystemApi
@RequiresFeature(PackageManager.FEATURE_IPSEC_TUNNELS)
@RequiresPermission(android.Manifest.permission.MANAGE_IPSEC_TUNNELS)
public void removeAddress(@NonNull InetAddress address, int prefixLen) throws IOException {
@@ -817,7 +818,7 @@ public final class IpSecManager {
}
/**
- * Delete an IpSecTunnelInterface
+ * Delete an IpSecTunnelInterface.
*
* <p>Calling close will deallocate the IpSecTunnelInterface and all of its system
* resources. Any packets bound for this interface either inbound or outbound will
@@ -839,7 +840,12 @@ public final class IpSecManager {
}
}
- /** Check that the Interface was closed properly. */
+
+ /**
+ * Check that the Interface was closed properly.
+ *
+ * @hide
+ */
@Override
protected void finalize() throws Throwable {
if (mCloseGuard != null) {
@@ -871,17 +877,52 @@ public final class IpSecManager {
* Create a new IpSecTunnelInterface as a local endpoint for tunneled IPsec traffic.
*
* <p>An application that creates tunnels is responsible for cleaning up the tunnel when the
- * underlying network goes away, and the onLost() callback is received.
+ * underlying network disconnects, and the {@link
+ * ConnectivityManager.NetworkCallback#onLost(Network)} callback is received.
+ *
+ * @param underlyingNetwork the {@link Network} that will carry traffic for this tunnel. Packets
+ * that go through the tunnel will need a underlying network to transit to the IPsec peer.
+ * This network should almost certainly be a physical network such as WiFi.
+ * @return a new {@link IpSecTunnelInterface} with the specified properties
+ * @throws IOException indicating that the tunnel could not be created due to a lower-layer
+ * error
+ * @throws ResourceUnavailableException indicating that the number of opening tunnels has
+ * reached the limit.
+ */
+ @NonNull
+ @RequiresFeature(PackageManager.FEATURE_IPSEC_TUNNELS)
+ @RequiresPermission(android.Manifest.permission.MANAGE_IPSEC_TUNNELS)
+ public IpSecTunnelInterface createIpSecTunnelInterface(@NonNull Network underlyingNetwork)
+ throws ResourceUnavailableException, IOException {
+
+ // TODO: Remove the need for adding two unused addresses with IPsec tunnels when {@link
+ // #createIpSecTunnelInterface(localAddress, remoteAddress, underlyingNetwork)} can be
+ // safely removed.
+ final InetAddress address = InetAddress.getLocalHost();
+ return createIpSecTunnelInterface(address, address, underlyingNetwork);
+ }
+
+ /**
+ * Create a new IpSecTunnelInterface as a local endpoint for tunneled IPsec traffic.
*
- * @param localAddress The local addres of the tunnel
- * @param remoteAddress The local addres of the tunnel
- * @param underlyingNetwork the {@link Network} that will carry traffic for this tunnel.
- * This network should almost certainly be a network such as WiFi with an L2 address.
- * @return a new {@link IpSecManager#IpSecTunnelInterface} with the specified properties
- * @throws IOException indicating that the socket could not be opened or bound
- * @throws ResourceUnavailableException indicating that too many encapsulation sockets are open
+ * <p>An application that creates tunnels is responsible for cleaning up the tunnel when the
+ * underlying network disconnects, and the {@link
+ * ConnectivityManager.NetworkCallback#onLost(Network)} callback is received.
+ *
+ * @param localAddress The local address of the tunnel
+ * @param remoteAddress The local address of the tunnel
+ * @param underlyingNetwork the {@link Network} that will carry traffic for this tunnel. Packets
+ * that go through the tunnel will need a underlying network to transit to the IPsec peer.
+ * This network should almost certainly be a physical network such as WiFi.
+ * @return a new {@link IpSecTunnelInterface} with the specified properties
+ * @throws IOException indicating that the tunnel could not be created due to a lower-layer
+ * error
+ * @throws ResourceUnavailableException indicating that the number of opening tunnels has
+ * reached the limit.
* @hide
+ * @deprecated Callers should use {@link #createIpSecTunnelInterface(Network)}
*/
+ @Deprecated
@SystemApi
@NonNull
@RequiresFeature(PackageManager.FEATURE_IPSEC_TUNNELS)
@@ -905,16 +946,14 @@ public final class IpSecManager {
* <p>Applications should probably not use this API directly.
*
*
- * @param tunnel The {@link IpSecManager#IpSecTunnelInterface} that will use the supplied
+ * @param tunnel The {@link IpSecTunnelInterface} that will use the supplied
* transform.
- * @param direction the direction, {@link DIRECTION_OUT} or {@link #DIRECTION_IN} in which
+ * @param direction the direction, {@link #DIRECTION_OUT} or {@link #DIRECTION_IN} in which
* the transform will be used.
* @param transform an {@link IpSecTransform} created in tunnel mode
- * @throws IOException indicating that the transform could not be applied due to a lower
- * layer failure.
- * @hide
+ * @throws IOException indicating that the transform could not be applied due to a lower-layer
+ * error
*/
- @SystemApi
@RequiresFeature(PackageManager.FEATURE_IPSEC_TUNNELS)
@RequiresPermission(android.Manifest.permission.MANAGE_IPSEC_TUNNELS)
public void applyTunnelModeTransform(@NonNull IpSecTunnelInterface tunnel,
diff --git a/core/java/android/net/Network.java b/core/java/android/net/Network.java
index f98a1f8a220d..fbca7f178e3c 100644
--- a/core/java/android/net/Network.java
+++ b/core/java/android/net/Network.java
@@ -420,7 +420,7 @@ public class Network implements Parcelable {
throw new SocketException("Only AF_INET/AF_INET6 sockets supported");
}
- final int err = NetworkUtils.bindSocketToNetwork(fd.getInt$(), netId);
+ final int err = NetworkUtils.bindSocketToNetwork(fd, netId);
if (err != 0) {
// bindSocketToNetwork returns negative errno.
throw new ErrnoException("Binding socket to network " + netId, -err)
diff --git a/core/java/android/net/NetworkAgent.java b/core/java/android/net/NetworkAgent.java
index 83a7d16fa2d9..d22d82d1f4d0 100644
--- a/core/java/android/net/NetworkAgent.java
+++ b/core/java/android/net/NetworkAgent.java
@@ -30,6 +30,7 @@ import android.os.Handler;
import android.os.Looper;
import android.os.Message;
import android.os.RemoteException;
+import android.telephony.data.EpsBearerQosSessionAttributes;
import android.util.Log;
import com.android.connectivity.aidl.INetworkAgent;
@@ -227,7 +228,7 @@ public abstract class NetworkAgent {
*/
public static final String REDIRECT_URL_KEY = "redirect URL";
- /**
+ /**
* Sent by the NetworkAgent to ConnectivityService to indicate this network was
* explicitly selected. This should be sent before the NetworkInfo is marked
* CONNECTED so it can be given special treatment at that time.
@@ -341,6 +342,24 @@ public abstract class NetworkAgent {
*/
private static final int EVENT_AGENT_DISCONNECTED = BASE + 19;
+ /**
+ * Sent by QosCallbackTracker to {@link NetworkAgent} to register a new filter with
+ * callback.
+ *
+ * arg1 = QoS agent callback ID
+ * obj = {@link QosFilter}
+ * @hide
+ */
+ public static final int CMD_REGISTER_QOS_CALLBACK = BASE + 20;
+
+ /**
+ * Sent by QosCallbackTracker to {@link NetworkAgent} to unregister a callback.
+ *
+ * arg1 = QoS agent callback ID
+ * @hide
+ */
+ public static final int CMD_UNREGISTER_QOS_CALLBACK = BASE + 21;
+
private static NetworkInfo getLegacyNetworkInfo(final NetworkAgentConfig config) {
// The subtype can be changed with (TODO) setLegacySubtype, but it starts
// with 0 (TelephonyManager.NETWORK_TYPE_UNKNOWN) and an empty description.
@@ -520,6 +539,17 @@ public abstract class NetworkAgent {
onRemoveKeepalivePacketFilter(msg.arg1 /* slot */);
break;
}
+ case CMD_REGISTER_QOS_CALLBACK: {
+ onQosCallbackRegistered(
+ msg.arg1 /* QoS callback id */,
+ (QosFilter) msg.obj /* QoS filter */);
+ break;
+ }
+ case CMD_UNREGISTER_QOS_CALLBACK: {
+ onQosCallbackUnregistered(
+ msg.arg1 /* QoS callback id */);
+ break;
+ }
}
}
}
@@ -553,6 +583,8 @@ public abstract class NetworkAgent {
}
private static class NetworkAgentBinder extends INetworkAgent.Stub {
+ private static final String LOG_TAG = NetworkAgentBinder.class.getSimpleName();
+
private final Handler mHandler;
private NetworkAgentBinder(Handler handler) {
@@ -639,6 +671,25 @@ public abstract class NetworkAgent {
mHandler.sendMessage(mHandler.obtainMessage(CMD_REMOVE_KEEPALIVE_PACKET_FILTER,
slot, 0));
}
+
+ @Override
+ public void onQosFilterCallbackRegistered(final int qosCallbackId,
+ final QosFilterParcelable qosFilterParcelable) {
+ if (qosFilterParcelable.getQosFilter() != null) {
+ mHandler.sendMessage(
+ mHandler.obtainMessage(CMD_REGISTER_QOS_CALLBACK, qosCallbackId, 0,
+ qosFilterParcelable.getQosFilter()));
+ return;
+ }
+
+ Log.wtf(LOG_TAG, "onQosFilterCallbackRegistered: qos filter is null.");
+ }
+
+ @Override
+ public void onQosCallbackUnregistered(final int qosCallbackId) {
+ mHandler.sendMessage(mHandler.obtainMessage(
+ CMD_UNREGISTER_QOS_CALLBACK, qosCallbackId, 0, null));
+ }
}
/**
@@ -1067,8 +1118,68 @@ public abstract class NetworkAgent {
protected void preventAutomaticReconnect() {
}
+ /**
+ * Called when a qos callback is registered with a filter.
+ * @param qosCallbackId the id for the callback registered
+ * @param filter the filter being registered
+ */
+ public void onQosCallbackRegistered(final int qosCallbackId, final @NonNull QosFilter filter) {
+ }
+
+ /**
+ * Called when a qos callback is registered with a filter.
+ * <p/>
+ * Any QoS events that are sent with the same callback id after this method is called
+ * are a no-op.
+ *
+ * @param qosCallbackId the id for the callback being unregistered
+ */
+ public void onQosCallbackUnregistered(final int qosCallbackId) {
+ }
+
+
+ /**
+ * Sends the attributes of Eps Bearer Qos Session back to the Application
+ *
+ * @param qosCallbackId the callback id that the session belongs to
+ * @param sessionId the unique session id across all Eps Bearer Qos Sessions
+ * @param attributes the attributes of the Eps Qos Session
+ */
+ public final void sendQosSessionAvailable(final int qosCallbackId, final int sessionId,
+ @NonNull final EpsBearerQosSessionAttributes attributes) {
+ Objects.requireNonNull(attributes, "The attributes must be non-null");
+ queueOrSendMessage(ra -> ra.sendEpsQosSessionAvailable(qosCallbackId,
+ new QosSession(sessionId, QosSession.TYPE_EPS_BEARER),
+ attributes));
+ }
+
+ /**
+ * Sends event that the Eps Qos Session was lost.
+ *
+ * @param qosCallbackId the callback id that the session belongs to
+ * @param sessionId the unique session id across all Eps Bearer Qos Sessions
+ */
+ public final void sendQosSessionLost(final int qosCallbackId, final int sessionId) {
+ queueOrSendMessage(ra -> ra.sendQosSessionLost(qosCallbackId,
+ new QosSession(sessionId, QosSession.TYPE_EPS_BEARER)));
+ }
+
+ /**
+ * Sends the exception type back to the application.
+ *
+ * The NetworkAgent should not send anymore messages with this id.
+ *
+ * @param qosCallbackId the callback id this exception belongs to
+ * @param exceptionType the type of exception
+ */
+ public final void sendQosCallbackError(final int qosCallbackId,
+ @QosCallbackException.ExceptionType final int exceptionType) {
+ queueOrSendMessage(ra -> ra.sendQosCallbackError(qosCallbackId, exceptionType));
+ }
+
+
/** @hide */
- protected void log(String s) {
+ protected void log(final String s) {
Log.d(LOG_TAG, "NetworkAgent: " + s);
}
}
diff --git a/core/java/android/net/NetworkCapabilities.java b/core/java/android/net/NetworkCapabilities.java
index 2d9f6d806f31..0a895b98f9fd 100644
--- a/core/java/android/net/NetworkCapabilities.java
+++ b/core/java/android/net/NetworkCapabilities.java
@@ -23,7 +23,6 @@ import android.annotation.NonNull;
import android.annotation.Nullable;
import android.annotation.RequiresPermission;
import android.annotation.SystemApi;
-import android.annotation.TestApi;
import android.compat.annotation.UnsupportedAppUsage;
import android.net.ConnectivityManager.NetworkCallback;
import android.os.Build;
@@ -576,7 +575,6 @@ public final class NetworkCapabilities implements Parcelable {
* @hide
*/
@UnsupportedAppUsage
- @TestApi
public @NetCapability int[] getCapabilities() {
return BitUtils.unpackBits(mNetworkCapabilities);
}
@@ -821,7 +819,7 @@ public final class NetworkCapabilities implements Parcelable {
*
* @hide
*/
- @TestApi
+ @SystemApi(client = SystemApi.Client.MODULE_LIBRARIES)
public static final int TRANSPORT_TEST = 7;
/** @hide */
diff --git a/core/java/android/net/NetworkIdentity.java b/core/java/android/net/NetworkIdentity.java
index a0dc72d4adbf..b644ed56ad8b 100644
--- a/core/java/android/net/NetworkIdentity.java
+++ b/core/java/android/net/NetworkIdentity.java
@@ -194,13 +194,15 @@ public class NetworkIdentity implements Comparable<NetworkIdentity> {
subscriberId = state.subscriberId;
if (type == TYPE_WIFI) {
- if (state.networkId != null) {
- networkId = state.networkId;
- } else {
- final WifiManager wifi = (WifiManager) context.getSystemService(
- Context.WIFI_SERVICE);
- final WifiInfo info = wifi.getConnectionInfo();
- networkId = info != null ? info.getSSID() : null;
+ if (state.networkCapabilities.getSsid() != null) {
+ networkId = state.networkCapabilities.getSsid();
+ if (networkId == null) {
+ // TODO: Figure out if this code path never runs. If so, remove them.
+ final WifiManager wifi = (WifiManager) context.getSystemService(
+ Context.WIFI_SERVICE);
+ final WifiInfo info = wifi.getConnectionInfo();
+ networkId = info != null ? info.getSSID() : null;
+ }
}
}
diff --git a/core/java/android/net/NetworkPolicyManager.java b/core/java/android/net/NetworkPolicyManager.java
index c029deae09df..82b035b08428 100644
--- a/core/java/android/net/NetworkPolicyManager.java
+++ b/core/java/android/net/NetworkPolicyManager.java
@@ -460,6 +460,22 @@ public class NetworkPolicyManager {
}
/**
+ * Check that the given uid is restricted from doing networking on metered networks.
+ *
+ * @param uid The target uid.
+ * @return true if the given uid is restricted from doing networking on metered networks.
+ *
+ * @hide
+ */
+ public boolean isUidRestrictedOnMeteredNetworks(int uid) {
+ try {
+ return mService.isUidRestrictedOnMeteredNetworks(uid);
+ } catch (RemoteException e) {
+ throw e.rethrowFromSystemServer();
+ }
+ }
+
+ /**
* Get multipath preference for the given network.
*/
public int getMultipathPreference(Network network) {
diff --git a/core/java/android/net/NetworkReleasedException.java b/core/java/android/net/NetworkReleasedException.java
new file mode 100644
index 000000000000..0629b7563aea
--- /dev/null
+++ b/core/java/android/net/NetworkReleasedException.java
@@ -0,0 +1,32 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.net;
+
+import android.annotation.SystemApi;
+
+/**
+ * Indicates that the {@link Network} was released and is no longer available.
+ *
+ * @hide
+ */
+@SystemApi
+public class NetworkReleasedException extends Exception {
+ /** @hide */
+ public NetworkReleasedException() {
+ super("The network was released and is no longer available");
+ }
+}
diff --git a/core/java/android/net/NetworkRequest.java b/core/java/android/net/NetworkRequest.java
index f0c637c76ec5..04011fc6816e 100644
--- a/core/java/android/net/NetworkRequest.java
+++ b/core/java/android/net/NetworkRequest.java
@@ -353,7 +353,9 @@ public class NetworkRequest implements Parcelable {
* NetworkSpecifier.
*/
public Builder setNetworkSpecifier(NetworkSpecifier networkSpecifier) {
- MatchAllNetworkSpecifier.checkNotMatchAllNetworkSpecifier(networkSpecifier);
+ if (networkSpecifier instanceof MatchAllNetworkSpecifier) {
+ throw new IllegalArgumentException("A MatchAllNetworkSpecifier is not permitted");
+ }
mNetworkCapabilities.setNetworkSpecifier(networkSpecifier);
return this;
}
diff --git a/core/java/android/net/NetworkUtils.java b/core/java/android/net/NetworkUtils.java
index b5962c5bae14..8be4af7b1396 100644
--- a/core/java/android/net/NetworkUtils.java
+++ b/core/java/android/net/NetworkUtils.java
@@ -81,11 +81,11 @@ public class NetworkUtils {
public native static boolean bindProcessToNetworkForHostResolution(int netId);
/**
- * Explicitly binds {@code socketfd} to the network designated by {@code netId}. This
+ * Explicitly binds {@code fd} to the network designated by {@code netId}. This
* overrides any binding via {@link #bindProcessToNetwork}.
* @return 0 on success or negative errno on failure.
*/
- public native static int bindSocketToNetwork(int socketfd, int netId);
+ public static native int bindSocketToNetwork(FileDescriptor fd, int netId);
/**
* Protect {@code fd} from VPN connections. After protecting, data sent through
@@ -93,9 +93,7 @@ public class NetworkUtils {
* forwarded through the VPN.
*/
@UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.R, trackingBug = 170729553)
- public static boolean protectFromVpn(FileDescriptor fd) {
- return protectFromVpn(fd.getInt$());
- }
+ public static native boolean protectFromVpn(FileDescriptor fd);
/**
* Protect {@code socketfd} from VPN connections. After protecting, data sent through
diff --git a/core/java/android/net/ProxyInfo.java b/core/java/android/net/ProxyInfo.java
index a202d77a211a..c9bca2876b0a 100644
--- a/core/java/android/net/ProxyInfo.java
+++ b/core/java/android/net/ProxyInfo.java
@@ -355,7 +355,7 @@ public class ProxyInfo implements Parcelable {
port = in.readInt();
}
String exclList = in.readString();
- String[] parsedExclList = in.readStringArray();
+ String[] parsedExclList = in.createStringArray();
ProxyInfo proxyProperties = new ProxyInfo(host, port, exclList, parsedExclList);
return proxyProperties;
}
diff --git a/core/java/android/net/QosCallback.java b/core/java/android/net/QosCallback.java
new file mode 100644
index 000000000000..22f06bc0e690
--- /dev/null
+++ b/core/java/android/net/QosCallback.java
@@ -0,0 +1,91 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.net;
+
+import android.annotation.NonNull;
+import android.annotation.SystemApi;
+
+import java.util.concurrent.Executor;
+
+/**
+ * Receives Qos information given a {@link Network}. The callback is registered with
+ * {@link ConnectivityManager#registerQosCallback}.
+ *
+ * <p>
+ * <br/>
+ * The callback will no longer receive calls if any of the following takes place:
+ * <ol>
+ * <li>{@link ConnectivityManager#unregisterQosCallback(QosCallback)} is called with the same
+ * callback instance.</li>
+ * <li>{@link QosCallback#onError(QosCallbackException)} is called.</li>
+ * <li>A network specific issue occurs. eg. Congestion on a carrier network.</li>
+ * <li>The network registered with the callback has no associated QoS providers</li>
+ * </ul>
+ * {@hide}
+ */
+@SystemApi
+public abstract class QosCallback {
+ /**
+ * Invoked after an error occurs on a registered callback. Once called, the callback is
+ * automatically unregistered and the callback will no longer receive calls.
+ *
+ * <p>The underlying exception can either be a runtime exception or a custom exception made for
+ * {@link QosCallback}. see: {@link QosCallbackException}.
+ *
+ * @param exception wraps the underlying cause
+ */
+ public void onError(@NonNull final QosCallbackException exception) {
+ }
+
+ /**
+ * Called when a Qos Session first becomes available to the callback or if its attributes have
+ * changed.
+ * <p>
+ * Note: The callback may be called multiple times with the same attributes.
+ *
+ * @param session the available session
+ * @param sessionAttributes the attributes of the session
+ */
+ public void onQosSessionAvailable(@NonNull final QosSession session,
+ @NonNull final QosSessionAttributes sessionAttributes) {
+ }
+
+ /**
+ * Called after a Qos Session is lost.
+ * <p>
+ * At least one call to
+ * {@link QosCallback#onQosSessionAvailable(QosSession, QosSessionAttributes)}
+ * with the same {@link QosSession} will precede a call to lost.
+ *
+ * @param session the lost session
+ */
+ public void onQosSessionLost(@NonNull final QosSession session) {
+ }
+
+ /**
+ * Thrown when there is a problem registering {@link QosCallback} with
+ * {@link ConnectivityManager#registerQosCallback(QosSocketInfo, QosCallback, Executor)}.
+ */
+ public static class QosCallbackRegistrationException extends RuntimeException {
+ /**
+ * @hide
+ */
+ public QosCallbackRegistrationException() {
+ super();
+ }
+ }
+}
diff --git a/core/java/android/net/QosCallbackConnection.java b/core/java/android/net/QosCallbackConnection.java
new file mode 100644
index 000000000000..bdb4ad68cd7b
--- /dev/null
+++ b/core/java/android/net/QosCallbackConnection.java
@@ -0,0 +1,128 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.net;
+
+import android.annotation.NonNull;
+import android.annotation.Nullable;
+import android.telephony.data.EpsBearerQosSessionAttributes;
+
+import com.android.internal.annotations.VisibleForTesting;
+
+import java.util.Objects;
+import java.util.concurrent.Executor;
+
+/**
+ * Sends messages from {@link com.android.server.ConnectivityService} to the registered
+ * {@link QosCallback}.
+ * <p/>
+ * This is a satellite class of {@link ConnectivityManager} and not meant
+ * to be used in other contexts.
+ *
+ * @hide
+ */
+class QosCallbackConnection extends android.net.IQosCallback.Stub {
+
+ @NonNull private final ConnectivityManager mConnectivityManager;
+ @Nullable private volatile QosCallback mCallback;
+ @NonNull private final Executor mExecutor;
+
+ @VisibleForTesting
+ @Nullable
+ public QosCallback getCallback() {
+ return mCallback;
+ }
+
+ /**
+ * The constructor for the connection
+ *
+ * @param connectivityManager the mgr that created this connection
+ * @param callback the callback to send messages back to
+ * @param executor The executor on which the callback will be invoked. The provided
+ * {@link Executor} must run callback sequentially, otherwise the order of
+ * callbacks cannot be guaranteed.
+ */
+ QosCallbackConnection(@NonNull final ConnectivityManager connectivityManager,
+ @NonNull final QosCallback callback,
+ @NonNull final Executor executor) {
+ mConnectivityManager = Objects.requireNonNull(connectivityManager,
+ "connectivityManager must be non-null");
+ mCallback = Objects.requireNonNull(callback, "callback must be non-null");
+ mExecutor = Objects.requireNonNull(executor, "executor must be non-null");
+ }
+
+ /**
+ * Called when either the {@link EpsBearerQosSessionAttributes} has changed or on the first time
+ * the attributes have become available.
+ *
+ * @param session the session that is now available
+ * @param attributes the corresponding attributes of session
+ */
+ @Override
+ public void onQosEpsBearerSessionAvailable(@NonNull final QosSession session,
+ @NonNull final EpsBearerQosSessionAttributes attributes) {
+
+ mExecutor.execute(() -> {
+ final QosCallback callback = mCallback;
+ if (callback != null) {
+ callback.onQosSessionAvailable(session, attributes);
+ }
+ });
+ }
+
+ /**
+ * Called when the session is lost.
+ *
+ * @param session the session that was lost
+ */
+ @Override
+ public void onQosSessionLost(@NonNull final QosSession session) {
+ mExecutor.execute(() -> {
+ final QosCallback callback = mCallback;
+ if (callback != null) {
+ callback.onQosSessionLost(session);
+ }
+ });
+ }
+
+ /**
+ * Called when there is an error on the registered callback.
+ *
+ * @param errorType the type of error
+ */
+ @Override
+ public void onError(@QosCallbackException.ExceptionType final int errorType) {
+ mExecutor.execute(() -> {
+ final QosCallback callback = mCallback;
+ if (callback != null) {
+ // Messages no longer need to be received since there was an error.
+ stopReceivingMessages();
+ mConnectivityManager.unregisterQosCallback(callback);
+ callback.onError(QosCallbackException.createException(errorType));
+ }
+ });
+ }
+
+ /**
+ * The callback will stop receiving messages.
+ * <p/>
+ * There are no synchronization guarantees on exactly when the callback will stop receiving
+ * messages.
+ */
+ void stopReceivingMessages() {
+ mCallback = null;
+ }
+}
diff --git a/core/java/android/net/QosCallbackException.java b/core/java/android/net/QosCallbackException.java
new file mode 100644
index 000000000000..7fd9a527e2ac
--- /dev/null
+++ b/core/java/android/net/QosCallbackException.java
@@ -0,0 +1,110 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.net;
+
+import android.annotation.IntDef;
+import android.annotation.NonNull;
+import android.annotation.SystemApi;
+import android.util.Log;
+
+import java.lang.annotation.Retention;
+import java.lang.annotation.RetentionPolicy;
+
+/**
+ * This is the exception type passed back through the onError method on {@link QosCallback}.
+ * {@link QosCallbackException#getCause()} contains the actual error that caused this exception.
+ *
+ * The possible exception types as causes are:
+ * 1. {@link NetworkReleasedException}
+ * 2. {@link SocketNotBoundException}
+ * 3. {@link UnsupportedOperationException}
+ * 4. {@link SocketLocalAddressChangedException}
+ *
+ * @hide
+ */
+@SystemApi
+public final class QosCallbackException extends Exception {
+
+ /** @hide */
+ @IntDef(prefix = {"EX_TYPE_"}, value = {
+ EX_TYPE_FILTER_NONE,
+ EX_TYPE_FILTER_NETWORK_RELEASED,
+ EX_TYPE_FILTER_SOCKET_NOT_BOUND,
+ EX_TYPE_FILTER_NOT_SUPPORTED,
+ EX_TYPE_FILTER_SOCKET_LOCAL_ADDRESS_CHANGED,
+ })
+ @Retention(RetentionPolicy.SOURCE)
+ public @interface ExceptionType {}
+
+ private static final String TAG = "QosCallbackException";
+
+ // Types of exceptions supported //
+ /** {@hide} */
+ public static final int EX_TYPE_FILTER_NONE = 0;
+
+ /** {@hide} */
+ public static final int EX_TYPE_FILTER_NETWORK_RELEASED = 1;
+
+ /** {@hide} */
+ public static final int EX_TYPE_FILTER_SOCKET_NOT_BOUND = 2;
+
+ /** {@hide} */
+ public static final int EX_TYPE_FILTER_NOT_SUPPORTED = 3;
+
+ /** {@hide} */
+ public static final int EX_TYPE_FILTER_SOCKET_LOCAL_ADDRESS_CHANGED = 4;
+
+ /**
+ * Creates exception based off of a type and message. Not all types of exceptions accept a
+ * custom message.
+ *
+ * {@hide}
+ */
+ @NonNull
+ static QosCallbackException createException(@ExceptionType final int type) {
+ switch (type) {
+ case EX_TYPE_FILTER_NETWORK_RELEASED:
+ return new QosCallbackException(new NetworkReleasedException());
+ case EX_TYPE_FILTER_SOCKET_NOT_BOUND:
+ return new QosCallbackException(new SocketNotBoundException());
+ case EX_TYPE_FILTER_NOT_SUPPORTED:
+ return new QosCallbackException(new UnsupportedOperationException(
+ "This device does not support the specified filter"));
+ case EX_TYPE_FILTER_SOCKET_LOCAL_ADDRESS_CHANGED:
+ return new QosCallbackException(
+ new SocketLocalAddressChangedException());
+ default:
+ Log.wtf(TAG, "create: No case setup for exception type: '" + type + "'");
+ return new QosCallbackException(
+ new RuntimeException("Unknown exception code: " + type));
+ }
+ }
+
+ /**
+ * @hide
+ */
+ public QosCallbackException(@NonNull final String message) {
+ super(message);
+ }
+
+ /**
+ * @hide
+ */
+ public QosCallbackException(@NonNull final Throwable cause) {
+ super(cause);
+ }
+}
diff --git a/core/java/android/net/QosFilter.java b/core/java/android/net/QosFilter.java
new file mode 100644
index 000000000000..ab55002e02b3
--- /dev/null
+++ b/core/java/android/net/QosFilter.java
@@ -0,0 +1,75 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.net;
+
+import android.annotation.NonNull;
+import android.annotation.SystemApi;
+
+import java.net.InetAddress;
+
+/**
+ * Provides the related filtering logic to the {@link NetworkAgent} to match {@link QosSession}s
+ * to their related {@link QosCallback}.
+ *
+ * Used by the {@link com.android.server.ConnectivityService} to validate a {@link QosCallback}
+ * is still able to receive a {@link QosSession}.
+ *
+ * @hide
+ */
+@SystemApi
+public abstract class QosFilter {
+
+ /**
+ * The constructor is kept hidden from outside this package to ensure that all derived types
+ * are known and properly handled when being passed to and from {@link NetworkAgent}.
+ *
+ * @hide
+ */
+ QosFilter() {
+ }
+
+ /**
+ * The network used with this filter.
+ *
+ * @return the registered {@link Network}
+ */
+ @NonNull
+ public abstract Network getNetwork();
+
+ /**
+ * Validates that conditions have not changed such that no further {@link QosSession}s should
+ * be passed back to the {@link QosCallback} associated to this filter.
+ *
+ * @return the error code when present, otherwise the filter is valid
+ *
+ * @hide
+ */
+ @QosCallbackException.ExceptionType
+ public abstract int validate();
+
+ /**
+ * Determines whether or not the parameters is a match for the filter.
+ *
+ * @param address the local address
+ * @param startPort the start of the port range
+ * @param endPort the end of the port range
+ * @return whether the parameters match the local address of the filter
+ */
+ public abstract boolean matchesLocalAddress(@NonNull InetAddress address,
+ int startPort, int endPort);
+}
+
diff --git a/core/java/android/net/QosFilterParcelable.aidl b/core/java/android/net/QosFilterParcelable.aidl
new file mode 100644
index 000000000000..312d6352ee92
--- /dev/null
+++ b/core/java/android/net/QosFilterParcelable.aidl
@@ -0,0 +1,21 @@
+/*
+**
+** Copyright (C) 2020 The Android Open Source Project
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+**
+** http://www.apache.org/licenses/LICENSE-2.0
+**
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+*/
+
+package android.net;
+
+parcelable QosFilterParcelable;
+
diff --git a/core/java/android/net/QosFilterParcelable.java b/core/java/android/net/QosFilterParcelable.java
new file mode 100644
index 000000000000..da3b2cf8ff7a
--- /dev/null
+++ b/core/java/android/net/QosFilterParcelable.java
@@ -0,0 +1,113 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.net;
+
+import android.annotation.NonNull;
+import android.annotation.Nullable;
+import android.os.Parcel;
+import android.os.Parcelable;
+import android.util.Log;
+
+import java.util.Objects;
+
+/**
+ * Aware of how to parcel different types of {@link QosFilter}s. Any new type of qos filter must
+ * have a specialized case written here.
+ * <p/>
+ * Specifically leveraged when transferring {@link QosFilter} from
+ * {@link com.android.server.ConnectivityService} to {@link NetworkAgent} when the filter is first
+ * registered.
+ * <p/>
+ * This is not meant to be used in other contexts.
+ *
+ * @hide
+ */
+public final class QosFilterParcelable implements Parcelable {
+
+ private static final String LOG_TAG = QosFilterParcelable.class.getSimpleName();
+
+ // Indicates that the filter was not successfully written to the parcel.
+ private static final int NO_FILTER_PRESENT = 0;
+
+ // The parcel is of type qos socket filter.
+ private static final int QOS_SOCKET_FILTER = 1;
+
+ private final QosFilter mQosFilter;
+
+ /**
+ * The underlying qos filter.
+ * <p/>
+ * Null only in the case parceling failed.
+ */
+ @Nullable
+ public QosFilter getQosFilter() {
+ return mQosFilter;
+ }
+
+ public QosFilterParcelable(@NonNull final QosFilter qosFilter) {
+ Objects.requireNonNull(qosFilter, "qosFilter must be non-null");
+
+ // NOTE: Normally a type check would belong here, but doing so breaks unit tests that rely
+ // on mocking qos filter.
+ mQosFilter = qosFilter;
+ }
+
+ private QosFilterParcelable(final Parcel in) {
+ final int filterParcelType = in.readInt();
+
+ switch (filterParcelType) {
+ case QOS_SOCKET_FILTER: {
+ mQosFilter = new QosSocketFilter(QosSocketInfo.CREATOR.createFromParcel(in));
+ break;
+ }
+
+ case NO_FILTER_PRESENT:
+ default: {
+ mQosFilter = null;
+ }
+ }
+ }
+
+ public static final Creator<QosFilterParcelable> CREATOR = new Creator<QosFilterParcelable>() {
+ @Override
+ public QosFilterParcelable createFromParcel(final Parcel in) {
+ return new QosFilterParcelable(in);
+ }
+
+ @Override
+ public QosFilterParcelable[] newArray(final int size) {
+ return new QosFilterParcelable[size];
+ }
+ };
+
+ @Override
+ public int describeContents() {
+ return 0;
+ }
+
+ @Override
+ public void writeToParcel(final Parcel dest, final int flags) {
+ if (mQosFilter instanceof QosSocketFilter) {
+ dest.writeInt(QOS_SOCKET_FILTER);
+ final QosSocketFilter qosSocketFilter = (QosSocketFilter) mQosFilter;
+ qosSocketFilter.getQosSocketInfo().writeToParcel(dest, 0);
+ return;
+ }
+ dest.writeInt(NO_FILTER_PRESENT);
+ Log.e(LOG_TAG, "Parceling failed, unknown type of filter present: " + mQosFilter);
+ }
+}
diff --git a/core/java/android/net/QosSession.aidl b/core/java/android/net/QosSession.aidl
new file mode 100644
index 000000000000..c2cf36624b55
--- /dev/null
+++ b/core/java/android/net/QosSession.aidl
@@ -0,0 +1,21 @@
+/*
+**
+** Copyright (C) 2020 The Android Open Source Project
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+**
+** http://www.apache.org/licenses/LICENSE-2.0
+**
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+*/
+
+package android.net;
+
+parcelable QosSession;
+
diff --git a/core/java/android/net/QosSession.java b/core/java/android/net/QosSession.java
new file mode 100644
index 000000000000..4f3bb77c5877
--- /dev/null
+++ b/core/java/android/net/QosSession.java
@@ -0,0 +1,136 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.net;
+
+import android.annotation.IntDef;
+import android.annotation.NonNull;
+import android.annotation.SystemApi;
+import android.os.Parcel;
+import android.os.Parcelable;
+
+/**
+ * Provides identifying information of a QoS session. Sent to an application through
+ * {@link QosCallback}.
+ *
+ * @hide
+ */
+@SystemApi
+public final class QosSession implements Parcelable {
+
+ /**
+ * The {@link QosSession} is a LTE EPS Session.
+ */
+ public static final int TYPE_EPS_BEARER = 1;
+
+ private final int mSessionId;
+
+ private final int mSessionType;
+
+ /**
+ * Gets the unique id of the session that is used to differentiate sessions across different
+ * types.
+ * <p/>
+ * Note: Different qos sessions can be provided by different actors.
+ *
+ * @return the unique id
+ */
+ public long getUniqueId() {
+ return (long) mSessionType << 32 | mSessionId;
+ }
+
+ /**
+ * Gets the session id that is unique within that type.
+ * <p/>
+ * Note: The session id is set by the actor providing the qos. It can be either manufactured by
+ * the actor, but also may have a particular meaning within that type. For example, using the
+ * bearer id as the session id for {@link android.telephony.data.EpsBearerQosSessionAttributes}
+ * is a straight forward way to keep the sessions unique from one another within that type.
+ *
+ * @return the id of the session
+ */
+ public int getSessionId() {
+ return mSessionId;
+ }
+
+ /**
+ * Gets the type of session.
+ */
+ @QosSessionType
+ public int getSessionType() {
+ return mSessionType;
+ }
+
+ /**
+ * Creates a {@link QosSession}.
+ *
+ * @param sessionId uniquely identifies the session across all sessions of the same type
+ * @param sessionType the type of session
+ */
+ public QosSession(final int sessionId, @QosSessionType final int sessionType) {
+ //Ensures the session id is unique across types of sessions
+ mSessionId = sessionId;
+ mSessionType = sessionType;
+ }
+
+
+ @Override
+ public String toString() {
+ return "QosSession{"
+ + "mSessionId=" + mSessionId
+ + ", mSessionType=" + mSessionType
+ + '}';
+ }
+
+ /**
+ * Annotations for types of qos sessions.
+ */
+ @IntDef(value = {
+ TYPE_EPS_BEARER,
+ })
+ @interface QosSessionType {}
+
+ private QosSession(final Parcel in) {
+ mSessionId = in.readInt();
+ mSessionType = in.readInt();
+ }
+
+ @NonNull
+ public static final Creator<QosSession> CREATOR = new Creator<QosSession>() {
+ @NonNull
+ @Override
+ public QosSession createFromParcel(@NonNull final Parcel in) {
+ return new QosSession(in);
+ }
+
+ @NonNull
+ @Override
+ public QosSession[] newArray(final int size) {
+ return new QosSession[size];
+ }
+ };
+
+ @Override
+ public int describeContents() {
+ return 0;
+ }
+
+ @Override
+ public void writeToParcel(@NonNull final Parcel dest, final int flags) {
+ dest.writeInt(mSessionId);
+ dest.writeInt(mSessionType);
+ }
+}
diff --git a/core/java/android/net/QosSessionAttributes.java b/core/java/android/net/QosSessionAttributes.java
new file mode 100644
index 000000000000..7a885942d1b5
--- /dev/null
+++ b/core/java/android/net/QosSessionAttributes.java
@@ -0,0 +1,30 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.net;
+
+import android.annotation.SystemApi;
+
+/**
+ * Implemented by classes that encapsulate Qos related attributes that describe a Qos Session.
+ *
+ * Use the instanceof keyword to determine the underlying type.
+ *
+ * @hide
+ */
+@SystemApi
+public interface QosSessionAttributes {
+}
diff --git a/core/java/android/net/QosSocketFilter.java b/core/java/android/net/QosSocketFilter.java
new file mode 100644
index 000000000000..2080e68f5fba
--- /dev/null
+++ b/core/java/android/net/QosSocketFilter.java
@@ -0,0 +1,166 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.net;
+
+import static android.net.QosCallbackException.EX_TYPE_FILTER_NONE;
+import static android.net.QosCallbackException.EX_TYPE_FILTER_SOCKET_LOCAL_ADDRESS_CHANGED;
+
+import android.annotation.NonNull;
+import android.annotation.Nullable;
+import android.os.ParcelFileDescriptor;
+import android.system.ErrnoException;
+import android.system.Os;
+import android.util.Log;
+
+import com.android.internal.annotations.VisibleForTesting;
+
+import java.io.FileDescriptor;
+import java.net.InetAddress;
+import java.net.InetSocketAddress;
+import java.net.Socket;
+import java.net.SocketAddress;
+import java.util.Objects;
+
+/**
+ * Filters a {@link QosSession} according to the binding on the provided {@link Socket}.
+ *
+ * @hide
+ */
+public class QosSocketFilter extends QosFilter {
+
+ private static final String TAG = QosSocketFilter.class.getSimpleName();
+
+ @NonNull
+ private final QosSocketInfo mQosSocketInfo;
+
+ /**
+ * Creates a {@link QosSocketFilter} based off of {@link QosSocketInfo}.
+ *
+ * @param qosSocketInfo the information required to filter and validate
+ */
+ public QosSocketFilter(@NonNull final QosSocketInfo qosSocketInfo) {
+ Objects.requireNonNull(qosSocketInfo, "qosSocketInfo must be non-null");
+ mQosSocketInfo = qosSocketInfo;
+ }
+
+ /**
+ * Gets the parcelable qos socket info that was used to create the filter.
+ */
+ @NonNull
+ public QosSocketInfo getQosSocketInfo() {
+ return mQosSocketInfo;
+ }
+
+ /**
+ * Performs two validations:
+ * 1. If the socket is not bound, then return
+ * {@link QosCallbackException.EX_TYPE_FILTER_SOCKET_NOT_BOUND}. This is detected
+ * by checking the local address on the filter which becomes null when the socket is no
+ * longer bound.
+ * 2. In the scenario that the socket is now bound to a different local address, which can
+ * happen in the case of UDP, then
+ * {@link QosCallbackException.EX_TYPE_FILTER_SOCKET_LOCAL_ADDRESS_CHANGED} is returned.
+ * @return validation error code
+ */
+ @Override
+ public int validate() {
+ final InetSocketAddress sa = getAddressFromFileDescriptor();
+ if (sa == null) {
+ return QosCallbackException.EX_TYPE_FILTER_SOCKET_NOT_BOUND;
+ }
+
+ if (!sa.equals(mQosSocketInfo.getLocalSocketAddress())) {
+ return EX_TYPE_FILTER_SOCKET_LOCAL_ADDRESS_CHANGED;
+ }
+
+ return EX_TYPE_FILTER_NONE;
+ }
+
+ /**
+ * The local address of the socket's binding.
+ *
+ * Note: If the socket is no longer bound, null is returned.
+ *
+ * @return the local address
+ */
+ @Nullable
+ private InetSocketAddress getAddressFromFileDescriptor() {
+ final ParcelFileDescriptor parcelFileDescriptor = mQosSocketInfo.getParcelFileDescriptor();
+ if (parcelFileDescriptor == null) return null;
+
+ final FileDescriptor fd = parcelFileDescriptor.getFileDescriptor();
+ if (fd == null) return null;
+
+ final SocketAddress address;
+ try {
+ address = Os.getsockname(fd);
+ } catch (final ErrnoException e) {
+ Log.e(TAG, "getAddressFromFileDescriptor: getLocalAddress exception", e);
+ return null;
+ }
+ if (address instanceof InetSocketAddress) {
+ return (InetSocketAddress) address;
+ }
+ return null;
+ }
+
+ /**
+ * The network used with this filter.
+ *
+ * @return the registered {@link Network}
+ */
+ @NonNull
+ @Override
+ public Network getNetwork() {
+ return mQosSocketInfo.getNetwork();
+ }
+
+ /**
+ * @inheritDoc
+ */
+ @Override
+ public boolean matchesLocalAddress(@NonNull final InetAddress address, final int startPort,
+ final int endPort) {
+ if (mQosSocketInfo.getLocalSocketAddress() == null) {
+ return false;
+ }
+
+ return matchesLocalAddress(mQosSocketInfo.getLocalSocketAddress(), address, startPort,
+ endPort);
+ }
+
+ /**
+ * Called from {@link QosSocketFilter#matchesLocalAddress(InetAddress, int, int)} with the
+ * filterSocketAddress coming from {@link QosSocketInfo#getLocalSocketAddress()}.
+ * <p>
+ * This method exists for testing purposes since {@link QosSocketInfo} couldn't be mocked
+ * due to being final.
+ *
+ * @param filterSocketAddress the socket address of the filter
+ * @param address the address to compare the filterSocketAddressWith
+ * @param startPort the start of the port range to check
+ * @param endPort the end of the port range to check
+ */
+ @VisibleForTesting
+ public static boolean matchesLocalAddress(@NonNull final InetSocketAddress filterSocketAddress,
+ @NonNull final InetAddress address,
+ final int startPort, final int endPort) {
+ return startPort <= filterSocketAddress.getPort()
+ && endPort >= filterSocketAddress.getPort()
+ && filterSocketAddress.getAddress().equals(address);
+ }
+}
diff --git a/core/java/android/net/QosSocketInfo.aidl b/core/java/android/net/QosSocketInfo.aidl
new file mode 100644
index 000000000000..476c0900e23e
--- /dev/null
+++ b/core/java/android/net/QosSocketInfo.aidl
@@ -0,0 +1,21 @@
+/*
+**
+** Copyright (C) 2020 The Android Open Source Project
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+**
+** http://www.apache.org/licenses/LICENSE-2.0
+**
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+*/
+
+package android.net;
+
+parcelable QosSocketInfo;
+
diff --git a/core/java/android/net/QosSocketInfo.java b/core/java/android/net/QosSocketInfo.java
new file mode 100644
index 000000000000..d37c4691ddde
--- /dev/null
+++ b/core/java/android/net/QosSocketInfo.java
@@ -0,0 +1,154 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.net;
+
+import android.annotation.NonNull;
+import android.annotation.SystemApi;
+import android.os.Parcel;
+import android.os.ParcelFileDescriptor;
+import android.os.Parcelable;
+
+import java.io.IOException;
+import java.net.InetAddress;
+import java.net.InetSocketAddress;
+import java.net.Socket;
+import java.net.UnknownHostException;
+import java.util.Objects;
+
+/**
+ * Used in conjunction with
+ * {@link ConnectivityManager#registerQosCallback}
+ * in order to receive Qos Sessions related to the local address and port of a bound {@link Socket}.
+ *
+ * @hide
+ */
+@SystemApi
+public final class QosSocketInfo implements Parcelable {
+
+ @NonNull
+ private final Network mNetwork;
+
+ @NonNull
+ private final ParcelFileDescriptor mParcelFileDescriptor;
+
+ @NonNull
+ private final InetSocketAddress mLocalSocketAddress;
+
+ /**
+ * The {@link Network} the socket is on.
+ *
+ * @return the registered {@link Network}
+ */
+ @NonNull
+ public Network getNetwork() {
+ return mNetwork;
+ }
+
+ /**
+ * The parcel file descriptor wrapped around the socket's file descriptor.
+ *
+ * @return the parcel file descriptor of the socket
+ */
+ @NonNull
+ ParcelFileDescriptor getParcelFileDescriptor() {
+ return mParcelFileDescriptor;
+ }
+
+ /**
+ * The local address of the socket passed into {@link QosSocketInfo(Network, Socket)}.
+ * The value does not reflect any changes that occur to the socket after it is first set
+ * in the constructor.
+ *
+ * @return the local address of the socket
+ */
+ @NonNull
+ public InetSocketAddress getLocalSocketAddress() {
+ return mLocalSocketAddress;
+ }
+
+ /**
+ * Creates a {@link QosSocketInfo} given a {@link Network} and bound {@link Socket}. The
+ * {@link Socket} must remain bound in order to receive {@link QosSession}s.
+ *
+ * @param network the network
+ * @param socket the bound {@link Socket}
+ */
+ public QosSocketInfo(@NonNull final Network network, @NonNull final Socket socket)
+ throws IOException {
+ Objects.requireNonNull(socket, "socket cannot be null");
+
+ mNetwork = Objects.requireNonNull(network, "network cannot be null");
+ mParcelFileDescriptor = ParcelFileDescriptor.dup(socket.getFileDescriptor$());
+ mLocalSocketAddress =
+ new InetSocketAddress(socket.getLocalAddress(), socket.getLocalPort());
+ }
+
+ /* Parcelable methods */
+ private QosSocketInfo(final Parcel in) {
+ mNetwork = Objects.requireNonNull(Network.CREATOR.createFromParcel(in));
+ mParcelFileDescriptor = ParcelFileDescriptor.CREATOR.createFromParcel(in);
+
+ final int addressLength = in.readInt();
+ mLocalSocketAddress = readSocketAddress(in, addressLength);
+ }
+
+ private InetSocketAddress readSocketAddress(final Parcel in, final int addressLength) {
+ final byte[] address = new byte[addressLength];
+ in.readByteArray(address);
+ final int port = in.readInt();
+
+ try {
+ return new InetSocketAddress(InetAddress.getByAddress(address), port);
+ } catch (final UnknownHostException e) {
+ /* The catch block was purposely left empty. UnknownHostException will never be thrown
+ since the address provided is numeric and non-null. */
+ }
+ return new InetSocketAddress();
+ }
+
+ @Override
+ public int describeContents() {
+ return 0;
+ }
+
+ @Override
+ public void writeToParcel(@NonNull final Parcel dest, final int flags) {
+ mNetwork.writeToParcel(dest, 0);
+ mParcelFileDescriptor.writeToParcel(dest, 0);
+
+ final byte[] address = mLocalSocketAddress.getAddress().getAddress();
+ dest.writeInt(address.length);
+ dest.writeByteArray(address);
+ dest.writeInt(mLocalSocketAddress.getPort());
+ }
+
+ @NonNull
+ public static final Parcelable.Creator<QosSocketInfo> CREATOR =
+ new Parcelable.Creator<QosSocketInfo>() {
+ @NonNull
+ @Override
+ public QosSocketInfo createFromParcel(final Parcel in) {
+ return new QosSocketInfo(in);
+ }
+
+ @NonNull
+ @Override
+ public QosSocketInfo[] newArray(final int size) {
+ return new QosSocketInfo[size];
+ }
+ };
+}
diff --git a/core/java/android/net/SocketLocalAddressChangedException.java b/core/java/android/net/SocketLocalAddressChangedException.java
new file mode 100644
index 000000000000..9daad83fd13e
--- /dev/null
+++ b/core/java/android/net/SocketLocalAddressChangedException.java
@@ -0,0 +1,32 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.net;
+
+import android.annotation.SystemApi;
+
+/**
+ * Thrown when the local address of the socket has changed.
+ *
+ * @hide
+ */
+@SystemApi
+public class SocketLocalAddressChangedException extends Exception {
+ /** @hide */
+ public SocketLocalAddressChangedException() {
+ super("The local address of the socket changed");
+ }
+}
diff --git a/core/java/android/net/SocketNotBoundException.java b/core/java/android/net/SocketNotBoundException.java
new file mode 100644
index 000000000000..b1d7026ac981
--- /dev/null
+++ b/core/java/android/net/SocketNotBoundException.java
@@ -0,0 +1,32 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.net;
+
+import android.annotation.SystemApi;
+
+/**
+ * Thrown when a previously bound socket becomes unbound.
+ *
+ * @hide
+ */
+@SystemApi
+public class SocketNotBoundException extends Exception {
+ /** @hide */
+ public SocketNotBoundException() {
+ super("The socket is unbound");
+ }
+}
diff --git a/core/java/com/android/internal/net/VpnInfo.aidl b/core/java/android/net/VpnInfo.aidl
index 6fc97be4095b..8bcaa81f3992 100644
--- a/core/java/com/android/internal/net/VpnInfo.aidl
+++ b/core/java/android/net/VpnInfo.aidl
@@ -14,6 +14,6 @@
* limitations under the License.
*/
-package com.android.internal.net;
+package android.net;
parcelable VpnInfo;
diff --git a/core/java/com/android/internal/net/VpnInfo.java b/core/java/android/net/VpnInfo.java
index e74af5eb50de..cf58c570f21f 100644
--- a/core/java/com/android/internal/net/VpnInfo.java
+++ b/core/java/android/net/VpnInfo.java
@@ -11,11 +11,13 @@
* distributed under the License is distributed on an "AS IS" BASIS,
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
* See the License for the specific language governing permissions and
- * limitations under the License
+ * limitations under the License.
*/
-package com.android.internal.net;
+package android.net;
+import android.annotation.NonNull;
+import android.annotation.Nullable;
import android.os.Parcel;
import android.os.Parcelable;
@@ -23,14 +25,28 @@ import java.util.Arrays;
/**
* A lightweight container used to carry information of the ongoing VPN.
- * Internal use only..
+ * Internal use only.
*
* @hide
*/
public class VpnInfo implements Parcelable {
- public int ownerUid;
- public String vpnIface;
- public String[] underlyingIfaces;
+ public final int ownerUid;
+ @Nullable
+ public final String vpnIface;
+ @Nullable
+ public final String[] underlyingIfaces;
+
+ public VpnInfo(int ownerUid, @Nullable String vpnIface, @Nullable String[] underlyingIfaces) {
+ this.ownerUid = ownerUid;
+ this.vpnIface = vpnIface;
+ this.underlyingIfaces = underlyingIfaces;
+ }
+
+ private VpnInfo(@NonNull Parcel in) {
+ this.ownerUid = in.readInt();
+ this.vpnIface = in.readString();
+ this.underlyingIfaces = in.createStringArray();
+ }
@Override
public String toString() {
@@ -47,22 +63,21 @@ public class VpnInfo implements Parcelable {
}
@Override
- public void writeToParcel(Parcel dest, int flags) {
+ public void writeToParcel(@NonNull Parcel dest, int flags) {
dest.writeInt(ownerUid);
dest.writeString(vpnIface);
dest.writeStringArray(underlyingIfaces);
}
+ @NonNull
public static final Parcelable.Creator<VpnInfo> CREATOR = new Parcelable.Creator<VpnInfo>() {
+ @NonNull
@Override
- public VpnInfo createFromParcel(Parcel source) {
- VpnInfo info = new VpnInfo();
- info.ownerUid = source.readInt();
- info.vpnIface = source.readString();
- info.underlyingIfaces = source.readStringArray();
- return info;
+ public VpnInfo createFromParcel(@NonNull Parcel in) {
+ return new VpnInfo(in);
}
+ @NonNull
@Override
public VpnInfo[] newArray(int size) {
return new VpnInfo[size];
diff --git a/core/java/android/net/vcn/VcnConfig.java b/core/java/android/net/vcn/VcnConfig.java
index ede8faaaf261..5eb4ba6a2f8e 100644
--- a/core/java/android/net/vcn/VcnConfig.java
+++ b/core/java/android/net/vcn/VcnConfig.java
@@ -96,7 +96,11 @@ public final class VcnConfig implements Parcelable {
return mPackageName;
}
- /** Retrieves the set of configured tunnels. */
+ /**
+ * Retrieves the set of configured tunnels.
+ *
+ * @hide
+ */
@NonNull
public Set<VcnGatewayConnectionConfig> getGatewayConnectionConfigs() {
return Collections.unmodifiableSet(mGatewayConnectionConfigs);
@@ -146,7 +150,7 @@ public final class VcnConfig implements Parcelable {
}
@Override
- public void writeToParcel(Parcel out, int flags) {
+ public void writeToParcel(@NonNull Parcel out, int flags) {
out.writeParcelable(toPersistableBundle(), flags);
}
@@ -164,8 +168,12 @@ public final class VcnConfig implements Parcelable {
}
};
- /** This class is used to incrementally build {@link VcnConfig} objects. */
- public static class Builder {
+ /**
+ * This class is used to incrementally build {@link VcnConfig} objects.
+ *
+ * @hide
+ */
+ public static final class Builder {
@NonNull private final String mPackageName;
@NonNull
@@ -182,6 +190,7 @@ public final class VcnConfig implements Parcelable {
*
* @param gatewayConnectionConfig the configuration for an individual gateway connection
* @return this {@link Builder} instance, for chaining
+ * @hide
*/
@NonNull
public Builder addGatewayConnectionConfig(
@@ -196,6 +205,7 @@ public final class VcnConfig implements Parcelable {
* Builds and validates the VcnConfig.
*
* @return an immutable VcnConfig instance
+ * @hide
*/
@NonNull
public VcnConfig build() {
diff --git a/core/java/android/net/vcn/VcnGatewayConnectionConfig.java b/core/java/android/net/vcn/VcnGatewayConnectionConfig.java
index d531cdb2a6e9..cead2f1caad1 100644
--- a/core/java/android/net/vcn/VcnGatewayConnectionConfig.java
+++ b/core/java/android/net/vcn/VcnGatewayConnectionConfig.java
@@ -17,6 +17,7 @@ package android.net.vcn;
import static com.android.internal.annotations.VisibleForTesting.Visibility;
+import android.annotation.IntDef;
import android.annotation.IntRange;
import android.annotation.NonNull;
import android.annotation.Nullable;
@@ -25,14 +26,19 @@ import android.os.PersistableBundle;
import android.util.ArraySet;
import com.android.internal.annotations.VisibleForTesting;
+import com.android.internal.util.ArrayUtils;
import com.android.internal.util.Preconditions;
import com.android.server.vcn.util.PersistableBundleUtils;
+import java.lang.annotation.Retention;
+import java.lang.annotation.RetentionPolicy;
import java.util.ArrayList;
import java.util.Arrays;
import java.util.Collections;
import java.util.Objects;
import java.util.Set;
+import java.util.SortedSet;
+import java.util.TreeSet;
import java.util.concurrent.TimeUnit;
/**
@@ -97,6 +103,26 @@ public final class VcnGatewayConnectionConfig {
ALLOWED_CAPABILITIES = Collections.unmodifiableSet(allowedCaps);
}
+ /** @hide */
+ @Retention(RetentionPolicy.SOURCE)
+ @IntDef(
+ prefix = {"NET_CAPABILITY_"},
+ value = {
+ NetworkCapabilities.NET_CAPABILITY_MMS,
+ NetworkCapabilities.NET_CAPABILITY_SUPL,
+ NetworkCapabilities.NET_CAPABILITY_DUN,
+ NetworkCapabilities.NET_CAPABILITY_FOTA,
+ NetworkCapabilities.NET_CAPABILITY_IMS,
+ NetworkCapabilities.NET_CAPABILITY_CBS,
+ NetworkCapabilities.NET_CAPABILITY_IA,
+ NetworkCapabilities.NET_CAPABILITY_RCS,
+ NetworkCapabilities.NET_CAPABILITY_XCAP,
+ NetworkCapabilities.NET_CAPABILITY_EIMS,
+ NetworkCapabilities.NET_CAPABILITY_INTERNET,
+ NetworkCapabilities.NET_CAPABILITY_MCX,
+ })
+ public @interface VcnSupportedCapability {}
+
private static final int DEFAULT_MAX_MTU = 1500;
/**
@@ -128,10 +154,10 @@ public final class VcnGatewayConnectionConfig {
};
private static final String EXPOSED_CAPABILITIES_KEY = "mExposedCapabilities";
- @NonNull private final Set<Integer> mExposedCapabilities;
+ @NonNull private final SortedSet<Integer> mExposedCapabilities;
private static final String UNDERLYING_CAPABILITIES_KEY = "mUnderlyingCapabilities";
- @NonNull private final Set<Integer> mUnderlyingCapabilities;
+ @NonNull private final SortedSet<Integer> mUnderlyingCapabilities;
// TODO: Add Ike/ChildSessionParams as a subclass - maybe VcnIkeGatewayConnectionConfig
@@ -141,14 +167,14 @@ public final class VcnGatewayConnectionConfig {
private static final String RETRY_INTERVAL_MS_KEY = "mRetryIntervalsMs";
@NonNull private final long[] mRetryIntervalsMs;
- @VisibleForTesting(visibility = Visibility.PRIVATE)
- public VcnGatewayConnectionConfig(
+ /** Builds a VcnGatewayConnectionConfig with the specified parameters. */
+ private VcnGatewayConnectionConfig(
@NonNull Set<Integer> exposedCapabilities,
@NonNull Set<Integer> underlyingCapabilities,
@NonNull long[] retryIntervalsMs,
@IntRange(from = MIN_MTU_V6) int maxMtu) {
- mExposedCapabilities = exposedCapabilities;
- mUnderlyingCapabilities = underlyingCapabilities;
+ mExposedCapabilities = new TreeSet(exposedCapabilities);
+ mUnderlyingCapabilities = new TreeSet(underlyingCapabilities);
mRetryIntervalsMs = retryIntervalsMs;
mMaxMtu = maxMtu;
@@ -163,9 +189,9 @@ public final class VcnGatewayConnectionConfig {
final PersistableBundle underlyingCapsBundle =
in.getPersistableBundle(UNDERLYING_CAPABILITIES_KEY);
- mExposedCapabilities = new ArraySet<>(PersistableBundleUtils.toList(
+ mExposedCapabilities = new TreeSet<>(PersistableBundleUtils.toList(
exposedCapsBundle, PersistableBundleUtils.INTEGER_DESERIALIZER));
- mUnderlyingCapabilities = new ArraySet<>(PersistableBundleUtils.toList(
+ mUnderlyingCapabilities = new TreeSet<>(PersistableBundleUtils.toList(
underlyingCapsBundle, PersistableBundleUtils.INTEGER_DESERIALIZER));
mRetryIntervalsMs = in.getLongArray(RETRY_INTERVAL_MS_KEY);
mMaxMtu = in.getInt(MAX_MTU_KEY);
@@ -219,52 +245,93 @@ public final class VcnGatewayConnectionConfig {
/**
* Returns all exposed capabilities.
*
+ * <p>The returned integer-value capabilities will not contain duplicates, and will be sorted in
+ * ascending numerical order.
+ *
+ * @see Builder#addExposedCapability(int)
+ * @see Builder#clearExposedCapability(int)
* @hide
*/
@NonNull
+ public int[] getExposedCapabilities() {
+ // Sorted set guarantees ordering
+ return ArrayUtils.convertToIntArray(new ArrayList<>(mExposedCapabilities));
+ }
+
+ /**
+ * Returns all exposed capabilities.
+ *
+ * <p>Left to prevent the need to make major changes while changes are actively in flight.
+ *
+ * @deprecated use getExposedCapabilities() instead
+ * @hide
+ */
+ @Deprecated
+ @NonNull
public Set<Integer> getAllExposedCapabilities() {
return Collections.unmodifiableSet(mExposedCapabilities);
}
/**
- * Checks if this config is configured to support/expose a specific capability.
+ * Returns all capabilities required of underlying networks.
*
- * @param capability the capability to check for
+ * <p>The returned integer-value capabilities will be sorted in ascending numerical order.
+ *
+ * @see Builder#addRequiredUnderlyingCapability(int)
+ * @see Builder#clearRequiredUnderlyingCapability(int)
+ * @hide
*/
- public boolean hasExposedCapability(int capability) {
- checkValidCapability(capability);
-
- return mExposedCapabilities.contains(capability);
+ @NonNull
+ public int[] getRequiredUnderlyingCapabilities() {
+ // Sorted set guarantees ordering
+ return ArrayUtils.convertToIntArray(new ArrayList<>(mUnderlyingCapabilities));
}
/**
* Returns all capabilities required of underlying networks.
*
+ * <p>Left to prevent the need to make major changes while changes are actively in flight.
+ *
+ * @deprecated use getRequiredUnderlyingCapabilities() instead
* @hide
*/
+ @Deprecated
@NonNull
public Set<Integer> getAllUnderlyingCapabilities() {
return Collections.unmodifiableSet(mUnderlyingCapabilities);
}
/**
- * Checks if this config requires an underlying network to have the specified capability.
+ * Retrieves the configured retry intervals.
*
- * @param capability the capability to check for
+ * @see Builder#setRetryInterval(long[])
+ * @hide
*/
- public boolean requiresUnderlyingCapability(int capability) {
- checkValidCapability(capability);
-
- return mUnderlyingCapabilities.contains(capability);
+ @NonNull
+ public long[] getRetryInterval() {
+ return Arrays.copyOf(mRetryIntervalsMs, mRetryIntervalsMs.length);
}
- /** Retrieves the configured retry intervals. */
+ /**
+ * Retrieves the configured retry intervals.
+ *
+ * <p>Left to prevent the need to make major changes while changes are actively in flight.
+ *
+ * @deprecated use getRequiredUnderlyingCapabilities() instead
+ * @hide
+ */
+ @Deprecated
@NonNull
public long[] getRetryIntervalsMs() {
- return Arrays.copyOf(mRetryIntervalsMs, mRetryIntervalsMs.length);
+ return getRetryInterval();
}
- /** Retrieves the maximum MTU allowed for this Gateway Connection. */
+ /**
+ * Retrieves the maximum MTU allowed for this Gateway Connection.
+ *
+ * @see Builder.setMaxMtu(int)
+ * @hide
+ */
@IntRange(from = MIN_MTU_V6)
public int getMaxMtu() {
return mMaxMtu;
@@ -319,8 +386,12 @@ public final class VcnGatewayConnectionConfig {
&& mMaxMtu == rhs.mMaxMtu;
}
- /** This class is used to incrementally build {@link VcnGatewayConnectionConfig} objects. */
- public static class Builder {
+ /**
+ * This class is used to incrementally build {@link VcnGatewayConnectionConfig} objects.
+ *
+ * @hide
+ */
+ public static final class Builder {
@NonNull private final Set<Integer> mExposedCapabilities = new ArraySet();
@NonNull private final Set<Integer> mUnderlyingCapabilities = new ArraySet();
@NonNull private long[] mRetryIntervalsMs = DEFAULT_RETRY_INTERVALS_MS;
@@ -338,8 +409,10 @@ public final class VcnGatewayConnectionConfig {
* @return this {@link Builder} instance, for chaining
* @see VcnGatewayConnectionConfig for a list of capabilities may be exposed by a Gateway
* Connection
+ * @hide
*/
- public Builder addExposedCapability(int exposedCapability) {
+ @NonNull
+ public Builder addExposedCapability(@VcnSupportedCapability int exposedCapability) {
checkValidCapability(exposedCapability);
mExposedCapabilities.add(exposedCapability);
@@ -354,8 +427,10 @@ public final class VcnGatewayConnectionConfig {
* @return this {@link Builder} instance, for chaining
* @see VcnGatewayConnectionConfig for a list of capabilities may be exposed by a Gateway
* Connection
+ * @hide
*/
- public Builder removeExposedCapability(int exposedCapability) {
+ @NonNull
+ public Builder clearExposedCapability(@VcnSupportedCapability int exposedCapability) {
checkValidCapability(exposedCapability);
mExposedCapabilities.remove(exposedCapability);
@@ -370,8 +445,11 @@ public final class VcnGatewayConnectionConfig {
* @return this {@link Builder} instance, for chaining
* @see VcnGatewayConnectionConfig for a list of capabilities may be required of underlying
* networks
+ * @hide
*/
- public Builder addRequiredUnderlyingCapability(int underlyingCapability) {
+ @NonNull
+ public Builder addRequiredUnderlyingCapability(
+ @VcnSupportedCapability int underlyingCapability) {
checkValidCapability(underlyingCapability);
mUnderlyingCapabilities.add(underlyingCapability);
@@ -390,8 +468,11 @@ public final class VcnGatewayConnectionConfig {
* @return this {@link Builder} instance, for chaining
* @see VcnGatewayConnectionConfig for a list of capabilities may be required of underlying
* networks
+ * @hide
*/
- public Builder removeRequiredUnderlyingCapability(int underlyingCapability) {
+ @NonNull
+ public Builder clearRequiredUnderlyingCapability(
+ @VcnSupportedCapability int underlyingCapability) {
checkValidCapability(underlyingCapability);
mUnderlyingCapabilities.remove(underlyingCapability);
@@ -420,6 +501,7 @@ public final class VcnGatewayConnectionConfig {
* 15m]}
* @return this {@link Builder} instance, for chaining
* @see VcnManager for additional discussion on fail-safe mode
+ * @hide
*/
@NonNull
public Builder setRetryInterval(@NonNull long[] retryIntervalsMs) {
@@ -441,6 +523,7 @@ public final class VcnGatewayConnectionConfig {
* @param maxMtu the maximum MTU allowed for this Gateway Connection. Must be greater than
* the IPv6 minimum MTU of 1280. Defaults to 1500.
* @return this {@link Builder} instance, for chaining
+ * @hide
*/
@NonNull
public Builder setMaxMtu(@IntRange(from = MIN_MTU_V6) int maxMtu) {
@@ -455,6 +538,7 @@ public final class VcnGatewayConnectionConfig {
* Builds and validates the VcnGatewayConnectionConfig.
*
* @return an immutable VcnGatewayConnectionConfig instance
+ * @hide
*/
@NonNull
public VcnGatewayConnectionConfig build() {
diff --git a/core/java/android/net/vcn/VcnManager.java b/core/java/android/net/vcn/VcnManager.java
index 2ccdc2633af0..2d0a6d74cb86 100644
--- a/core/java/android/net/vcn/VcnManager.java
+++ b/core/java/android/net/vcn/VcnManager.java
@@ -65,6 +65,7 @@ import java.util.concurrent.Executor;
public final class VcnManager {
@NonNull private static final String TAG = VcnManager.class.getSimpleName();
+ /** @hide */
@VisibleForTesting
public static final Map<
VcnUnderlyingNetworkPolicyListener, VcnUnderlyingNetworkPolicyListenerBinder>
diff --git a/core/java/android/os/Build.java b/core/java/android/os/Build.java
index 0d8769e7635c..10761187d969 100755
--- a/core/java/android/os/Build.java
+++ b/core/java/android/os/Build.java
@@ -317,6 +317,7 @@ public class Build {
* @see #SDK_INT
* @hide
*/
+ @SystemApi(client = SystemApi.Client.MODULE_LIBRARIES)
@TestApi
public static final int FIRST_SDK_INT = SystemProperties
.getInt("ro.product.first_api_level", 0);
diff --git a/core/java/android/os/storage/OWNERS b/core/java/android/os/storage/OWNERS
index 8af7de597294..ff126e12cf61 100644
--- a/core/java/android/os/storage/OWNERS
+++ b/core/java/android/os/storage/OWNERS
@@ -1,7 +1,10 @@
# Bug component: 95221
-narayan@google.com
-nandana@google.com
corinac@google.com
+nandana@google.com
zezeozue@google.com
maco@google.com
+sahanas@google.com
+abkaur@google.com
+chiangi@google.com
+narayan@google.com
diff --git a/core/java/android/se/omapi/SEService.java b/core/java/android/se/omapi/SEService.java
index a5c5c613e1f2..333af91ac872 100644
--- a/core/java/android/se/omapi/SEService.java
+++ b/core/java/android/se/omapi/SEService.java
@@ -22,7 +22,10 @@
package android.se.omapi;
+import android.annotation.BroadcastBehavior;
import android.annotation.NonNull;
+import android.annotation.SdkConstant;
+import android.annotation.SdkConstant.SdkConstantType;
import android.content.ComponentName;
import android.content.Context;
import android.content.Intent;
@@ -71,6 +74,28 @@ public final class SEService {
}
/**
+ * Broadcast Action: Intent to notify if the secure element state is changed.
+ */
+ @SdkConstant(SdkConstantType.BROADCAST_INTENT_ACTION)
+ @BroadcastBehavior(registeredOnly = true, protectedBroadcast = true)
+ public static final String ACTION_SECURE_ELEMENT_STATE_CHANGED =
+ "android.se.omapi.action.SECURE_ELEMENT_STATE_CHANGED";
+
+ /**
+ * Mandatory extra containing the reader name of the state changed secure element.
+ *
+ * @see Reader#getName()
+ */
+ public static final String EXTRA_READER_NAME = "android.se.omapi.extra.READER_NAME";
+
+ /**
+ * Mandatory extra containing the connected state of the state changed secure element.
+ *
+ * True if the secure element is connected correctly, false otherwise.
+ */
+ public static final String EXTRA_READER_STATE = "android.se.omapi.extra.READER_STATE";
+
+ /**
* Listener object that allows the notification of the caller if this
* SEService could be bound to the backend.
*/
diff --git a/core/java/android/service/resumeonreboot/IResumeOnRebootService.aidl b/core/java/android/service/resumeonreboot/IResumeOnRebootService.aidl
new file mode 100644
index 000000000000..d9b403ca0609
--- /dev/null
+++ b/core/java/android/service/resumeonreboot/IResumeOnRebootService.aidl
@@ -0,0 +1,25 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.service.resumeonreboot;
+
+import android.os.RemoteCallback;
+
+/** @hide */
+interface IResumeOnRebootService {
+ oneway void wrapSecret(in byte[] unwrappedBlob, in long lifeTimeInMillis, in RemoteCallback resultCallback);
+ oneway void unwrap(in byte[] wrappedBlob, in RemoteCallback resultCallback);
+} \ No newline at end of file
diff --git a/core/java/android/service/resumeonreboot/ResumeOnRebootService.java b/core/java/android/service/resumeonreboot/ResumeOnRebootService.java
new file mode 100644
index 000000000000..4ebaa96f4be2
--- /dev/null
+++ b/core/java/android/service/resumeonreboot/ResumeOnRebootService.java
@@ -0,0 +1,164 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.service.resumeonreboot;
+
+import android.annotation.DurationMillisLong;
+import android.annotation.NonNull;
+import android.annotation.Nullable;
+import android.annotation.SdkConstant;
+import android.annotation.SystemApi;
+import android.app.Service;
+import android.content.Intent;
+import android.os.Bundle;
+import android.os.Handler;
+import android.os.IBinder;
+import android.os.ParcelableException;
+import android.os.RemoteCallback;
+import android.os.RemoteException;
+
+import com.android.internal.os.BackgroundThread;
+
+import java.io.IOException;
+
+/**
+ * Base class for service that provides wrapping/unwrapping of the opaque blob needed for
+ * ResumeOnReboot operation. The package needs to provide a wrap/unwrap implementation for handling
+ * the opaque blob, that's secure even when on device keystore and clock is compromised. This can
+ * be achieved by using tamper-resistant hardware such as a secure element with a secure clock, or
+ * using a remote server to store and retrieve data and manage timing.
+ *
+ * <p>To extend this class, you must declare the service in your manifest file with the
+ * {@link android.Manifest.permission#BIND_RESUME_ON_REBOOT_SERVICE} permission,
+ * include an intent filter with the {@link #SERVICE_INTERFACE} action and mark the service as
+ * direct-boot aware. In addition, the package that contains the service must be granted
+ * {@link android.Manifest.permission#BIND_RESUME_ON_REBOOT_SERVICE}.
+ * For example:</p>
+ * <pre>
+ * &lt;service android:name=".FooResumeOnRebootService"
+ * android:exported="true"
+ * android:priority="100"
+ * android:directBootAware="true"
+ * android:permission="android.permission.BIND_RESUME_ON_REBOOT_SERVICE"&gt;
+ * &lt;intent-filter&gt;
+ * &lt;action android:name="android.service.resumeonreboot.ResumeOnRebootService" /&gt;
+ * &lt;/intent-filter&gt;
+ * &lt;/service&gt;
+ * </pre>
+ *
+ * //TODO: Replace this with public link when available.
+ *
+ * @hide
+ * @see
+ * <a href="https://goto.google.com/server-based-ror">https://goto.google.com/server-based-ror</a>
+ */
+@SystemApi
+public abstract class ResumeOnRebootService extends Service {
+
+ /**
+ * The intent that the service must respond to. Add it to the intent filter of the service.
+ */
+ @SdkConstant(SdkConstant.SdkConstantType.SERVICE_ACTION)
+ public static final String SERVICE_INTERFACE =
+ "android.service.resumeonreboot.ResumeOnRebootService";
+ /** @hide */
+ public static final String UNWRAPPED_BLOB_KEY = "unrwapped_blob_key";
+ /** @hide */
+ public static final String WRAPPED_BLOB_KEY = "wrapped_blob_key";
+ /** @hide */
+ public static final String EXCEPTION_KEY = "exception_key";
+
+ private final Handler mHandler = BackgroundThread.getHandler();
+
+ /**
+ * Implementation for wrapping the opaque blob used for resume-on-reboot prior to
+ * reboot. The service should not assume any structure of the blob to be wrapped. The
+ * implementation should wrap the opaque blob in a reasonable time or throw {@link IOException}
+ * if it's unable to complete the action.
+ *
+ * @param blob The opaque blob with size on the order of 100 bytes.
+ * @param lifeTimeInMillis The life time of the blob. This must be strictly enforced by the
+ * implementation and any attempt to unWrap the wrapped blob returned by
+ * this function after expiration should
+ * fail.
+ * @return Wrapped blob to be persisted across reboot with size on the order of 100 bytes.
+ * @throws IOException if the implementation is unable to wrap the blob successfully.
+ */
+ @NonNull
+ public abstract byte[] onWrap(@NonNull byte[] blob, @DurationMillisLong long lifeTimeInMillis)
+ throws IOException;
+
+ /**
+ * Implementation for unwrapping the wrapped blob used for resume-on-reboot after reboot. This
+ * operation would happen after reboot during direct boot mode (i.e before device is unlocked
+ * for the first time). The implementation should unwrap the wrapped blob in a reasonable time
+ * and returns the result or throw {@link IOException} if it's unable to complete the action
+ * and {@link IllegalArgumentException} if {@code unwrapBlob} fails because the wrappedBlob is
+ * stale.
+ *
+ * @param wrappedBlob The wrapped blob with size on the order of 100 bytes.
+ * @return Unwrapped blob used for resume-on-reboot with the size on the order of 100 bytes.
+ * @throws IOException if the implementation is unable to unwrap the wrapped blob successfully.
+ */
+ @NonNull
+ public abstract byte[] onUnwrap(@NonNull byte[] wrappedBlob) throws IOException;
+
+ private final android.service.resumeonreboot.IResumeOnRebootService mInterface =
+ new android.service.resumeonreboot.IResumeOnRebootService.Stub() {
+
+ @Override
+ public void wrapSecret(byte[] unwrappedBlob,
+ @DurationMillisLong long lifeTimeInMillis,
+ RemoteCallback resultCallback) throws RemoteException {
+ mHandler.post(() -> {
+ try {
+ byte[] wrappedBlob = onWrap(unwrappedBlob,
+ lifeTimeInMillis);
+ Bundle bundle = new Bundle();
+ bundle.putByteArray(WRAPPED_BLOB_KEY, wrappedBlob);
+ resultCallback.sendResult(bundle);
+ } catch (Throwable e) {
+ Bundle bundle = new Bundle();
+ bundle.putParcelable(EXCEPTION_KEY, new ParcelableException(e));
+ resultCallback.sendResult(bundle);
+ }
+ });
+ }
+
+ @Override
+ public void unwrap(byte[] wrappedBlob, RemoteCallback resultCallback)
+ throws RemoteException {
+ mHandler.post(() -> {
+ try {
+ byte[] unwrappedBlob = onUnwrap(wrappedBlob);
+ Bundle bundle = new Bundle();
+ bundle.putByteArray(UNWRAPPED_BLOB_KEY, unwrappedBlob);
+ resultCallback.sendResult(bundle);
+ } catch (Throwable e) {
+ Bundle bundle = new Bundle();
+ bundle.putParcelable(EXCEPTION_KEY, new ParcelableException(e));
+ resultCallback.sendResult(bundle);
+ }
+ });
+ }
+ };
+
+ @Nullable
+ @Override
+ public IBinder onBind(@Nullable Intent intent) {
+ return mInterface.asBinder();
+ }
+}
diff --git a/core/java/android/util/FeatureFlagUtils.java b/core/java/android/util/FeatureFlagUtils.java
index 537498c44d5e..9d0ae30f1420 100644
--- a/core/java/android/util/FeatureFlagUtils.java
+++ b/core/java/android/util/FeatureFlagUtils.java
@@ -39,7 +39,6 @@ public class FeatureFlagUtils {
public static final String SEAMLESS_TRANSFER = "settings_seamless_transfer";
public static final String HEARING_AID_SETTINGS = "settings_bluetooth_hearing_aid";
public static final String SCREENRECORD_LONG_PRESS = "settings_screenrecord_long_press";
- public static final String DYNAMIC_SYSTEM = "settings_dynamic_system";
public static final String SETTINGS_WIFITRACKER2 = "settings_wifitracker2";
public static final String SETTINGS_FUSE_FLAG = "settings_fuse";
/** @hide */
@@ -53,7 +52,6 @@ public class FeatureFlagUtils {
DEFAULT_FLAGS.put("settings_audio_switcher", "true");
DEFAULT_FLAGS.put("settings_systemui_theme", "true");
DEFAULT_FLAGS.put(SETTINGS_FUSE_FLAG, "true");
- DEFAULT_FLAGS.put(DYNAMIC_SYSTEM, "false");
DEFAULT_FLAGS.put(SEAMLESS_TRANSFER, "false");
DEFAULT_FLAGS.put(HEARING_AID_SETTINGS, "false");
DEFAULT_FLAGS.put(SCREENRECORD_LONG_PRESS, "false");
diff --git a/core/java/android/util/OWNERS b/core/java/android/util/OWNERS
index 8f3d9f6f5881..14aa38682d2b 100644
--- a/core/java/android/util/OWNERS
+++ b/core/java/android/util/OWNERS
@@ -1,3 +1,6 @@
per-file FeatureFlagUtils.java = sbasi@google.com
per-file FeatureFlagUtils.java = tmfang@google.com
per-file FeatureFlagUtils.java = asapperstein@google.com
+
+per-file TypedValue.java = file:/core/java/android/content/res/OWNERS
+per-file AttributeSet.java = file:/core/java/android/content/res/OWNERS
diff --git a/core/java/android/uwb/AngleMeasurement.java b/core/java/android/uwb/AngleMeasurement.java
index 93b5fd4cd4b6..9df213b2092f 100644
--- a/core/java/android/uwb/AngleMeasurement.java
+++ b/core/java/android/uwb/AngleMeasurement.java
@@ -18,6 +18,7 @@ package android.uwb;
import android.annotation.FloatRange;
import android.annotation.NonNull;
+import android.annotation.SystemApi;
import android.os.Parcel;
import android.os.Parcelable;
@@ -31,6 +32,7 @@ import java.util.Objects;
*
* @hide
*/
+@SystemApi
public final class AngleMeasurement implements Parcelable {
private final double mRadians;
private final double mErrorRadians;
diff --git a/core/java/android/uwb/AngleOfArrivalMeasurement.java b/core/java/android/uwb/AngleOfArrivalMeasurement.java
index 20a1c7aa72d0..3d8626b98bed 100644
--- a/core/java/android/uwb/AngleOfArrivalMeasurement.java
+++ b/core/java/android/uwb/AngleOfArrivalMeasurement.java
@@ -18,6 +18,7 @@ package android.uwb;
import android.annotation.NonNull;
import android.annotation.Nullable;
+import android.annotation.SystemApi;
import android.os.Parcel;
import android.os.Parcelable;
@@ -28,6 +29,7 @@ import java.util.Objects;
*
* @hide
*/
+@SystemApi
public final class AngleOfArrivalMeasurement implements Parcelable {
private final AngleMeasurement mAzimuthAngleMeasurement;
private final AngleMeasurement mAltitudeAngleMeasurement;
@@ -53,7 +55,7 @@ public final class AngleOfArrivalMeasurement implements Parcelable {
* @return the azimuth {@link AngleMeasurement}
*/
@NonNull
- public AngleMeasurement getAzimuthAngleMeasurement() {
+ public AngleMeasurement getAzimuth() {
return mAzimuthAngleMeasurement;
}
@@ -70,7 +72,7 @@ public final class AngleOfArrivalMeasurement implements Parcelable {
* @return altitude {@link AngleMeasurement} or null when this is not available
*/
@Nullable
- public AngleMeasurement getAltitudeAngleMeasurement() {
+ public AngleMeasurement getAltitude() {
return mAltitudeAngleMeasurement;
}
@@ -85,8 +87,8 @@ public final class AngleOfArrivalMeasurement implements Parcelable {
if (obj instanceof AngleOfArrivalMeasurement) {
AngleOfArrivalMeasurement other = (AngleOfArrivalMeasurement) obj;
- return mAzimuthAngleMeasurement.equals(other.getAzimuthAngleMeasurement())
- && mAltitudeAngleMeasurement.equals(other.getAltitudeAngleMeasurement());
+ return mAzimuthAngleMeasurement.equals(other.getAzimuth())
+ && mAltitudeAngleMeasurement.equals(other.getAltitude());
}
return false;
}
@@ -116,11 +118,9 @@ public final class AngleOfArrivalMeasurement implements Parcelable {
public AngleOfArrivalMeasurement createFromParcel(Parcel in) {
Builder builder = new Builder();
- builder.setAzimuthAngleMeasurement(
- in.readParcelable(AngleMeasurement.class.getClassLoader()));
+ builder.setAzimuth(in.readParcelable(AngleMeasurement.class.getClassLoader()));
- builder.setAltitudeAngleMeasurement(
- in.readParcelable(AngleMeasurement.class.getClassLoader()));
+ builder.setAltitude(in.readParcelable(AngleMeasurement.class.getClassLoader()));
return builder.build();
}
@@ -144,7 +144,7 @@ public final class AngleOfArrivalMeasurement implements Parcelable {
* @param azimuthAngle azimuth angle
*/
@NonNull
- public Builder setAzimuthAngleMeasurement(@NonNull AngleMeasurement azimuthAngle) {
+ public Builder setAzimuth(@NonNull AngleMeasurement azimuthAngle) {
mAzimuthAngleMeasurement = azimuthAngle;
return this;
}
@@ -155,7 +155,7 @@ public final class AngleOfArrivalMeasurement implements Parcelable {
* @param altitudeAngle altitude angle
*/
@NonNull
- public Builder setAltitudeAngleMeasurement(@NonNull AngleMeasurement altitudeAngle) {
+ public Builder setAltitude(@NonNull AngleMeasurement altitudeAngle) {
mAltitudeAngleMeasurement = altitudeAngle;
return this;
}
diff --git a/core/java/android/uwb/DistanceMeasurement.java b/core/java/android/uwb/DistanceMeasurement.java
index 10c2172d5a6b..2a9bbdf3ec5d 100644
--- a/core/java/android/uwb/DistanceMeasurement.java
+++ b/core/java/android/uwb/DistanceMeasurement.java
@@ -19,6 +19,7 @@ package android.uwb;
import android.annotation.FloatRange;
import android.annotation.NonNull;
import android.annotation.Nullable;
+import android.annotation.SystemApi;
import android.os.Parcel;
import android.os.Parcelable;
@@ -32,6 +33,7 @@ import java.util.Objects;
*
* @hide
*/
+@SystemApi
public final class DistanceMeasurement implements Parcelable {
private final double mMeters;
private final double mErrorMeters;
diff --git a/core/java/android/uwb/RangingMeasurement.java b/core/java/android/uwb/RangingMeasurement.java
index 50e5f0d8d554..249e2b746d0d 100644
--- a/core/java/android/uwb/RangingMeasurement.java
+++ b/core/java/android/uwb/RangingMeasurement.java
@@ -20,6 +20,7 @@ import android.annotation.IntDef;
import android.annotation.NonNull;
import android.annotation.Nullable;
import android.annotation.SuppressLint;
+import android.annotation.SystemApi;
import android.os.Parcel;
import android.os.Parcelable;
import android.os.SystemClock;
@@ -33,6 +34,7 @@ import java.util.Objects;
*
* @hide
*/
+@SystemApi
public final class RangingMeasurement implements Parcelable {
private final UwbAddress mRemoteDeviceAddress;
private final @Status int mStatus;
diff --git a/core/java/android/uwb/RangingReport.java b/core/java/android/uwb/RangingReport.java
index 5b5f084914ab..7a2df8617700 100644
--- a/core/java/android/uwb/RangingReport.java
+++ b/core/java/android/uwb/RangingReport.java
@@ -18,6 +18,7 @@ package android.uwb;
import android.annotation.NonNull;
import android.annotation.Nullable;
+import android.annotation.SystemApi;
import android.os.Parcel;
import android.os.Parcelable;
@@ -30,6 +31,7 @@ import java.util.Objects;
*
* @hide
*/
+@SystemApi
public final class RangingReport implements Parcelable {
private final List<RangingMeasurement> mRangingMeasurements;
diff --git a/core/java/android/uwb/RangingSession.java b/core/java/android/uwb/RangingSession.java
index 0f87af415825..bfa8bf21ec6a 100644
--- a/core/java/android/uwb/RangingSession.java
+++ b/core/java/android/uwb/RangingSession.java
@@ -18,6 +18,7 @@ package android.uwb;
import android.annotation.IntDef;
import android.annotation.NonNull;
+import android.annotation.SystemApi;
import android.os.Binder;
import android.os.PersistableBundle;
import android.os.RemoteException;
@@ -42,6 +43,7 @@ import java.util.concurrent.Executor;
*
* @hide
*/
+@SystemApi
public final class RangingSession implements AutoCloseable {
private static final String TAG = "Uwb.RangingSession";
private final SessionHandle mSessionHandle;
diff --git a/core/java/android/uwb/UwbAddress.java b/core/java/android/uwb/UwbAddress.java
index b9523a307c42..22883be88760 100644
--- a/core/java/android/uwb/UwbAddress.java
+++ b/core/java/android/uwb/UwbAddress.java
@@ -18,6 +18,7 @@ package android.uwb;
import android.annotation.NonNull;
import android.annotation.Nullable;
+import android.annotation.SystemApi;
import android.os.Parcel;
import android.os.Parcelable;
@@ -28,6 +29,7 @@ import java.util.Arrays;
*
* @hide
*/
+@SystemApi
public final class UwbAddress implements Parcelable {
public static final int SHORT_ADDRESS_BYTE_LENGTH = 2;
public static final int EXTENDED_ADDRESS_BYTE_LENGTH = 8;
diff --git a/core/java/android/uwb/UwbManager.java b/core/java/android/uwb/UwbManager.java
index 15ee5b5f22eb..8adfe0601b14 100644
--- a/core/java/android/uwb/UwbManager.java
+++ b/core/java/android/uwb/UwbManager.java
@@ -20,6 +20,7 @@ import android.annotation.CallbackExecutor;
import android.annotation.IntDef;
import android.annotation.NonNull;
import android.annotation.SuppressLint;
+import android.annotation.SystemApi;
import android.annotation.SystemService;
import android.content.Context;
import android.os.IBinder;
@@ -44,6 +45,7 @@ import java.util.concurrent.Executor;
*
* @hide
*/
+@SystemApi
@SystemService(Context.UWB_SERVICE)
public final class UwbManager {
private IUwbAdapter mUwbAdapter;
diff --git a/core/java/com/android/internal/app/OWNERS b/core/java/com/android/internal/app/OWNERS
index c5a956a81d8d..99692d0736c2 100644
--- a/core/java/com/android/internal/app/OWNERS
+++ b/core/java/com/android/internal/app/OWNERS
@@ -3,3 +3,5 @@ per-file *Resolver* = file:/packages/SystemUI/OWNERS
per-file *Chooser* = file:/packages/SystemUI/OWNERS
per-file SimpleIconFactory.java = file:/packages/SystemUI/OWNERS
per-file NetInitiatedActivity.java = file:/location/java/android/location/OWNERS
+per-file IVoice* = file:/core/java/android/service/voice/OWNERS
+per-file *Hotword* = file:/core/java/android/service/voice/OWNERS
diff --git a/core/java/com/android/internal/graphics/fonts/OWNERS b/core/java/com/android/internal/graphics/fonts/OWNERS
new file mode 100644
index 000000000000..18486af9d12c
--- /dev/null
+++ b/core/java/com/android/internal/graphics/fonts/OWNERS
@@ -0,0 +1 @@
+include /graphics/java/android/graphics/fonts/OWNERS
diff --git a/core/jni/android_net_NetUtils.cpp b/core/jni/android_net_NetUtils.cpp
index 2155246cd544..e2af87ee1adf 100644
--- a/core/jni/android_net_NetUtils.cpp
+++ b/core/jni/android_net_NetUtils.cpp
@@ -18,6 +18,7 @@
#include <vector>
+#include <android/file_descriptor_jni.h>
#include <arpa/inet.h>
#include <linux/filter.h>
#include <linux/if_arp.h>
@@ -83,7 +84,7 @@ static void android_net_utils_attachDropAllBPFFilter(JNIEnv *env, jobject clazz,
filter_code,
};
- int fd = jniGetFDFromFileDescriptor(env, javaFd);
+ int fd = AFileDescriptor_getFD(env, javaFd);
if (setsockopt(fd, SOL_SOCKET, SO_ATTACH_FILTER, &filter, sizeof(filter)) != 0) {
jniThrowExceptionFmt(env, "java/net/SocketException",
"setsockopt(SO_ATTACH_FILTER): %s", strerror(errno));
@@ -93,7 +94,7 @@ static void android_net_utils_attachDropAllBPFFilter(JNIEnv *env, jobject clazz,
static void android_net_utils_detachBPFFilter(JNIEnv *env, jobject clazz, jobject javaFd)
{
int optval_ignored = 0;
- int fd = jniGetFDFromFileDescriptor(env, javaFd);
+ int fd = AFileDescriptor_getFD(env, javaFd);
if (setsockopt(fd, SOL_SOCKET, SO_DETACH_FILTER, &optval_ignored, sizeof(optval_ignored)) !=
0) {
jniThrowExceptionFmt(env, "java/net/SocketException",
@@ -117,10 +118,9 @@ static jboolean android_net_utils_bindProcessToNetworkForHostResolution(JNIEnv *
return (jboolean) !setNetworkForResolv(netId);
}
-static jint android_net_utils_bindSocketToNetwork(JNIEnv *env, jobject thiz, jint socket,
- jint netId)
-{
- return setNetworkForSocket(netId, socket);
+static jint android_net_utils_bindSocketToNetwork(JNIEnv *env, jobject thiz, jobject javaFd,
+ jint netId) {
+ return setNetworkForSocket(netId, AFileDescriptor_getFD(env, javaFd));
}
static jboolean android_net_utils_protectFromVpn(JNIEnv *env, jobject thiz, jint socket)
@@ -128,6 +128,10 @@ static jboolean android_net_utils_protectFromVpn(JNIEnv *env, jobject thiz, jint
return (jboolean) !protectFromVpn(socket);
}
+static jboolean android_net_utils_protectFromVpnWithFd(JNIEnv *env, jobject thiz, jobject javaFd) {
+ return android_net_utils_protectFromVpn(env, thiz, AFileDescriptor_getFD(env, javaFd));
+}
+
static jboolean android_net_utils_queryUserAccess(JNIEnv *env, jobject thiz, jint uid, jint netId)
{
return (jboolean) !queryUserAccess(uid, netId);
@@ -178,7 +182,7 @@ static jobject android_net_utils_resNetworkSend(JNIEnv *env, jobject thiz, jint
}
static jobject android_net_utils_resNetworkResult(JNIEnv *env, jobject thiz, jobject javaFd) {
- int fd = jniGetFDFromFileDescriptor(env, javaFd);
+ int fd = AFileDescriptor_getFD(env, javaFd);
int rcode;
std::vector<uint8_t> buf(MAXPACKETSIZE, 0);
@@ -205,7 +209,7 @@ static jobject android_net_utils_resNetworkResult(JNIEnv *env, jobject thiz, job
}
static void android_net_utils_resNetworkCancel(JNIEnv *env, jobject thiz, jobject javaFd) {
- int fd = jniGetFDFromFileDescriptor(env, javaFd);
+ int fd = AFileDescriptor_getFD(env, javaFd);
resNetworkCancel(fd);
jniSetFileDescriptorOfFD(env, javaFd, -1);
}
@@ -231,7 +235,7 @@ static jobject android_net_utils_getTcpRepairWindow(JNIEnv *env, jobject thiz, j
return NULL;
}
- int fd = jniGetFDFromFileDescriptor(env, javaFd);
+ int fd = AFileDescriptor_getFD(env, javaFd);
struct tcp_repair_window trw = {};
socklen_t size = sizeof(trw);
@@ -271,8 +275,9 @@ static const JNINativeMethod gNetworkUtilMethods[] = {
{ "bindProcessToNetwork", "(I)Z", (void*) android_net_utils_bindProcessToNetwork },
{ "getBoundNetworkForProcess", "()I", (void*) android_net_utils_getBoundNetworkForProcess },
{ "bindProcessToNetworkForHostResolution", "(I)Z", (void*) android_net_utils_bindProcessToNetworkForHostResolution },
- { "bindSocketToNetwork", "(II)I", (void*) android_net_utils_bindSocketToNetwork },
- { "protectFromVpn", "(I)Z", (void*)android_net_utils_protectFromVpn },
+ { "bindSocketToNetwork", "(Ljava/io/FileDescriptor;I)I", (void*) android_net_utils_bindSocketToNetwork },
+ { "protectFromVpn", "(I)Z", (void*) android_net_utils_protectFromVpn },
+ { "protectFromVpn", "(Ljava/io/FileDescriptor;)Z", (void*) android_net_utils_protectFromVpnWithFd },
{ "queryUserAccess", "(II)Z", (void*)android_net_utils_queryUserAccess },
{ "attachDropAllBPFFilter", "(Ljava/io/FileDescriptor;)V", (void*) android_net_utils_attachDropAllBPFFilter },
{ "detachBPFFilter", "(Ljava/io/FileDescriptor;)V", (void*) android_net_utils_detachBPFFilter },
diff --git a/core/res/AndroidManifest.xml b/core/res/AndroidManifest.xml
index 35e583f7d5d4..24dabfc02454 100644
--- a/core/res/AndroidManifest.xml
+++ b/core/res/AndroidManifest.xml
@@ -309,6 +309,9 @@
<protected-broadcast android:name="android.net.nsd.STATE_CHANGED" />
+ <!-- For OMAPI -->
+ <protected-broadcast android:name="android.se.omapi.action.SECURE_ELEMENT_STATE_CHANGED" />
+
<protected-broadcast android:name="android.nfc.action.ADAPTER_STATE_CHANGED" />
<protected-broadcast android:name="android.nfc.action.ALWAYS_ON_STATE_CHANGED" />
<protected-broadcast android:name="android.nfc.action.PREFERRED_PAYMENT_CHANGED" />
@@ -2987,6 +2990,12 @@
<permission android:name="android.permission.RECOVERY"
android:protectionLevel="signature|privileged" />
+ <!-- @SystemApi Allows an application to do certain operations needed for
+ resume on reboot feature.
+ @hide -->
+ <permission android:name="android.permission.BIND_RESUME_ON_REBOOT_SERVICE"
+ android:protectionLevel="signature" />
+
<!-- @SystemApi Allows an application to read system update info.
@hide -->
<permission android:name="android.permission.READ_SYSTEM_UPDATE_INFO"
diff --git a/core/sysprop/WatchdogProperties.sysprop b/core/sysprop/WatchdogProperties.sysprop
index 1bcc773a9a5d..93e8b788aed9 100644
--- a/core/sysprop/WatchdogProperties.sysprop
+++ b/core/sysprop/WatchdogProperties.sysprop
@@ -16,7 +16,7 @@ module: "android.sysprop.WatchdogProperties"
owner: Platform
# To escape the watchdog timeout loop, fatal reboot the system when
-# watchdog timed out 'fatal_count' times in 'fatal_window_second'
+# watchdog timed out 'fatal_count' times in 'fatal_window_seconds'
# seconds, if both values are not 0. Default value of both is 0.
prop {
api_name: "fatal_count"
@@ -26,8 +26,9 @@ prop {
access: Readonly
}
+# See 'fatal_count' for documentation.
prop {
- api_name: "fatal_window_second"
+ api_name: "fatal_window_seconds"
type: Integer
prop_name: "framework_watchdog.fatal_window.second"
scope: Internal
@@ -35,9 +36,9 @@ prop {
}
# The fatal counting can be disabled by setting property
-# 'is_fatal_ignore' to true.
+# 'should_ignore_fatal_count' to true.
prop {
- api_name: "is_fatal_ignore"
+ api_name: "should_ignore_fatal_count"
type: Boolean
prop_name: "persist.debug.framework_watchdog.fatal_ignore"
scope: Internal
diff --git a/core/sysprop/api/com.android.sysprop.watchdog-latest.txt b/core/sysprop/api/com.android.sysprop.watchdog-latest.txt
index d901aef945c9..c8462111fa94 100644
--- a/core/sysprop/api/com.android.sysprop.watchdog-latest.txt
+++ b/core/sysprop/api/com.android.sysprop.watchdog-latest.txt
@@ -7,13 +7,13 @@ props {
prop_name: "framework_watchdog.fatal_count"
}
prop {
- api_name: "fatal_window_second"
+ api_name: "fatal_window_seconds"
type: Integer
scope: Internal
prop_name: "framework_watchdog.fatal_window.second"
}
prop {
- api_name: "is_fatal_ignore"
+ api_name: "should_ignore_fatal_count"
scope: Internal
prop_name: "persist.debug.framework_watchdog.fatal_ignore"
}
diff --git a/core/tests/bugreports/src/com/android/os/bugreports/tests/BugreportManagerTest.java b/core/tests/bugreports/src/com/android/os/bugreports/tests/BugreportManagerTest.java
index 222471a830b1..09f16a82cd7f 100644
--- a/core/tests/bugreports/src/com/android/os/bugreports/tests/BugreportManagerTest.java
+++ b/core/tests/bugreports/src/com/android/os/bugreports/tests/BugreportManagerTest.java
@@ -76,6 +76,12 @@ public class BugreportManagerTest {
private static final long DUMPSTATE_STARTUP_TIMEOUT_MS = TimeUnit.SECONDS.toMillis(10);
private static final long UIAUTOMATOR_TIMEOUT_MS = TimeUnit.SECONDS.toMillis(10);
+
+ // A small timeout used when waiting for the result of a BugreportCallback to be received.
+ // This value must be at least 1000ms since there is an intentional delay in
+ // BugreportManagerServiceImpl in the error case.
+ private static final long CALLBACK_RESULT_TIMEOUT_MS = 1500;
+
// Sent by Shell when its bugreport finishes (contains final bugreport/screenshot file name
// associated with the bugreport).
private static final String INTENT_BUGREPORT_FINISHED =
@@ -185,7 +191,7 @@ public class BugreportManagerTest {
ParcelFileDescriptor bugreportFd2 = parcelFd(bugreportFile2);
ParcelFileDescriptor screenshotFd2 = parcelFd(screenshotFile2);
mBrm.startBugreport(bugreportFd2, screenshotFd2, wifi(), mExecutor, callback2);
- Thread.sleep(500 /* .5s */);
+ Thread.sleep(CALLBACK_RESULT_TIMEOUT_MS);
// Verify #2 encounters an error.
assertThat(callback2.getErrorCode()).isEqualTo(
@@ -194,7 +200,7 @@ public class BugreportManagerTest {
// Cancel #1 so we can move on to the next test.
mBrm.cancelBugreport();
- Thread.sleep(500 /* .5s */);
+ waitTillDoneOrTimeout(callback);
assertThat(callback.isDone()).isTrue();
assertFdsAreClosed(mBugreportFd, mScreenshotFd);
}
@@ -220,7 +226,7 @@ public class BugreportManagerTest {
// Try again, with DUMP permission.
getPermissions();
mBrm.cancelBugreport();
- Thread.sleep(500 /* .5s */);
+ waitTillDoneOrTimeout(callback);
assertThat(callback.isDone()).isTrue();
assertFdsAreClosed(mBugreportFd, mScreenshotFd);
}
diff --git a/core/tests/coretests/src/android/app/OWNERS b/core/tests/coretests/src/android/app/OWNERS
index bd7da0c3f209..b3f399363aef 100644
--- a/core/tests/coretests/src/android/app/OWNERS
+++ b/core/tests/coretests/src/android/app/OWNERS
@@ -1 +1,6 @@
per-file Window*.java = file:/services/core/java/com/android/server/wm/OWNERS
+
+# Notification, DND, Status bar
+per-file *Notification* = file:/packages/SystemUI/OWNERS
+per-file *Zen* = file:/packages/SystemUI/OWNERS
+per-file *StatusBar* = file:/packages/SystemUI/OWNERS
diff --git a/core/tests/coretests/src/android/app/people/OWNERS b/core/tests/coretests/src/android/app/people/OWNERS
new file mode 100644
index 000000000000..6ec8e6aa8d81
--- /dev/null
+++ b/core/tests/coretests/src/android/app/people/OWNERS
@@ -0,0 +1 @@
+file:/core/java/android/app/people/OWNERS \ No newline at end of file
diff --git a/core/tests/coretests/src/android/content/pm/OWNERS b/core/tests/coretests/src/android/content/pm/OWNERS
index 711f5f012b8b..7b7670696bfa 100644
--- a/core/tests/coretests/src/android/content/pm/OWNERS
+++ b/core/tests/coretests/src/android/content/pm/OWNERS
@@ -1,2 +1,3 @@
per-file AppSearchPersonTest.java = file:/core/java/android/content/pm/SHORTCUT_OWNERS
-
+per-file SigningDetailsTest.java = mpgroover@google.com
+per-file SigningDetailsTest.java = cbrubaker@google.com
diff --git a/core/tests/coretests/src/android/text/format/DateIntervalFormatTest.java b/core/tests/coretests/src/android/text/format/DateIntervalFormatTest.java
index 0f17d27048f3..6be9306bbd2d 100644
--- a/core/tests/coretests/src/android/text/format/DateIntervalFormatTest.java
+++ b/core/tests/coretests/src/android/text/format/DateIntervalFormatTest.java
@@ -254,7 +254,7 @@ public class DateIntervalFormatTest {
assertEquals("19–22 de ene. de 2009",
formatDateRange(es_US, tz, fixedTime, fixedTime + 3 * DAY,
FORMAT_SHOW_DATE | FORMAT_ABBREV_ALL));
- assertEquals("lun., 19 de ene. – jue., 22 de ene. de 2009",
+ assertEquals("lun, 19 de ene. – jue, 22 de ene. de 2009",
formatDateRange(es_US, tz, fixedTime, fixedTime + 3 * DAY,
FORMAT_SHOW_WEEKDAY | FORMAT_ABBREV_ALL));
assertEquals("lunes, 19 de enero–jueves, 22 de enero de 2009",
@@ -265,7 +265,7 @@ public class DateIntervalFormatTest {
assertEquals("19 de ene. – 22 de abr. 2009",
formatDateRange(es_US, tz, fixedTime, fixedTime + 3 * MONTH,
FORMAT_SHOW_DATE | FORMAT_ABBREV_ALL));
- assertEquals("lun., 19 de ene. – mié., 22 de abr. de 2009",
+ assertEquals("lun, 19 de ene. – mié, 22 de abr. de 2009",
formatDateRange(es_US, tz, fixedTime, fixedTime + 3 * MONTH,
FORMAT_SHOW_WEEKDAY | FORMAT_ABBREV_ALL));
assertEquals("enero–abril de 2009",
@@ -286,9 +286,9 @@ public class DateIntervalFormatTest {
assertEquals("19–22 de enero de 2009",
formatDateRange(es_ES, tz, fixedTime, fixedTime + 3 * DAY, 0));
- assertEquals("19–22 ene. 2009", formatDateRange(es_ES, tz, fixedTime, fixedTime + 3 * DAY,
+ assertEquals("19–22 ene 2009", formatDateRange(es_ES, tz, fixedTime, fixedTime + 3 * DAY,
FORMAT_SHOW_DATE | FORMAT_ABBREV_ALL));
- assertEquals("lun., 19 ene. – jue., 22 ene. 2009",
+ assertEquals("lun, 19 ene – jue, 22 ene 2009",
formatDateRange(es_ES, tz, fixedTime, fixedTime + 3 * DAY,
FORMAT_SHOW_WEEKDAY | FORMAT_ABBREV_ALL));
assertEquals("lunes, 19 de enero–jueves, 22 de enero de 2009",
@@ -296,19 +296,19 @@ public class DateIntervalFormatTest {
assertEquals("19 de enero–22 de abril de 2009",
formatDateRange(es_ES, tz, fixedTime, fixedTime + 3 * MONTH, 0));
- assertEquals("19 ene. – 22 abr. 2009",
+ assertEquals("19 ene – 22 abr 2009",
formatDateRange(es_ES, tz, fixedTime, fixedTime + 3 * MONTH,
FORMAT_SHOW_DATE | FORMAT_ABBREV_ALL));
- assertEquals("lun., 19 ene. – mié., 22 abr. 2009",
+ assertEquals("lun, 19 ene – mié, 22 abr 2009",
formatDateRange(es_ES, tz, fixedTime, fixedTime + 3 * MONTH,
FORMAT_SHOW_WEEKDAY | FORMAT_ABBREV_ALL));
assertEquals("enero–abril de 2009",
formatDateRange(es_ES, tz, fixedTime, fixedTime + 3 * MONTH, FORMAT_NO_MONTH_DAY));
- assertEquals("19 ene. 2009 – 9 feb. 2012",
+ assertEquals("19 ene 2009 – 9 feb 2012",
formatDateRange(es_ES, tz, fixedTime, fixedTime + 3 * YEAR,
FORMAT_SHOW_DATE | FORMAT_ABBREV_ALL));
- assertEquals("ene. 2009 – feb. 2012",
+ assertEquals("ene 2009 – feb 2012",
formatDateRange(es_ES, tz, fixedTime, fixedTime + 3 * YEAR,
FORMAT_NO_MONTH_DAY | FORMAT_ABBREV_ALL));
assertEquals("19 de enero de 2009–9 de febrero de 2012",
diff --git a/core/tests/coretests/src/android/text/format/FormatterTest.java b/core/tests/coretests/src/android/text/format/FormatterTest.java
index 068d04798858..5612833e5ddd 100644
--- a/core/tests/coretests/src/android/text/format/FormatterTest.java
+++ b/core/tests/coretests/src/android/text/format/FormatterTest.java
@@ -212,7 +212,7 @@ public class FormatterTest {
// Make sure it works on different locales.
setLocale(new Locale("ru", "RU"));
- assertEquals("1 мин.", Formatter.formatShortElapsedTimeRoundingUpToMinutes(
+ assertEquals("1 мин", Formatter.formatShortElapsedTimeRoundingUpToMinutes(
mContext, 1 * SECOND));
}
diff --git a/core/tests/coretests/src/android/text/format/RelativeDateTimeFormatterTest.java b/core/tests/coretests/src/android/text/format/RelativeDateTimeFormatterTest.java
index 4b3b5735b4f3..b3425162f48f 100644
--- a/core/tests/coretests/src/android/text/format/RelativeDateTimeFormatterTest.java
+++ b/core/tests/coretests/src/android/text/format/RelativeDateTimeFormatterTest.java
@@ -755,8 +755,8 @@ public class RelativeDateTimeFormatterTest {
final Locale locale = new Locale("fr");
android.icu.text.RelativeDateTimeFormatter icuFormatter =
android.icu.text.RelativeDateTimeFormatter.getInstance(locale);
- assertEquals("D à T", icuFormatter.combineDateAndTime("D", "T"));
+ assertEquals("D, T", icuFormatter.combineDateAndTime("D", "T"));
// Ensure single quote ' and curly braces {} are not interpreted in input values.
- assertEquals("D'x' à T{0}", icuFormatter.combineDateAndTime("D'x'", "T{0}"));
+ assertEquals("D'x', T{0}", icuFormatter.combineDateAndTime("D'x'", "T{0}"));
}
}
diff --git a/core/tests/uwbtests/src/android/uwb/AngleOfArrivalMeasurementTest.java b/core/tests/uwbtests/src/android/uwb/AngleOfArrivalMeasurementTest.java
index e0884e3e1c28..9394dec7f46f 100644
--- a/core/tests/uwbtests/src/android/uwb/AngleOfArrivalMeasurementTest.java
+++ b/core/tests/uwbtests/src/android/uwb/AngleOfArrivalMeasurementTest.java
@@ -42,14 +42,14 @@ public class AngleOfArrivalMeasurementTest {
AngleOfArrivalMeasurement.Builder builder = new AngleOfArrivalMeasurement.Builder();
tryBuild(builder, false);
- builder.setAltitudeAngleMeasurement(altitude);
+ builder.setAltitude(altitude);
tryBuild(builder, false);
- builder.setAzimuthAngleMeasurement(azimuth);
+ builder.setAzimuth(azimuth);
AngleOfArrivalMeasurement measurement = tryBuild(builder, true);
- assertEquals(azimuth, measurement.getAzimuthAngleMeasurement());
- assertEquals(altitude, measurement.getAltitudeAngleMeasurement());
+ assertEquals(azimuth, measurement.getAzimuth());
+ assertEquals(altitude, measurement.getAltitude());
}
private AngleMeasurement getAngleMeasurement(double radian, double error, double confidence) {
diff --git a/core/tests/uwbtests/src/android/uwb/UwbTestUtils.java b/core/tests/uwbtests/src/android/uwb/UwbTestUtils.java
index b4b2e303443e..8e7f7c562ade 100644
--- a/core/tests/uwbtests/src/android/uwb/UwbTestUtils.java
+++ b/core/tests/uwbtests/src/android/uwb/UwbTestUtils.java
@@ -42,8 +42,8 @@ public class UwbTestUtils {
public static AngleOfArrivalMeasurement getAngleOfArrivalMeasurement() {
return new AngleOfArrivalMeasurement.Builder()
- .setAltitudeAngleMeasurement(getAngleMeasurement())
- .setAzimuthAngleMeasurement(getAngleMeasurement())
+ .setAltitude(getAngleMeasurement())
+ .setAzimuth(getAngleMeasurement())
.build();
}
diff --git a/data/etc/OWNERS b/data/etc/OWNERS
index 9867d810dba2..65d3a012b129 100644
--- a/data/etc/OWNERS
+++ b/data/etc/OWNERS
@@ -1,3 +1,4 @@
+alanstokes@google.com
cbrubaker@google.com
hackbod@android.com
hackbod@google.com
@@ -12,4 +13,4 @@ toddke@android.com
toddke@google.com
yamasani@google.com
-per-file preinstalled-packages* = file:/MULTIUSER_OWNERS \ No newline at end of file
+per-file preinstalled-packages* = file:/MULTIUSER_OWNERS
diff --git a/identity/java/android/security/identity/CredstoreIdentityCredential.java b/identity/java/android/security/identity/CredstoreIdentityCredential.java
index 7c0af6def696..6398cee74cba 100644
--- a/identity/java/android/security/identity/CredstoreIdentityCredential.java
+++ b/identity/java/android/security/identity/CredstoreIdentityCredential.java
@@ -37,6 +37,7 @@ import java.security.cert.CertificateEncodingException;
import java.security.cert.CertificateException;
import java.security.cert.CertificateFactory;
import java.security.cert.X509Certificate;
+import java.time.Instant;
import java.util.Collection;
import java.util.LinkedList;
import java.util.Map;
@@ -237,12 +238,18 @@ class CredstoreIdentityCredential extends IdentityCredential {
}
private boolean mAllowUsingExhaustedKeys = true;
+ private boolean mAllowUsingExpiredKeys = false;
@Override
public void setAllowUsingExhaustedKeys(boolean allowUsingExhaustedKeys) {
mAllowUsingExhaustedKeys = allowUsingExhaustedKeys;
}
+ @Override
+ public void setAllowUsingExpiredKeys(boolean allowUsingExpiredKeys) {
+ mAllowUsingExpiredKeys = allowUsingExpiredKeys;
+ }
+
private boolean mOperationHandleSet = false;
private long mOperationHandle = 0;
@@ -256,7 +263,8 @@ class CredstoreIdentityCredential extends IdentityCredential {
public long getCredstoreOperationHandle() {
if (!mOperationHandleSet) {
try {
- mOperationHandle = mBinder.selectAuthKey(mAllowUsingExhaustedKeys);
+ mOperationHandle = mBinder.selectAuthKey(mAllowUsingExhaustedKeys,
+ mAllowUsingExpiredKeys);
mOperationHandleSet = true;
} catch (android.os.RemoteException e) {
throw new RuntimeException("Unexpected RemoteException ", e);
@@ -306,7 +314,8 @@ class CredstoreIdentityCredential extends IdentityCredential {
rnsParcels,
sessionTranscript != null ? sessionTranscript : new byte[0],
readerSignature != null ? readerSignature : new byte[0],
- mAllowUsingExhaustedKeys);
+ mAllowUsingExhaustedKeys,
+ mAllowUsingExpiredKeys);
} catch (android.os.RemoteException e) {
throw new RuntimeException("Unexpected RemoteException ", e);
} catch (android.os.ServiceSpecificException e) {
@@ -410,6 +419,34 @@ class CredstoreIdentityCredential extends IdentityCredential {
}
@Override
+ public void storeStaticAuthenticationData(X509Certificate authenticationKey,
+ Instant expirationDate,
+ byte[] staticAuthData)
+ throws UnknownAuthenticationKeyException {
+ try {
+ AuthKeyParcel authKeyParcel = new AuthKeyParcel();
+ authKeyParcel.x509cert = authenticationKey.getEncoded();
+ long millisSinceEpoch = (expirationDate.getEpochSecond() * 1000)
+ + (expirationDate.getNano() / 1000000);
+ mBinder.storeStaticAuthenticationDataWithExpiration(authKeyParcel,
+ millisSinceEpoch, staticAuthData);
+ } catch (CertificateEncodingException e) {
+ throw new RuntimeException("Error encoding authenticationKey", e);
+ } catch (android.os.RemoteException e) {
+ throw new RuntimeException("Unexpected RemoteException ", e);
+ } catch (android.os.ServiceSpecificException e) {
+ if (e.errorCode == ICredentialStore.ERROR_NOT_SUPPORTED) {
+ throw new UnsupportedOperationException("Not supported", e);
+ } else if (e.errorCode == ICredentialStore.ERROR_AUTHENTICATION_KEY_NOT_FOUND) {
+ throw new UnknownAuthenticationKeyException(e.getMessage(), e);
+ } else {
+ throw new RuntimeException("Unexpected ServiceSpecificException with code "
+ + e.errorCode, e);
+ }
+ }
+ }
+
+ @Override
public @NonNull int[] getAuthenticationDataUsageCount() {
try {
int[] usageCount = mBinder.getAuthenticationDataUsageCount();
@@ -421,4 +458,49 @@ class CredstoreIdentityCredential extends IdentityCredential {
+ e.errorCode, e);
}
}
+
+ @Override
+ public @NonNull byte[] proveOwnership(@NonNull byte[] challenge) {
+ try {
+ byte[] proofOfOwnership = mBinder.proveOwnership(challenge);
+ return proofOfOwnership;
+ } catch (android.os.RemoteException e) {
+ throw new RuntimeException("Unexpected RemoteException ", e);
+ } catch (android.os.ServiceSpecificException e) {
+ if (e.errorCode == ICredentialStore.ERROR_NOT_SUPPORTED) {
+ throw new UnsupportedOperationException("Not supported", e);
+ } else {
+ throw new RuntimeException("Unexpected ServiceSpecificException with code "
+ + e.errorCode, e);
+ }
+ }
+ }
+
+ @Override
+ public @NonNull byte[] delete(@NonNull byte[] challenge) {
+ try {
+ byte[] proofOfDeletion = mBinder.deleteWithChallenge(challenge);
+ return proofOfDeletion;
+ } catch (android.os.RemoteException e) {
+ throw new RuntimeException("Unexpected RemoteException ", e);
+ } catch (android.os.ServiceSpecificException e) {
+ throw new RuntimeException("Unexpected ServiceSpecificException with code "
+ + e.errorCode, e);
+ }
+ }
+
+ @Override
+ public @NonNull byte[] update(@NonNull PersonalizationData personalizationData) {
+ try {
+ IWritableCredential binder = mBinder.update();
+ byte[] proofOfProvision =
+ CredstoreWritableIdentityCredential.personalize(binder, personalizationData);
+ return proofOfProvision;
+ } catch (android.os.RemoteException e) {
+ throw new RuntimeException("Unexpected RemoteException ", e);
+ } catch (android.os.ServiceSpecificException e) {
+ throw new RuntimeException("Unexpected ServiceSpecificException with code "
+ + e.errorCode, e);
+ }
+ }
}
diff --git a/identity/java/android/security/identity/CredstoreIdentityCredentialStore.java b/identity/java/android/security/identity/CredstoreIdentityCredentialStore.java
index 129063361b35..d8d47424e2e8 100644
--- a/identity/java/android/security/identity/CredstoreIdentityCredentialStore.java
+++ b/identity/java/android/security/identity/CredstoreIdentityCredentialStore.java
@@ -162,5 +162,4 @@ class CredstoreIdentityCredentialStore extends IdentityCredentialStore {
+ e.errorCode, e);
}
}
-
}
diff --git a/identity/java/android/security/identity/CredstoreWritableIdentityCredential.java b/identity/java/android/security/identity/CredstoreWritableIdentityCredential.java
index 725e3d8e429a..d2e7984ce19f 100644
--- a/identity/java/android/security/identity/CredstoreWritableIdentityCredential.java
+++ b/identity/java/android/security/identity/CredstoreWritableIdentityCredential.java
@@ -76,7 +76,14 @@ class CredstoreWritableIdentityCredential extends WritableIdentityCredential {
@NonNull @Override
public byte[] personalize(@NonNull PersonalizationData personalizationData) {
+ return personalize(mBinder, personalizationData);
+ }
+ // Used by both personalize() and CredstoreIdentityCredential.update().
+ //
+ @NonNull
+ static byte[] personalize(IWritableCredential binder,
+ @NonNull PersonalizationData personalizationData) {
Collection<AccessControlProfile> accessControlProfiles =
personalizationData.getAccessControlProfiles();
@@ -144,7 +151,7 @@ class CredstoreWritableIdentityCredential extends WritableIdentityCredential {
secureUserId = getRootSid();
}
try {
- byte[] personalizationReceipt = mBinder.personalize(acpParcels, ensParcels,
+ byte[] personalizationReceipt = binder.personalize(acpParcels, ensParcels,
secureUserId);
return personalizationReceipt;
} catch (android.os.RemoteException e) {
@@ -164,5 +171,4 @@ class CredstoreWritableIdentityCredential extends WritableIdentityCredential {
return rootSid;
}
-
}
diff --git a/identity/java/android/security/identity/IdentityCredential.java b/identity/java/android/security/identity/IdentityCredential.java
index 4eb6e420c07f..8f175bb63edb 100644
--- a/identity/java/android/security/identity/IdentityCredential.java
+++ b/identity/java/android/security/identity/IdentityCredential.java
@@ -23,6 +23,7 @@ import java.security.InvalidKeyException;
import java.security.KeyPair;
import java.security.PublicKey;
import java.security.cert.X509Certificate;
+import java.time.Instant;
import java.util.Collection;
import java.util.Map;
@@ -114,6 +115,25 @@ public abstract class IdentityCredential {
public abstract void setAllowUsingExhaustedKeys(boolean allowUsingExhaustedKeys);
/**
+ * Sets whether to allow using an authentication key which has been expired if no
+ * other key is available. This must be called prior to calling
+ * {@link #getEntries(byte[], Map, byte[], byte[])}.
+ *
+ * <p>By default this is set to false.
+ *
+ * <p>This is only implemented in feature version 202101 or later. If not implemented, the call
+ * fails with {@link UnsupportedOperationException}. See
+ * {@link android.content.pm.PackageManager#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} for known
+ * feature versions.
+ *
+ * @param allowUsingExpiredKeys whether to allow using an authentication key which use count
+ * has been exceeded if no other key is available.
+ */
+ public void setAllowUsingExpiredKeys(boolean allowUsingExpiredKeys) {
+ throw new UnsupportedOperationException();
+ }
+
+ /**
* Called by android.hardware.biometrics.CryptoObject#getOpId() to get an
* operation handle.
*
@@ -289,6 +309,21 @@ public abstract class IdentityCredential {
*
* <p>Each X.509 certificate is signed by CredentialKey. The certificate chain for CredentialKey
* can be obtained using the {@link #getCredentialKeyCertificateChain()} method.
+
+ * <p>If the implementation is feature version 202101 or later,
+ * each X.509 certificate contains an X.509 extension at OID 1.3.6.1.4.1.11129.2.1.26 which
+ * contains a DER encoded OCTET STRING with the bytes of the CBOR with the following CDDL:
+ * <pre>
+ * ProofOfBinding = [
+ * "ProofOfBinding",
+ * bstr, // Contains SHA-256(ProofOfProvisioning)
+ * ]
+ * </pre>
+ * <p>This CBOR enables an issuer to determine the exact state of the credential it
+ * returns issuer-signed data for.
+ *
+ * <p> See {@link android.content.pm.PackageManager#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} for
+ * known feature versions.
*
* @return A collection of X.509 certificates for dynamic authentication keys that need issuer
* certification.
@@ -308,16 +343,136 @@ public abstract class IdentityCredential {
* the authenticity
* and integrity of the credential data fields.
* @throws UnknownAuthenticationKeyException If the given authentication key is not recognized.
+ * @deprecated Use {@link #storeStaticAuthenticationData(X509Certificate, Instant, byte[])}
+ * instead.
*/
+ @Deprecated
public abstract void storeStaticAuthenticationData(
@NonNull X509Certificate authenticationKey,
@NonNull byte[] staticAuthData)
throws UnknownAuthenticationKeyException;
/**
+ * Store authentication data associated with a dynamic authentication key.
+ *
+ * This should only be called for an authenticated key returned by
+ * {@link #getAuthKeysNeedingCertification()}.
+ *
+ * <p>This is only implemented in feature version 202101 or later. If not implemented, the call
+ * fails with {@link UnsupportedOperationException}. See
+ * {@link android.content.pm.PackageManager#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} for known
+ * feature versions.
+ *
+ * @param authenticationKey The dynamic authentication key for which certification and
+ * associated static
+ * authentication data is being provided.
+ * @param expirationDate The expiration date of the static authentication data.
+ * @param staticAuthData Static authentication data provided by the issuer that validates
+ * the authenticity
+ * and integrity of the credential data fields.
+ * @throws UnknownAuthenticationKeyException If the given authentication key is not recognized.
+ */
+ public void storeStaticAuthenticationData(
+ @NonNull X509Certificate authenticationKey,
+ @NonNull Instant expirationDate,
+ @NonNull byte[] staticAuthData)
+ throws UnknownAuthenticationKeyException {
+ throw new UnsupportedOperationException();
+ }
+
+ /**
* Get the number of times the dynamic authentication keys have been used.
*
* @return int array of dynamic authentication key usage counts.
*/
public @NonNull abstract int[] getAuthenticationDataUsageCount();
+
+ /**
+ * Proves ownership of a credential.
+ *
+ * <p>This method returns a COSE_Sign1 data structure signed by the CredentialKey
+ * with payload set to {@code ProofOfDeletion} as defined below.</p>
+ *
+ * <p>The returned CBOR is the following:</p>
+ * <pre>
+ * ProofOfOwnership = [
+ * "ProofOfOwnership", ; tstr
+ * tstr, ; DocType
+ * bstr, ; Challenge
+ * bool ; true if this is a test credential, should
+ * ; always be false.
+ * ]
+ * </pre>
+ *
+ * <p>This is only implemented in feature version 202101 or later. If not implemented, the call
+ * fails with {@link UnsupportedOperationException}. See
+ * {@link android.content.pm.PackageManager#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} for known
+ * feature versions.
+ *
+ * @param challenge is a non-empty byte array whose contents should be unique, fresh and
+ * provided by the issuing authority. The value provided is embedded in the
+ * generated CBOR and enables the issuing authority to verify that the
+ * returned proof is fresh.
+ * @return the COSE_Sign1 data structure above
+ */
+ public @NonNull byte[] proveOwnership(@NonNull byte[] challenge) {
+ throw new UnsupportedOperationException();
+ }
+
+ /**
+ * Deletes a credential.
+ *
+ * <p>This method returns a COSE_Sign1 data structure signed by the CredentialKey
+ * with payload set to {@code ProofOfDeletion} as defined below.</p>
+ *
+ * <pre>
+ * ProofOfDeletion = [
+ * "ProofOfDeletion", ; tstr
+ * tstr, ; DocType
+ * bstr, ; Challenge
+ * bool ; true if this is a test credential, should
+ * ; always be false.
+ * ]
+ * </pre>
+ *
+ * <p>This is only implemented in feature version 202101 or later. If not implemented, the call
+ * fails with {@link UnsupportedOperationException}. See
+ * {@link android.content.pm.PackageManager#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} for known
+ * feature versions.
+ *
+ * @param challenge is a non-empty byte array whose contents should be unique, fresh and
+ * provided by the issuing authority. The value provided is embedded in the
+ * generated CBOR and enables the issuing authority to verify that the
+ * returned proof is fresh.
+ * @return the COSE_Sign1 data structure above
+ */
+ public @NonNull byte[] delete(@NonNull byte[] challenge) {
+ throw new UnsupportedOperationException();
+ }
+
+ /**
+ * Updates the credential with new access control profiles and data items.
+ *
+ * <p>This method is similar to
+ * {@link WritableIdentityCredential#personalize(PersonalizationData)} except that it operates
+ * on an existing credential, see the documentation for that method for the format of the
+ * returned data.
+ *
+ * <p>If this call succeeds an side-effect is that all dynamic authentication keys for the
+ * credential are deleted. The application will need to use
+ * {@link #getAuthKeysNeedingCertification()} to generate replacement keys and return
+ * them for issuer certification.
+ *
+ * <p>This is only implemented in feature version 202101 or later. If not implemented, the call
+ * fails with {@link UnsupportedOperationException}. See
+ * {@link android.content.pm.PackageManager#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} for known
+ * feature versions.
+ *
+ * @param personalizationData The data to update, including access control profiles
+ * and data elements and their values, grouped into namespaces.
+ * @return A COSE_Sign1 data structure, see above.
+ */
+ public @NonNull byte[] update(@NonNull PersonalizationData personalizationData) {
+ throw new UnsupportedOperationException();
+ }
}
diff --git a/identity/java/android/security/identity/IdentityCredentialStore.java b/identity/java/android/security/identity/IdentityCredentialStore.java
index 3843d9279900..6ccd0e892141 100644
--- a/identity/java/android/security/identity/IdentityCredentialStore.java
+++ b/identity/java/android/security/identity/IdentityCredentialStore.java
@@ -72,6 +72,17 @@ import java.lang.annotation.RetentionPolicy;
* <p>Credentials provisioned to the direct access store should <strong>always</strong> use reader
* authentication to protect data elements. The reason for this is user authentication or user
* approval of data release is not possible when the device is off.
+ *
+ * <p>The Identity Credential API is designed to be able to evolve and change over time
+ * but still provide 100% backwards compatibility. This is complicated by the fact that
+ * there may be a version skew between the API used by the application and the version
+ * implemented in secure hardware. To solve this problem, the API provides for a way
+ * for the application to query which feature version the hardware implements (if any
+ * at all) using
+ * {@link android.content.pm#FEATURE_IDENTITY_CREDENTIAL_HARDWARE} and
+ * {@link android.content.pm#FEATURE_IDENTITY_CREDENTIAL_HARDWARE_DIRECT_ACCESS}.
+ * Methods which only work on certain feature versions are clearly documented as
+ * such.
*/
public abstract class IdentityCredentialStore {
IdentityCredentialStore() {}
@@ -193,7 +204,9 @@ public abstract class IdentityCredentialStore {
* @param credentialName the name of the credential to delete.
* @return {@code null} if the credential was not found, the COSE_Sign1 data structure above
* if the credential was found and deleted.
+ * @deprecated Use {@link IdentityCredential#delete(byte[])} instead.
*/
+ @Deprecated
public abstract @Nullable byte[] deleteCredentialByName(@NonNull String credentialName);
/** @hide */
@@ -201,5 +214,4 @@ public abstract class IdentityCredentialStore {
@Retention(RetentionPolicy.SOURCE)
public @interface Ciphersuite {
}
-
}
diff --git a/keystore/java/android/security/Authorization.java b/keystore/java/android/security/Authorization.java
index fcc518c374e3..21d23b1b2575 100644
--- a/keystore/java/android/security/Authorization.java
+++ b/keystore/java/android/security/Authorization.java
@@ -82,7 +82,7 @@ public class Authorization {
*
* @param locked - whether it is a lock (true) or unlock (false) event
* @param syntheticPassword - if it is an unlock event with the password, pass the synthetic
- * password provided by the LockSettingService
+ * password provided by the LockSettingService
*
* @return 0 if successful or a {@code ResponseCode}.
*/
diff --git a/keystore/java/android/security/keystore2/AndroidKeyStoreECPublicKey.java b/keystore/java/android/security/keystore2/AndroidKeyStoreECPublicKey.java
index 6ddaa704afa8..b631999c2c54 100644
--- a/keystore/java/android/security/keystore2/AndroidKeyStoreECPublicKey.java
+++ b/keystore/java/android/security/keystore2/AndroidKeyStoreECPublicKey.java
@@ -38,9 +38,10 @@ public class AndroidKeyStoreECPublicKey extends AndroidKeyStorePublicKey impleme
public AndroidKeyStoreECPublicKey(@NonNull KeyDescriptor descriptor,
@NonNull KeyMetadata metadata,
+ @NonNull byte[] x509EncodedForm,
@NonNull KeyStoreSecurityLevel securityLevel,
@NonNull ECParameterSpec params, @NonNull ECPoint w) {
- super(descriptor, metadata, KeyProperties.KEY_ALGORITHM_EC, securityLevel);
+ super(descriptor, metadata, x509EncodedForm, KeyProperties.KEY_ALGORITHM_EC, securityLevel);
mParams = params;
mW = w;
}
@@ -48,7 +49,7 @@ public class AndroidKeyStoreECPublicKey extends AndroidKeyStorePublicKey impleme
public AndroidKeyStoreECPublicKey(@NonNull KeyDescriptor descriptor,
@NonNull KeyMetadata metadata,
@NonNull KeyStoreSecurityLevel securityLevel, @NonNull ECPublicKey info) {
- this(descriptor, metadata, securityLevel, info.getParams(), info.getW());
+ this(descriptor, metadata, info.getEncoded(), securityLevel, info.getParams(), info.getW());
if (!"X.509".equalsIgnoreCase(info.getFormat())) {
throw new IllegalArgumentException(
"Unsupported key export format: " + info.getFormat());
diff --git a/keystore/java/android/security/keystore2/AndroidKeyStorePublicKey.java b/keystore/java/android/security/keystore2/AndroidKeyStorePublicKey.java
index 49dd77e3a3db..db3e567cb6b4 100644
--- a/keystore/java/android/security/keystore2/AndroidKeyStorePublicKey.java
+++ b/keystore/java/android/security/keystore2/AndroidKeyStorePublicKey.java
@@ -32,13 +32,15 @@ import java.security.PublicKey;
public abstract class AndroidKeyStorePublicKey extends AndroidKeyStoreKey implements PublicKey {
private final byte[] mCertificate;
private final byte[] mCertificateChain;
+ private final byte[] mEncoded;
public AndroidKeyStorePublicKey(@NonNull KeyDescriptor descriptor,
- @NonNull KeyMetadata metadata, @NonNull String algorithm,
- @NonNull KeyStoreSecurityLevel securityLevel) {
+ @NonNull KeyMetadata metadata, @NonNull byte[] x509EncodedForm,
+ @NonNull String algorithm, @NonNull KeyStoreSecurityLevel securityLevel) {
super(descriptor, metadata.key.nspace, metadata.authorizations, algorithm, securityLevel);
mCertificate = metadata.certificate;
mCertificateChain = metadata.certificateChain;
+ mEncoded = x509EncodedForm;
}
abstract AndroidKeyStorePrivateKey getPrivateKey();
@@ -50,7 +52,7 @@ public abstract class AndroidKeyStorePublicKey extends AndroidKeyStoreKey implem
@Override
public byte[] getEncoded() {
- return ArrayUtils.cloneIfNotEmpty(mCertificate);
+ return ArrayUtils.cloneIfNotEmpty(mEncoded);
}
@Override
diff --git a/keystore/java/android/security/keystore2/AndroidKeyStoreRSAPublicKey.java b/keystore/java/android/security/keystore2/AndroidKeyStoreRSAPublicKey.java
index b578ea9baa06..9fe6cf3c113f 100644
--- a/keystore/java/android/security/keystore2/AndroidKeyStoreRSAPublicKey.java
+++ b/keystore/java/android/security/keystore2/AndroidKeyStoreRSAPublicKey.java
@@ -36,9 +36,11 @@ public class AndroidKeyStoreRSAPublicKey extends AndroidKeyStorePublicKey implem
public AndroidKeyStoreRSAPublicKey(@NonNull KeyDescriptor descriptor,
@NonNull KeyMetadata metadata,
+ @NonNull byte[] x509EncodedForm,
@NonNull KeyStoreSecurityLevel securityLevel, @NonNull BigInteger modulus,
@NonNull BigInteger publicExponent) {
- super(descriptor, metadata, KeyProperties.KEY_ALGORITHM_RSA, securityLevel);
+ super(descriptor, metadata, x509EncodedForm, KeyProperties.KEY_ALGORITHM_RSA,
+ securityLevel);
mModulus = modulus;
mPublicExponent = publicExponent;
}
@@ -46,7 +48,8 @@ public class AndroidKeyStoreRSAPublicKey extends AndroidKeyStorePublicKey implem
public AndroidKeyStoreRSAPublicKey(@NonNull KeyDescriptor descriptor,
@NonNull KeyMetadata metadata,
@NonNull KeyStoreSecurityLevel securityLevel, @NonNull RSAPublicKey info) {
- this(descriptor, metadata, securityLevel, info.getModulus(), info.getPublicExponent());
+ this(descriptor, metadata, info.getEncoded(), securityLevel, info.getModulus(),
+ info.getPublicExponent());
if (!"X.509".equalsIgnoreCase(info.getFormat())) {
throw new IllegalArgumentException(
"Unsupported key export format: " + info.getFormat());
diff --git a/libs/androidfw/LocaleDataTables.cpp b/libs/androidfw/LocaleDataTables.cpp
index 6c6c5c9f4e22..8a10599b498f 100644
--- a/libs/androidfw/LocaleDataTables.cpp
+++ b/libs/androidfw/LocaleDataTables.cpp
@@ -64,42 +64,43 @@ const char SCRIPT_CODES[][4] = {
/* 60 */ {'N', 'k', 'o', 'o'},
/* 61 */ {'N', 's', 'h', 'u'},
/* 62 */ {'O', 'g', 'a', 'm'},
- /* 63 */ {'O', 'r', 'k', 'h'},
- /* 64 */ {'O', 'r', 'y', 'a'},
- /* 65 */ {'O', 's', 'g', 'e'},
- /* 66 */ {'P', 'a', 'u', 'c'},
- /* 67 */ {'P', 'h', 'l', 'i'},
- /* 68 */ {'P', 'h', 'n', 'x'},
- /* 69 */ {'P', 'l', 'r', 'd'},
- /* 70 */ {'P', 'r', 't', 'i'},
- /* 71 */ {'R', 'u', 'n', 'r'},
- /* 72 */ {'S', 'a', 'm', 'r'},
- /* 73 */ {'S', 'a', 'r', 'b'},
- /* 74 */ {'S', 'a', 'u', 'r'},
- /* 75 */ {'S', 'g', 'n', 'w'},
- /* 76 */ {'S', 'i', 'n', 'h'},
- /* 77 */ {'S', 'o', 'g', 'd'},
- /* 78 */ {'S', 'o', 'r', 'a'},
- /* 79 */ {'S', 'o', 'y', 'o'},
- /* 80 */ {'S', 'y', 'r', 'c'},
- /* 81 */ {'T', 'a', 'l', 'e'},
- /* 82 */ {'T', 'a', 'l', 'u'},
- /* 83 */ {'T', 'a', 'm', 'l'},
- /* 84 */ {'T', 'a', 'n', 'g'},
- /* 85 */ {'T', 'a', 'v', 't'},
- /* 86 */ {'T', 'e', 'l', 'u'},
- /* 87 */ {'T', 'f', 'n', 'g'},
- /* 88 */ {'T', 'h', 'a', 'a'},
- /* 89 */ {'T', 'h', 'a', 'i'},
- /* 90 */ {'T', 'i', 'b', 't'},
- /* 91 */ {'U', 'g', 'a', 'r'},
- /* 92 */ {'V', 'a', 'i', 'i'},
- /* 93 */ {'W', 'c', 'h', 'o'},
- /* 94 */ {'X', 'p', 'e', 'o'},
- /* 95 */ {'X', 's', 'u', 'x'},
- /* 96 */ {'Y', 'i', 'i', 'i'},
- /* 97 */ {'~', '~', '~', 'A'},
- /* 98 */ {'~', '~', '~', 'B'},
+ /* 63 */ {'O', 'l', 'c', 'k'},
+ /* 64 */ {'O', 'r', 'k', 'h'},
+ /* 65 */ {'O', 'r', 'y', 'a'},
+ /* 66 */ {'O', 's', 'g', 'e'},
+ /* 67 */ {'P', 'a', 'u', 'c'},
+ /* 68 */ {'P', 'h', 'l', 'i'},
+ /* 69 */ {'P', 'h', 'n', 'x'},
+ /* 70 */ {'P', 'l', 'r', 'd'},
+ /* 71 */ {'P', 'r', 't', 'i'},
+ /* 72 */ {'R', 'u', 'n', 'r'},
+ /* 73 */ {'S', 'a', 'm', 'r'},
+ /* 74 */ {'S', 'a', 'r', 'b'},
+ /* 75 */ {'S', 'a', 'u', 'r'},
+ /* 76 */ {'S', 'g', 'n', 'w'},
+ /* 77 */ {'S', 'i', 'n', 'h'},
+ /* 78 */ {'S', 'o', 'g', 'd'},
+ /* 79 */ {'S', 'o', 'r', 'a'},
+ /* 80 */ {'S', 'o', 'y', 'o'},
+ /* 81 */ {'S', 'y', 'r', 'c'},
+ /* 82 */ {'T', 'a', 'l', 'e'},
+ /* 83 */ {'T', 'a', 'l', 'u'},
+ /* 84 */ {'T', 'a', 'm', 'l'},
+ /* 85 */ {'T', 'a', 'n', 'g'},
+ /* 86 */ {'T', 'a', 'v', 't'},
+ /* 87 */ {'T', 'e', 'l', 'u'},
+ /* 88 */ {'T', 'f', 'n', 'g'},
+ /* 89 */ {'T', 'h', 'a', 'a'},
+ /* 90 */ {'T', 'h', 'a', 'i'},
+ /* 91 */ {'T', 'i', 'b', 't'},
+ /* 92 */ {'U', 'g', 'a', 'r'},
+ /* 93 */ {'V', 'a', 'i', 'i'},
+ /* 94 */ {'W', 'c', 'h', 'o'},
+ /* 95 */ {'X', 'p', 'e', 'o'},
+ /* 96 */ {'X', 's', 'u', 'x'},
+ /* 97 */ {'Y', 'i', 'i', 'i'},
+ /* 98 */ {'~', '~', '~', 'A'},
+ /* 99 */ {'~', '~', '~', 'B'},
};
@@ -120,7 +121,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x80600000u, 46u}, // ada -> Latn
{0x90600000u, 46u}, // ade -> Latn
{0xA4600000u, 46u}, // adj -> Latn
- {0xBC600000u, 90u}, // adp -> Tibt
+ {0xBC600000u, 91u}, // adp -> Tibt
{0xE0600000u, 17u}, // ady -> Cyrl
{0xE4600000u, 46u}, // adz -> Latn
{0x61650000u, 4u}, // ae -> Avst
@@ -138,7 +139,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0xB8E00000u, 0u}, // aho -> Ahom
{0x99200000u, 46u}, // ajg -> Latn
{0x616B0000u, 46u}, // ak -> Latn
- {0xA9400000u, 95u}, // akk -> Xsux
+ {0xA9400000u, 96u}, // akk -> Xsux
{0x81600000u, 46u}, // ala -> Latn
{0xA1600000u, 46u}, // ali -> Latn
{0xB5600000u, 46u}, // aln -> Latn
@@ -163,7 +164,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0xC9E00000u, 46u}, // aps -> Latn
{0xE5E00000u, 46u}, // apz -> Latn
{0x61720000u, 1u}, // ar -> Arab
- {0x61725842u, 98u}, // ar-XB -> ~~~B
+ {0x61725842u, 99u}, // ar-XB -> ~~~B
{0x8A200000u, 2u}, // arc -> Armi
{0x9E200000u, 46u}, // arh -> Latn
{0xB6200000u, 46u}, // arn -> Latn
@@ -174,7 +175,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0xE6200000u, 1u}, // arz -> Arab
{0x61730000u, 7u}, // as -> Beng
{0x82400000u, 46u}, // asa -> Latn
- {0x92400000u, 75u}, // ase -> Sgnw
+ {0x92400000u, 76u}, // ase -> Sgnw
{0x9A400000u, 46u}, // asg -> Latn
{0xBA400000u, 46u}, // aso -> Latn
{0xCE400000u, 46u}, // ast -> Latn
@@ -231,7 +232,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0xDC810000u, 46u}, // bex -> Latn
{0xE4810000u, 46u}, // bez -> Latn
{0x8CA10000u, 46u}, // bfd -> Latn
- {0xC0A10000u, 83u}, // bfq -> Taml
+ {0xC0A10000u, 84u}, // bfq -> Taml
{0xCCA10000u, 1u}, // bft -> Arab
{0xE0A10000u, 18u}, // bfy -> Deva
{0x62670000u, 17u}, // bg -> Cyrl
@@ -265,7 +266,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0xC1410000u, 46u}, // bkq -> Latn
{0xD1410000u, 46u}, // bku -> Latn
{0xD5410000u, 46u}, // bkv -> Latn
- {0xCD610000u, 85u}, // blt -> Tavt
+ {0xCD610000u, 86u}, // blt -> Tavt
{0x626D0000u, 46u}, // bm -> Latn
{0x9D810000u, 46u}, // bmh -> Latn
{0xA9810000u, 46u}, // bmk -> Latn
@@ -275,7 +276,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x99A10000u, 46u}, // bng -> Latn
{0xB1A10000u, 46u}, // bnm -> Latn
{0xBDA10000u, 46u}, // bnp -> Latn
- {0x626F0000u, 90u}, // bo -> Tibt
+ {0x626F0000u, 91u}, // bo -> Tibt
{0xA5C10000u, 46u}, // boj -> Latn
{0xB1C10000u, 46u}, // bom -> Latn
{0xB5C10000u, 46u}, // bon -> Latn
@@ -322,6 +323,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x9F210000u, 46u}, // bzh -> Latn
{0xDB210000u, 46u}, // bzw -> Latn
{0x63610000u, 46u}, // ca -> Latn
+ {0x8C020000u, 46u}, // cad -> Latn
{0xB4020000u, 46u}, // can -> Latn
{0xA4220000u, 46u}, // cbj -> Latn
{0x9C420000u, 46u}, // cch -> Latn
@@ -346,7 +348,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0xE1420000u, 46u}, // cky -> Latn
{0x81620000u, 46u}, // cla -> Latn
{0x91820000u, 46u}, // cme -> Latn
- {0x99820000u, 79u}, // cmg -> Soyo
+ {0x99820000u, 80u}, // cmg -> Soyo
{0x636F0000u, 46u}, // co -> Latn
{0xBDC20000u, 15u}, // cop -> Copt
{0xC9E20000u, 46u}, // cps -> Latn
@@ -360,7 +362,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x63730000u, 46u}, // cs -> Latn
{0x86420000u, 46u}, // csb -> Latn
{0xDA420000u, 10u}, // csw -> Cans
- {0x8E620000u, 66u}, // ctd -> Pauc
+ {0x8E620000u, 67u}, // ctd -> Pauc
{0x63750000u, 17u}, // cu -> Cyrl
{0x63760000u, 17u}, // cv -> Cyrl
{0x63790000u, 46u}, // cy -> Latn
@@ -389,7 +391,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x91230000u, 46u}, // dje -> Latn
{0xA5A30000u, 46u}, // dnj -> Latn
{0x85C30000u, 46u}, // dob -> Latn
- {0xA1C30000u, 1u}, // doi -> Arab
+ {0xA1C30000u, 18u}, // doi -> Deva
{0xBDC30000u, 46u}, // dop -> Latn
{0xD9C30000u, 46u}, // dow -> Latn
{0x9E230000u, 56u}, // drh -> Mong
@@ -404,12 +406,12 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x8A830000u, 46u}, // duc -> Latn
{0x8E830000u, 46u}, // dud -> Latn
{0x9A830000u, 46u}, // dug -> Latn
- {0x64760000u, 88u}, // dv -> Thaa
+ {0x64760000u, 89u}, // dv -> Thaa
{0x82A30000u, 46u}, // dva -> Latn
{0xDAC30000u, 46u}, // dww -> Latn
{0xBB030000u, 46u}, // dyo -> Latn
{0xD3030000u, 46u}, // dyu -> Latn
- {0x647A0000u, 90u}, // dz -> Tibt
+ {0x647A0000u, 91u}, // dz -> Tibt
{0x9B230000u, 46u}, // dzg -> Latn
{0xD0240000u, 46u}, // ebu -> Latn
{0x65650000u, 46u}, // ee -> Latn
@@ -422,7 +424,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x81840000u, 46u}, // ema -> Latn
{0xA1840000u, 46u}, // emi -> Latn
{0x656E0000u, 46u}, // en -> Latn
- {0x656E5841u, 97u}, // en-XA -> ~~~A
+ {0x656E5841u, 98u}, // en-XA -> ~~~A
{0xB5A40000u, 46u}, // enn -> Latn
{0xC1A40000u, 46u}, // enq -> Latn
{0x656F0000u, 46u}, // eo -> Latn
@@ -438,6 +440,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x65750000u, 46u}, // eu -> Latn
{0xBAC40000u, 46u}, // ewo -> Latn
{0xCEE40000u, 46u}, // ext -> Latn
+ {0x83240000u, 46u}, // eza -> Latn
{0x66610000u, 1u}, // fa -> Arab
{0x80050000u, 46u}, // faa -> Latn
{0x84050000u, 46u}, // fab -> Latn
@@ -521,7 +524,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x95C60000u, 20u}, // gof -> Ethi
{0xA1C60000u, 46u}, // goi -> Latn
{0xB1C60000u, 18u}, // gom -> Deva
- {0xB5C60000u, 86u}, // gon -> Telu
+ {0xB5C60000u, 87u}, // gon -> Telu
{0xC5C60000u, 46u}, // gor -> Latn
{0xC9C60000u, 46u}, // gos -> Latn
{0xCDC60000u, 24u}, // got -> Goth
@@ -566,7 +569,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0xAD070000u, 46u}, // hil -> Latn
{0x81670000u, 46u}, // hla -> Latn
{0xD1670000u, 32u}, // hlu -> Hluw
- {0x8D870000u, 69u}, // hmd -> Plrd
+ {0x8D870000u, 70u}, // hmd -> Plrd
{0xCD870000u, 46u}, // hmt -> Latn
{0x8DA70000u, 1u}, // hnd -> Arab
{0x91A70000u, 18u}, // hne -> Deva
@@ -601,7 +604,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x69670000u, 46u}, // ig -> Latn
{0x84C80000u, 46u}, // igb -> Latn
{0x90C80000u, 46u}, // ige -> Latn
- {0x69690000u, 96u}, // ii -> Yiii
+ {0x69690000u, 97u}, // ii -> Yiii
{0xA5280000u, 46u}, // ijj -> Latn
{0x696B0000u, 46u}, // ik -> Latn
{0xA9480000u, 46u}, // ikk -> Latn
@@ -626,6 +629,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x6A610000u, 36u}, // ja -> Jpan
{0x84090000u, 46u}, // jab -> Latn
{0xB0090000u, 46u}, // jam -> Latn
+ {0xC4090000u, 46u}, // jar -> Latn
{0xB8290000u, 46u}, // jbo -> Latn
{0xD0290000u, 46u}, // jbu -> Latn
{0xB4890000u, 46u}, // jen -> Latn
@@ -661,7 +665,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x906A0000u, 46u}, // kde -> Latn
{0x9C6A0000u, 1u}, // kdh -> Arab
{0xAC6A0000u, 46u}, // kdl -> Latn
- {0xCC6A0000u, 89u}, // kdt -> Thai
+ {0xCC6A0000u, 90u}, // kdt -> Thai
{0x808A0000u, 46u}, // kea -> Latn
{0xB48A0000u, 46u}, // ken -> Latn
{0xE48A0000u, 46u}, // kez -> Latn
@@ -673,7 +677,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x94CA0000u, 46u}, // kgf -> Latn
{0xBCCA0000u, 46u}, // kgp -> Latn
{0x80EA0000u, 46u}, // kha -> Latn
- {0x84EA0000u, 82u}, // khb -> Talu
+ {0x84EA0000u, 83u}, // khb -> Talu
{0xB4EA0000u, 18u}, // khn -> Deva
{0xC0EA0000u, 46u}, // khq -> Latn
{0xC8EA0000u, 46u}, // khs -> Latn
@@ -766,7 +770,8 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x82EA0000u, 46u}, // kxa -> Latn
{0x8AEA0000u, 20u}, // kxc -> Ethi
{0x92EA0000u, 46u}, // kxe -> Latn
- {0xB2EA0000u, 89u}, // kxm -> Thai
+ {0xAEEA0000u, 18u}, // kxl -> Deva
+ {0xB2EA0000u, 90u}, // kxm -> Thai
{0xBEEA0000u, 1u}, // kxp -> Arab
{0xDAEA0000u, 46u}, // kxw -> Latn
{0xE6EA0000u, 46u}, // kxz -> Latn
@@ -775,6 +780,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x6B795452u, 46u}, // ky-TR -> Latn
{0x930A0000u, 46u}, // kye -> Latn
{0xDF0A0000u, 46u}, // kyx -> Latn
+ {0x9F2A0000u, 1u}, // kzh -> Arab
{0xA72A0000u, 46u}, // kzj -> Latn
{0xC72A0000u, 46u}, // kzr -> Latn
{0xCF2A0000u, 46u}, // kzt -> Latn
@@ -790,7 +796,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0xD02B0000u, 46u}, // lbu -> Latn
{0xD82B0000u, 46u}, // lbw -> Latn
{0xB04B0000u, 46u}, // lcm -> Latn
- {0xBC4B0000u, 89u}, // lcp -> Thai
+ {0xBC4B0000u, 90u}, // lcp -> Thai
{0x846B0000u, 46u}, // ldb -> Latn
{0x8C8B0000u, 46u}, // led -> Latn
{0x908B0000u, 46u}, // lee -> Latn
@@ -814,7 +820,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0xCD4B0000u, 46u}, // lkt -> Latn
{0x916B0000u, 46u}, // lle -> Latn
{0xB56B0000u, 46u}, // lln -> Latn
- {0xB58B0000u, 86u}, // lmn -> Telu
+ {0xB58B0000u, 87u}, // lmn -> Telu
{0xB98B0000u, 46u}, // lmo -> Latn
{0xBD8B0000u, 46u}, // lmp -> Latn
{0x6C6E0000u, 46u}, // ln -> Latn
@@ -836,7 +842,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0xE28B0000u, 46u}, // luy -> Latn
{0xE68B0000u, 1u}, // luz -> Arab
{0x6C760000u, 46u}, // lv -> Latn
- {0xAECB0000u, 89u}, // lwl -> Thai
+ {0xAECB0000u, 90u}, // lwl -> Thai
{0x9F2B0000u, 28u}, // lzh -> Hans
{0xE72B0000u, 46u}, // lzz -> Latn
{0x8C0C0000u, 46u}, // mad -> Latn
@@ -927,7 +933,6 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0xBA2C0000u, 57u}, // mro -> Mroo
{0x6D730000u, 46u}, // ms -> Latn
{0x6D734343u, 1u}, // ms-CC -> Arab
- {0x6D734944u, 1u}, // ms-ID -> Arab
{0x6D740000u, 46u}, // mt -> Latn
{0x8A6C0000u, 46u}, // mtc -> Latn
{0x966C0000u, 46u}, // mtf -> Latn
@@ -1006,11 +1011,11 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x9DAD0000u, 46u}, // nnh -> Latn
{0xA9AD0000u, 46u}, // nnk -> Latn
{0xB1AD0000u, 46u}, // nnm -> Latn
- {0xBDAD0000u, 93u}, // nnp -> Wcho
+ {0xBDAD0000u, 94u}, // nnp -> Wcho
{0x6E6F0000u, 46u}, // no -> Latn
{0x8DCD0000u, 44u}, // nod -> Lana
{0x91CD0000u, 18u}, // noe -> Deva
- {0xB5CD0000u, 71u}, // non -> Runr
+ {0xB5CD0000u, 72u}, // non -> Runr
{0xBDCD0000u, 46u}, // nop -> Latn
{0xD1CD0000u, 46u}, // nou -> Latn
{0xBA0D0000u, 60u}, // nqo -> Nkoo
@@ -1044,18 +1049,18 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0xB5AE0000u, 46u}, // onn -> Latn
{0xC9AE0000u, 46u}, // ons -> Latn
{0xB1EE0000u, 46u}, // opm -> Latn
- {0x6F720000u, 64u}, // or -> Orya
+ {0x6F720000u, 65u}, // or -> Orya
{0xBA2E0000u, 46u}, // oro -> Latn
{0xD22E0000u, 1u}, // oru -> Arab
{0x6F730000u, 17u}, // os -> Cyrl
- {0x824E0000u, 65u}, // osa -> Osge
+ {0x824E0000u, 66u}, // osa -> Osge
{0x826E0000u, 1u}, // ota -> Arab
- {0xAA6E0000u, 63u}, // otk -> Orkh
+ {0xAA6E0000u, 64u}, // otk -> Orkh
{0xB32E0000u, 46u}, // ozm -> Latn
{0x70610000u, 27u}, // pa -> Guru
{0x7061504Bu, 1u}, // pa-PK -> Arab
{0x980F0000u, 46u}, // pag -> Latn
- {0xAC0F0000u, 67u}, // pal -> Phli
+ {0xAC0F0000u, 68u}, // pal -> Phli
{0xB00F0000u, 46u}, // pam -> Latn
{0xBC0F0000u, 46u}, // pap -> Latn
{0xD00F0000u, 46u}, // pau -> Latn
@@ -1065,11 +1070,11 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x886F0000u, 46u}, // pdc -> Latn
{0xCC6F0000u, 46u}, // pdt -> Latn
{0x8C8F0000u, 46u}, // ped -> Latn
- {0xB88F0000u, 94u}, // peo -> Xpeo
+ {0xB88F0000u, 95u}, // peo -> Xpeo
{0xDC8F0000u, 46u}, // pex -> Latn
{0xACAF0000u, 46u}, // pfl -> Latn
{0xACEF0000u, 1u}, // phl -> Arab
- {0xB4EF0000u, 68u}, // phn -> Phnx
+ {0xB4EF0000u, 69u}, // phn -> Phnx
{0xAD0F0000u, 46u}, // pil -> Latn
{0xBD0F0000u, 46u}, // pip -> Latn
{0x814F0000u, 8u}, // pka -> Brah
@@ -1105,7 +1110,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0xB4D10000u, 46u}, // rgn -> Latn
{0x98F10000u, 1u}, // rhg -> Arab
{0x81110000u, 46u}, // ria -> Latn
- {0x95110000u, 87u}, // rif -> Tfng
+ {0x95110000u, 88u}, // rif -> Tfng
{0x95114E4Cu, 46u}, // rif-NL -> Latn
{0xC9310000u, 18u}, // rjs -> Deva
{0xCD510000u, 7u}, // rkt -> Beng
@@ -1135,9 +1140,9 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x9C120000u, 17u}, // sah -> Cyrl
{0xC0120000u, 46u}, // saq -> Latn
{0xC8120000u, 46u}, // sas -> Latn
- {0xCC120000u, 46u}, // sat -> Latn
+ {0xCC120000u, 63u}, // sat -> Olck
{0xD4120000u, 46u}, // sav -> Latn
- {0xE4120000u, 74u}, // saz -> Saur
+ {0xE4120000u, 75u}, // saz -> Saur
{0x80320000u, 46u}, // sba -> Latn
{0x90320000u, 46u}, // sbe -> Latn
{0xBC320000u, 46u}, // sbp -> Latn
@@ -1161,11 +1166,11 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0xD8D20000u, 20u}, // sgw -> Ethi
{0xE4D20000u, 46u}, // sgz -> Latn
{0x73680000u, 46u}, // sh -> Latn
- {0xA0F20000u, 87u}, // shi -> Tfng
+ {0xA0F20000u, 88u}, // shi -> Tfng
{0xA8F20000u, 46u}, // shk -> Latn
{0xB4F20000u, 58u}, // shn -> Mymr
{0xD0F20000u, 1u}, // shu -> Arab
- {0x73690000u, 76u}, // si -> Sinh
+ {0x73690000u, 77u}, // si -> Sinh
{0x8D120000u, 46u}, // sid -> Latn
{0x99120000u, 46u}, // sig -> Latn
{0xAD120000u, 46u}, // sil -> Latn
@@ -1184,7 +1189,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x81920000u, 46u}, // sma -> Latn
{0xA5920000u, 46u}, // smj -> Latn
{0xB5920000u, 46u}, // smn -> Latn
- {0xBD920000u, 72u}, // smp -> Samr
+ {0xBD920000u, 73u}, // smp -> Samr
{0xC1920000u, 46u}, // smq -> Latn
{0xC9920000u, 46u}, // sms -> Latn
{0x736E0000u, 46u}, // sn -> Latn
@@ -1194,10 +1199,10 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0xDDB20000u, 46u}, // snx -> Latn
{0xE1B20000u, 46u}, // sny -> Latn
{0x736F0000u, 46u}, // so -> Latn
- {0x99D20000u, 77u}, // sog -> Sogd
+ {0x99D20000u, 78u}, // sog -> Sogd
{0xA9D20000u, 46u}, // sok -> Latn
{0xC1D20000u, 46u}, // soq -> Latn
- {0xD1D20000u, 89u}, // sou -> Thai
+ {0xD1D20000u, 90u}, // sou -> Thai
{0xE1D20000u, 46u}, // soy -> Latn
{0x8DF20000u, 46u}, // spd -> Latn
{0xADF20000u, 46u}, // spl -> Latn
@@ -1208,7 +1213,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x7372524Fu, 46u}, // sr-RO -> Latn
{0x73725255u, 46u}, // sr-RU -> Latn
{0x73725452u, 46u}, // sr-TR -> Latn
- {0x86320000u, 78u}, // srb -> Sora
+ {0x86320000u, 79u}, // srb -> Sora
{0xB6320000u, 46u}, // srn -> Latn
{0xC6320000u, 46u}, // srr -> Latn
{0xDE320000u, 18u}, // srx -> Deva
@@ -1235,9 +1240,9 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0xB6F20000u, 46u}, // sxn -> Latn
{0xDAF20000u, 46u}, // sxw -> Latn
{0xAF120000u, 7u}, // syl -> Beng
- {0xC7120000u, 80u}, // syr -> Syrc
+ {0xC7120000u, 81u}, // syr -> Syrc
{0xAF320000u, 46u}, // szl -> Latn
- {0x74610000u, 83u}, // ta -> Taml
+ {0x74610000u, 84u}, // ta -> Taml
{0xA4130000u, 18u}, // taj -> Deva
{0xAC130000u, 46u}, // tal -> Latn
{0xB4130000u, 46u}, // tan -> Latn
@@ -1251,11 +1256,11 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0xE4330000u, 46u}, // tbz -> Latn
{0xA0530000u, 46u}, // tci -> Latn
{0xE0530000u, 42u}, // tcy -> Knda
- {0x8C730000u, 81u}, // tdd -> Tale
+ {0x8C730000u, 82u}, // tdd -> Tale
{0x98730000u, 18u}, // tdg -> Deva
{0x9C730000u, 18u}, // tdh -> Deva
{0xD0730000u, 46u}, // tdu -> Latn
- {0x74650000u, 86u}, // te -> Telu
+ {0x74650000u, 87u}, // te -> Telu
{0x8C930000u, 46u}, // ted -> Latn
{0xB0930000u, 46u}, // tem -> Latn
{0xB8930000u, 46u}, // teo -> Latn
@@ -1266,7 +1271,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x88D30000u, 46u}, // tgc -> Latn
{0xB8D30000u, 46u}, // tgo -> Latn
{0xD0D30000u, 46u}, // tgu -> Latn
- {0x74680000u, 89u}, // th -> Thai
+ {0x74680000u, 90u}, // th -> Thai
{0xACF30000u, 18u}, // thl -> Deva
{0xC0F30000u, 18u}, // thq -> Deva
{0xC4F30000u, 18u}, // thr -> Deva
@@ -1305,14 +1310,14 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x8E530000u, 25u}, // tsd -> Grek
{0x96530000u, 18u}, // tsf -> Deva
{0x9A530000u, 46u}, // tsg -> Latn
- {0xA6530000u, 90u}, // tsj -> Tibt
+ {0xA6530000u, 91u}, // tsj -> Tibt
{0xDA530000u, 46u}, // tsw -> Latn
{0x74740000u, 17u}, // tt -> Cyrl
{0x8E730000u, 46u}, // ttd -> Latn
{0x92730000u, 46u}, // tte -> Latn
{0xA6730000u, 46u}, // ttj -> Latn
{0xC6730000u, 46u}, // ttr -> Latn
- {0xCA730000u, 89u}, // tts -> Thai
+ {0xCA730000u, 90u}, // tts -> Thai
{0xCE730000u, 46u}, // ttt -> Latn
{0x9E930000u, 46u}, // tuh -> Latn
{0xAE930000u, 46u}, // tul -> Latn
@@ -1323,7 +1328,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0xD2B30000u, 46u}, // tvu -> Latn
{0x9ED30000u, 46u}, // twh -> Latn
{0xC2D30000u, 46u}, // twq -> Latn
- {0x9AF30000u, 84u}, // txg -> Tang
+ {0x9AF30000u, 85u}, // txg -> Tang
{0x74790000u, 46u}, // ty -> Latn
{0x83130000u, 46u}, // tya -> Latn
{0xD7130000u, 17u}, // tyv -> Cyrl
@@ -1333,7 +1338,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x75670000u, 1u}, // ug -> Arab
{0x75674B5Au, 17u}, // ug-KZ -> Cyrl
{0x75674D4Eu, 17u}, // ug-MN -> Cyrl
- {0x80D40000u, 91u}, // uga -> Ugar
+ {0x80D40000u, 92u}, // uga -> Ugar
{0x756B0000u, 17u}, // uk -> Cyrl
{0xA1740000u, 46u}, // uli -> Latn
{0x85940000u, 46u}, // umb -> Latn
@@ -1346,6 +1351,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0xCE340000u, 46u}, // urt -> Latn
{0xDA340000u, 46u}, // urw -> Latn
{0x82540000u, 46u}, // usa -> Latn
+ {0x9E740000u, 46u}, // uth -> Latn
{0xC6740000u, 46u}, // utr -> Latn
{0x9EB40000u, 46u}, // uvh -> Latn
{0xAEB40000u, 46u}, // uvl -> Latn
@@ -1353,7 +1359,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x757A4146u, 1u}, // uz-AF -> Arab
{0x757A434Eu, 17u}, // uz-CN -> Cyrl
{0x98150000u, 46u}, // vag -> Latn
- {0xA0150000u, 92u}, // vai -> Vaii
+ {0xA0150000u, 93u}, // vai -> Vaii
{0xB4150000u, 46u}, // van -> Latn
{0x76650000u, 46u}, // ve -> Latn
{0x88950000u, 46u}, // vec -> Latn
@@ -1376,7 +1382,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0xB4160000u, 46u}, // wan -> Latn
{0xC4160000u, 46u}, // war -> Latn
{0xBC360000u, 46u}, // wbp -> Latn
- {0xC0360000u, 86u}, // wbq -> Telu
+ {0xC0360000u, 87u}, // wbq -> Telu
{0xC4360000u, 18u}, // wbr -> Deva
{0xA0560000u, 46u}, // wci -> Latn
{0xC4960000u, 46u}, // wer -> Latn
@@ -1418,9 +1424,9 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0xC5B70000u, 18u}, // xnr -> Deva
{0x99D70000u, 46u}, // xog -> Latn
{0xB5D70000u, 46u}, // xon -> Latn
- {0xC5F70000u, 70u}, // xpr -> Prti
+ {0xC5F70000u, 71u}, // xpr -> Prti
{0x86370000u, 46u}, // xrb -> Latn
- {0x82570000u, 73u}, // xsa -> Sarb
+ {0x82570000u, 74u}, // xsa -> Sarb
{0xA2570000u, 46u}, // xsi -> Latn
{0xB2570000u, 46u}, // xsm -> Latn
{0xC6570000u, 18u}, // xsr -> Deva
@@ -1461,7 +1467,7 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x98190000u, 46u}, // zag -> Latn
{0xA4790000u, 1u}, // zdj -> Arab
{0x80990000u, 46u}, // zea -> Latn
- {0x9CD90000u, 87u}, // zgh -> Tfng
+ {0x9CD90000u, 88u}, // zgh -> Tfng
{0x7A680000u, 28u}, // zh -> Hans
{0x7A684155u, 29u}, // zh-AU -> Hant
{0x7A68424Eu, 29u}, // zh-BN -> Hant
@@ -1470,7 +1476,6 @@ const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
{0x7A68484Bu, 29u}, // zh-HK -> Hant
{0x7A684944u, 29u}, // zh-ID -> Hant
{0x7A684D4Fu, 29u}, // zh-MO -> Hant
- {0x7A684D59u, 29u}, // zh-MY -> Hant
{0x7A685041u, 29u}, // zh-PA -> Hant
{0x7A685046u, 29u}, // zh-PF -> Hant
{0x7A685048u, 29u}, // zh-PH -> Hant
@@ -1592,6 +1597,7 @@ std::unordered_set<uint64_t> REPRESENTATIVE_LOCALES({
0xD701434D4C61746ELLU, // byv_Latn_CM
0x93214D4C4C61746ELLU, // bze_Latn_ML
0x636145534C61746ELLU, // ca_Latn_ES
+ 0x8C0255534C61746ELLU, // cad_Latn_US
0x9C424E474C61746ELLU, // cch_Latn_NG
0xBC42424443616B6DLLU, // ccp_Cakm_BD
0x636552554379726CLLU, // ce_Cyrl_RU
@@ -1627,6 +1633,7 @@ std::unordered_set<uint64_t> REPRESENTATIVE_LOCALES({
0x637652554379726CLLU, // cv_Cyrl_RU
0x637947424C61746ELLU, // cy_Latn_GB
0x6461444B4C61746ELLU, // da_Latn_DK
+ 0x940343494C61746ELLU, // daf_Latn_CI
0xA80355534C61746ELLU, // dak_Latn_US
0xC40352554379726CLLU, // dar_Cyrl_RU
0xD4034B454C61746ELLU, // dav_Latn_KE
@@ -1636,7 +1643,7 @@ std::unordered_set<uint64_t> REPRESENTATIVE_LOCALES({
0xC4C343414C61746ELLU, // dgr_Latn_CA
0x91234E454C61746ELLU, // dje_Latn_NE
0xA5A343494C61746ELLU, // dnj_Latn_CI
- 0xA1C3494E41726162LLU, // doi_Arab_IN
+ 0xA1C3494E44657661LLU, // doi_Deva_IN
0x9E23434E4D6F6E67LLU, // drh_Mong_CN
0x864344454C61746ELLU, // dsb_Latn_DE
0xB2634D4C4C61746ELLU, // dtm_Latn_ML
@@ -1839,6 +1846,7 @@ std::unordered_set<uint64_t> REPRESENTATIVE_LOCALES({
0xC6AA49444C61746ELLU, // kvr_Latn_ID
0xDEAA504B41726162LLU, // kvx_Arab_PK
0x6B7747424C61746ELLU, // kw_Latn_GB
+ 0xAEEA494E44657661LLU, // kxl_Deva_IN
0xB2EA544854686169LLU, // kxm_Thai_TH
0xBEEA504B41726162LLU, // kxp_Arab_PK
0x6B79434E41726162LLU, // ky_Arab_CN
@@ -2047,7 +2055,7 @@ std::unordered_set<uint64_t> REPRESENTATIVE_LOCALES({
0x9C1252554379726CLLU, // sah_Cyrl_RU
0xC0124B454C61746ELLU, // saq_Latn_KE
0xC81249444C61746ELLU, // sas_Latn_ID
- 0xCC12494E4C61746ELLU, // sat_Latn_IN
+ 0xCC12494E4F6C636BLLU, // sat_Olck_IN
0xD412534E4C61746ELLU, // sav_Latn_SN
0xE412494E53617572LLU, // saz_Saur_IN
0xBC32545A4C61746ELLU, // sbp_Latn_TZ
@@ -2149,6 +2157,7 @@ std::unordered_set<uint64_t> REPRESENTATIVE_LOCALES({
0x747254524C61746ELLU, // tr_Latn_TR
0xD23354524C61746ELLU, // tru_Latn_TR
0xD63354574C61746ELLU, // trv_Latn_TW
+ 0xDA33504B41726162LLU, // trw_Arab_PK
0x74735A414C61746ELLU, // ts_Latn_ZA
0x8E5347524772656BLLU, // tsd_Grek_GR
0x96534E5044657661LLU, // tsf_Deva_NP
diff --git a/libs/androidfw/ResourceTypes.cpp b/libs/androidfw/ResourceTypes.cpp
index bce70e2aae9e..223382731bc0 100644
--- a/libs/androidfw/ResourceTypes.cpp
+++ b/libs/androidfw/ResourceTypes.cpp
@@ -30,6 +30,7 @@
#include <memory>
#include <set>
#include <type_traits>
+#include <vector>
#include <android-base/macros.h>
#include <androidfw/ByteBucketArray.h>
@@ -1029,7 +1030,7 @@ base::expected<size_t, NullOrIOError> ResStringPool::indexOfString(const char16_
// But we don't want to hit the cache, so instead we will have a
// local temporary allocation for the conversions.
size_t convBufferLen = strLen + 4;
- char16_t* convBuffer = (char16_t*)calloc(convBufferLen, sizeof(char16_t));
+ std::vector<char16_t> convBuffer(convBufferLen);
ssize_t l = 0;
ssize_t h = mHeader->stringCount-1;
@@ -1043,8 +1044,8 @@ base::expected<size_t, NullOrIOError> ResStringPool::indexOfString(const char16_
}
if (s.has_value()) {
char16_t* end = utf8_to_utf16(reinterpret_cast<const uint8_t*>(s->data()),
- s->size(), convBuffer, convBufferLen);
- c = strzcmp16(convBuffer, end-convBuffer, str, strLen);
+ s->size(), convBuffer.data(), convBufferLen);
+ c = strzcmp16(convBuffer.data(), end-convBuffer.data(), str, strLen);
}
if (kDebugStringPoolNoisy) {
ALOGI("Looking at %s, cmp=%d, l/mid/h=%d/%d/%d\n",
@@ -1054,7 +1055,6 @@ base::expected<size_t, NullOrIOError> ResStringPool::indexOfString(const char16_
if (kDebugStringPoolNoisy) {
ALOGI("MATCH!");
}
- free(convBuffer);
return mid;
} else if (c < 0) {
l = mid + 1;
@@ -1062,7 +1062,6 @@ base::expected<size_t, NullOrIOError> ResStringPool::indexOfString(const char16_
h = mid - 1;
}
}
- free(convBuffer);
} else {
// It is unusual to get the ID from an unsorted string block...
// most often this happens because we want to get IDs for style
diff --git a/packages/Connectivity/framework/Android.bp b/packages/Connectivity/framework/Android.bp
new file mode 100644
index 000000000000..8db8d7699a1e
--- /dev/null
+++ b/packages/Connectivity/framework/Android.bp
@@ -0,0 +1,29 @@
+//
+// Copyright (C) 2020 The Android Open Source Project
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+//
+
+// TODO: use a java_library in the bootclasspath instead
+filegroup {
+ name: "framework-connectivity-sources",
+ srcs: [
+ "src/**/*.java",
+ "src/**/*.aidl",
+ ],
+ path: "src",
+ visibility: [
+ "//frameworks/base",
+ "//packages/modules/Connectivity:__subpackages__",
+ ],
+} \ No newline at end of file
diff --git a/packages/Connectivity/framework/src/com/android/connectivity/aidl/INetworkAgent.aidl b/packages/Connectivity/framework/src/com/android/connectivity/aidl/INetworkAgent.aidl
new file mode 100644
index 000000000000..64b556720cd2
--- /dev/null
+++ b/packages/Connectivity/framework/src/com/android/connectivity/aidl/INetworkAgent.aidl
@@ -0,0 +1,49 @@
+/**
+ * Copyright (c) 2020, The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing perNmissions and
+ * limitations under the License.
+ */
+package com.android.connectivity.aidl;
+
+import android.net.NattKeepalivePacketData;
+import android.net.QosFilterParcelable;
+import android.net.TcpKeepalivePacketData;
+
+import com.android.connectivity.aidl.INetworkAgentRegistry;
+
+/**
+ * Interface to notify NetworkAgent of connectivity events.
+ * @hide
+ */
+oneway interface INetworkAgent {
+ void onRegistered(in INetworkAgentRegistry registry);
+ void onDisconnected();
+ void onBandwidthUpdateRequested();
+ void onValidationStatusChanged(int validationStatus,
+ in @nullable String captivePortalUrl);
+ void onSaveAcceptUnvalidated(boolean acceptUnvalidated);
+ void onStartNattSocketKeepalive(int slot, int intervalDurationMs,
+ in NattKeepalivePacketData packetData);
+ void onStartTcpSocketKeepalive(int slot, int intervalDurationMs,
+ in TcpKeepalivePacketData packetData);
+ void onStopSocketKeepalive(int slot);
+ void onSignalStrengthThresholdsUpdated(in int[] thresholds);
+ void onPreventAutomaticReconnect();
+ void onAddNattKeepalivePacketFilter(int slot,
+ in NattKeepalivePacketData packetData);
+ void onAddTcpKeepalivePacketFilter(int slot,
+ in TcpKeepalivePacketData packetData);
+ void onRemoveKeepalivePacketFilter(int slot);
+ void onQosFilterCallbackRegistered(int qosCallbackId, in QosFilterParcelable filterParcel);
+ void onQosCallbackUnregistered(int qosCallbackId);
+}
diff --git a/packages/Connectivity/framework/src/com/android/connectivity/aidl/INetworkAgentRegistry.aidl b/packages/Connectivity/framework/src/com/android/connectivity/aidl/INetworkAgentRegistry.aidl
new file mode 100644
index 000000000000..f0193db5c2e2
--- /dev/null
+++ b/packages/Connectivity/framework/src/com/android/connectivity/aidl/INetworkAgentRegistry.aidl
@@ -0,0 +1,41 @@
+/**
+ * Copyright (c) 2020, The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing perNmissions and
+ * limitations under the License.
+ */
+package com.android.connectivity.aidl;
+
+import android.net.LinkProperties;
+import android.net.Network;
+import android.net.NetworkCapabilities;
+import android.net.NetworkInfo;
+import android.net.QosSession;
+import android.telephony.data.EpsBearerQosSessionAttributes;
+
+/**
+ * Interface for NetworkAgents to send network network properties.
+ * @hide
+ */
+oneway interface INetworkAgentRegistry {
+ void sendNetworkCapabilities(in NetworkCapabilities nc);
+ void sendLinkProperties(in LinkProperties lp);
+ // TODO: consider replacing this by "markConnected()" and removing
+ void sendNetworkInfo(in NetworkInfo info);
+ void sendScore(int score);
+ void sendExplicitlySelected(boolean explicitlySelected, boolean acceptPartial);
+ void sendSocketKeepaliveEvent(int slot, int reason);
+ void sendUnderlyingNetworks(in @nullable List<Network> networks);
+ void sendEpsQosSessionAvailable(int callbackId, in QosSession session, in EpsBearerQosSessionAttributes attributes);
+ void sendQosSessionLost(int qosCallbackId, in QosSession session);
+ void sendQosCallbackError(int qosCallbackId, int exceptionType);
+}
diff --git a/packages/DynamicSystemInstallationService/src/com/android/dynsystem/BootCompletedReceiver.java b/packages/DynamicSystemInstallationService/src/com/android/dynsystem/BootCompletedReceiver.java
index 06c52942e671..fcee98d0bd0b 100644
--- a/packages/DynamicSystemInstallationService/src/com/android/dynsystem/BootCompletedReceiver.java
+++ b/packages/DynamicSystemInstallationService/src/com/android/dynsystem/BootCompletedReceiver.java
@@ -19,11 +19,8 @@ package com.android.dynsystem;
import android.content.BroadcastReceiver;
import android.content.Context;
import android.content.Intent;
-import android.os.SystemProperties;
import android.os.UserHandle;
import android.os.image.DynamicSystemClient;
-import android.os.image.DynamicSystemManager;
-import android.util.FeatureFlagUtils;
/**
@@ -43,24 +40,10 @@ public class BootCompletedReceiver extends BroadcastReceiver {
return;
}
- DynamicSystemManager dynSystem =
- (DynamicSystemManager) context.getSystemService(Context.DYNAMIC_SYSTEM_SERVICE);
-
- boolean isInUse = (dynSystem != null) && dynSystem.isInUse();
-
- if (!isInUse && !featureFlagEnabled()) {
- return;
- }
-
Intent startServiceIntent = new Intent(
context, DynamicSystemInstallationService.class);
startServiceIntent.setAction(DynamicSystemClient.ACTION_NOTIFY_IF_IN_USE);
context.startServiceAsUser(startServiceIntent, UserHandle.SYSTEM);
}
-
- private boolean featureFlagEnabled() {
- return SystemProperties.getBoolean(
- FeatureFlagUtils.PERSIST_PREFIX + FeatureFlagUtils.DYNAMIC_SYSTEM, false);
- }
}
diff --git a/packages/DynamicSystemInstallationService/src/com/android/dynsystem/VerificationActivity.java b/packages/DynamicSystemInstallationService/src/com/android/dynsystem/VerificationActivity.java
index 82ea7449bf6d..64e42cc595ec 100644
--- a/packages/DynamicSystemInstallationService/src/com/android/dynsystem/VerificationActivity.java
+++ b/packages/DynamicSystemInstallationService/src/com/android/dynsystem/VerificationActivity.java
@@ -22,10 +22,8 @@ import android.content.Context;
import android.content.Intent;
import android.net.Uri;
import android.os.Bundle;
-import android.os.SystemProperties;
import android.os.UserHandle;
import android.os.image.DynamicSystemClient;
-import android.util.FeatureFlagUtils;
import android.util.Log;
/**
@@ -46,12 +44,6 @@ public class VerificationActivity extends Activity {
protected void onCreate(Bundle savedInstanceState) {
super.onCreate(savedInstanceState);
- if (!featureFlagEnabled()) {
- Log.w(TAG, FeatureFlagUtils.DYNAMIC_SYSTEM + " not enabled; activity aborted.");
- finish();
- return;
- }
-
KeyguardManager km = (KeyguardManager) getSystemService(Context.KEYGUARD_SERVICE);
if (km != null) {
@@ -101,11 +93,6 @@ public class VerificationActivity extends Activity {
startServiceAsUser(intent, UserHandle.SYSTEM);
}
- private boolean featureFlagEnabled() {
- return SystemProperties.getBoolean(
- FeatureFlagUtils.PERSIST_PREFIX + FeatureFlagUtils.DYNAMIC_SYSTEM, false);
- }
-
static boolean isVerified(String url) {
if (url == null) return true;
return sVerifiedUrl != null && sVerifiedUrl.equals(url);
diff --git a/packages/SystemUI/Android.bp b/packages/SystemUI/Android.bp
index 6ecf303c6dc8..249b1946d435 100644
--- a/packages/SystemUI/Android.bp
+++ b/packages/SystemUI/Android.bp
@@ -45,7 +45,7 @@ android_library {
"WindowManager-Shell",
"SystemUIPluginLib",
"SystemUISharedLib",
- "SystemUI-statsd",
+ "SystemUI-statsd",
"SettingsLib",
"androidx.viewpager2_viewpager2",
"androidx.legacy_legacy-support-v4",
diff --git a/services/OWNERS b/services/OWNERS
index 88d0b61a2ab6..03e0807eea62 100644
--- a/services/OWNERS
+++ b/services/OWNERS
@@ -1 +1,6 @@
per-file Android.bp = file:platform/build/soong:/OWNERS
+
+# art-team@ manages the system server profile
+per-file art-profile* = calin@google.com, mathieuc@google.com, ngeoffray@google.com
+
+per-file java/com/android/server/* = toddke@google.com
diff --git a/services/core/Android.bp b/services/core/Android.bp
index adebcc7ee54e..4bebe399b8bc 100644
--- a/services/core/Android.bp
+++ b/services/core/Android.bp
@@ -84,6 +84,7 @@ java_library_static {
":storaged_aidl",
":vold_aidl",
":platform-compat-config",
+ ":platform-compat-overrides",
":display-device-config",
"java/com/android/server/EventLogTags.logtags",
"java/com/android/server/am/EventLogTags.logtags",
@@ -203,6 +204,8 @@ filegroup {
"java/com/android/server/connectivity/NetworkRanker.java",
"java/com/android/server/connectivity/PermissionMonitor.java",
"java/com/android/server/connectivity/ProxyTracker.java",
+ "java/com/android/server/connectivity/QosCallbackAgentConnection.java",
+ "java/com/android/server/connectivity/QosCallbackTracker.java",
"java/com/android/server/connectivity/TcpKeepaliveController.java",
"java/com/android/server/connectivity/Vpn.java",
"java/com/android/server/connectivity/VpnIkev2Utils.java",
diff --git a/services/core/java/com/android/server/ConnectivityService.java b/services/core/java/com/android/server/ConnectivityService.java
index b07e98f60237..410ec1d3a267 100644
--- a/services/core/java/com/android/server/ConnectivityService.java
+++ b/services/core/java/com/android/server/ConnectivityService.java
@@ -94,6 +94,7 @@ import android.net.INetworkMonitor;
import android.net.INetworkMonitorCallbacks;
import android.net.INetworkPolicyListener;
import android.net.INetworkStatsService;
+import android.net.IQosCallback;
import android.net.ISocketKeepaliveCallback;
import android.net.InetAddresses;
import android.net.IpMemoryStore;
@@ -121,6 +122,10 @@ import android.net.NetworkUtils;
import android.net.NetworkWatchlistManager;
import android.net.PrivateDnsConfigParcel;
import android.net.ProxyInfo;
+import android.net.QosCallbackException;
+import android.net.QosFilter;
+import android.net.QosSocketFilter;
+import android.net.QosSocketInfo;
import android.net.RouteInfo;
import android.net.RouteInfoParcel;
import android.net.SocketKeepalive;
@@ -128,6 +133,7 @@ import android.net.TetheringManager;
import android.net.UidRange;
import android.net.UidRangeParcel;
import android.net.Uri;
+import android.net.VpnInfo;
import android.net.VpnManager;
import android.net.VpnService;
import android.net.metrics.INetdEventListener;
@@ -179,7 +185,6 @@ import com.android.internal.app.IBatteryStats;
import com.android.internal.logging.MetricsLogger;
import com.android.internal.net.LegacyVpnInfo;
import com.android.internal.net.VpnConfig;
-import com.android.internal.net.VpnInfo;
import com.android.internal.net.VpnProfile;
import com.android.internal.util.ArrayUtils;
import com.android.internal.util.AsyncChannel;
@@ -204,6 +209,7 @@ import com.android.server.connectivity.NetworkNotificationManager.NotificationTy
import com.android.server.connectivity.NetworkRanker;
import com.android.server.connectivity.PermissionMonitor;
import com.android.server.connectivity.ProxyTracker;
+import com.android.server.connectivity.QosCallbackTracker;
import com.android.server.connectivity.Vpn;
import com.android.server.net.BaseNetworkObserver;
import com.android.server.net.LockdownVpnTracker;
@@ -279,6 +285,10 @@ public class ConnectivityService extends IConnectivityManager.Stub
// Default to 30s linger time-out. Modifiable only for testing.
private static final String LINGER_DELAY_PROPERTY = "persist.netmon.linger";
private static final int DEFAULT_LINGER_DELAY_MS = 30_000;
+
+ // The maximum number of network request allowed per uid before an exception is thrown.
+ private static final int MAX_NETWORK_REQUESTS_PER_UID = 100;
+
@VisibleForTesting
protected int mLingerDelayMs; // Can't be final, or test subclass constructors can't change it.
@@ -291,6 +301,8 @@ public class ConnectivityService extends IConnectivityManager.Stub
@VisibleForTesting
protected final PermissionMonitor mPermissionMonitor;
+ private final PerUidCounter mNetworkRequestCounter;
+
private KeyStore mKeyStore;
@VisibleForTesting
@@ -313,6 +325,8 @@ public class ConnectivityService extends IConnectivityManager.Stub
private boolean mRestrictBackground;
private final Context mContext;
+ // The Context is created for UserHandle.ALL.
+ private final Context mUserAllContext;
private final Dependencies mDeps;
// 0 is full bad, 100 is full good
private int mDefaultInetConditionPublished = 0;
@@ -614,6 +628,7 @@ public class ConnectivityService extends IConnectivityManager.Stub
private final LocationPermissionChecker mLocationPermissionChecker;
private KeepaliveTracker mKeepaliveTracker;
+ private QosCallbackTracker mQosCallbackTracker;
private NetworkNotificationManager mNotifier;
private LingerMonitor mLingerMonitor;
@@ -858,6 +873,66 @@ public class ConnectivityService extends IConnectivityManager.Stub
};
/**
+ * Keeps track of the number of requests made under different uids.
+ */
+ public static class PerUidCounter {
+ private final int mMaxCountPerUid;
+
+ // Map from UID to number of NetworkRequests that UID has filed.
+ @GuardedBy("mUidToNetworkRequestCount")
+ private final SparseIntArray mUidToNetworkRequestCount = new SparseIntArray();
+
+ /**
+ * Constructor
+ *
+ * @param maxCountPerUid the maximum count per uid allowed
+ */
+ public PerUidCounter(final int maxCountPerUid) {
+ mMaxCountPerUid = maxCountPerUid;
+ }
+
+ /**
+ * Increments the request count of the given uid. Throws an exception if the number
+ * of open requests for the uid exceeds the value of maxCounterPerUid which is the value
+ * passed into the constructor. see: {@link #PerUidCounter(int)}.
+ *
+ * @throws ServiceSpecificException with
+ * {@link ConnectivityManager.Errors.TOO_MANY_REQUESTS} if the number of requests for
+ * the uid exceed the allowed number.
+ *
+ * @param uid the uid that the request was made under
+ */
+ public void incrementCountOrThrow(final int uid) {
+ synchronized (mUidToNetworkRequestCount) {
+ final int networkRequests = mUidToNetworkRequestCount.get(uid, 0) + 1;
+ if (networkRequests >= mMaxCountPerUid) {
+ throw new ServiceSpecificException(
+ ConnectivityManager.Errors.TOO_MANY_REQUESTS);
+ }
+ mUidToNetworkRequestCount.put(uid, networkRequests);
+ }
+ }
+
+ /**
+ * Decrements the request count of the given uid.
+ *
+ * @param uid the uid that the request was made under
+ */
+ public void decrementCount(final int uid) {
+ synchronized (mUidToNetworkRequestCount) {
+ final int requests = mUidToNetworkRequestCount.get(uid, 0);
+ if (requests < 1) {
+ logwtf("BUG: too small request count " + requests + " for UID " + uid);
+ } else if (requests == 1) {
+ mUidToNetworkRequestCount.delete(uid);
+ } else {
+ mUidToNetworkRequestCount.put(uid, requests - 1);
+ }
+ }
+ }
+ }
+
+ /**
* Dependencies of ConnectivityService, for injection in tests.
*/
@VisibleForTesting
@@ -945,6 +1020,7 @@ public class ConnectivityService extends IConnectivityManager.Stub
mSystemProperties = mDeps.getSystemProperties();
mNetIdManager = mDeps.makeNetIdManager();
mContext = Objects.requireNonNull(context, "missing Context");
+ mNetworkRequestCounter = new PerUidCounter(MAX_NETWORK_REQUESTS_PER_UID);
mMetricsLog = logger;
mDefaultRequest = createDefaultInternetRequestForTransport(-1, NetworkRequest.Type.REQUEST);
@@ -1086,8 +1162,8 @@ public class ConnectivityService extends IConnectivityManager.Stub
intentFilter.addAction(Intent.ACTION_USER_REMOVED);
intentFilter.addAction(Intent.ACTION_USER_UNLOCKED);
- final Context userAllContext = mContext.createContextAsUser(UserHandle.ALL, 0 /* flags */);
- userAllContext.registerReceiver(
+ mUserAllContext = mContext.createContextAsUser(UserHandle.ALL, 0 /* flags */);
+ mUserAllContext.registerReceiver(
mIntentReceiver,
intentFilter,
null /* broadcastPermission */,
@@ -1103,7 +1179,7 @@ public class ConnectivityService extends IConnectivityManager.Stub
intentFilter.addAction(Intent.ACTION_PACKAGE_REPLACED);
intentFilter.addAction(Intent.ACTION_PACKAGE_REMOVED);
intentFilter.addDataScheme("package");
- userAllContext.registerReceiver(
+ mUserAllContext.registerReceiver(
mIntentReceiver,
intentFilter,
null /* broadcastPermission */,
@@ -1112,7 +1188,7 @@ public class ConnectivityService extends IConnectivityManager.Stub
// Listen to lockdown VPN reset.
intentFilter = new IntentFilter();
intentFilter.addAction(LockdownVpnTracker.ACTION_LOCKDOWN_RESET);
- userAllContext.registerReceiver(
+ mUserAllContext.registerReceiver(
mIntentReceiver, intentFilter, NETWORK_STACK, mHandler);
mNetworkActivityTracker = new LegacyNetworkActivityTracker(mContext, mNMS);
@@ -1125,6 +1201,7 @@ public class ConnectivityService extends IConnectivityManager.Stub
mKeepaliveTracker = new KeepaliveTracker(mContext, mHandler);
mNotifier = new NetworkNotificationManager(mContext, mTelephonyManager);
+ mQosCallbackTracker = new QosCallbackTracker(mHandler, mNetworkRequestCounter);
final int dailyLimit = Settings.Global.getInt(mContext.getContentResolver(),
Settings.Global.NETWORK_SWITCH_NOTIFICATION_DAILY_LIMIT,
@@ -1381,9 +1458,8 @@ public class ConnectivityService extends IConnectivityManager.Stub
return;
}
final String action = blocked ? "BLOCKED" : "UNBLOCKED";
- final NetworkRequest satisfiedRequest = nri.getSatisfiedRequest();
- final int requestId = satisfiedRequest != null
- ? satisfiedRequest.requestId : nri.mRequests.get(0).requestId;
+ final int requestId = nri.getActiveRequest() != null
+ ? nri.getActiveRequest().requestId : nri.mRequests.get(0).requestId;
mNetworkInfoBlockingLogs.log(String.format(
"%s %d(%d) on netId %d", action, nri.mUid, requestId, net.getNetId()));
}
@@ -2275,7 +2351,7 @@ public class ConnectivityService extends IConnectivityManager.Stub
intent.addFlags(Intent.FLAG_RECEIVER_VISIBLE_TO_INSTANT_APPS);
}
try {
- mContext.sendStickyBroadcastAsUser(intent, UserHandle.ALL, options);
+ mUserAllContext.sendStickyBroadcast(intent, options);
} finally {
Binder.restoreCallingIdentity(ident);
}
@@ -2653,7 +2729,7 @@ public class ConnectivityService extends IConnectivityManager.Stub
@VisibleForTesting
NetworkRequestInfo[] requestsSortedById() {
NetworkRequestInfo[] requests = new NetworkRequestInfo[0];
- requests = mNetworkRequests.values().toArray(requests);
+ requests = getNrisFromGlobalRequests().toArray(requests);
// Sort the array based off the NRI containing the min requestId in its requests.
Arrays.sort(requests,
Comparator.comparingInt(nri -> Collections.min(nri.mRequests,
@@ -2777,6 +2853,7 @@ public class ConnectivityService extends IConnectivityManager.Stub
updateCapabilitiesForNetwork(nai);
notifyIfacesChangedForNetworkStats();
}
+ break;
}
}
}
@@ -3338,6 +3415,8 @@ public class ConnectivityService extends IConnectivityManager.Stub
// of rematchAllNetworksAndRequests
notifyNetworkCallbacks(nai, ConnectivityManager.CALLBACK_LOST);
mKeepaliveTracker.handleStopAllKeepalives(nai, SocketKeepalive.ERROR_INVALID_NETWORK);
+
+ mQosCallbackTracker.handleNetworkReleased(nai.network);
for (String iface : nai.linkProperties.getAllInterfaceNames()) {
// Disable wakeup packet monitoring for each interface.
wakeupModifyInterface(iface, nai.networkCapabilities, false);
@@ -3355,10 +3434,10 @@ public class ConnectivityService extends IConnectivityManager.Stub
for (int i = 0; i < nai.numNetworkRequests(); i++) {
NetworkRequest request = nai.requestAt(i);
final NetworkRequestInfo nri = mNetworkRequests.get(request);
- final NetworkAgentInfo currentNetwork = nri.mSatisfier;
+ final NetworkAgentInfo currentNetwork = nri.getSatisfier();
if (currentNetwork != null
&& currentNetwork.network.getNetId() == nai.network.getNetId()) {
- nri.mSatisfier = null;
+ nri.setSatisfier(null, null);
sendUpdatedScoreToFactories(request, null);
}
}
@@ -3436,42 +3515,63 @@ public class ConnectivityService extends IConnectivityManager.Stub
return null;
}
- private void handleRegisterNetworkRequestWithIntent(Message msg) {
+ private void handleRegisterNetworkRequestWithIntent(@NonNull final Message msg) {
final NetworkRequestInfo nri = (NetworkRequestInfo) (msg.obj);
-
- NetworkRequestInfo existingRequest = findExistingNetworkRequestInfo(nri.mPendingIntent);
+ // handleRegisterNetworkRequestWithIntent() doesn't apply to multilayer requests.
+ ensureNotMultilayerRequest(nri, "handleRegisterNetworkRequestWithIntent");
+ final NetworkRequestInfo existingRequest =
+ findExistingNetworkRequestInfo(nri.mPendingIntent);
if (existingRequest != null) { // remove the existing request.
- if (DBG) log("Replacing " + existingRequest.request + " with "
- + nri.request + " because their intents matched.");
- handleReleaseNetworkRequest(existingRequest.request, getCallingUid(),
+ if (DBG) {
+ log("Replacing " + existingRequest.mRequests.get(0) + " with "
+ + nri.mRequests.get(0) + " because their intents matched.");
+ }
+ handleReleaseNetworkRequest(existingRequest.mRequests.get(0), getCallingUid(),
/* callOnUnavailable */ false);
}
handleRegisterNetworkRequest(nri);
}
- private void handleRegisterNetworkRequest(NetworkRequestInfo nri) {
+ private void handleRegisterNetworkRequest(@NonNull final NetworkRequestInfo nri) {
ensureRunningOnConnectivityServiceThread();
- mNetworkRequests.put(nri.request, nri);
mNetworkRequestInfoLogs.log("REGISTER " + nri);
- if (nri.request.isListen()) {
- for (NetworkAgentInfo network : mNetworkAgentInfos) {
- if (nri.request.networkCapabilities.hasSignalStrength() &&
- network.satisfiesImmutableCapabilitiesOf(nri.request)) {
- updateSignalStrengthThresholds(network, "REGISTER", nri.request);
+ for (final NetworkRequest req : nri.mRequests) {
+ mNetworkRequests.put(req, nri);
+ if (req.isListen()) {
+ for (final NetworkAgentInfo network : mNetworkAgentInfos) {
+ if (req.networkCapabilities.hasSignalStrength()
+ && network.satisfiesImmutableCapabilitiesOf(req)) {
+ updateSignalStrengthThresholds(network, "REGISTER", req);
+ }
}
}
}
rematchAllNetworksAndRequests();
- if (nri.request.isRequest() && nri.mSatisfier == null) {
- sendUpdatedScoreToFactories(nri.request, null);
+ // If an active request exists, return as its score has already been sent if needed.
+ if (null != nri.getActiveRequest()) {
+ return;
+ }
+
+ // As this request was not satisfied on rematch and thus never had any scores sent to the
+ // factories, send null now for each request of type REQUEST.
+ for (final NetworkRequest req : nri.mRequests) {
+ if (!req.isRequest()) {
+ continue;
+ }
+ sendUpdatedScoreToFactories(req, null);
}
}
- private void handleReleaseNetworkRequestWithIntent(PendingIntent pendingIntent,
- int callingUid) {
- NetworkRequestInfo nri = findExistingNetworkRequestInfo(pendingIntent);
+ private void handleReleaseNetworkRequestWithIntent(@NonNull final PendingIntent pendingIntent,
+ final int callingUid) {
+ final NetworkRequestInfo nri = findExistingNetworkRequestInfo(pendingIntent);
if (nri != null) {
- handleReleaseNetworkRequest(nri.request, callingUid, /* callOnUnavailable */ false);
+ // handleReleaseNetworkRequestWithIntent() paths don't apply to multilayer requests.
+ ensureNotMultilayerRequest(nri, "handleReleaseNetworkRequestWithIntent");
+ handleReleaseNetworkRequest(
+ nri.mRequests.get(0),
+ callingUid,
+ /* callOnUnavailable */ false);
}
}
@@ -3525,6 +3625,11 @@ public class ConnectivityService extends IConnectivityManager.Stub
return false;
}
for (final NetworkRequest req : nri.mRequests) {
+ // This multilayer listen request is satisfied therefore no further requests need to be
+ // evaluated deeming this network not a potential satisfier.
+ if (req.isListen() && nri.getActiveRequest() == req) {
+ return false;
+ }
// As non-multilayer listen requests have already returned, the below would only happen
// for a multilayer request therefore continue to the next request if available.
if (req.isListen()) {
@@ -3545,7 +3650,7 @@ public class ConnectivityService extends IConnectivityManager.Stub
// 2. Unvalidated WiFi will not be reaped when validated cellular
// is currently satisfying the request. This is desirable when
// WiFi ends up validating and out scoring cellular.
- || nri.mSatisfier.getCurrentScore()
+ || nri.getSatisfier().getCurrentScore()
< candidate.getCurrentScoreAsValidated();
return isNetworkNeeded;
}
@@ -3570,30 +3675,45 @@ public class ConnectivityService extends IConnectivityManager.Stub
return nri;
}
- private void handleTimedOutNetworkRequest(final NetworkRequestInfo nri) {
+ private void ensureNotMultilayerRequest(@NonNull final NetworkRequestInfo nri,
+ final String callingMethod) {
+ if (nri.isMultilayerRequest()) {
+ throw new IllegalStateException(
+ callingMethod + " does not support multilayer requests.");
+ }
+ }
+
+ private void handleTimedOutNetworkRequest(@NonNull final NetworkRequestInfo nri) {
ensureRunningOnConnectivityServiceThread();
- if (mNetworkRequests.get(nri.request) == null) {
+ // handleTimedOutNetworkRequest() is part of the requestNetwork() flow which works off of a
+ // single NetworkRequest and thus does not apply to multilayer requests.
+ ensureNotMultilayerRequest(nri, "handleTimedOutNetworkRequest");
+ if (mNetworkRequests.get(nri.mRequests.get(0)) == null) {
return;
}
- if (nri.mSatisfier != null) {
+ if (nri.getSatisfier() != null) {
return;
}
- if (VDBG || (DBG && nri.request.isRequest())) {
- log("releasing " + nri.request + " (timeout)");
+ if (VDBG || (DBG && nri.mRequests.get(0).isRequest())) {
+ log("releasing " + nri.mRequests.get(0) + " (timeout)");
}
handleRemoveNetworkRequest(nri);
- callCallbackForRequest(nri, null, ConnectivityManager.CALLBACK_UNAVAIL, 0);
+ callCallbackForRequest(
+ nri, null, ConnectivityManager.CALLBACK_UNAVAIL, 0);
}
- private void handleReleaseNetworkRequest(NetworkRequest request, int callingUid,
- boolean callOnUnavailable) {
+ private void handleReleaseNetworkRequest(@NonNull final NetworkRequest request,
+ final int callingUid,
+ final boolean callOnUnavailable) {
final NetworkRequestInfo nri =
getNriForAppRequest(request, callingUid, "release NetworkRequest");
if (nri == null) {
return;
}
- if (VDBG || (DBG && nri.request.isRequest())) {
- log("releasing " + nri.request + " (release request)");
+ // handleReleaseNetworkRequest() paths don't apply to multilayer requests.
+ ensureNotMultilayerRequest(nri, "handleReleaseNetworkRequest");
+ if (VDBG || (DBG && request.isRequest())) {
+ log("releasing " + request + " (release request)");
}
handleRemoveNetworkRequest(nri);
if (callOnUnavailable) {
@@ -3601,42 +3721,88 @@ public class ConnectivityService extends IConnectivityManager.Stub
}
}
- private void handleRemoveNetworkRequest(final NetworkRequestInfo nri) {
+ private void handleRemoveNetworkRequest(@NonNull final NetworkRequestInfo nri) {
ensureRunningOnConnectivityServiceThread();
nri.unlinkDeathRecipient();
- mNetworkRequests.remove(nri.request);
+ for (final NetworkRequest req : nri.mRequests) {
+ mNetworkRequests.remove(req);
+ if (req.isListen()) {
+ removeListenRequestFromNetworks(req);
+ }
+ }
+ mNetworkRequestCounter.decrementCount(nri.mUid);
+ mNetworkRequestInfoLogs.log("RELEASE " + nri);
- decrementNetworkRequestPerUidCount(nri);
+ if (null != nri.getActiveRequest()) {
+ if (nri.getActiveRequest().isRequest()) {
+ removeSatisfiedNetworkRequestFromNetwork(nri);
+ } else {
+ nri.setSatisfier(null, null);
+ }
+ }
- mNetworkRequestInfoLogs.log("RELEASE " + nri);
- if (nri.request.isRequest()) {
- boolean wasKept = false;
- final NetworkAgentInfo nai = nri.mSatisfier;
- if (nai != null) {
- boolean wasBackgroundNetwork = nai.isBackgroundNetwork();
- nai.removeRequest(nri.request.requestId);
- if (VDBG || DDBG) {
- log(" Removing from current network " + nai.toShortString()
- + ", leaving " + nai.numNetworkRequests() + " requests.");
- }
- // If there are still lingered requests on this network, don't tear it down,
- // but resume lingering instead.
- final long now = SystemClock.elapsedRealtime();
- if (updateLingerState(nai, now)) {
- notifyNetworkLosing(nai, now);
- }
- if (unneeded(nai, UnneededFor.TEARDOWN)) {
- if (DBG) log("no live requests for " + nai.toShortString() + "; disconnecting");
- teardownUnneededNetwork(nai);
- } else {
- wasKept = true;
- }
- nri.mSatisfier = null;
- if (!wasBackgroundNetwork && nai.isBackgroundNetwork()) {
- // Went from foreground to background.
- updateCapabilitiesForNetwork(nai);
- }
+ cancelNpiRequests(nri);
+ }
+
+ private void cancelNpiRequests(@NonNull final NetworkRequestInfo nri) {
+ for (final NetworkRequest req : nri.mRequests) {
+ cancelNpiRequest(req);
+ }
+ }
+
+ private void cancelNpiRequest(@NonNull final NetworkRequest req) {
+ if (req.isRequest()) {
+ for (final NetworkProviderInfo npi : mNetworkProviderInfos.values()) {
+ npi.cancelRequest(req);
+ }
+ }
+ }
+
+ private void removeListenRequestFromNetworks(@NonNull final NetworkRequest req) {
+ // listens don't have a singular affected Network. Check all networks to see
+ // if this listen request applies and remove it.
+ for (final NetworkAgentInfo nai : mNetworkAgentInfos) {
+ nai.removeRequest(req.requestId);
+ if (req.networkCapabilities.hasSignalStrength()
+ && nai.satisfiesImmutableCapabilitiesOf(req)) {
+ updateSignalStrengthThresholds(nai, "RELEASE", req);
+ }
+ }
+ }
+
+ /**
+ * Remove a NetworkRequestInfo's satisfied request from its 'satisfier' (NetworkAgentInfo) and
+ * manage the necessary upkeep (linger, teardown networks, etc.) when doing so.
+ * @param nri the NetworkRequestInfo to disassociate from its current NetworkAgentInfo
+ */
+ private void removeSatisfiedNetworkRequestFromNetwork(@NonNull final NetworkRequestInfo nri) {
+ boolean wasKept = false;
+ final NetworkAgentInfo nai = nri.getSatisfier();
+ if (nai != null) {
+ final int requestLegacyType = nri.getActiveRequest().legacyType;
+ final boolean wasBackgroundNetwork = nai.isBackgroundNetwork();
+ nai.removeRequest(nri.getActiveRequest().requestId);
+ if (VDBG || DDBG) {
+ log(" Removing from current network " + nai.toShortString()
+ + ", leaving " + nai.numNetworkRequests() + " requests.");
+ }
+ // If there are still lingered requests on this network, don't tear it down,
+ // but resume lingering instead.
+ final long now = SystemClock.elapsedRealtime();
+ if (updateLingerState(nai, now)) {
+ notifyNetworkLosing(nai, now);
+ }
+ if (unneeded(nai, UnneededFor.TEARDOWN)) {
+ if (DBG) log("no live requests for " + nai.toShortString() + "; disconnecting");
+ teardownUnneededNetwork(nai);
+ } else {
+ wasKept = true;
+ }
+ nri.setSatisfier(null, null);
+ if (!wasBackgroundNetwork && nai.isBackgroundNetwork()) {
+ // Went from foreground to background.
+ updateCapabilitiesForNetwork(nai);
}
// Maintain the illusion. When this request arrived, we might have pretended
@@ -3644,15 +3810,15 @@ public class ConnectivityService extends IConnectivityManager.Stub
// connected. Now that this request has gone away, we might have to pretend
// that the network disconnected. LegacyTypeTracker will generate that
// phantom disconnect for this type.
- if (nri.request.legacyType != TYPE_NONE && nai != null) {
+ if (requestLegacyType != TYPE_NONE) {
boolean doRemove = true;
if (wasKept) {
// check if any of the remaining requests for this network are for the
// same legacy type - if so, don't remove the nai
for (int i = 0; i < nai.numNetworkRequests(); i++) {
NetworkRequest otherRequest = nai.requestAt(i);
- if (otherRequest.legacyType == nri.request.legacyType &&
- otherRequest.isRequest()) {
+ if (otherRequest.legacyType == requestLegacyType
+ && otherRequest.isRequest()) {
if (DBG) log(" still have other legacy request - leaving");
doRemove = false;
}
@@ -3660,36 +3826,9 @@ public class ConnectivityService extends IConnectivityManager.Stub
}
if (doRemove) {
- mLegacyTypeTracker.remove(nri.request.legacyType, nai, false);
+ mLegacyTypeTracker.remove(requestLegacyType, nai, false);
}
}
-
- for (NetworkProviderInfo npi : mNetworkProviderInfos.values()) {
- npi.cancelRequest(nri.request);
- }
- } else {
- // listens don't have a singular affectedNetwork. Check all networks to see
- // if this listen request applies and remove it.
- for (NetworkAgentInfo nai : mNetworkAgentInfos) {
- nai.removeRequest(nri.request.requestId);
- if (nri.request.networkCapabilities.hasSignalStrength() &&
- nai.satisfiesImmutableCapabilitiesOf(nri.request)) {
- updateSignalStrengthThresholds(nai, "RELEASE", nri.request);
- }
- }
- }
- }
-
- private void decrementNetworkRequestPerUidCount(final NetworkRequestInfo nri) {
- synchronized (mUidToNetworkRequestCount) {
- final int requests = mUidToNetworkRequestCount.get(nri.mUid, 0);
- if (requests < 1) {
- Log.wtf(TAG, "BUG: too small request count " + requests + " for UID " + nri.mUid);
- } else if (requests == 1) {
- mUidToNetworkRequestCount.removeAt(mUidToNetworkRequestCount.indexOfKey(nri.mUid));
- } else {
- mUidToNetworkRequestCount.put(nri.mUid, requests - 1);
- }
}
}
@@ -4519,6 +4658,10 @@ public class ConnectivityService extends IConnectivityManager.Stub
Log.w(TAG, s);
}
+ private static void logwtf(String s) {
+ Log.wtf(TAG, s);
+ }
+
private static void loge(String s) {
Log.e(TAG, s);
}
@@ -4761,16 +4904,14 @@ public class ConnectivityService extends IConnectivityManager.Stub
if (interfaces.isEmpty()) return null;
- VpnInfo info = new VpnInfo();
- info.ownerUid = nai.networkCapabilities.getOwnerUid();
- info.vpnIface = nai.linkProperties.getInterfaceName();
// Must be non-null or NetworkStatsService will crash.
// Cannot happen in production code because Vpn only registers the NetworkAgent after the
// tun or ipsec interface is created.
- if (info.vpnIface == null) return null;
- info.underlyingIfaces = interfaces.toArray(new String[0]);
+ if (nai.linkProperties.getInterfaceName() == null) return null;
- return info;
+ return new VpnInfo(nai.networkCapabilities.getOwnerUid(),
+ nai.linkProperties.getInterfaceName(),
+ interfaces.toArray(new String[0]));
}
/**
@@ -5261,11 +5402,6 @@ public class ConnectivityService extends IConnectivityManager.Stub
private final HashMap<Messenger, NetworkProviderInfo> mNetworkProviderInfos = new HashMap<>();
private final HashMap<NetworkRequest, NetworkRequestInfo> mNetworkRequests = new HashMap<>();
- private static final int MAX_NETWORK_REQUESTS_PER_UID = 100;
- // Map from UID to number of NetworkRequests that UID has filed.
- @GuardedBy("mUidToNetworkRequestCount")
- private final SparseIntArray mUidToNetworkRequestCount = new SparseIntArray();
-
private static class NetworkProviderInfo {
public final String name;
public final Messenger messenger;
@@ -5351,18 +5487,38 @@ public class ConnectivityService extends IConnectivityManager.Stub
/**
* Tracks info about the requester.
- * Also used to notice when the calling process dies so we can self-expire
+ * Also used to notice when the calling process dies so as to self-expire
*/
@VisibleForTesting
protected class NetworkRequestInfo implements IBinder.DeathRecipient {
final List<NetworkRequest> mRequests;
- final NetworkRequest request;
+
+ // mSatisfier and mActiveRequest rely on one another therefore set them together.
+ void setSatisfier(
+ @Nullable final NetworkAgentInfo satisfier,
+ @Nullable final NetworkRequest activeRequest) {
+ mSatisfier = satisfier;
+ mActiveRequest = activeRequest;
+ }
// The network currently satisfying this request, or null if none. Must only be touched
// on the handler thread. This only makes sense for network requests and not for listens,
// as defined by NetworkRequest#isRequest(). For listens, this is always null.
@Nullable
- NetworkAgentInfo mSatisfier;
+ private NetworkAgentInfo mSatisfier;
+ NetworkAgentInfo getSatisfier() {
+ return mSatisfier;
+ }
+
+ // The request in mRequests assigned to a network agent. This is null if none of the
+ // requests in mRequests can be satisfied. This member has the constraint of only being
+ // accessible on the handler thread.
+ @Nullable
+ private NetworkRequest mActiveRequest;
+ NetworkRequest getActiveRequest() {
+ return mActiveRequest;
+ }
+
final PendingIntent mPendingIntent;
boolean mPendingIntentSent;
private final IBinder mBinder;
@@ -5371,7 +5527,6 @@ public class ConnectivityService extends IConnectivityManager.Stub
final Messenger messenger;
NetworkRequestInfo(NetworkRequest r, PendingIntent pi) {
- request = r;
mRequests = initializeRequests(r);
ensureAllNetworkRequestsHaveType(mRequests);
mPendingIntent = pi;
@@ -5379,20 +5534,19 @@ public class ConnectivityService extends IConnectivityManager.Stub
mBinder = null;
mPid = getCallingPid();
mUid = mDeps.getCallingUid();
- enforceRequestCountLimit();
+ mNetworkRequestCounter.incrementCountOrThrow(mUid);
}
NetworkRequestInfo(Messenger m, NetworkRequest r, IBinder binder) {
super();
messenger = m;
- request = r;
mRequests = initializeRequests(r);
ensureAllNetworkRequestsHaveType(mRequests);
mBinder = binder;
mPid = getCallingPid();
mUid = mDeps.getCallingUid();
mPendingIntent = null;
- enforceRequestCountLimit();
+ mNetworkRequestCounter.incrementCountOrThrow(mUid);
try {
mBinder.linkToDeath(this, 0);
@@ -5415,31 +5569,6 @@ public class ConnectivityService extends IConnectivityManager.Stub
return Collections.unmodifiableList(tempRequests);
}
- private NetworkRequest getSatisfiedRequest() {
- if (mSatisfier == null) {
- return null;
- }
-
- for (NetworkRequest req : mRequests) {
- if (mSatisfier.isSatisfyingRequest(req.requestId)) {
- return req;
- }
- }
-
- return null;
- }
-
- private void enforceRequestCountLimit() {
- synchronized (mUidToNetworkRequestCount) {
- int networkRequests = mUidToNetworkRequestCount.get(mUid, 0) + 1;
- if (networkRequests >= MAX_NETWORK_REQUESTS_PER_UID) {
- throw new ServiceSpecificException(
- ConnectivityManager.Errors.TOO_MANY_REQUESTS);
- }
- mUidToNetworkRequestCount.put(mUid, networkRequests);
- }
- }
-
void unlinkDeathRecipient() {
if (mBinder != null) {
mBinder.unlinkToDeath(this, 0);
@@ -5486,6 +5615,10 @@ public class ConnectivityService extends IConnectivityManager.Stub
private int[] getSignalStrengthThresholds(@NonNull final NetworkAgentInfo nai) {
final SortedSet<Integer> thresholds = new TreeSet<>();
synchronized (nai) {
+ // mNetworkRequests may contain the same value multiple times in case of
+ // multilayer requests. It won't matter in this case because the thresholds
+ // will then be the same and be deduplicated as they enter the `thresholds` set.
+ // TODO : have mNetworkRequests be a Set<NetworkRequestInfo> or the like.
for (final NetworkRequestInfo nri : mNetworkRequests.values()) {
for (final NetworkRequest req : nri.mRequests) {
if (req.networkCapabilities.hasSignalStrength()
@@ -5525,7 +5658,9 @@ public class ConnectivityService extends IConnectivityManager.Stub
if (ns == null) {
return;
}
- MatchAllNetworkSpecifier.checkNotMatchAllNetworkSpecifier(ns);
+ if (ns instanceof MatchAllNetworkSpecifier) {
+ throw new IllegalArgumentException("A MatchAllNetworkSpecifier is not permitted");
+ }
}
private void ensureValid(NetworkCapabilities nc) {
@@ -5661,9 +5796,14 @@ public class ConnectivityService extends IConnectivityManager.Stub
// Policy already enforced.
return;
}
- if (mPolicyManagerInternal.isUidRestrictedOnMeteredNetworks(uid)) {
- // If UID is restricted, don't allow them to bring up metered APNs.
- networkCapabilities.addCapability(NET_CAPABILITY_NOT_METERED);
+ final long ident = Binder.clearCallingIdentity();
+ try {
+ if (mPolicyManager.isUidRestrictedOnMeteredNetworks(uid)) {
+ // If UID is restricted, don't allow them to bring up metered APNs.
+ networkCapabilities.addCapability(NET_CAPABILITY_NOT_METERED);
+ }
+ } finally {
+ Binder.restoreCallingIdentity(ident);
}
}
@@ -5856,13 +5996,19 @@ public class ConnectivityService extends IConnectivityManager.Stub
}
@Override
- public void declareNetworkRequestUnfulfillable(NetworkRequest request) {
+ public void declareNetworkRequestUnfulfillable(@NonNull final NetworkRequest request) {
if (request.hasTransport(TRANSPORT_TEST)) {
enforceNetworkFactoryOrTestNetworksPermission();
} else {
enforceNetworkFactoryPermission();
}
- mHandler.post(() -> handleReleaseNetworkRequest(request, mDeps.getCallingUid(), true));
+ final NetworkRequestInfo nri = mNetworkRequests.get(request);
+ if (nri != null) {
+ // declareNetworkRequestUnfulfillable() paths don't apply to multilayer requests.
+ ensureNotMultilayerRequest(nri, "declareNetworkRequestUnfulfillable");
+ mHandler.post(() -> handleReleaseNetworkRequest(
+ nri.mRequests.get(0), mDeps.getCallingUid(), true));
+ }
}
// NOTE: Accessed on multiple threads, must be synchronized on itself.
@@ -5998,7 +6144,7 @@ public class ConnectivityService extends IConnectivityManager.Stub
final NetworkAgentInfo nai = new NetworkAgentInfo(na,
new Network(mNetIdManager.reserveNetId()), new NetworkInfo(networkInfo), lp, nc,
currentScore, mContext, mTrackerHandler, new NetworkAgentConfig(networkAgentConfig),
- this, mNetd, mDnsResolver, mNMS, providerId, uid);
+ this, mNetd, mDnsResolver, mNMS, providerId, uid, mQosCallbackTracker);
// Make sure the LinkProperties and NetworkCapabilities reflect what the agent info says.
processCapabilitiesFromAgent(nai, nc);
@@ -6787,6 +6933,39 @@ public class ConnectivityService extends IConnectivityManager.Stub
}
}
+ private void sendUpdatedScoreToFactories(
+ @NonNull final NetworkReassignment.RequestReassignment event) {
+ // If a request of type REQUEST is now being satisfied by a new network.
+ if (null != event.mNewNetworkRequest && event.mNewNetworkRequest.isRequest()) {
+ sendUpdatedScoreToFactories(event.mNewNetworkRequest, event.mNewNetwork);
+ }
+
+ // If a previously satisfied request of type REQUEST is no longer being satisfied.
+ if (null != event.mOldNetworkRequest && event.mOldNetworkRequest.isRequest()
+ && event.mOldNetworkRequest != event.mNewNetworkRequest) {
+ sendUpdatedScoreToFactories(event.mOldNetworkRequest, null);
+ }
+
+ cancelMultilayerLowerPriorityNpiRequests(event.mNetworkRequestInfo);
+ }
+
+ /**
+ * Cancel with all NPIs the given NRI's multilayer requests that are a lower priority than
+ * its currently satisfied active request.
+ * @param nri the NRI to cancel lower priority requests for.
+ */
+ private void cancelMultilayerLowerPriorityNpiRequests(
+ @NonNull final NetworkRequestInfo nri) {
+ if (!nri.isMultilayerRequest() || null == nri.mActiveRequest) {
+ return;
+ }
+
+ final int indexOfNewRequest = nri.mRequests.indexOf(nri.mActiveRequest);
+ for (int i = indexOfNewRequest + 1; i < nri.mRequests.size(); i++) {
+ cancelNpiRequest(nri.mRequests.get(i));
+ }
+ }
+
private void sendUpdatedScoreToFactories(@NonNull NetworkRequest networkRequest,
@Nullable NetworkAgentInfo nai) {
final int score;
@@ -6807,21 +6986,35 @@ public class ConnectivityService extends IConnectivityManager.Stub
}
/** Sends all current NetworkRequests to the specified factory. */
- private void sendAllRequestsToProvider(NetworkProviderInfo npi) {
+ private void sendAllRequestsToProvider(@NonNull final NetworkProviderInfo npi) {
ensureRunningOnConnectivityServiceThread();
- for (NetworkRequestInfo nri : mNetworkRequests.values()) {
- if (nri.request.isListen()) continue;
- NetworkAgentInfo nai = nri.mSatisfier;
- final int score;
- final int serial;
- if (nai != null) {
- score = nai.getCurrentScore();
- serial = nai.factorySerialNumber;
- } else {
- score = 0;
- serial = NetworkProvider.ID_NONE;
+ for (final NetworkRequestInfo nri : getNrisFromGlobalRequests()) {
+ for (final NetworkRequest req : nri.mRequests) {
+ if (req.isListen() && nri.getActiveRequest() == req) {
+ break;
+ }
+ if (req.isListen()) {
+ continue;
+ }
+ // Only set the nai for the request it is satisfying.
+ final NetworkAgentInfo nai =
+ nri.getActiveRequest() == req ? nri.getSatisfier() : null;
+ final int score;
+ final int serial;
+ if (null != nai) {
+ score = nai.getCurrentScore();
+ serial = nai.factorySerialNumber;
+ } else {
+ score = 0;
+ serial = NetworkProvider.ID_NONE;
+ }
+ npi.requestNetwork(req, score, serial);
+ // For multilayer requests, don't send lower priority requests if a higher priority
+ // request is already satisfied.
+ if (null != nai) {
+ break;
+ }
}
- npi.requestNetwork(nri.request, score, serial);
}
}
@@ -6830,7 +7023,12 @@ public class ConnectivityService extends IConnectivityManager.Stub
if (notificationType == ConnectivityManager.CALLBACK_AVAILABLE && !nri.mPendingIntentSent) {
Intent intent = new Intent();
intent.putExtra(ConnectivityManager.EXTRA_NETWORK, networkAgent.network);
- intent.putExtra(ConnectivityManager.EXTRA_NETWORK_REQUEST, nri.request);
+ // If apps could file multi-layer requests with PendingIntents, they'd need to know
+ // which of the layer is satisfied alongside with some ID for the request. Hence, if
+ // such an API is ever implemented, there is no doubt the right request to send in
+ // EXTRA_NETWORK_REQUEST is mActiveRequest, and whatever ID would be added would need to
+ // be sent as a separate extra.
+ intent.putExtra(ConnectivityManager.EXTRA_NETWORK_REQUEST, nri.getActiveRequest());
nri.mPendingIntentSent = true;
sendIntent(nri.mPendingIntent, intent);
}
@@ -6860,8 +7058,9 @@ public class ConnectivityService extends IConnectivityManager.Stub
releasePendingNetworkRequestWithDelay(pendingIntent);
}
- private void callCallbackForRequest(NetworkRequestInfo nri,
- NetworkAgentInfo networkAgent, int notificationType, int arg1) {
+ private void callCallbackForRequest(@NonNull final NetworkRequestInfo nri,
+ @NonNull final NetworkAgentInfo networkAgent, final int notificationType,
+ final int arg1) {
if (nri.messenger == null) {
// Default request has no msgr. Also prevents callbacks from being invoked for
// NetworkRequestInfos registered with ConnectivityDiagnostics requests. Those callbacks
@@ -6869,8 +7068,14 @@ public class ConnectivityService extends IConnectivityManager.Stub
return;
}
Bundle bundle = new Bundle();
+ // In the case of multi-layer NRIs, the first request is not necessarily the one that
+ // is satisfied. This is vexing, but the ConnectivityManager code that receives this
+ // callback is only using the request as a token to identify the callback, so it doesn't
+ // matter too much at this point as long as the callback can be found.
+ // TODO b/177608132: make sure callbacks are indexed by NRIs and not NetworkRequest objects.
// TODO: check if defensive copies of data is needed.
- putParcelable(bundle, new NetworkRequest(nri.request));
+ final NetworkRequest nrForCallback = new NetworkRequest(nri.mRequests.get(0));
+ putParcelable(bundle, nrForCallback);
Message msg = Message.obtain();
if (notificationType != ConnectivityManager.CALLBACK_UNAVAIL) {
putParcelable(bundle, networkAgent.network);
@@ -6883,7 +7088,7 @@ public class ConnectivityService extends IConnectivityManager.Stub
putParcelable(
bundle,
createWithLocationInfoSanitizedIfNecessaryWhenParceled(
- nc, nri.mUid, nri.request.getRequestorPackageName()));
+ nc, nri.mUid, nrForCallback.getRequestorPackageName()));
putParcelable(bundle, linkPropertiesRestrictedForCallerPermissions(
networkAgent.linkProperties, nri.mPid, nri.mUid));
// For this notification, arg1 contains the blocked status.
@@ -6902,7 +7107,7 @@ public class ConnectivityService extends IConnectivityManager.Stub
putParcelable(
bundle,
createWithLocationInfoSanitizedIfNecessaryWhenParceled(
- netCap, nri.mUid, nri.request.getRequestorPackageName()));
+ netCap, nri.mUid, nrForCallback.getRequestorPackageName()));
break;
}
case ConnectivityManager.CALLBACK_IP_CHANGED: {
@@ -6921,12 +7126,12 @@ public class ConnectivityService extends IConnectivityManager.Stub
try {
if (VDBG) {
String notification = ConnectivityManager.getCallbackName(notificationType);
- log("sending notification " + notification + " for " + nri.request);
+ log("sending notification " + notification + " for " + nrForCallback);
}
nri.messenger.send(msg);
} catch (RemoteException e) {
// may occur naturally in the race of binder death.
- loge("RemoteException caught trying to send a callback msg for " + nri.request);
+ loge("RemoteException caught trying to send a callback msg for " + nrForCallback);
}
}
@@ -7002,19 +7207,25 @@ public class ConnectivityService extends IConnectivityManager.Stub
}
private void processNewlyLostListenRequests(@NonNull final NetworkAgentInfo nai) {
- for (NetworkRequestInfo nri : mNetworkRequests.values()) {
- NetworkRequest nr = nri.request;
+ for (final NetworkRequestInfo nri : mNetworkRequests.values()) {
+ if (nri.isMultilayerRequest()) {
+ continue;
+ }
+ final NetworkRequest nr = nri.mRequests.get(0);
if (!nr.isListen()) continue;
if (nai.isSatisfyingRequest(nr.requestId) && !nai.satisfies(nr)) {
- nai.removeRequest(nri.request.requestId);
+ nai.removeRequest(nr.requestId);
callCallbackForRequest(nri, nai, ConnectivityManager.CALLBACK_LOST, 0);
}
}
}
private void processNewlySatisfiedListenRequests(@NonNull final NetworkAgentInfo nai) {
- for (NetworkRequestInfo nri : mNetworkRequests.values()) {
- NetworkRequest nr = nri.request;
+ for (final NetworkRequestInfo nri : mNetworkRequests.values()) {
+ if (nri.isMultilayerRequest()) {
+ continue;
+ }
+ final NetworkRequest nr = nri.mRequests.get(0);
if (!nr.isListen()) continue;
if (nai.satisfies(nr) && !nai.isSatisfyingRequest(nr.requestId)) {
nai.addRequest(nr);
@@ -7026,19 +7237,25 @@ public class ConnectivityService extends IConnectivityManager.Stub
// An accumulator class to gather the list of changes that result from a rematch.
private static class NetworkReassignment {
static class RequestReassignment {
- @NonNull public final NetworkRequestInfo mRequest;
+ @NonNull public final NetworkRequestInfo mNetworkRequestInfo;
+ @NonNull public final NetworkRequest mOldNetworkRequest;
+ @NonNull public final NetworkRequest mNewNetworkRequest;
@Nullable public final NetworkAgentInfo mOldNetwork;
@Nullable public final NetworkAgentInfo mNewNetwork;
- RequestReassignment(@NonNull final NetworkRequestInfo request,
+ RequestReassignment(@NonNull final NetworkRequestInfo networkRequestInfo,
+ @NonNull final NetworkRequest oldNetworkRequest,
+ @NonNull final NetworkRequest newNetworkRequest,
@Nullable final NetworkAgentInfo oldNetwork,
@Nullable final NetworkAgentInfo newNetwork) {
- mRequest = request;
+ mNetworkRequestInfo = networkRequestInfo;
+ mOldNetworkRequest = oldNetworkRequest;
+ mNewNetworkRequest = newNetworkRequest;
mOldNetwork = oldNetwork;
mNewNetwork = newNetwork;
}
public String toString() {
- return mRequest.mRequests.get(0).requestId + " : "
+ return mNetworkRequestInfo.mRequests.get(0).requestId + " : "
+ (null != mOldNetwork ? mOldNetwork.network.getNetId() : "null")
+ " → " + (null != mNewNetwork ? mNewNetwork.network.getNetId() : "null");
}
@@ -7056,7 +7273,7 @@ public class ConnectivityService extends IConnectivityManager.Stub
// sure this stays true, but without imposing this expensive check on all
// reassignments on all user devices.
for (final RequestReassignment existing : mReassignments) {
- if (existing.mRequest.equals(reassignment.mRequest)) {
+ if (existing.mNetworkRequestInfo.equals(reassignment.mNetworkRequestInfo)) {
throw new IllegalStateException("Trying to reassign ["
+ reassignment + "] but already have ["
+ existing + "]");
@@ -7071,7 +7288,7 @@ public class ConnectivityService extends IConnectivityManager.Stub
@Nullable
private RequestReassignment getReassignment(@NonNull final NetworkRequestInfo nri) {
for (final RequestReassignment event : getRequestReassignments()) {
- if (nri == event.mRequest) return event;
+ if (nri == event.mNetworkRequestInfo) return event;
}
return null;
}
@@ -7098,6 +7315,8 @@ public class ConnectivityService extends IConnectivityManager.Stub
}
private void updateSatisfiersForRematchRequest(@NonNull final NetworkRequestInfo nri,
+ @NonNull final NetworkRequest previousRequest,
+ @NonNull final NetworkRequest newRequest,
@Nullable final NetworkAgentInfo previousSatisfier,
@Nullable final NetworkAgentInfo newSatisfier,
final long now) {
@@ -7107,58 +7326,98 @@ public class ConnectivityService extends IConnectivityManager.Stub
if (VDBG || DDBG) {
log(" accepting network in place of " + previousSatisfier.toShortString());
}
- previousSatisfier.removeRequest(nri.request.requestId);
- previousSatisfier.lingerRequest(nri.request.requestId, now, mLingerDelayMs);
+ previousSatisfier.removeRequest(previousRequest.requestId);
+ previousSatisfier.lingerRequest(previousRequest.requestId, now, mLingerDelayMs);
} else {
if (VDBG || DDBG) log(" accepting network in place of null");
}
- newSatisfier.unlingerRequest(nri.request.requestId);
- if (!newSatisfier.addRequest(nri.request)) {
+ newSatisfier.unlingerRequest(newRequest.requestId);
+ if (!newSatisfier.addRequest(newRequest)) {
Log.wtf(TAG, "BUG: " + newSatisfier.toShortString() + " already has "
- + nri.request);
+ + newRequest);
}
} else {
if (DBG) {
log("Network " + previousSatisfier.toShortString() + " stopped satisfying"
- + " request " + nri.request.requestId);
+ + " request " + previousRequest.requestId);
}
- previousSatisfier.removeRequest(nri.request.requestId);
+ previousSatisfier.removeRequest(previousRequest.requestId);
}
- nri.mSatisfier = newSatisfier;
+ nri.setSatisfier(newSatisfier, newRequest);
}
+ /**
+ * This function is triggered when something can affect what network should satisfy what
+ * request, and it computes the network reassignment from the passed collection of requests to
+ * network match to the one that the system should now have. That data is encoded in an
+ * object that is a list of changes, each of them having an NRI, and old satisfier, and a new
+ * satisfier.
+ *
+ * After the reassignment is computed, it is applied to the state objects.
+ *
+ * @param networkRequests the nri objects to evaluate for possible network reassignment
+ * @return NetworkReassignment listing of proposed network assignment changes
+ */
@NonNull
- private NetworkReassignment computeNetworkReassignment() {
- ensureRunningOnConnectivityServiceThread();
+ private NetworkReassignment computeNetworkReassignment(
+ @NonNull final Collection<NetworkRequestInfo> networkRequests) {
final NetworkReassignment changes = new NetworkReassignment();
// Gather the list of all relevant agents and sort them by score.
final ArrayList<NetworkAgentInfo> nais = new ArrayList<>();
for (final NetworkAgentInfo nai : mNetworkAgentInfos) {
- if (!nai.everConnected) continue;
+ if (!nai.everConnected) {
+ continue;
+ }
nais.add(nai);
}
- for (final NetworkRequestInfo nri : mNetworkRequests.values()) {
- if (nri.request.isListen()) continue;
- final NetworkAgentInfo bestNetwork = mNetworkRanker.getBestNetwork(nri.request, nais);
+ for (final NetworkRequestInfo nri : networkRequests) {
+ // Non-multilayer listen requests can be ignored.
+ if (!nri.isMultilayerRequest() && nri.mRequests.get(0).isListen()) {
+ continue;
+ }
+ NetworkAgentInfo bestNetwork = null;
+ NetworkRequest bestRequest = null;
+ for (final NetworkRequest req : nri.mRequests) {
+ bestNetwork = mNetworkRanker.getBestNetwork(req, nais);
+ // Stop evaluating as the highest possible priority request is satisfied.
+ if (null != bestNetwork) {
+ bestRequest = req;
+ break;
+ }
+ }
if (bestNetwork != nri.mSatisfier) {
// bestNetwork may be null if no network can satisfy this request.
changes.addRequestReassignment(new NetworkReassignment.RequestReassignment(
- nri, nri.mSatisfier, bestNetwork));
+ nri, nri.mActiveRequest, bestRequest, nri.getSatisfier(), bestNetwork));
}
}
return changes;
}
+ private Set<NetworkRequestInfo> getNrisFromGlobalRequests() {
+ return new HashSet<>(mNetworkRequests.values());
+ }
+
/**
- * Attempt to rematch all Networks with NetworkRequests. This may result in Networks
+ * Attempt to rematch all Networks with all NetworkRequests. This may result in Networks
* being disconnected.
*/
private void rematchAllNetworksAndRequests() {
+ rematchNetworksAndRequests(getNrisFromGlobalRequests());
+ }
+
+ /**
+ * Attempt to rematch all Networks with given NetworkRequests. This may result in Networks
+ * being disconnected.
+ */
+ private void rematchNetworksAndRequests(
+ @NonNull final Set<NetworkRequestInfo> networkRequests) {
+ ensureRunningOnConnectivityServiceThread();
// TODO: This may be slow, and should be optimized.
final long now = SystemClock.elapsedRealtime();
- final NetworkReassignment changes = computeNetworkReassignment();
+ final NetworkReassignment changes = computeNetworkReassignment(networkRequests);
if (VDBG || DDBG) {
log(changes.debugString());
} else if (DBG) {
@@ -7183,8 +7442,10 @@ public class ConnectivityService extends IConnectivityManager.Stub
// the linger status.
for (final NetworkReassignment.RequestReassignment event :
changes.getRequestReassignments()) {
- updateSatisfiersForRematchRequest(event.mRequest, event.mOldNetwork,
- event.mNewNetwork, now);
+ updateSatisfiersForRematchRequest(event.mNetworkRequestInfo,
+ event.mOldNetworkRequest, event.mNewNetworkRequest,
+ event.mOldNetwork, event.mNewNetwork,
+ now);
}
final NetworkAgentInfo oldDefaultNetwork = getDefaultNetwork();
@@ -7236,12 +7497,12 @@ public class ConnectivityService extends IConnectivityManager.Stub
// trying to connect if they know they cannot match it.
// TODO - this could get expensive if there are a lot of outstanding requests for this
// network. Think of a way to reduce this. Push netid->request mapping to each factory?
- sendUpdatedScoreToFactories(event.mRequest.request, event.mNewNetwork);
+ sendUpdatedScoreToFactories(event);
if (null != event.mNewNetwork) {
- notifyNetworkAvailable(event.mNewNetwork, event.mRequest);
+ notifyNetworkAvailable(event.mNewNetwork, event.mNetworkRequestInfo);
} else {
- callCallbackForRequest(event.mRequest, event.mOldNetwork,
+ callCallbackForRequest(event.mNetworkRequestInfo, event.mOldNetwork,
ConnectivityManager.CALLBACK_LOST, 0);
}
}
@@ -8278,7 +8539,7 @@ public class ConnectivityService extends IConnectivityManager.Stub
// Decrement the reference count for this NetworkRequestInfo. The reference count is
// incremented when the NetworkRequestInfo is created as part of
// enforceRequestCountLimit().
- decrementNetworkRequestPerUidCount(nri);
+ mNetworkRequestCounter.decrementCount(nri.mUid);
return;
}
@@ -8344,7 +8605,7 @@ public class ConnectivityService extends IConnectivityManager.Stub
// Decrement the reference count for this NetworkRequestInfo. The reference count is
// incremented when the NetworkRequestInfo is created as part of
// enforceRequestCountLimit().
- decrementNetworkRequestPerUidCount(nri);
+ mNetworkRequestCounter.decrementCount(nri.mUid);
iCb.unlinkToDeath(cbInfo, 0);
}
@@ -8565,7 +8826,7 @@ public class ConnectivityService extends IConnectivityManager.Stub
private final INetworkManagementService mNMS;
LegacyNetworkActivityTracker(@NonNull Context context,
- @NonNull INetworkManagementService nms) {
+ @NonNull INetworkManagementService nms) {
mContext = context;
mNMS = nms;
try {
@@ -8584,7 +8845,7 @@ public class ConnectivityService extends IConnectivityManager.Stub
sendDataActivityBroadcast(transportTypeToLegacyType(transportType), active,
tsNanos);
}
- };
+ };
// This is deprecated and only to support legacy use cases.
private int transportTypeToLegacyType(int type) {
@@ -8694,4 +8955,53 @@ public class ConnectivityService extends IConnectivityManager.Stub
}
}
}
+ /**
+ * Registers {@link QosSocketFilter} with {@link IQosCallback}.
+ *
+ * @param socketInfo the socket information
+ * @param callback the callback to register
+ */
+ @Override
+ public void registerQosSocketCallback(@NonNull final QosSocketInfo socketInfo,
+ @NonNull final IQosCallback callback) {
+ final NetworkAgentInfo nai = getNetworkAgentInfoForNetwork(socketInfo.getNetwork());
+ if (nai == null || nai.networkCapabilities == null) {
+ try {
+ callback.onError(QosCallbackException.EX_TYPE_FILTER_NETWORK_RELEASED);
+ } catch (final RemoteException ex) {
+ loge("registerQosCallbackInternal: RemoteException", ex);
+ }
+ return;
+ }
+ registerQosCallbackInternal(new QosSocketFilter(socketInfo), callback, nai);
+ }
+
+ /**
+ * Register a {@link IQosCallback} with base {@link QosFilter}.
+ *
+ * @param filter the filter to register
+ * @param callback the callback to register
+ * @param nai the agent information related to the filter's network
+ */
+ @VisibleForTesting
+ public void registerQosCallbackInternal(@NonNull final QosFilter filter,
+ @NonNull final IQosCallback callback, @NonNull final NetworkAgentInfo nai) {
+ if (filter == null) throw new IllegalArgumentException("filter must be non-null");
+ if (callback == null) throw new IllegalArgumentException("callback must be non-null");
+
+ if (!nai.networkCapabilities.hasCapability(NET_CAPABILITY_NOT_RESTRICTED)) {
+ enforceConnectivityRestrictedNetworksPermission();
+ }
+ mQosCallbackTracker.registerCallback(callback, filter, nai);
+ }
+
+ /**
+ * Unregisters the given callback.
+ *
+ * @param callback the callback to unregister
+ */
+ @Override
+ public void unregisterQosCallback(@NonNull final IQosCallback callback) {
+ mQosCallbackTracker.unregisterCallback(callback);
+ }
}
diff --git a/services/core/java/com/android/server/DynamicSystemService.java b/services/core/java/com/android/server/DynamicSystemService.java
index f2b63a642c29..88ce2208adcb 100644
--- a/services/core/java/com/android/server/DynamicSystemService.java
+++ b/services/core/java/com/android/server/DynamicSystemService.java
@@ -22,7 +22,6 @@ import android.gsi.AvbPublicKey;
import android.gsi.GsiProgress;
import android.gsi.IGsiService;
import android.gsi.IGsiServiceCallback;
-import android.os.Environment;
import android.os.ParcelFileDescriptor;
import android.os.RemoteException;
import android.os.ServiceManager;
@@ -30,7 +29,7 @@ import android.os.SystemProperties;
import android.os.UserHandle;
import android.os.image.IDynamicSystemService;
import android.os.storage.StorageManager;
-import android.os.storage.StorageVolume;
+import android.os.storage.VolumeInfo;
import android.util.Slog;
import java.io.File;
@@ -88,16 +87,17 @@ public class DynamicSystemService extends IDynamicSystemService.Stub {
String path = SystemProperties.get("os.aot.path");
if (path.isEmpty()) {
final int userId = UserHandle.myUserId();
- final StorageVolume[] volumes =
- StorageManager.getVolumeList(userId, StorageManager.FLAG_FOR_WRITE);
- for (StorageVolume volume : volumes) {
- if (volume.isEmulated()) continue;
- if (!volume.isRemovable()) continue;
- if (!Environment.MEDIA_MOUNTED.equals(volume.getState())) continue;
- File sdCard = volume.getPathFile();
- if (sdCard.isDirectory()) {
- path = new File(sdCard, dsuSlot).getPath();
- break;
+ final StorageManager sm = mContext.getSystemService(StorageManager.class);
+ for (VolumeInfo volume : sm.getVolumes()) {
+ if (volume.getType() != volume.TYPE_PUBLIC) {
+ continue;
+ }
+ if (!volume.isMountedWritable()) {
+ continue;
+ }
+ File sd_internal = volume.getInternalPathForUser(userId);
+ if (sd_internal != null) {
+ path = new File(sd_internal, dsuSlot).getPath();
}
}
if (path.isEmpty()) {
diff --git a/services/core/java/com/android/server/StorageManagerService.java b/services/core/java/com/android/server/StorageManagerService.java
index 5c34584d0adf..4e2519b47a47 100644
--- a/services/core/java/com/android/server/StorageManagerService.java
+++ b/services/core/java/com/android/server/StorageManagerService.java
@@ -3297,6 +3297,12 @@ class StorageManagerService extends IStorageManager.Stub
enforcePermission(android.Manifest.permission.STORAGE_INTERNAL);
if (isFsEncrypted) {
+ // When a user has secure lock screen, require secret to actually unlock.
+ // This check is mostly in place for emulation mode.
+ if (StorageManager.isFileEncryptedEmulatedOnly() &&
+ mLockPatternUtils.isSecure(userId) && ArrayUtils.isEmpty(secret)) {
+ throw new IllegalStateException("Secret required to unlock secure user " + userId);
+ }
try {
mVold.unlockUserKey(userId, serialNumber, encodeBytes(token),
encodeBytes(secret));
diff --git a/services/core/java/com/android/server/VcnManagementService.java b/services/core/java/com/android/server/VcnManagementService.java
index 2fdc7965675d..76db0192cb00 100644
--- a/services/core/java/com/android/server/VcnManagementService.java
+++ b/services/core/java/com/android/server/VcnManagementService.java
@@ -31,16 +31,19 @@ import android.net.vcn.VcnConfig;
import android.os.Binder;
import android.os.Handler;
import android.os.HandlerThread;
+import android.os.IBinder;
import android.os.Looper;
import android.os.ParcelUuid;
import android.os.PersistableBundle;
import android.os.Process;
+import android.os.RemoteException;
import android.os.ServiceSpecificException;
import android.os.UserHandle;
import android.telephony.SubscriptionInfo;
import android.telephony.SubscriptionManager;
import android.telephony.TelephonyManager;
import android.util.ArrayMap;
+import android.util.Log;
import android.util.Slog;
import com.android.internal.annotations.GuardedBy;
@@ -155,6 +158,11 @@ public class VcnManagementService extends IVcnManagementService.Stub {
@NonNull private final PersistableBundleUtils.LockingReadWriteHelper mConfigDiskRwHelper;
+ @GuardedBy("mLock")
+ @NonNull
+ private final Map<IBinder, PolicyListenerBinderDeath> mRegisteredPolicyListeners =
+ new ArrayMap<>();
+
@VisibleForTesting(visibility = Visibility.PRIVATE)
VcnManagementService(@NonNull Context context, @NonNull Dependencies deps) {
mContext = requireNonNull(context, "Missing context");
@@ -497,19 +505,60 @@ public class VcnManagementService extends IVcnManagementService.Stub {
}
}
+ /** Binder death recipient used to remove a registered policy listener. */
+ private class PolicyListenerBinderDeath implements Binder.DeathRecipient {
+ @NonNull private final IVcnUnderlyingNetworkPolicyListener mListener;
+
+ PolicyListenerBinderDeath(@NonNull IVcnUnderlyingNetworkPolicyListener listener) {
+ mListener = listener;
+ }
+
+ @Override
+ public void binderDied() {
+ Log.e(TAG, "app died without removing VcnUnderlyingNetworkPolicyListener");
+ removeVcnUnderlyingNetworkPolicyListener(mListener);
+ }
+ }
+
/** Adds the provided listener for receiving VcnUnderlyingNetworkPolicy updates. */
+ @GuardedBy("mLock")
@Override
public void addVcnUnderlyingNetworkPolicyListener(
- IVcnUnderlyingNetworkPolicyListener listener) {
- // TODO(b/175739863): implement policy listener registration
- throw new UnsupportedOperationException("Not yet implemented");
+ @NonNull IVcnUnderlyingNetworkPolicyListener listener) {
+ requireNonNull(listener, "listener was null");
+
+ mContext.enforceCallingPermission(
+ android.Manifest.permission.NETWORK_FACTORY,
+ "Must have permission NETWORK_FACTORY to register a policy listener");
+
+ PolicyListenerBinderDeath listenerBinderDeath = new PolicyListenerBinderDeath(listener);
+
+ synchronized (mLock) {
+ mRegisteredPolicyListeners.put(listener.asBinder(), listenerBinderDeath);
+
+ try {
+ listener.asBinder().linkToDeath(listenerBinderDeath, 0 /* flags */);
+ } catch (RemoteException e) {
+ // Remote binder already died - cleanup registered Listener
+ listenerBinderDeath.binderDied();
+ }
+ }
}
/** Removes the provided listener from receiving VcnUnderlyingNetworkPolicy updates. */
+ @GuardedBy("mLock")
@Override
public void removeVcnUnderlyingNetworkPolicyListener(
- IVcnUnderlyingNetworkPolicyListener listener) {
- // TODO(b/175739863): implement policy listener unregistration
- throw new UnsupportedOperationException("Not yet implemented");
+ @NonNull IVcnUnderlyingNetworkPolicyListener listener) {
+ requireNonNull(listener, "listener was null");
+
+ synchronized (mLock) {
+ PolicyListenerBinderDeath listenerBinderDeath =
+ mRegisteredPolicyListeners.remove(listener.asBinder());
+
+ if (listenerBinderDeath != null) {
+ listener.asBinder().unlinkToDeath(listenerBinderDeath, 0 /* flags */);
+ }
+ }
}
}
diff --git a/services/core/java/com/android/server/Watchdog.java b/services/core/java/com/android/server/Watchdog.java
index 630548df4b0b..ab24015a1174 100644
--- a/services/core/java/com/android/server/Watchdog.java
+++ b/services/core/java/com/android/server/Watchdog.java
@@ -704,7 +704,7 @@ public class Watchdog extends Thread {
WatchdogDiagnostics.diagnoseCheckers(blockedCheckers);
Slog.w(TAG, "*** GOODBYE!");
if (!Build.IS_USER && isCrashLoopFound()
- && !WatchdogProperties.is_fatal_ignore().orElse(false)) {
+ && !WatchdogProperties.should_ignore_fatal_count().orElse(false)) {
breakCrashLoop();
}
Process.killProcess(Process.myPid());
@@ -783,7 +783,7 @@ public class Watchdog extends Thread {
private boolean isCrashLoopFound() {
int fatalCount = WatchdogProperties.fatal_count().orElse(0);
long fatalWindowMs = TimeUnit.SECONDS.toMillis(
- WatchdogProperties.fatal_window_second().orElse(0));
+ WatchdogProperties.fatal_window_seconds().orElse(0));
if (fatalCount == 0 || fatalWindowMs == 0) {
if (fatalCount != fatalWindowMs) {
Slog.w(TAG, String.format("sysprops '%s' and '%s' should be set or unset together",
diff --git a/services/core/java/com/android/server/apphibernation/AppHibernationService.java b/services/core/java/com/android/server/apphibernation/AppHibernationService.java
new file mode 100644
index 000000000000..508bb01e50a8
--- /dev/null
+++ b/services/core/java/com/android/server/apphibernation/AppHibernationService.java
@@ -0,0 +1,349 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server.apphibernation;
+
+import static android.content.Intent.ACTION_PACKAGE_ADDED;
+import static android.content.Intent.ACTION_PACKAGE_REMOVED;
+import static android.content.Intent.ACTION_USER_ADDED;
+import static android.content.Intent.ACTION_USER_REMOVED;
+import static android.content.Intent.EXTRA_REPLACING;
+import static android.content.pm.PackageManager.MATCH_ALL;
+import static android.provider.DeviceConfig.NAMESPACE_APP_HIBERNATION;
+
+import android.annotation.NonNull;
+import android.annotation.Nullable;
+import android.app.ActivityManager;
+import android.app.IActivityManager;
+import android.apphibernation.IAppHibernationService;
+import android.content.BroadcastReceiver;
+import android.content.Context;
+import android.content.Intent;
+import android.content.IntentFilter;
+import android.content.pm.IPackageManager;
+import android.content.pm.PackageInfo;
+import android.content.pm.UserInfo;
+import android.os.Binder;
+import android.os.RemoteException;
+import android.os.ResultReceiver;
+import android.os.ServiceManager;
+import android.os.ShellCallback;
+import android.os.Trace;
+import android.os.UserHandle;
+import android.os.UserManager;
+import android.provider.DeviceConfig;
+import android.util.ArrayMap;
+import android.util.SparseArray;
+
+import com.android.internal.annotations.GuardedBy;
+import com.android.internal.annotations.VisibleForTesting;
+import com.android.server.SystemService;
+
+import java.io.FileDescriptor;
+import java.util.List;
+import java.util.Map;
+
+/**
+ * System service that manages app hibernation state, a state apps can enter that means they are
+ * not being actively used and can be optimized for storage. The actual policy for determining
+ * if an app should hibernate is managed by PermissionController code.
+ */
+public final class AppHibernationService extends SystemService {
+ private static final String TAG = "AppHibernationService";
+
+ /**
+ * Lock for accessing any in-memory hibernation state
+ */
+ private final Object mLock = new Object();
+ private final Context mContext;
+ private final IPackageManager mIPackageManager;
+ private final IActivityManager mIActivityManager;
+ private final UserManager mUserManager;
+ @GuardedBy("mLock")
+ private final SparseArray<Map<String, UserPackageState>> mUserStates = new SparseArray<>();
+
+ /**
+ * Initializes the system service.
+ * <p>
+ * Subclasses must define a single argument constructor that accepts the context
+ * and passes it to super.
+ * </p>
+ *
+ * @param context The system server context.
+ */
+ public AppHibernationService(@NonNull Context context) {
+ this(context, IPackageManager.Stub.asInterface(ServiceManager.getService("package")),
+ ActivityManager.getService(),
+ context.getSystemService(UserManager.class));
+ }
+
+ @VisibleForTesting
+ AppHibernationService(@NonNull Context context, IPackageManager packageManager,
+ IActivityManager activityManager, UserManager userManager) {
+ super(context);
+ mContext = context;
+ mIPackageManager = packageManager;
+ mIActivityManager = activityManager;
+ mUserManager = userManager;
+
+ final Context userAllContext = mContext.createContextAsUser(UserHandle.ALL, 0 /* flags */);
+
+ IntentFilter intentFilter = new IntentFilter();
+ intentFilter.addAction(ACTION_USER_ADDED);
+ intentFilter.addAction(ACTION_USER_REMOVED);
+ userAllContext.registerReceiver(mBroadcastReceiver, intentFilter);
+
+ intentFilter = new IntentFilter();
+ intentFilter.addAction(ACTION_PACKAGE_ADDED);
+ intentFilter.addAction(ACTION_PACKAGE_REMOVED);
+ intentFilter.addDataScheme("package");
+ userAllContext.registerReceiver(mBroadcastReceiver, intentFilter);
+ }
+
+ @Override
+ public void onStart() {
+ publishBinderService(Context.APP_HIBERNATION_SERVICE, mServiceStub);
+ }
+
+ @Override
+ public void onBootPhase(int phase) {
+ if (phase == PHASE_BOOT_COMPLETED) {
+ synchronized (mLock) {
+ final List<UserInfo> users = mUserManager.getUsers();
+ // TODO: Pull from persistent disk storage. For now, just make from scratch.
+ for (UserInfo user : users) {
+ addUserPackageStatesL(user.id);
+ }
+ }
+ }
+ }
+
+ /**
+ * Whether a package is hibernating for a given user.
+ *
+ * @param packageName the package to check
+ * @param userId the user to check
+ * @return true if package is hibernating for the user
+ */
+ public boolean isHibernating(String packageName, int userId) {
+ userId = handleIncomingUser(userId, "isHibernating");
+ synchronized (mLock) {
+ final Map<String, UserPackageState> packageStates = mUserStates.get(userId);
+ if (packageStates == null) {
+ throw new IllegalArgumentException("No user associated with user id " + userId);
+ }
+ final UserPackageState pkgState = packageStates.get(packageName);
+ if (pkgState == null) {
+ throw new IllegalArgumentException(
+ String.format("Package %s is not installed for user %s",
+ packageName, userId));
+ }
+ return pkgState != null ? pkgState.hibernated : null;
+ }
+ }
+
+ /**
+ * Set whether the package is hibernating for the given user.
+ *
+ * @param packageName package to modify state
+ * @param userId user
+ * @param isHibernating new hibernation state
+ */
+ public void setHibernating(String packageName, int userId, boolean isHibernating) {
+ userId = handleIncomingUser(userId, "setHibernating");
+ synchronized (mLock) {
+ if (!mUserStates.contains(userId)) {
+ throw new IllegalArgumentException("No user associated with user id " + userId);
+ }
+ Map<String, UserPackageState> packageStates = mUserStates.get(userId);
+ UserPackageState pkgState = packageStates.get(packageName);
+ if (pkgState == null) {
+ throw new IllegalArgumentException(
+ String.format("Package %s is not installed for user %s",
+ packageName, userId));
+ }
+
+ if (pkgState.hibernated == isHibernating) {
+ return;
+ }
+
+
+ final long caller = Binder.clearCallingIdentity();
+ try {
+ if (isHibernating) {
+ Trace.traceBegin(Trace.TRACE_TAG_SYSTEM_SERVER, "hibernatePackage");
+ mIActivityManager.forceStopPackage(packageName, userId);
+ mIPackageManager.deleteApplicationCacheFilesAsUser(packageName, userId,
+ null /* observer */);
+ } else {
+ Trace.traceBegin(Trace.TRACE_TAG_SYSTEM_SERVER, "unhibernatePackage");
+ mIPackageManager.setPackageStoppedState(packageName, false, userId);
+ }
+ pkgState.hibernated = isHibernating;
+ } catch (RemoteException e) {
+ throw new IllegalStateException(
+ "Failed to hibernate due to manager not being available", e);
+ } finally {
+ Trace.traceEnd(Trace.TRACE_TAG_SYSTEM_SERVER);
+ Binder.restoreCallingIdentity(caller);
+ }
+
+ // TODO: Support package level hibernation when package is hibernating for all users
+ }
+ }
+
+ /**
+ * Populates {@link #mUserStates} with the users installed packages. The caller should hold
+ * {@link #mLock}.
+ *
+ * @param userId user id to add installed packages for
+ */
+ private void addUserPackageStatesL(int userId) {
+ Map<String, UserPackageState> packages = new ArrayMap<>();
+ List<PackageInfo> packageList;
+ try {
+ packageList = mIPackageManager.getInstalledPackages(MATCH_ALL, userId).getList();
+ } catch (RemoteException e) {
+ throw new IllegalStateException("Package manager not available.", e);
+ }
+
+ for (PackageInfo pkg : packageList) {
+ packages.put(pkg.packageName, new UserPackageState());
+ }
+ mUserStates.put(userId, packages);
+ }
+
+ private void onUserAdded(int userId) {
+ synchronized (mLock) {
+ addUserPackageStatesL(userId);
+ }
+ }
+
+ private void onUserRemoved(int userId) {
+ synchronized (mLock) {
+ mUserStates.remove(userId);
+ }
+ }
+
+ private void onPackageAdded(@NonNull String packageName, int userId) {
+ synchronized (mLock) {
+ mUserStates.get(userId).put(packageName, new UserPackageState());
+ }
+ }
+
+ private void onPackageRemoved(@NonNull String packageName, int userId) {
+ synchronized (mLock) {
+ mUserStates.get(userId).remove(packageName);
+ }
+ }
+
+ /**
+ * Private helper method to get the real user id and enforce permission checks.
+ *
+ * @param userId user id to handle
+ * @param name name to use for exceptions
+ * @return real user id
+ */
+ private int handleIncomingUser(int userId, @NonNull String name) {
+ int callingUid = Binder.getCallingUid();
+ try {
+ return mIActivityManager.handleIncomingUser(Binder.getCallingPid(), callingUid, userId,
+ false /* allowAll */, true /* requireFull */, name, null);
+ } catch (RemoteException re) {
+ throw re.rethrowFromSystemServer();
+ }
+ }
+
+ private final AppHibernationServiceStub mServiceStub = new AppHibernationServiceStub(this);
+
+ static final class AppHibernationServiceStub extends IAppHibernationService.Stub {
+ final AppHibernationService mService;
+
+ AppHibernationServiceStub(AppHibernationService service) {
+ mService = service;
+ }
+
+ @Override
+ public boolean isHibernating(String packageName, int userId) {
+ return mService.isHibernating(packageName, userId);
+ }
+
+ @Override
+ public void setHibernating(String packageName, int userId, boolean isHibernating) {
+ mService.setHibernating(packageName, userId, isHibernating);
+ }
+
+ @Override
+ public void onShellCommand(@Nullable FileDescriptor in, @Nullable FileDescriptor out,
+ @Nullable FileDescriptor err, @NonNull String[] args,
+ @Nullable ShellCallback callback, @NonNull ResultReceiver resultReceiver) {
+ new AppHibernationShellCommand(mService).exec(this, in, out, err, args, callback,
+ resultReceiver);
+ }
+ }
+
+ // Broadcast receiver for user and package add/removal events
+ private final BroadcastReceiver mBroadcastReceiver = new BroadcastReceiver() {
+ @Override
+ public void onReceive(Context context, Intent intent) {
+ final int userId = intent.getIntExtra(Intent.EXTRA_USER_HANDLE, UserHandle.USER_NULL);
+ if (userId == UserHandle.USER_NULL) {
+ return;
+ }
+
+ final String action = intent.getAction();
+ if (ACTION_USER_ADDED.equals(action)) {
+ onUserAdded(userId);
+ }
+ if (ACTION_USER_REMOVED.equals(action)) {
+ onUserRemoved(userId);
+ }
+ if (ACTION_PACKAGE_ADDED.equals(action) || ACTION_PACKAGE_REMOVED.equals(action)) {
+ final String packageName = intent.getData().getSchemeSpecificPart();
+ if (intent.getBooleanExtra(EXTRA_REPLACING, false)) {
+ // Package removal/add is part of an update, so no need to modify package state.
+ return;
+ }
+
+ if (ACTION_PACKAGE_ADDED.equals(action)) {
+ onPackageAdded(packageName, userId);
+ } else if (ACTION_PACKAGE_REMOVED.equals(action)) {
+ onPackageRemoved(packageName, userId);
+ }
+ }
+ }
+ };
+
+ /**
+ * Whether app hibernation is enabled on this device.
+ *
+ * @return true if enabled, false otherwise
+ */
+ public static boolean isAppHibernationEnabled() {
+ return DeviceConfig.getBoolean(
+ NAMESPACE_APP_HIBERNATION,
+ AppHibernationConstants.KEY_APP_HIBERNATION_ENABLED,
+ false /* defaultValue */);
+ }
+
+ /**
+ * Data class that contains hibernation state info of a package for a user.
+ */
+ private static final class UserPackageState {
+ public boolean hibernated;
+ // TODO: Track whether hibernation is exempted by the user
+ }
+}
diff --git a/services/core/java/com/android/server/apphibernation/AppHibernationShellCommand.java b/services/core/java/com/android/server/apphibernation/AppHibernationShellCommand.java
new file mode 100644
index 000000000000..869885e28958
--- /dev/null
+++ b/services/core/java/com/android/server/apphibernation/AppHibernationShellCommand.java
@@ -0,0 +1,109 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server.apphibernation;
+
+import android.os.ShellCommand;
+import android.os.UserHandle;
+import android.text.TextUtils;
+
+import java.io.PrintWriter;
+
+/**
+ * Shell command implementation for {@link AppHibernationService}.
+ */
+final class AppHibernationShellCommand extends ShellCommand {
+ private static final String USER_OPT = "--user";
+ private static final int SUCCESS = 0;
+ private static final int ERROR = -1;
+ private final AppHibernationService mService;
+
+ AppHibernationShellCommand(AppHibernationService service) {
+ mService = service;
+ }
+
+ @Override
+ public int onCommand(String cmd) {
+ if (cmd == null) {
+ return handleDefaultCommands(cmd);
+ }
+ switch (cmd) {
+ case "set-state":
+ return runSetState();
+ case "get-state":
+ return runGetState();
+ default:
+ return handleDefaultCommands(cmd);
+ }
+ }
+
+ private int runSetState() {
+ int userId = parseUserOption();
+
+ String pkg = getNextArgRequired();
+ if (pkg == null) {
+ getErrPrintWriter().println("Error: no package specified");
+ return ERROR;
+ }
+
+ String newStateRaw = getNextArgRequired();
+ if (newStateRaw == null) {
+ getErrPrintWriter().println("Error: No state to set specified");
+ return ERROR;
+ }
+ boolean newState = Boolean.parseBoolean(newStateRaw);
+
+ mService.setHibernating(pkg, userId, newState);
+ return SUCCESS;
+ }
+
+ private int runGetState() {
+ int userId = parseUserOption();
+
+ String pkg = getNextArgRequired();
+ if (pkg == null) {
+ getErrPrintWriter().println("Error: No package specified");
+ return ERROR;
+ }
+ boolean isHibernating = mService.isHibernating(pkg, userId);
+ final PrintWriter pw = getOutPrintWriter();
+ pw.println(isHibernating);
+ return SUCCESS;
+ }
+
+ private int parseUserOption() {
+ String option = getNextOption();
+ if (TextUtils.equals(option, USER_OPT)) {
+ return UserHandle.parseUserArg(getNextArgRequired());
+ }
+ return UserHandle.USER_CURRENT;
+ }
+
+ @Override
+ public void onHelp() {
+ final PrintWriter pw = getOutPrintWriter();
+ pw.println("App hibernation (app_hibernation) commands: ");
+ pw.println(" help");
+ pw.println(" Print this help text.");
+ pw.println("");
+ pw.println(" set-state [--user USER_ID] PACKAGE true|false");
+ pw.println(" Sets the hibernation state of the package to value specified");
+ pw.println("");
+ pw.println(" get-state [--user USER_ID] PACKAGE");
+ pw.println(" Gets the hibernation state of the package");
+ pw.println("");
+ }
+}
diff --git a/services/core/java/com/android/server/compat/CompatChange.java b/services/core/java/com/android/server/compat/CompatChange.java
index 9ba957ef27ae..e3757dfc6a59 100644
--- a/services/core/java/com/android/server/compat/CompatChange.java
+++ b/services/core/java/com/android/server/compat/CompatChange.java
@@ -23,8 +23,11 @@ import android.content.pm.ApplicationInfo;
import com.android.internal.compat.CompatibilityChangeInfo;
import com.android.server.compat.config.Change;
+import com.android.server.compat.overrides.ChangeOverrides;
+import com.android.server.compat.overrides.OverrideValue;
import java.util.HashMap;
+import java.util.List;
import java.util.Map;
/**
@@ -253,6 +256,71 @@ public final class CompatChange extends CompatibilityChangeInfo {
return mDeferredOverrides != null && mDeferredOverrides.containsKey(packageName);
}
+ /**
+ * Checks whether a change has any package overrides.
+ * @return true if the change has at least one deferred override
+ */
+ boolean hasAnyPackageOverride() {
+ return mDeferredOverrides != null && !mDeferredOverrides.isEmpty();
+ }
+
+ /**
+ * Checks whether a change has any deferred overrides.
+ * @return true if the change has at least one deferred override
+ */
+ boolean hasAnyDeferredOverride() {
+ return mPackageOverrides != null && !mPackageOverrides.isEmpty();
+ }
+
+ void loadOverrides(ChangeOverrides changeOverrides) {
+ if (mDeferredOverrides == null) {
+ mDeferredOverrides = new HashMap<>();
+ }
+ mDeferredOverrides.clear();
+ for (OverrideValue override : changeOverrides.getDeferred().getOverrideValue()) {
+ mDeferredOverrides.put(override.getPackageName(), override.getEnabled());
+ }
+
+ if (mPackageOverrides == null) {
+ mPackageOverrides = new HashMap<>();
+ }
+ mPackageOverrides.clear();
+ for (OverrideValue override : changeOverrides.getValidated().getOverrideValue()) {
+ mPackageOverrides.put(override.getPackageName(), override.getEnabled());
+ }
+ }
+
+ ChangeOverrides saveOverrides() {
+ if (!hasAnyDeferredOverride() && !hasAnyPackageOverride()) {
+ return null;
+ }
+ ChangeOverrides changeOverrides = new ChangeOverrides();
+ changeOverrides.setChangeId(getId());
+ ChangeOverrides.Deferred deferredOverrides = new ChangeOverrides.Deferred();
+ List<OverrideValue> deferredList = deferredOverrides.getOverrideValue();
+ if (mDeferredOverrides != null) {
+ for (Map.Entry<String, Boolean> entry : mDeferredOverrides.entrySet()) {
+ OverrideValue override = new OverrideValue();
+ override.setPackageName(entry.getKey());
+ override.setEnabled(entry.getValue());
+ deferredList.add(override);
+ }
+ }
+ changeOverrides.setDeferred(deferredOverrides);
+ ChangeOverrides.Validated validatedOverrides = new ChangeOverrides.Validated();
+ List<OverrideValue> validatedList = validatedOverrides.getOverrideValue();
+ if (mPackageOverrides != null) {
+ for (Map.Entry<String, Boolean> entry : mPackageOverrides.entrySet()) {
+ OverrideValue override = new OverrideValue();
+ override.setPackageName(entry.getKey());
+ override.setEnabled(entry.getValue());
+ validatedList.add(override);
+ }
+ }
+ changeOverrides.setValidated(validatedOverrides);
+ return changeOverrides;
+ }
+
@Override
public String toString() {
StringBuilder sb = new StringBuilder("ChangeId(")
diff --git a/services/core/java/com/android/server/compat/CompatConfig.java b/services/core/java/com/android/server/compat/CompatConfig.java
index 69686a2e4678..6b77b9d4ce39 100644
--- a/services/core/java/com/android/server/compat/CompatConfig.java
+++ b/services/core/java/com/android/server/compat/CompatConfig.java
@@ -34,7 +34,10 @@ import com.android.internal.compat.CompatibilityChangeInfo;
import com.android.internal.compat.IOverrideValidator;
import com.android.internal.compat.OverrideAllowedState;
import com.android.server.compat.config.Change;
-import com.android.server.compat.config.XmlParser;
+import com.android.server.compat.config.Config;
+import com.android.server.compat.overrides.ChangeOverrides;
+import com.android.server.compat.overrides.Overrides;
+import com.android.server.compat.overrides.XmlWriter;
import com.android.server.pm.ApexManager;
import org.xmlpull.v1.XmlPullParserException;
@@ -60,11 +63,14 @@ import javax.xml.datatype.DatatypeConfigurationException;
final class CompatConfig {
private static final String TAG = "CompatConfig";
+ private static final String APP_COMPAT_DATA_DIR = "/data/misc/appcompat";
+ private static final String OVERRIDES_FILE = "compat_framework_overrides.xml";
@GuardedBy("mChanges")
private final LongSparseArray<CompatChange> mChanges = new LongSparseArray<>();
private final OverrideValidatorImpl mOverrideValidator;
+ private File mOverridesFile;
@VisibleForTesting
CompatConfig(AndroidBuildClassifier androidBuildClassifier, Context context) {
@@ -83,6 +89,8 @@ final class CompatConfig {
config.initConfigFromLib(Environment.buildPath(
apex.apexDirectory, "etc", "compatconfig"));
}
+ File overridesFile = new File(APP_COMPAT_DATA_DIR, OVERRIDES_FILE);
+ config.initOverrides(overridesFile);
config.invalidateCache();
return config;
}
@@ -202,6 +210,17 @@ final class CompatConfig {
* @throws IllegalStateException if overriding is not allowed
*/
boolean addOverride(long changeId, String packageName, boolean enabled) {
+ boolean alreadyKnown = addOverrideUnsafe(changeId, packageName, enabled);
+ saveOverrides();
+ invalidateCache();
+ return alreadyKnown;
+ }
+
+ /**
+ * Unsafe version of {@link #addOverride(long, String, boolean)}.
+ * It does not invalidate the cache nor save the overrides.
+ */
+ private boolean addOverrideUnsafe(long changeId, String packageName, boolean enabled) {
boolean alreadyKnown = true;
OverrideAllowedState allowedState =
mOverrideValidator.getOverrideAllowedState(changeId, packageName);
@@ -224,7 +243,6 @@ final class CompatConfig {
throw new IllegalStateException("Should only be able to override changes that "
+ "are allowed or can be deferred.");
}
- invalidateCache();
}
return alreadyKnown;
}
@@ -282,6 +300,17 @@ final class CompatConfig {
* @return {@code true} if an override existed;
*/
boolean removeOverride(long changeId, String packageName) {
+ boolean overrideExists = removeOverrideUnsafe(changeId, packageName);
+ saveOverrides();
+ invalidateCache();
+ return overrideExists;
+ }
+
+ /**
+ * Unsafe version of {@link #removeOverride(long, String)}.
+ * It does not invalidate the cache nor save the overrides.
+ */
+ private boolean removeOverrideUnsafe(long changeId, String packageName) {
boolean overrideExists = false;
synchronized (mChanges) {
CompatChange c = mChanges.get(changeId);
@@ -300,7 +329,6 @@ final class CompatConfig {
}
}
}
- invalidateCache();
return overrideExists;
}
@@ -315,12 +343,13 @@ final class CompatConfig {
void addOverrides(CompatibilityChangeConfig overrides, String packageName) {
synchronized (mChanges) {
for (Long changeId : overrides.enabledChanges()) {
- addOverride(changeId, packageName, true);
+ addOverrideUnsafe(changeId, packageName, true);
}
for (Long changeId : overrides.disabledChanges()) {
- addOverride(changeId, packageName, false);
+ addOverrideUnsafe(changeId, packageName, false);
}
+ saveOverrides();
invalidateCache();
}
}
@@ -337,8 +366,9 @@ final class CompatConfig {
synchronized (mChanges) {
for (int i = 0; i < mChanges.size(); ++i) {
CompatChange change = mChanges.valueAt(i);
- removeOverride(change.getId(), packageName);
+ removeOverrideUnsafe(change.getId(), packageName);
}
+ saveOverrides();
invalidateCache();
}
}
@@ -372,8 +402,10 @@ final class CompatConfig {
int enableTargetSdkChangesForPackage(String packageName, int targetSdkVersion) {
long[] changes = getAllowedChangesSinceTargetSdkForPackage(packageName, targetSdkVersion);
for (long changeId : changes) {
- addOverride(changeId, packageName, true);
+ addOverrideUnsafe(changeId, packageName, true);
}
+ saveOverrides();
+ invalidateCache();
return changes.length;
}
@@ -386,8 +418,10 @@ final class CompatConfig {
int disableTargetSdkChangesForPackage(String packageName, int targetSdkVersion) {
long[] changes = getAllowedChangesSinceTargetSdkForPackage(packageName, targetSdkVersion);
for (long changeId : changes) {
- addOverride(changeId, packageName, false);
+ addOverrideUnsafe(changeId, packageName, false);
}
+ saveOverrides();
+ invalidateCache();
return changes.length;
}
@@ -494,7 +528,8 @@ final class CompatConfig {
private void readConfig(File configFile) {
try (InputStream in = new BufferedInputStream(new FileInputStream(configFile))) {
- for (Change change : XmlParser.read(in).getCompatChange()) {
+ Config config = com.android.server.compat.config.XmlParser.read(in);
+ for (Change change : config.getCompatChange()) {
Slog.d(TAG, "Adding: " + change.toString());
addChange(new CompatChange(change));
}
@@ -503,6 +538,65 @@ final class CompatConfig {
}
}
+ void initOverrides(File overridesFile) {
+ if (!overridesFile.exists()) {
+ mOverridesFile = overridesFile;
+ // There have not been any overrides added yet.
+ return;
+ }
+
+ try (InputStream in = new BufferedInputStream(new FileInputStream(overridesFile))) {
+ Overrides overrides = com.android.server.compat.overrides.XmlParser.read(in);
+ for (ChangeOverrides changeOverrides : overrides.getChangeOverrides()) {
+ long changeId = changeOverrides.getChangeId();
+ CompatChange compatChange = mChanges.get(changeId);
+ if (compatChange == null) {
+ Slog.w(TAG, "Change ID " + changeId + " not found. "
+ + "Skipping overrides for it.");
+ continue;
+ }
+ compatChange.loadOverrides(changeOverrides);
+ }
+ } catch (IOException | DatatypeConfigurationException | XmlPullParserException e) {
+ Slog.w(TAG, "Error processing " + overridesFile + " " + e.toString());
+ return;
+ }
+ mOverridesFile = overridesFile;
+ }
+
+ /**
+ * Persist compat framework overrides to /data/misc/appcompat/compat_framework_overrides.xml
+ */
+ void saveOverrides() {
+ if (mOverridesFile == null) {
+ return;
+ }
+ synchronized (mChanges) {
+ // Create the file if it doesn't already exist
+ try {
+ mOverridesFile.createNewFile();
+ } catch (IOException e) {
+ Slog.e(TAG, "Could not create override config file: " + e.toString());
+ return;
+ }
+ try (PrintWriter out = new PrintWriter(mOverridesFile)) {
+ XmlWriter writer = new XmlWriter(out);
+ Overrides overrides = new Overrides();
+ List<ChangeOverrides> changeOverridesList = overrides.getChangeOverrides();
+ for (int idx = 0; idx < mChanges.size(); ++idx) {
+ CompatChange c = mChanges.valueAt(idx);
+ ChangeOverrides changeOverrides = c.saveOverrides();
+ if (changeOverrides != null) {
+ changeOverridesList.add(changeOverrides);
+ }
+ }
+ XmlWriter.write(writer, overrides);
+ } catch (IOException e) {
+ Slog.e(TAG, e.toString());
+ }
+ }
+ }
+
IOverrideValidator getOverrideValidator() {
return mOverrideValidator;
}
diff --git a/services/core/java/com/android/server/connectivity/NetworkAgentInfo.java b/services/core/java/com/android/server/connectivity/NetworkAgentInfo.java
index e3663baaf9f7..ab0360b0395a 100644
--- a/services/core/java/com/android/server/connectivity/NetworkAgentInfo.java
+++ b/services/core/java/com/android/server/connectivity/NetworkAgentInfo.java
@@ -36,12 +36,17 @@ import android.net.NetworkInfo;
import android.net.NetworkMonitorManager;
import android.net.NetworkRequest;
import android.net.NetworkState;
+import android.net.QosCallbackException;
+import android.net.QosFilter;
+import android.net.QosFilterParcelable;
+import android.net.QosSession;
import android.net.TcpKeepalivePacketData;
import android.os.Handler;
import android.os.IBinder;
import android.os.INetworkManagementService;
import android.os.RemoteException;
import android.os.SystemClock;
+import android.telephony.data.EpsBearerQosSessionAttributes;
import android.util.Log;
import android.util.Pair;
import android.util.SparseArray;
@@ -321,18 +326,20 @@ public class NetworkAgentInfo implements Comparable<NetworkAgentInfo> {
private final ConnectivityService mConnService;
private final Context mContext;
private final Handler mHandler;
+ private final QosCallbackTracker mQosCallbackTracker;
public NetworkAgentInfo(INetworkAgent na, Network net, NetworkInfo info,
LinkProperties lp, NetworkCapabilities nc, int score, Context context,
Handler handler, NetworkAgentConfig config, ConnectivityService connService, INetd netd,
IDnsResolver dnsResolver, INetworkManagementService nms, int factorySerialNumber,
- int creatorUid) {
+ int creatorUid, QosCallbackTracker qosCallbackTracker) {
Objects.requireNonNull(net);
Objects.requireNonNull(info);
Objects.requireNonNull(lp);
Objects.requireNonNull(nc);
Objects.requireNonNull(context);
Objects.requireNonNull(config);
+ Objects.requireNonNull(qosCallbackTracker);
networkAgent = na;
network = net;
networkInfo = info;
@@ -346,6 +353,7 @@ public class NetworkAgentInfo implements Comparable<NetworkAgentInfo> {
networkAgentConfig = config;
this.factorySerialNumber = factorySerialNumber;
this.creatorUid = creatorUid;
+ mQosCallbackTracker = qosCallbackTracker;
}
private class AgentDeathMonitor implements IBinder.DeathRecipient {
@@ -531,6 +539,31 @@ public class NetworkAgentInfo implements Comparable<NetworkAgentInfo> {
}
}
+ /**
+ * Notify the NetworkAgent that the qos filter should be registered against the given qos
+ * callback id.
+ */
+ public void onQosFilterCallbackRegistered(final int qosCallbackId,
+ final QosFilter qosFilter) {
+ try {
+ networkAgent.onQosFilterCallbackRegistered(qosCallbackId,
+ new QosFilterParcelable(qosFilter));
+ } catch (final RemoteException e) {
+ Log.e(TAG, "Error registering a qos callback id against a qos filter", e);
+ }
+ }
+
+ /**
+ * Notify the NetworkAgent that the given qos callback id should be unregistered.
+ */
+ public void onQosCallbackUnregistered(final int qosCallbackId) {
+ try {
+ networkAgent.onQosCallbackUnregistered(qosCallbackId);
+ } catch (RemoteException e) {
+ Log.e(TAG, "Error unregistering a qos callback id", e);
+ }
+ }
+
// TODO: consider moving out of NetworkAgentInfo into its own class
private class NetworkAgentMessageHandler extends INetworkAgentRegistry.Stub {
private final Handler mHandler;
@@ -584,6 +617,23 @@ public class NetworkAgentInfo implements Comparable<NetworkAgentInfo> {
mHandler.obtainMessage(NetworkAgent.EVENT_UNDERLYING_NETWORKS_CHANGED,
new Pair<>(NetworkAgentInfo.this, networks)).sendToTarget();
}
+
+ @Override
+ public void sendEpsQosSessionAvailable(final int qosCallbackId, final QosSession session,
+ final EpsBearerQosSessionAttributes attributes) {
+ mQosCallbackTracker.sendEventQosSessionAvailable(qosCallbackId, session, attributes);
+ }
+
+ @Override
+ public void sendQosSessionLost(final int qosCallbackId, final QosSession session) {
+ mQosCallbackTracker.sendEventQosSessionLost(qosCallbackId, session);
+ }
+
+ @Override
+ public void sendQosCallbackError(final int qosCallbackId,
+ @QosCallbackException.ExceptionType final int exceptionType) {
+ mQosCallbackTracker.sendEventQosCallbackError(qosCallbackId, exceptionType);
+ }
}
/**
diff --git a/services/core/java/com/android/server/connectivity/QosCallbackAgentConnection.java b/services/core/java/com/android/server/connectivity/QosCallbackAgentConnection.java
new file mode 100644
index 000000000000..816bf2be0d69
--- /dev/null
+++ b/services/core/java/com/android/server/connectivity/QosCallbackAgentConnection.java
@@ -0,0 +1,192 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server.connectivity;
+
+import static android.net.QosCallbackException.EX_TYPE_FILTER_NONE;
+
+import android.annotation.NonNull;
+import android.net.IQosCallback;
+import android.net.Network;
+import android.net.QosCallbackException;
+import android.net.QosFilter;
+import android.net.QosSession;
+import android.os.IBinder;
+import android.os.RemoteException;
+import android.telephony.data.EpsBearerQosSessionAttributes;
+import android.util.Slog;
+
+import java.util.Objects;
+
+/**
+ * Wraps callback related information and sends messages between network agent and the application.
+ * <p/>
+ * This is a satellite class of {@link com.android.server.ConnectivityService} and not meant
+ * to be used in other contexts.
+ *
+ * @hide
+ */
+class QosCallbackAgentConnection implements IBinder.DeathRecipient {
+ private static final String TAG = QosCallbackAgentConnection.class.getSimpleName();
+ private static final boolean DBG = false;
+
+ private final int mAgentCallbackId;
+ @NonNull private final QosCallbackTracker mQosCallbackTracker;
+ @NonNull private final IQosCallback mCallback;
+ @NonNull private final IBinder mBinder;
+ @NonNull private final QosFilter mFilter;
+ @NonNull private final NetworkAgentInfo mNetworkAgentInfo;
+
+ private final int mUid;
+
+ /**
+ * Gets the uid
+ * @return uid
+ */
+ int getUid() {
+ return mUid;
+ }
+
+ /**
+ * Gets the binder
+ * @return binder
+ */
+ @NonNull
+ IBinder getBinder() {
+ return mBinder;
+ }
+
+ /**
+ * Gets the callback id
+ *
+ * @return callback id
+ */
+ int getAgentCallbackId() {
+ return mAgentCallbackId;
+ }
+
+ /**
+ * Gets the network tied to the callback of this connection
+ *
+ * @return network
+ */
+ @NonNull
+ Network getNetwork() {
+ return mFilter.getNetwork();
+ }
+
+ QosCallbackAgentConnection(@NonNull final QosCallbackTracker qosCallbackTracker,
+ final int agentCallbackId,
+ @NonNull final IQosCallback callback,
+ @NonNull final QosFilter filter,
+ final int uid,
+ @NonNull final NetworkAgentInfo networkAgentInfo) {
+ Objects.requireNonNull(qosCallbackTracker, "qosCallbackTracker must be non-null");
+ Objects.requireNonNull(callback, "callback must be non-null");
+ Objects.requireNonNull(filter, "filter must be non-null");
+ Objects.requireNonNull(networkAgentInfo, "networkAgentInfo must be non-null");
+
+ mQosCallbackTracker = qosCallbackTracker;
+ mAgentCallbackId = agentCallbackId;
+ mCallback = callback;
+ mFilter = filter;
+ mUid = uid;
+ mBinder = mCallback.asBinder();
+ mNetworkAgentInfo = networkAgentInfo;
+ }
+
+ @Override
+ public void binderDied() {
+ logw("binderDied: binder died with callback id: " + mAgentCallbackId);
+ mQosCallbackTracker.unregisterCallback(mCallback);
+ }
+
+ void unlinkToDeathRecipient() {
+ mBinder.unlinkToDeath(this, 0);
+ }
+
+ // Returns false if the NetworkAgent was never notified.
+ boolean sendCmdRegisterCallback() {
+ final int exceptionType = mFilter.validate();
+ if (exceptionType != EX_TYPE_FILTER_NONE) {
+ try {
+ if (DBG) log("sendCmdRegisterCallback: filter validation failed");
+ mCallback.onError(exceptionType);
+ } catch (final RemoteException e) {
+ loge("sendCmdRegisterCallback:", e);
+ }
+ return false;
+ }
+
+ try {
+ mBinder.linkToDeath(this, 0);
+ } catch (final RemoteException e) {
+ loge("failed linking to death recipient", e);
+ return false;
+ }
+ mNetworkAgentInfo.onQosFilterCallbackRegistered(mAgentCallbackId, mFilter);
+ return true;
+ }
+
+ void sendCmdUnregisterCallback() {
+ if (DBG) log("sendCmdUnregisterCallback: unregistering");
+ mNetworkAgentInfo.onQosCallbackUnregistered(mAgentCallbackId);
+ }
+
+ void sendEventQosSessionAvailable(final QosSession session,
+ final EpsBearerQosSessionAttributes attributes) {
+ try {
+ if (DBG) log("sendEventQosSessionAvailable: sending...");
+ mCallback.onQosEpsBearerSessionAvailable(session, attributes);
+ } catch (final RemoteException e) {
+ loge("sendEventQosSessionAvailable: remote exception", e);
+ }
+ }
+
+ void sendEventQosSessionLost(@NonNull final QosSession session) {
+ try {
+ if (DBG) log("sendEventQosSessionLost: sending...");
+ mCallback.onQosSessionLost(session);
+ } catch (final RemoteException e) {
+ loge("sendEventQosSessionLost: remote exception", e);
+ }
+ }
+
+ void sendEventQosCallbackError(@QosCallbackException.ExceptionType final int exceptionType) {
+ try {
+ if (DBG) log("sendEventQosCallbackError: sending...");
+ mCallback.onError(exceptionType);
+ } catch (final RemoteException e) {
+ loge("sendEventQosCallbackError: remote exception", e);
+ }
+ }
+
+ private static void log(@NonNull final String msg) {
+ Slog.d(TAG, msg);
+ }
+
+ private static void logw(@NonNull final String msg) {
+ Slog.w(TAG, msg);
+ }
+
+ private static void loge(@NonNull final String msg, final Throwable t) {
+ Slog.e(TAG, msg, t);
+ }
+
+ private static void logwtf(@NonNull final String msg) {
+ Slog.wtf(TAG, msg);
+ }
+}
diff --git a/services/core/java/com/android/server/connectivity/QosCallbackTracker.java b/services/core/java/com/android/server/connectivity/QosCallbackTracker.java
new file mode 100644
index 000000000000..87b4c162a2cc
--- /dev/null
+++ b/services/core/java/com/android/server/connectivity/QosCallbackTracker.java
@@ -0,0 +1,277 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server.connectivity;
+
+import android.annotation.NonNull;
+import android.annotation.Nullable;
+import android.net.IQosCallback;
+import android.net.Network;
+import android.net.QosCallbackException;
+import android.net.QosFilter;
+import android.net.QosSession;
+import android.os.Binder;
+import android.os.Handler;
+import android.os.IBinder;
+import android.telephony.data.EpsBearerQosSessionAttributes;
+import android.util.Slog;
+
+import com.android.internal.util.CollectionUtils;
+import com.android.server.ConnectivityService;
+
+import java.util.ArrayList;
+import java.util.List;
+
+/**
+ * Tracks qos callbacks and handles the communication between the network agent and application.
+ * <p/>
+ * Any method prefixed by handle must be called from the
+ * {@link com.android.server.ConnectivityService} handler thread.
+ *
+ * @hide
+ */
+public class QosCallbackTracker {
+ private static final String TAG = QosCallbackTracker.class.getSimpleName();
+ private static final boolean DBG = true;
+
+ @NonNull
+ private final Handler mConnectivityServiceHandler;
+
+ @NonNull
+ private final ConnectivityService.PerUidCounter mNetworkRequestCounter;
+
+ /**
+ * Each agent gets a unique callback id that is used to proxy messages back to the original
+ * callback.
+ * <p/>
+ * Note: The fact that this is initialized to 0 is to ensure that the thread running
+ * {@link #handleRegisterCallback(IQosCallback, QosFilter, int, NetworkAgentInfo)} sees the
+ * initialized value. This would not necessarily be the case if the value was initialized to
+ * the non-default value.
+ * <p/>
+ * Note: The term previous does not apply to the first callback id that is assigned.
+ */
+ private int mPreviousAgentCallbackId = 0;
+
+ @NonNull
+ private final List<QosCallbackAgentConnection> mConnections = new ArrayList<>();
+
+ /**
+ *
+ * @param connectivityServiceHandler must be the same handler used with
+ * {@link com.android.server.ConnectivityService}
+ * @param networkRequestCounter keeps track of the number of open requests under a given
+ * uid
+ */
+ public QosCallbackTracker(@NonNull final Handler connectivityServiceHandler,
+ final ConnectivityService.PerUidCounter networkRequestCounter) {
+ mConnectivityServiceHandler = connectivityServiceHandler;
+ mNetworkRequestCounter = networkRequestCounter;
+ }
+
+ /**
+ * Registers the callback with the tracker
+ *
+ * @param callback the callback to register
+ * @param filter the filter being registered alongside the callback
+ */
+ public void registerCallback(@NonNull final IQosCallback callback,
+ @NonNull final QosFilter filter, @NonNull final NetworkAgentInfo networkAgentInfo) {
+ final int uid = Binder.getCallingUid();
+
+ // Enforce that the number of requests under this uid has exceeded the allowed number
+ mNetworkRequestCounter.incrementCountOrThrow(uid);
+
+ mConnectivityServiceHandler.post(
+ () -> handleRegisterCallback(callback, filter, uid, networkAgentInfo));
+ }
+
+ private void handleRegisterCallback(@NonNull final IQosCallback callback,
+ @NonNull final QosFilter filter, final int uid,
+ @NonNull final NetworkAgentInfo networkAgentInfo) {
+ final QosCallbackAgentConnection ac =
+ handleRegisterCallbackInternal(callback, filter, uid, networkAgentInfo);
+ if (ac != null) {
+ if (DBG) log("handleRegisterCallback: added callback " + ac.getAgentCallbackId());
+ mConnections.add(ac);
+ } else {
+ mNetworkRequestCounter.decrementCount(uid);
+ }
+ }
+
+ private QosCallbackAgentConnection handleRegisterCallbackInternal(
+ @NonNull final IQosCallback callback,
+ @NonNull final QosFilter filter, final int uid,
+ @NonNull final NetworkAgentInfo networkAgentInfo) {
+ final IBinder binder = callback.asBinder();
+ if (CollectionUtils.any(mConnections, c -> c.getBinder().equals(binder))) {
+ // A duplicate registration would have only made this far due to a programming error.
+ logwtf("handleRegisterCallback: Callbacks can only be register once.");
+ return null;
+ }
+
+ mPreviousAgentCallbackId = mPreviousAgentCallbackId + 1;
+ final int newCallbackId = mPreviousAgentCallbackId;
+
+ final QosCallbackAgentConnection ac =
+ new QosCallbackAgentConnection(this, newCallbackId, callback,
+ filter, uid, networkAgentInfo);
+
+ final int exceptionType = filter.validate();
+ if (exceptionType != QosCallbackException.EX_TYPE_FILTER_NONE) {
+ ac.sendEventQosCallbackError(exceptionType);
+ return null;
+ }
+
+ // Only add to the callback maps if the NetworkAgent successfully registered it
+ if (!ac.sendCmdRegisterCallback()) {
+ // There was an issue when registering the agent
+ if (DBG) log("handleRegisterCallback: error sending register callback");
+ mNetworkRequestCounter.decrementCount(uid);
+ return null;
+ }
+ return ac;
+ }
+
+ /**
+ * Unregisters callback
+ * @param callback callback to unregister
+ */
+ public void unregisterCallback(@NonNull final IQosCallback callback) {
+ mConnectivityServiceHandler.post(() -> handleUnregisterCallback(callback.asBinder(), true));
+ }
+
+ private void handleUnregisterCallback(@NonNull final IBinder binder,
+ final boolean sendToNetworkAgent) {
+ final QosCallbackAgentConnection agentConnection =
+ CollectionUtils.find(mConnections, c -> c.getBinder().equals(binder));
+ if (agentConnection == null) {
+ logw("handleUnregisterCallback: agentConnection is null");
+ return;
+ }
+
+ if (DBG) {
+ log("handleUnregisterCallback: unregister "
+ + agentConnection.getAgentCallbackId());
+ }
+
+ mNetworkRequestCounter.decrementCount(agentConnection.getUid());
+ mConnections.remove(agentConnection);
+
+ if (sendToNetworkAgent) {
+ agentConnection.sendCmdUnregisterCallback();
+ }
+ agentConnection.unlinkToDeathRecipient();
+ }
+
+ /**
+ * Called when the NetworkAgent sends the qos session available event
+ *
+ * @param qosCallbackId the callback id that the qos session is now available to
+ * @param session the qos session that is now available
+ * @param attributes the qos attributes that are now available on the qos session
+ */
+ public void sendEventQosSessionAvailable(final int qosCallbackId,
+ final QosSession session,
+ final EpsBearerQosSessionAttributes attributes) {
+ runOnAgentConnection(qosCallbackId, "sendEventQosSessionAvailable: ",
+ ac -> ac.sendEventQosSessionAvailable(session, attributes));
+ }
+
+ /**
+ * Called when the NetworkAgent sends the qos session lost event
+ *
+ * @param qosCallbackId the callback id that lost the qos session
+ * @param session the corresponding qos session
+ */
+ public void sendEventQosSessionLost(final int qosCallbackId,
+ final QosSession session) {
+ runOnAgentConnection(qosCallbackId, "sendEventQosSessionLost: ",
+ ac -> ac.sendEventQosSessionLost(session));
+ }
+
+ /**
+ * Called when the NetworkAgent sends the qos session on error event
+ *
+ * @param qosCallbackId the callback id that should receive the exception
+ * @param exceptionType the type of exception that caused the callback to error
+ */
+ public void sendEventQosCallbackError(final int qosCallbackId,
+ @QosCallbackException.ExceptionType final int exceptionType) {
+ runOnAgentConnection(qosCallbackId, "sendEventQosCallbackError: ",
+ ac -> {
+ ac.sendEventQosCallbackError(exceptionType);
+ handleUnregisterCallback(ac.getBinder(), false);
+ });
+ }
+
+ /**
+ * Unregisters all callbacks associated to this network agent
+ *
+ * Note: Must be called on the connectivity service handler thread
+ *
+ * @param network the network that was released
+ */
+ public void handleNetworkReleased(@Nullable final Network network) {
+ final List<QosCallbackAgentConnection> connections =
+ CollectionUtils.filter(mConnections, ac -> ac.getNetwork().equals(network));
+
+ for (final QosCallbackAgentConnection agentConnection : connections) {
+ agentConnection.sendEventQosCallbackError(
+ QosCallbackException.EX_TYPE_FILTER_NETWORK_RELEASED);
+
+ // Call unregister workflow w\o sending anything to agent since it is disconnected.
+ handleUnregisterCallback(agentConnection.getBinder(), false);
+ }
+ }
+
+ private interface AgentConnectionAction {
+ void execute(@NonNull QosCallbackAgentConnection agentConnection);
+ }
+
+ @Nullable
+ private void runOnAgentConnection(final int qosCallbackId,
+ @NonNull final String logPrefix,
+ @NonNull final AgentConnectionAction action) {
+ mConnectivityServiceHandler.post(() -> {
+ final QosCallbackAgentConnection ac =
+ CollectionUtils.find(mConnections,
+ c -> c.getAgentCallbackId() == qosCallbackId);
+ if (ac == null) {
+ loge(logPrefix + ": " + qosCallbackId + " missing callback id");
+ return;
+ }
+
+ action.execute(ac);
+ });
+ }
+
+ private static void log(final String msg) {
+ Slog.d(TAG, msg);
+ }
+
+ private static void logw(final String msg) {
+ Slog.w(TAG, msg);
+ }
+
+ private static void loge(final String msg) {
+ Slog.e(TAG, msg);
+ }
+
+ private static void logwtf(final String msg) {
+ Slog.wtf(TAG, msg);
+ }
+}
diff --git a/services/core/java/com/android/server/connectivity/Vpn.java b/services/core/java/com/android/server/connectivity/Vpn.java
index fb1e8197ccff..8ce6746bc7cb 100644
--- a/services/core/java/com/android/server/connectivity/Vpn.java
+++ b/services/core/java/com/android/server/connectivity/Vpn.java
@@ -70,6 +70,7 @@ import android.net.NetworkRequest;
import android.net.RouteInfo;
import android.net.UidRange;
import android.net.UidRangeParcel;
+import android.net.VpnInfo;
import android.net.VpnManager;
import android.net.VpnService;
import android.net.ipsec.ike.ChildSessionCallback;
@@ -109,7 +110,6 @@ import com.android.internal.annotations.VisibleForTesting;
import com.android.internal.messages.nano.SystemMessageProto.SystemMessage;
import com.android.internal.net.LegacyVpnInfo;
import com.android.internal.net.VpnConfig;
-import com.android.internal.net.VpnInfo;
import com.android.internal.net.VpnProfile;
import com.android.server.DeviceIdleInternal;
import com.android.server.LocalServices;
@@ -1816,18 +1816,15 @@ public class Vpn {
}
/**
- * This method should only be called by ConnectivityService because it doesn't
- * have enough data to fill VpnInfo.primaryUnderlyingIface field.
+ * This method should not be called if underlying interfaces field is needed, because it doesn't
+ * have enough data to fill VpnInfo.underlyingIfaces field.
*/
public synchronized VpnInfo getVpnInfo() {
if (!isRunningLocked()) {
return null;
}
- VpnInfo info = new VpnInfo();
- info.ownerUid = mOwnerUID;
- info.vpnIface = mInterface;
- return info;
+ return new VpnInfo(mOwnerUID, mInterface, null);
}
public synchronized boolean appliesToUid(int uid) {
diff --git a/services/core/java/com/android/server/hdmi/HdmiCecLocalDeviceAudioSystem.java b/services/core/java/com/android/server/hdmi/HdmiCecLocalDeviceAudioSystem.java
index ab289ea6f081..f876e1ad4b88 100644
--- a/services/core/java/com/android/server/hdmi/HdmiCecLocalDeviceAudioSystem.java
+++ b/services/core/java/com/android/server/hdmi/HdmiCecLocalDeviceAudioSystem.java
@@ -901,7 +901,6 @@ public class HdmiCecLocalDeviceAudioSystem extends HdmiCecLocalDeviceSource {
@ServiceThreadOnly
void setArcStatus(boolean enabled) {
- // TODO(shubang): add tests
assertRunOnServiceThread();
HdmiLogger.debug("Set Arc Status[old:%b new:%b]", mArcEstablished, enabled);
diff --git a/services/core/java/com/android/server/locksettings/LockSettingsStorage.java b/services/core/java/com/android/server/locksettings/LockSettingsStorage.java
index 81d07cc11527..c4225eda7d24 100644
--- a/services/core/java/com/android/server/locksettings/LockSettingsStorage.java
+++ b/services/core/java/com/android/server/locksettings/LockSettingsStorage.java
@@ -88,6 +88,7 @@ class LockSettingsStorage {
private static final String CHILD_PROFILE_LOCK_FILE = "gatekeeper.profile.key";
private static final String REBOOT_ESCROW_FILE = "reboot.escrow.key";
+ private static final String REBOOT_ESCROW_SERVER_BLOB = "reboot.escrow.server.blob.key";
private static final String SYNTHETIC_PASSWORD_DIRECTORY = "spblob/";
@@ -317,6 +318,22 @@ class LockSettingsStorage {
deleteFile(getRebootEscrowFile(userId));
}
+ public void writeRebootEscrowServerBlob(byte[] serverBlob) {
+ writeFile(getRebootEscrowServerBlob(), serverBlob);
+ }
+
+ public byte[] readRebootEscrowServerBlob() {
+ return readFile(getRebootEscrowServerBlob());
+ }
+
+ public boolean hasRebootEscrowServerBlob() {
+ return hasFile(getRebootEscrowServerBlob());
+ }
+
+ public void removeRebootEscrowServerBlob() {
+ deleteFile(getRebootEscrowServerBlob());
+ }
+
public boolean hasPassword(int userId) {
return hasFile(getLockPasswordFilename(userId));
}
@@ -445,6 +462,12 @@ class LockSettingsStorage {
return getLockCredentialFilePathForUser(userId, REBOOT_ESCROW_FILE);
}
+ @VisibleForTesting
+ String getRebootEscrowServerBlob() {
+ // There is a single copy of server blob for all users.
+ return getLockCredentialFilePathForUser(UserHandle.USER_SYSTEM, REBOOT_ESCROW_SERVER_BLOB);
+ }
+
private String getLockCredentialFilePathForUser(int userId, String basename) {
String dataSystemDirectory = Environment.getDataDirectory().getAbsolutePath() +
SYSTEM_DIRECTORY;
diff --git a/services/core/java/com/android/server/locksettings/RebootEscrowManager.java b/services/core/java/com/android/server/locksettings/RebootEscrowManager.java
index fbec91576ca1..06962d414009 100644
--- a/services/core/java/com/android/server/locksettings/RebootEscrowManager.java
+++ b/services/core/java/com/android/server/locksettings/RebootEscrowManager.java
@@ -124,26 +124,28 @@ class RebootEscrowManager {
static class Injector {
protected Context mContext;
private final RebootEscrowKeyStoreManager mKeyStoreManager;
- private final RebootEscrowProviderInterface mRebootEscrowProvider;
+ private final LockSettingsStorage mStorage;
+ private RebootEscrowProviderInterface mRebootEscrowProvider;
- Injector(Context context) {
+ Injector(Context context, LockSettingsStorage storage) {
mContext = context;
+ mStorage = storage;
mKeyStoreManager = new RebootEscrowKeyStoreManager();
+ }
- RebootEscrowProviderInterface rebootEscrowProvider = null;
- // TODO(xunchang) add implementation for server based ror.
+ private RebootEscrowProviderInterface createRebootEscrowProvider() {
+ RebootEscrowProviderInterface rebootEscrowProvider;
if (DeviceConfig.getBoolean(DeviceConfig.NAMESPACE_OTA,
"server_based_ror_enabled", false)) {
- Slog.e(TAG, "Server based ror isn't implemented yet.");
+ rebootEscrowProvider = new RebootEscrowProviderServerBasedImpl(mContext, mStorage);
} else {
rebootEscrowProvider = new RebootEscrowProviderHalImpl();
}
- if (rebootEscrowProvider != null && rebootEscrowProvider.hasRebootEscrowSupport()) {
- mRebootEscrowProvider = rebootEscrowProvider;
- } else {
- mRebootEscrowProvider = null;
+ if (rebootEscrowProvider.hasRebootEscrowSupport()) {
+ return rebootEscrowProvider;
}
+ return null;
}
public Context getContext() {
@@ -159,6 +161,12 @@ class RebootEscrowManager {
}
public RebootEscrowProviderInterface getRebootEscrowProvider() {
+ // Initialize for the provider lazily. Because the device_config and service
+ // implementation apps may change when system server is running.
+ if (mRebootEscrowProvider == null) {
+ mRebootEscrowProvider = createRebootEscrowProvider();
+ }
+
return mRebootEscrowProvider;
}
@@ -177,7 +185,7 @@ class RebootEscrowManager {
}
RebootEscrowManager(Context context, Callbacks callbacks, LockSettingsStorage storage) {
- this(new Injector(context), callbacks, storage);
+ this(new Injector(context, storage), callbacks, storage);
}
@VisibleForTesting
diff --git a/services/core/java/com/android/server/locksettings/RebootEscrowProviderServerBasedImpl.java b/services/core/java/com/android/server/locksettings/RebootEscrowProviderServerBasedImpl.java
new file mode 100644
index 000000000000..ba1a680ba7fb
--- /dev/null
+++ b/services/core/java/com/android/server/locksettings/RebootEscrowProviderServerBasedImpl.java
@@ -0,0 +1,202 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server.locksettings;
+
+import android.annotation.Nullable;
+import android.content.Context;
+import android.os.RemoteException;
+import android.provider.DeviceConfig;
+import android.util.Slog;
+
+import com.android.internal.annotations.VisibleForTesting;
+import com.android.server.locksettings.ResumeOnRebootServiceProvider.ResumeOnRebootServiceConnection;
+
+import java.io.IOException;
+import java.util.concurrent.TimeoutException;
+
+import javax.crypto.SecretKey;
+
+/**
+ * An implementation of the {@link RebootEscrowProviderInterface} by communicating with server to
+ * encrypt & decrypt the blob.
+ */
+class RebootEscrowProviderServerBasedImpl implements RebootEscrowProviderInterface {
+ private static final String TAG = "RebootEscrowProvider";
+
+ // Timeout for service binding
+ private static final long DEFAULT_SERVICE_TIMEOUT_IN_SECONDS = 10;
+
+ /**
+ * Use the default lifetime of 10 minutes. The lifetime covers the following activities:
+ * Server wrap secret -> device reboot -> server unwrap blob.
+ */
+ private static final long DEFAULT_SERVER_BLOB_LIFETIME_IN_MILLIS = 600_1000;
+
+ private final LockSettingsStorage mStorage;
+
+ private final Injector mInjector;
+
+ static class Injector {
+ private ResumeOnRebootServiceConnection mServiceConnection = null;
+
+ Injector(Context context) {
+ mServiceConnection = new ResumeOnRebootServiceProvider(context).getServiceConnection();
+ if (mServiceConnection == null) {
+ Slog.e(TAG, "Failed to resolve resume on reboot server service.");
+ }
+ }
+
+ Injector(ResumeOnRebootServiceConnection serviceConnection) {
+ mServiceConnection = serviceConnection;
+ }
+
+ @Nullable
+ private ResumeOnRebootServiceConnection getServiceConnection() {
+ return mServiceConnection;
+ }
+
+ long getServiceTimeoutInSeconds() {
+ return DeviceConfig.getLong(DeviceConfig.NAMESPACE_OTA,
+ "server_based_service_timeout_in_seconds",
+ DEFAULT_SERVICE_TIMEOUT_IN_SECONDS);
+ }
+
+ long getServerBlobLifetimeInMillis() {
+ return DeviceConfig.getLong(DeviceConfig.NAMESPACE_OTA,
+ "server_based_server_blob_lifetime_in_millis",
+ DEFAULT_SERVER_BLOB_LIFETIME_IN_MILLIS);
+ }
+ }
+
+ RebootEscrowProviderServerBasedImpl(Context context, LockSettingsStorage storage) {
+ this(storage, new Injector(context));
+ }
+
+ @VisibleForTesting
+ RebootEscrowProviderServerBasedImpl(LockSettingsStorage storage, Injector injector) {
+ mStorage = storage;
+ mInjector = injector;
+ }
+
+ @Override
+ public boolean hasRebootEscrowSupport() {
+ return mInjector.getServiceConnection() != null;
+ }
+
+ private byte[] unwrapServerBlob(byte[] serverBlob, SecretKey decryptionKey) throws
+ TimeoutException, RemoteException, IOException {
+ ResumeOnRebootServiceConnection serviceConnection = mInjector.getServiceConnection();
+ if (serviceConnection == null) {
+ Slog.w(TAG, "Had reboot escrow data for users, but resume on reboot server"
+ + " service is unavailable");
+ return null;
+ }
+
+ // Decrypt with k_k from the key store first.
+ byte[] decryptedBlob = AesEncryptionUtil.decrypt(decryptionKey, serverBlob);
+ if (decryptedBlob == null) {
+ Slog.w(TAG, "Decrypted server blob should not be null");
+ return null;
+ }
+
+ // Ask the server connection service to decrypt the inner layer, to get the reboot
+ // escrow key (k_s).
+ serviceConnection.bindToService(mInjector.getServiceTimeoutInSeconds());
+ byte[] escrowKeyBytes = serviceConnection.unwrap(decryptedBlob,
+ mInjector.getServiceTimeoutInSeconds());
+ serviceConnection.unbindService();
+
+ return escrowKeyBytes;
+ }
+
+ @Override
+ public RebootEscrowKey getAndClearRebootEscrowKey(SecretKey decryptionKey) {
+ byte[] serverBlob = mStorage.readRebootEscrowServerBlob();
+ // Delete the server blob in storage.
+ mStorage.removeRebootEscrowServerBlob();
+ if (serverBlob == null) {
+ Slog.w(TAG, "Failed to read reboot escrow server blob from storage");
+ return null;
+ }
+
+ try {
+ byte[] escrowKeyBytes = unwrapServerBlob(serverBlob, decryptionKey);
+ if (escrowKeyBytes == null) {
+ Slog.w(TAG, "Decrypted reboot escrow key bytes should not be null");
+ return null;
+ } else if (escrowKeyBytes.length != 32) {
+ Slog.e(TAG, "Decrypted reboot escrow key has incorrect size "
+ + escrowKeyBytes.length);
+ return null;
+ }
+
+ return RebootEscrowKey.fromKeyBytes(escrowKeyBytes);
+ } catch (TimeoutException | RemoteException | IOException e) {
+ Slog.w(TAG, "Failed to decrypt the server blob ", e);
+ return null;
+ }
+ }
+
+ @Override
+ public void clearRebootEscrowKey() {
+ mStorage.removeRebootEscrowServerBlob();
+ }
+
+ private byte[] wrapEscrowKey(byte[] escrowKeyBytes, SecretKey encryptionKey) throws
+ TimeoutException, RemoteException, IOException {
+ ResumeOnRebootServiceConnection serviceConnection = mInjector.getServiceConnection();
+ if (serviceConnection == null) {
+ Slog.w(TAG, "Failed to encrypt the reboot escrow key: resume on reboot server"
+ + " service is unavailable");
+ return null;
+ }
+
+ serviceConnection.bindToService(mInjector.getServiceTimeoutInSeconds());
+ // Ask the server connection service to encrypt the reboot escrow key.
+ byte[] serverEncryptedBlob = serviceConnection.wrapBlob(escrowKeyBytes,
+ mInjector.getServerBlobLifetimeInMillis(), mInjector.getServiceTimeoutInSeconds());
+ serviceConnection.unbindService();
+
+ if (serverEncryptedBlob == null) {
+ Slog.w(TAG, "Server encrypted reboot escrow key cannot be null");
+ return null;
+ }
+
+ // Additionally wrap the server blob with a local key.
+ return AesEncryptionUtil.encrypt(encryptionKey, serverEncryptedBlob);
+ }
+
+ @Override
+ public boolean storeRebootEscrowKey(RebootEscrowKey escrowKey, SecretKey encryptionKey) {
+ mStorage.removeRebootEscrowServerBlob();
+ try {
+ byte[] wrappedBlob = wrapEscrowKey(escrowKey.getKeyBytes(), encryptionKey);
+ if (wrappedBlob == null) {
+ Slog.w(TAG, "Failed to encrypt the reboot escrow key");
+ return false;
+ }
+ mStorage.writeRebootEscrowServerBlob(wrappedBlob);
+
+ Slog.i(TAG, "Reboot escrow key encrypted and stored.");
+ return true;
+ } catch (TimeoutException | RemoteException | IOException e) {
+ Slog.w(TAG, "Failed to encrypt the reboot escrow key ", e);
+ }
+
+ return false;
+ }
+}
diff --git a/services/core/java/com/android/server/locksettings/ResumeOnRebootServiceProvider.java b/services/core/java/com/android/server/locksettings/ResumeOnRebootServiceProvider.java
new file mode 100644
index 000000000000..8399f54764e0
--- /dev/null
+++ b/services/core/java/com/android/server/locksettings/ResumeOnRebootServiceProvider.java
@@ -0,0 +1,249 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server.locksettings;
+
+import android.Manifest;
+import android.annotation.NonNull;
+import android.annotation.Nullable;
+import android.content.ComponentName;
+import android.content.Context;
+import android.content.Intent;
+import android.content.ServiceConnection;
+import android.content.pm.PackageManager;
+import android.content.pm.ResolveInfo;
+import android.content.pm.ServiceInfo;
+import android.os.Bundle;
+import android.os.IBinder;
+import android.os.ParcelableException;
+import android.os.RemoteCallback;
+import android.os.RemoteException;
+import android.os.UserHandle;
+import android.provider.DeviceConfig;
+import android.service.resumeonreboot.IResumeOnRebootService;
+import android.service.resumeonreboot.ResumeOnRebootService;
+import android.util.Slog;
+
+import com.android.internal.annotations.VisibleForTesting;
+import com.android.internal.os.BackgroundThread;
+
+import java.io.IOException;
+import java.util.List;
+import java.util.concurrent.CountDownLatch;
+import java.util.concurrent.TimeUnit;
+import java.util.concurrent.TimeoutException;
+
+/** @hide */
+public class ResumeOnRebootServiceProvider {
+
+ private static final String PROVIDER_PACKAGE = DeviceConfig.getString(
+ DeviceConfig.NAMESPACE_OTA, "resume_on_reboot_service_package", "");
+ private static final String PROVIDER_REQUIRED_PERMISSION =
+ Manifest.permission.BIND_RESUME_ON_REBOOT_SERVICE;
+ private static final String TAG = "ResumeOnRebootServiceProvider";
+
+ private final Context mContext;
+ private final PackageManager mPackageManager;
+
+ public ResumeOnRebootServiceProvider(Context context) {
+ this(context, context.getPackageManager());
+ }
+
+ @VisibleForTesting
+ public ResumeOnRebootServiceProvider(Context context, PackageManager packageManager) {
+ this.mContext = context;
+ this.mPackageManager = packageManager;
+ }
+
+ @Nullable
+ private ServiceInfo resolveService() {
+ Intent intent = new Intent();
+ intent.setAction(ResumeOnRebootService.SERVICE_INTERFACE);
+ if (PROVIDER_PACKAGE != null && !PROVIDER_PACKAGE.equals("")) {
+ intent.setPackage(PROVIDER_PACKAGE);
+ }
+
+ List<ResolveInfo> resolvedIntents =
+ mPackageManager.queryIntentServices(intent, PackageManager.MATCH_SYSTEM_ONLY);
+ for (ResolveInfo resolvedInfo : resolvedIntents) {
+ if (resolvedInfo.serviceInfo != null
+ && PROVIDER_REQUIRED_PERMISSION.equals(resolvedInfo.serviceInfo.permission)) {
+ return resolvedInfo.serviceInfo;
+ }
+ }
+ return null;
+ }
+
+ /** Creates a new {@link ResumeOnRebootServiceConnection} */
+ @Nullable
+ public ResumeOnRebootServiceConnection getServiceConnection() {
+ ServiceInfo serviceInfo = resolveService();
+ if (serviceInfo == null) {
+ return null;
+ }
+ return new ResumeOnRebootServiceConnection(mContext, serviceInfo.getComponentName());
+ }
+
+ /**
+ * Connection class used for contacting the registered {@link IResumeOnRebootService}
+ */
+ public static class ResumeOnRebootServiceConnection {
+
+ private static final String TAG = "ResumeOnRebootServiceConnection";
+ private final Context mContext;
+ private final ComponentName mComponentName;
+ private IResumeOnRebootService mBinder;
+
+ private ResumeOnRebootServiceConnection(Context context,
+ @NonNull ComponentName componentName) {
+ mContext = context;
+ mComponentName = componentName;
+ }
+
+ /** Unbind from the service */
+ public void unbindService() {
+ mContext.unbindService(new ServiceConnection() {
+ @Override
+ public void onServiceConnected(ComponentName name, IBinder service) {
+ }
+
+ @Override
+ public void onServiceDisconnected(ComponentName name) {
+ mBinder = null;
+
+ }
+ });
+ }
+
+ /** Bind to the service */
+ public void bindToService(long timeOut) throws TimeoutException {
+ if (mBinder == null || !mBinder.asBinder().isBinderAlive()) {
+ CountDownLatch connectionLatch = new CountDownLatch(1);
+ Intent intent = new Intent();
+ intent.setComponent(mComponentName);
+ final boolean success = mContext.bindServiceAsUser(intent, new ServiceConnection() {
+ @Override
+ public void onServiceConnected(ComponentName name, IBinder service) {
+ mBinder = IResumeOnRebootService.Stub.asInterface(service);
+ connectionLatch.countDown();
+ }
+
+ @Override
+ public void onServiceDisconnected(ComponentName name) {
+ }
+ },
+ Context.BIND_AUTO_CREATE | Context.BIND_FOREGROUND_SERVICE,
+ BackgroundThread.getHandler(), UserHandle.SYSTEM);
+
+ if (!success) {
+ Slog.e(TAG, "Binding: " + mComponentName + " u" + UserHandle.SYSTEM
+ + " failed.");
+ return;
+ }
+ waitForLatch(connectionLatch, "serviceConnection", timeOut);
+ }
+ }
+
+ /** Wrap opaque blob */
+ public byte[] wrapBlob(byte[] unwrappedBlob, long lifeTimeInMillis,
+ long timeOutInMillis)
+ throws RemoteException, TimeoutException, IOException {
+ if (mBinder == null || !mBinder.asBinder().isBinderAlive()) {
+ throw new RemoteException("Service not bound");
+ }
+ CountDownLatch binderLatch = new CountDownLatch(1);
+ ResumeOnRebootServiceCallback
+ resultCallback =
+ new ResumeOnRebootServiceCallback(
+ binderLatch);
+ mBinder.wrapSecret(unwrappedBlob, lifeTimeInMillis, new RemoteCallback(resultCallback));
+ waitForLatch(binderLatch, "wrapSecret", timeOutInMillis);
+ if (resultCallback.getResult().containsKey(ResumeOnRebootService.EXCEPTION_KEY)) {
+ throwTypedException(resultCallback.getResult().getParcelable(
+ ResumeOnRebootService.EXCEPTION_KEY));
+ }
+ return resultCallback.mResult.getByteArray(ResumeOnRebootService.WRAPPED_BLOB_KEY);
+ }
+
+ /** Unwrap wrapped blob */
+ public byte[] unwrap(byte[] wrappedBlob, long timeOut)
+ throws RemoteException, TimeoutException, IOException {
+ if (mBinder == null || !mBinder.asBinder().isBinderAlive()) {
+ throw new RemoteException("Service not bound");
+ }
+ CountDownLatch binderLatch = new CountDownLatch(1);
+ ResumeOnRebootServiceCallback
+ resultCallback =
+ new ResumeOnRebootServiceCallback(
+ binderLatch);
+ mBinder.unwrap(wrappedBlob, new RemoteCallback(resultCallback));
+ waitForLatch(binderLatch, "unWrapSecret", timeOut);
+ if (resultCallback.getResult().containsKey(ResumeOnRebootService.EXCEPTION_KEY)) {
+ throwTypedException(resultCallback.getResult().getParcelable(
+ ResumeOnRebootService.EXCEPTION_KEY));
+ }
+ return resultCallback.getResult().getByteArray(
+ ResumeOnRebootService.UNWRAPPED_BLOB_KEY);
+ }
+
+ private void throwTypedException(
+ ParcelableException exception)
+ throws IOException {
+ if (exception.getCause() instanceof IOException) {
+ exception.maybeRethrow(IOException.class);
+ } else if (exception.getCause() instanceof IllegalStateException) {
+ exception.maybeRethrow(IllegalStateException.class);
+ } else {
+ // This should not happen. Wrap the cause in IllegalStateException so that it
+ // doesn't disrupt the exception handling
+ throw new IllegalStateException(exception.getCause());
+ }
+ }
+
+ private void waitForLatch(CountDownLatch latch, String reason, long timeOut)
+ throws TimeoutException {
+ try {
+ if (!latch.await(timeOut, TimeUnit.SECONDS)) {
+ throw new TimeoutException("Latch wait for " + reason + " elapsed");
+ }
+ } catch (InterruptedException e) {
+ Thread.currentThread().interrupt();
+ throw new IllegalStateException("Latch wait for " + reason + " interrupted");
+ }
+ }
+ }
+
+ private static class ResumeOnRebootServiceCallback implements
+ RemoteCallback.OnResultListener {
+
+ private final CountDownLatch mResultLatch;
+ private Bundle mResult;
+
+ private ResumeOnRebootServiceCallback(CountDownLatch resultLatch) {
+ this.mResultLatch = resultLatch;
+ }
+
+ @Override
+ public void onResult(@Nullable Bundle result) {
+ this.mResult = result;
+ mResultLatch.countDown();
+ }
+
+ private Bundle getResult() {
+ return mResult;
+ }
+ }
+}
diff --git a/services/core/java/com/android/server/net/NetworkPolicyManagerInternal.java b/services/core/java/com/android/server/net/NetworkPolicyManagerInternal.java
index 141fa6a17873..f92f3dcd77ef 100644
--- a/services/core/java/com/android/server/net/NetworkPolicyManagerInternal.java
+++ b/services/core/java/com/android/server/net/NetworkPolicyManagerInternal.java
@@ -39,11 +39,6 @@ public abstract class NetworkPolicyManagerInternal {
public abstract void resetUserState(int userId);
/**
- * @return true if the given uid is restricted from doing networking on metered networks.
- */
- public abstract boolean isUidRestrictedOnMeteredNetworks(int uid);
-
- /**
* Figure out if networking is blocked for a given set of conditions.
*
* This is used by ConnectivityService via passing stale copies of conditions, so it must not
diff --git a/services/core/java/com/android/server/net/NetworkPolicyManagerService.java b/services/core/java/com/android/server/net/NetworkPolicyManagerService.java
index 1c41dc073ac8..01d4faf5c594 100644
--- a/services/core/java/com/android/server/net/NetworkPolicyManagerService.java
+++ b/services/core/java/com/android/server/net/NetworkPolicyManagerService.java
@@ -5361,7 +5361,7 @@ public class NetworkPolicyManagerService extends INetworkPolicyManager.Stub {
public boolean isUidNetworkingBlocked(int uid, boolean isNetworkMetered) {
final long startTime = mStatLogger.getTime();
- enforceAnyPermissionOf(OBSERVE_NETWORK_POLICY, PERMISSION_MAINLINE_NETWORK_STACK);
+ mContext.enforceCallingOrSelfPermission(OBSERVE_NETWORK_POLICY, TAG);
final int uidRules;
final boolean isBackgroundRestricted;
synchronized (mUidRulesFirstLock) {
@@ -5376,6 +5376,23 @@ public class NetworkPolicyManagerService extends INetworkPolicyManager.Stub {
return ret;
}
+ @Override
+ public boolean isUidRestrictedOnMeteredNetworks(int uid) {
+ mContext.enforceCallingOrSelfPermission(OBSERVE_NETWORK_POLICY, TAG);
+ final int uidRules;
+ final boolean isBackgroundRestricted;
+ synchronized (mUidRulesFirstLock) {
+ uidRules = mUidRules.get(uid, RULE_ALLOW_ALL);
+ isBackgroundRestricted = mRestrictBackground;
+ }
+ //TODO(b/177490332): The logic here might not be correct because it doesn't consider
+ // RULE_REJECT_METERED condition. And it could be replaced by
+ // isUidNetworkingBlockedInternal().
+ return isBackgroundRestricted
+ && !hasRule(uidRules, RULE_ALLOW_METERED)
+ && !hasRule(uidRules, RULE_TEMPORARY_ALLOW_METERED);
+ }
+
private static boolean isSystem(int uid) {
return uid < Process.FIRST_APPLICATION_UID;
}
@@ -5444,22 +5461,6 @@ public class NetworkPolicyManagerService extends INetworkPolicyManager.Stub {
}
}
- /**
- * @return true if the given uid is restricted from doing networking on metered networks.
- */
- @Override
- public boolean isUidRestrictedOnMeteredNetworks(int uid) {
- final int uidRules;
- final boolean isBackgroundRestricted;
- synchronized (mUidRulesFirstLock) {
- uidRules = mUidRules.get(uid, RULE_ALLOW_ALL);
- isBackgroundRestricted = mRestrictBackground;
- }
- return isBackgroundRestricted
- && !hasRule(uidRules, RULE_ALLOW_METERED)
- && !hasRule(uidRules, RULE_TEMPORARY_ALLOW_METERED);
- }
-
@Override
public void onTempPowerSaveWhitelistChange(int appId, boolean added) {
synchronized (mUidRulesFirstLock) {
diff --git a/services/core/java/com/android/server/net/NetworkStatsFactory.java b/services/core/java/com/android/server/net/NetworkStatsFactory.java
index e9868fde3059..4faa7903c630 100644
--- a/services/core/java/com/android/server/net/NetworkStatsFactory.java
+++ b/services/core/java/com/android/server/net/NetworkStatsFactory.java
@@ -27,6 +27,7 @@ import static com.android.server.NetworkManagementSocketTagger.kernelToTag;
import android.annotation.Nullable;
import android.net.INetd;
import android.net.NetworkStats;
+import android.net.VpnInfo;
import android.net.util.NetdService;
import android.os.RemoteException;
import android.os.StrictMode;
@@ -34,7 +35,6 @@ import android.os.SystemClock;
import com.android.internal.annotations.GuardedBy;
import com.android.internal.annotations.VisibleForTesting;
-import com.android.internal.net.VpnInfo;
import com.android.internal.util.ArrayUtils;
import com.android.internal.util.ProcFileReader;
diff --git a/services/core/java/com/android/server/net/NetworkStatsService.java b/services/core/java/com/android/server/net/NetworkStatsService.java
index 81a6641de8a4..4be7b483af16 100644
--- a/services/core/java/com/android/server/net/NetworkStatsService.java
+++ b/services/core/java/com/android/server/net/NetworkStatsService.java
@@ -105,6 +105,7 @@ import android.net.NetworkStatsHistory;
import android.net.NetworkTemplate;
import android.net.TrafficStats;
import android.net.Uri;
+import android.net.VpnInfo;
import android.net.netstats.provider.INetworkStatsProvider;
import android.net.netstats.provider.INetworkStatsProviderCallback;
import android.net.netstats.provider.NetworkStatsProvider;
@@ -143,7 +144,6 @@ import android.util.proto.ProtoOutputStream;
import com.android.internal.annotations.GuardedBy;
import com.android.internal.annotations.VisibleForTesting;
-import com.android.internal.net.VpnInfo;
import com.android.internal.util.ArrayUtils;
import com.android.internal.util.DumpUtils;
import com.android.internal.util.FileRotator;
diff --git a/services/core/java/com/android/server/os/BugreportManagerServiceImpl.java b/services/core/java/com/android/server/os/BugreportManagerServiceImpl.java
index ef0f0eeb56f8..4ff75fa06077 100644
--- a/services/core/java/com/android/server/os/BugreportManagerServiceImpl.java
+++ b/services/core/java/com/android/server/os/BugreportManagerServiceImpl.java
@@ -336,6 +336,13 @@ class BugreportManagerServiceImpl extends IDumpstate.Stub {
@Override
public void binderDied() {
+ try {
+ // Allow a small amount of time for any error or finished callbacks to be made.
+ // This ensures that the listener does not receive an erroneous runtime error
+ // callback.
+ Thread.sleep(1000);
+ } catch (InterruptedException ignored) {
+ }
synchronized (mLock) {
if (!mDone) {
// If we have not gotten a "done" callback this must be a crash.
diff --git a/services/core/java/com/android/server/pm/ModuleInfoProvider.java b/services/core/java/com/android/server/pm/ModuleInfoProvider.java
index 06706cd06e11..0ffc1ed9e90c 100644
--- a/services/core/java/com/android/server/pm/ModuleInfoProvider.java
+++ b/services/core/java/com/android/server/pm/ModuleInfoProvider.java
@@ -184,7 +184,7 @@ public class ModuleInfoProvider {
List<PackageInfo> allPackages;
try {
allPackages = mPackageManager.getInstalledPackages(
- flags | PackageManager.MATCH_APEX, UserHandle.USER_SYSTEM).getList();
+ flags | PackageManager.MATCH_APEX, UserHandle.getCallingUserId()).getList();
} catch (RemoteException e) {
Slog.w(TAG, "Unable to retrieve all package names", e);
return Collections.emptyList();
diff --git a/services/core/java/com/android/server/security/OWNERS b/services/core/java/com/android/server/security/OWNERS
new file mode 100644
index 000000000000..91b240bcb189
--- /dev/null
+++ b/services/core/java/com/android/server/security/OWNERS
@@ -0,0 +1,4 @@
+# Bug component: 36824
+
+per-file FileIntegrityService.java = victorhsieh@google.com
+per-file VerityUtils.java = victorhsieh@google.com
diff --git a/services/core/java/com/android/server/vcn/UnderlyingNetworkTracker.java b/services/core/java/com/android/server/vcn/UnderlyingNetworkTracker.java
index e1feb5aab869..6427ae2dc13c 100644
--- a/services/core/java/com/android/server/vcn/UnderlyingNetworkTracker.java
+++ b/services/core/java/com/android/server/vcn/UnderlyingNetworkTracker.java
@@ -24,6 +24,9 @@ import android.net.NetworkCapabilities;
import android.os.Handler;
import android.os.ParcelUuid;
+import com.android.internal.annotations.VisibleForTesting;
+import com.android.internal.annotations.VisibleForTesting.Visibility;
+
import java.util.Objects;
/**
@@ -72,7 +75,8 @@ public class UnderlyingNetworkTracker extends Handler {
@NonNull public final LinkProperties linkProperties;
public final boolean blocked;
- private UnderlyingNetworkRecord(
+ @VisibleForTesting(visibility = Visibility.PRIVATE)
+ UnderlyingNetworkRecord(
@NonNull Network network,
@NonNull NetworkCapabilities networkCapabilities,
@NonNull LinkProperties linkProperties,
diff --git a/services/core/java/com/android/server/vcn/VcnGatewayConnection.java b/services/core/java/com/android/server/vcn/VcnGatewayConnection.java
index 4e0c0c54923b..8805fa2f4dbb 100644
--- a/services/core/java/com/android/server/vcn/VcnGatewayConnection.java
+++ b/services/core/java/com/android/server/vcn/VcnGatewayConnection.java
@@ -24,7 +24,6 @@ import static com.android.server.VcnManagementService.VDBG;
import android.annotation.NonNull;
import android.annotation.Nullable;
-import android.net.ConnectivityManager;
import android.net.InetAddresses;
import android.net.IpPrefix;
import android.net.IpSecManager;
@@ -36,8 +35,6 @@ import android.net.LinkProperties;
import android.net.Network;
import android.net.NetworkAgent;
import android.net.NetworkCapabilities;
-import android.net.NetworkInfo;
-import android.net.NetworkInfo.DetailedState;
import android.net.RouteInfo;
import android.net.annotations.PolicyDirection;
import android.net.ipsec.ike.ChildSessionCallback;
@@ -54,7 +51,6 @@ import android.os.Handler;
import android.os.HandlerExecutor;
import android.os.Message;
import android.os.ParcelUuid;
-import android.telephony.TelephonyManager;
import android.util.Slog;
import com.android.internal.annotations.VisibleForTesting;
@@ -126,7 +122,9 @@ public class VcnGatewayConnection extends StateMachine {
private static final int TOKEN_ALL = Integer.MIN_VALUE;
private static final int NETWORK_LOSS_DISCONNECT_TIMEOUT_SECONDS = 30;
- private static final int TEARDOWN_TIMEOUT_SECONDS = 5;
+
+ @VisibleForTesting(visibility = Visibility.PRIVATE)
+ static final int TEARDOWN_TIMEOUT_SECONDS = 5;
private interface EventInfo {}
@@ -360,11 +358,25 @@ public class VcnGatewayConnection extends StateMachine {
*/
private static final int EVENT_TEARDOWN_TIMEOUT_EXPIRED = 8;
- @NonNull private final DisconnectedState mDisconnectedState = new DisconnectedState();
- @NonNull private final DisconnectingState mDisconnectingState = new DisconnectingState();
- @NonNull private final ConnectingState mConnectingState = new ConnectingState();
- @NonNull private final ConnectedState mConnectedState = new ConnectedState();
- @NonNull private final RetryTimeoutState mRetryTimeoutState = new RetryTimeoutState();
+ @VisibleForTesting(visibility = Visibility.PRIVATE)
+ @NonNull
+ final DisconnectedState mDisconnectedState = new DisconnectedState();
+
+ @VisibleForTesting(visibility = Visibility.PRIVATE)
+ @NonNull
+ final DisconnectingState mDisconnectingState = new DisconnectingState();
+
+ @VisibleForTesting(visibility = Visibility.PRIVATE)
+ @NonNull
+ final ConnectingState mConnectingState = new ConnectingState();
+
+ @VisibleForTesting(visibility = Visibility.PRIVATE)
+ @NonNull
+ final ConnectedState mConnectedState = new ConnectedState();
+
+ @VisibleForTesting(visibility = Visibility.PRIVATE)
+ @NonNull
+ final RetryTimeoutState mRetryTimeoutState = new RetryTimeoutState();
@NonNull private final VcnContext mVcnContext;
@NonNull private final ParcelUuid mSubscriptionGroup;
@@ -403,13 +415,6 @@ public class VcnGatewayConnection extends StateMachine {
private int mCurrentToken = -1;
/**
- * The next usable token.
- *
- * <p>A new token MUST be used for all new IKE sessions.
- */
- private int mNextToken = 0;
-
- /**
* The number of unsuccessful attempts since the last successful connection.
*
* <p>This number MUST be incremented each time the RetryTimeout state is entered, and cleared
@@ -430,7 +435,7 @@ public class VcnGatewayConnection extends StateMachine {
* <p>Set in Connecting or Migrating States, always @NonNull in Connecting, Connected, and
* Migrating states, null otherwise.
*/
- private IkeSession mIkeSession;
+ private VcnIkeSession mIkeSession;
/**
* The last known child configuration.
@@ -455,7 +460,8 @@ public class VcnGatewayConnection extends StateMachine {
this(vcnContext, subscriptionGroup, connectionConfig, new Dependencies());
}
- private VcnGatewayConnection(
+ @VisibleForTesting(visibility = Visibility.PRIVATE)
+ VcnGatewayConnection(
@NonNull VcnContext vcnContext,
@NonNull ParcelUuid subscriptionGroup,
@NonNull VcnGatewayConnectionConfig connectionConfig,
@@ -508,7 +514,6 @@ public class VcnGatewayConnection extends StateMachine {
EVENT_DISCONNECT_REQUESTED,
TOKEN_ALL,
new EventDisconnectRequestedInfo(DISCONNECT_REASON_TEARDOWN));
- quit();
// TODO: Notify VcnInstance (via callbacks) of permanent teardown of this tunnel, since this
// is also called asynchronously when a NetworkAgent becomes unwanted
@@ -654,7 +659,7 @@ public class VcnGatewayConnection extends StateMachine {
protected void teardownNetwork() {
if (mNetworkAgent != null) {
- mNetworkAgent.sendNetworkInfo(buildNetworkInfo(false /* isConnected */));
+ mNetworkAgent.unregister();
mNetworkAgent = null;
}
}
@@ -667,6 +672,8 @@ public class VcnGatewayConnection extends StateMachine {
protected void handleDisconnectRequested(String msg) {
Slog.v(TAG, "Tearing down. Cause: " + msg);
+ mIsRunning = false;
+
teardownNetwork();
teardownIke();
@@ -697,7 +704,37 @@ public class VcnGatewayConnection extends StateMachine {
*/
private class DisconnectedState extends BaseState {
@Override
- protected void processStateMsg(Message msg) {}
+ protected void enterState() {
+ if (!mIsRunning) {
+ quitNow(); // Ignore all queued events; cleanup is complete.
+ }
+
+ if (mIkeSession != null || mNetworkAgent != null) {
+ Slog.wtf(TAG, "Active IKE Session or NetworkAgent in DisconnectedState");
+ }
+ }
+
+ @Override
+ protected void processStateMsg(Message msg) {
+ switch (msg.what) {
+ case EVENT_UNDERLYING_NETWORK_CHANGED:
+ // First network found; start tunnel
+ mUnderlying = ((EventUnderlyingNetworkChangedInfo) msg.obj).newUnderlying;
+
+ if (mUnderlying != null) {
+ transitionTo(mConnectingState);
+ }
+ break;
+ case EVENT_DISCONNECT_REQUESTED:
+ mIsRunning = false;
+
+ quitNow();
+ break;
+ default:
+ logUnhandledMessage(msg);
+ break;
+ }
+ }
}
private abstract class ActiveBaseState extends BaseState {
@@ -732,7 +769,70 @@ public class VcnGatewayConnection extends StateMachine {
*/
private class DisconnectingState extends ActiveBaseState {
@Override
- protected void processStateMsg(Message msg) {}
+ protected void enterState() throws Exception {
+ if (mIkeSession == null) {
+ Slog.wtf(TAG, "IKE session was already closed when entering Disconnecting state.");
+ sendMessage(EVENT_SESSION_CLOSED, mCurrentToken);
+ return;
+ }
+
+ // If underlying network has already been lost, save some time and just kill the session
+ if (mUnderlying == null) {
+ // Will trigger a EVENT_SESSION_CLOSED as IkeSession shuts down.
+ mIkeSession.kill();
+ return;
+ }
+
+ sendMessageDelayed(
+ EVENT_TEARDOWN_TIMEOUT_EXPIRED,
+ mCurrentToken,
+ TimeUnit.SECONDS.toMillis(TEARDOWN_TIMEOUT_SECONDS));
+ }
+
+ @Override
+ protected void processStateMsg(Message msg) {
+ switch (msg.what) {
+ case EVENT_UNDERLYING_NETWORK_CHANGED: // Fallthrough
+ mUnderlying = ((EventUnderlyingNetworkChangedInfo) msg.obj).newUnderlying;
+
+ // If we received a new underlying network, continue.
+ if (mUnderlying != null) {
+ break;
+ }
+
+ // Fallthrough; no network exists to send IKE close session requests.
+ case EVENT_TEARDOWN_TIMEOUT_EXPIRED:
+ // Grace period ended. Kill session, triggering EVENT_SESSION_CLOSED
+ mIkeSession.kill();
+
+ break;
+ case EVENT_DISCONNECT_REQUESTED:
+ teardownNetwork();
+
+ String reason = ((EventDisconnectRequestedInfo) msg.obj).reason;
+ if (reason.equals(DISCONNECT_REASON_UNDERLYING_NETWORK_LOST)) {
+ // Will trigger EVENT_SESSION_CLOSED immediately.
+ mIkeSession.kill();
+ break;
+ }
+
+ // Otherwise we are already in the process of shutting down.
+ break;
+ case EVENT_SESSION_CLOSED:
+ mIkeSession = null;
+
+ if (mIsRunning && mUnderlying != null) {
+ transitionTo(mRetryTimeoutState);
+ } else {
+ teardownNetwork();
+ transitionTo(mDisconnectedState);
+ }
+ break;
+ default:
+ logUnhandledMessage(msg);
+ break;
+ }
+ }
}
/**
@@ -769,20 +869,6 @@ public class VcnGatewayConnection extends StateMachine {
protected void processStateMsg(Message msg) {}
}
- // TODO: Remove this when migrating to new NetworkAgent API
- private static NetworkInfo buildNetworkInfo(boolean isConnected) {
- NetworkInfo info =
- new NetworkInfo(
- ConnectivityManager.TYPE_MOBILE,
- TelephonyManager.NETWORK_TYPE_UNKNOWN,
- "MOBILE",
- "VCN");
- info.setDetailedState(
- isConnected ? DetailedState.CONNECTED : DetailedState.DISCONNECTED, null, null);
-
- return info;
- }
-
@VisibleForTesting(visibility = Visibility.PRIVATE)
static NetworkCapabilities buildNetworkCapabilities(
@NonNull VcnGatewayConnectionConfig gatewayConnectionConfig) {
@@ -893,7 +979,64 @@ public class VcnGatewayConnection extends StateMachine {
}
}
- /** External dependencies used by VcnGatewayConnection, for injection in tests. */
+ @VisibleForTesting(visibility = Visibility.PRIVATE)
+ UnderlyingNetworkTrackerCallback getUnderlyingNetworkTrackerCallback() {
+ return mUnderlyingNetworkTrackerCallback;
+ }
+
+ @VisibleForTesting(visibility = Visibility.PRIVATE)
+ UnderlyingNetworkRecord getUnderlyingNetwork() {
+ return mUnderlying;
+ }
+
+ @VisibleForTesting(visibility = Visibility.PRIVATE)
+ void setUnderlyingNetwork(@Nullable UnderlyingNetworkRecord record) {
+ mUnderlying = record;
+ }
+
+ @VisibleForTesting(visibility = Visibility.PRIVATE)
+ boolean isRunning() {
+ return mIsRunning;
+ }
+
+ @VisibleForTesting(visibility = Visibility.PRIVATE)
+ void setIsRunning(boolean isRunning) {
+ mIsRunning = isRunning;
+ }
+
+ @VisibleForTesting(visibility = Visibility.PRIVATE)
+ VcnIkeSession getIkeSession() {
+ return mIkeSession;
+ }
+
+ @VisibleForTesting(visibility = Visibility.PRIVATE)
+ void setIkeSession(@Nullable VcnIkeSession session) {
+ mIkeSession = session;
+ }
+
+ private IkeSessionParams buildIkeParams() {
+ // TODO: Implement this with ConnectingState
+ return null;
+ }
+
+ private ChildSessionParams buildChildParams() {
+ // TODO: Implement this with ConnectingState
+ return null;
+ }
+
+ @VisibleForTesting(visibility = Visibility.PRIVATE)
+ VcnIkeSession buildIkeSession() {
+ final int token = ++mCurrentToken;
+
+ return mDeps.newIkeSession(
+ mVcnContext,
+ buildIkeParams(),
+ buildChildParams(),
+ new IkeSessionCallbackImpl(token),
+ new ChildSessionCallbackImpl(token));
+ }
+
+ /** External dependencies used by VcnGatewayConnection, for injection in tests */
@VisibleForTesting(visibility = Visibility.PRIVATE)
public static class Dependencies {
/** Builds a new UnderlyingNetworkTracker. */
@@ -905,19 +1048,67 @@ public class VcnGatewayConnection extends StateMachine {
}
/** Builds a new IkeSession. */
- public IkeSession newIkeSession(
+ public VcnIkeSession newIkeSession(
VcnContext vcnContext,
IkeSessionParams ikeSessionParams,
ChildSessionParams childSessionParams,
IkeSessionCallback ikeSessionCallback,
ChildSessionCallback childSessionCallback) {
- return new IkeSession(
- vcnContext.getContext(),
+ return new VcnIkeSession(
+ vcnContext,
ikeSessionParams,
childSessionParams,
- new HandlerExecutor(new Handler(vcnContext.getLooper())),
ikeSessionCallback,
childSessionCallback);
}
}
+
+ /** Proxy implementation of IKE session, used for testing. */
+ @VisibleForTesting(visibility = Visibility.PRIVATE)
+ public static class VcnIkeSession {
+ private final IkeSession mImpl;
+
+ public VcnIkeSession(
+ VcnContext vcnContext,
+ IkeSessionParams ikeSessionParams,
+ ChildSessionParams childSessionParams,
+ IkeSessionCallback ikeSessionCallback,
+ ChildSessionCallback childSessionCallback) {
+ mImpl =
+ new IkeSession(
+ vcnContext.getContext(),
+ ikeSessionParams,
+ childSessionParams,
+ new HandlerExecutor(new Handler(vcnContext.getLooper())),
+ ikeSessionCallback,
+ childSessionCallback);
+ }
+
+ /** Creates a new IKE Child session. */
+ public void openChildSession(
+ @NonNull ChildSessionParams childSessionParams,
+ @NonNull ChildSessionCallback childSessionCallback) {
+ mImpl.openChildSession(childSessionParams, childSessionCallback);
+ }
+
+ /** Closes an IKE session as identified by the ChildSessionCallback. */
+ public void closeChildSession(@NonNull ChildSessionCallback childSessionCallback) {
+ mImpl.closeChildSession(childSessionCallback);
+ }
+
+ /** Gracefully closes this IKE Session, waiting for remote acknowledgement. */
+ public void close() {
+ mImpl.close();
+ }
+
+ /** Forcibly kills this IKE Session, without waiting for a closure confirmation. */
+ public void kill() {
+ mImpl.kill();
+ }
+
+ /** Sets the underlying network used by the IkeSession. */
+ public void setNetwork(@NonNull Network network) {
+ mImpl.setNetwork(network);
+ }
+ }
}
diff --git a/services/core/xsd/Android.bp b/services/core/xsd/Android.bp
index b7d6424450f3..3690afc1bc41 100644
--- a/services/core/xsd/Android.bp
+++ b/services/core/xsd/Android.bp
@@ -8,11 +8,19 @@ xsd_config {
xsd_config {
name: "platform-compat-config",
- srcs: ["platform-compat-config.xsd"],
- api_dir: "platform-compat-schema",
+ srcs: ["platform-compat/config/platform-compat-config.xsd"],
+ api_dir: "platform-compat/config/schema",
package_name: "com.android.server.compat.config",
}
+xsd_config {
+ name: "platform-compat-overrides",
+ srcs: ["platform-compat/overrides/platform-compat-overrides.xsd"],
+ api_dir: "platform-compat/overrides/schema",
+ package_name: "com.android.server.compat.overrides",
+ gen_writer: true,
+}
+
xsd_config {
name: "display-device-config",
diff --git a/services/core/xsd/platform-compat-schema/OWNERS b/services/core/xsd/platform-compat/OWNERS
index f8c3520e9fa8..f8c3520e9fa8 100644
--- a/services/core/xsd/platform-compat-schema/OWNERS
+++ b/services/core/xsd/platform-compat/OWNERS
diff --git a/services/core/xsd/platform-compat-config.xsd b/services/core/xsd/platform-compat/config/platform-compat-config.xsd
index a62e2c385766..a62e2c385766 100644
--- a/services/core/xsd/platform-compat-config.xsd
+++ b/services/core/xsd/platform-compat/config/platform-compat-config.xsd
diff --git a/services/core/xsd/platform-compat-schema/current.txt b/services/core/xsd/platform-compat/config/schema/current.txt
index fb8bbefd8374..fb8bbefd8374 100644
--- a/services/core/xsd/platform-compat-schema/current.txt
+++ b/services/core/xsd/platform-compat/config/schema/current.txt
diff --git a/services/core/xsd/platform-compat-schema/last_current.txt b/services/core/xsd/platform-compat/config/schema/last_current.txt
index e69de29bb2d1..e69de29bb2d1 100644
--- a/services/core/xsd/platform-compat-schema/last_current.txt
+++ b/services/core/xsd/platform-compat/config/schema/last_current.txt
diff --git a/services/core/xsd/platform-compat-schema/last_removed.txt b/services/core/xsd/platform-compat/config/schema/last_removed.txt
index e69de29bb2d1..e69de29bb2d1 100644
--- a/services/core/xsd/platform-compat-schema/last_removed.txt
+++ b/services/core/xsd/platform-compat/config/schema/last_removed.txt
diff --git a/services/core/xsd/platform-compat-schema/removed.txt b/services/core/xsd/platform-compat/config/schema/removed.txt
index d802177e249b..d802177e249b 100644
--- a/services/core/xsd/platform-compat-schema/removed.txt
+++ b/services/core/xsd/platform-compat/config/schema/removed.txt
diff --git a/services/core/xsd/platform-compat/overrides/platform-compat-overrides.xsd b/services/core/xsd/platform-compat/overrides/platform-compat-overrides.xsd
new file mode 100644
index 000000000000..e27e1b8ca89d
--- /dev/null
+++ b/services/core/xsd/platform-compat/overrides/platform-compat-overrides.xsd
@@ -0,0 +1,55 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!--
+ ~ Copyright (C) 2019 The Android Open Source Project
+ ~
+ ~ Licensed under the Apache License, Version 2.0 (the "License");
+ ~ you may not use this file except in compliance with the License.
+ ~ You may obtain a copy of the License at
+ ~
+ ~ http://www.apache.org/licenses/LICENSE-2.0
+ ~
+ ~ Unless required by applicable law or agreed to in writing, software
+ ~ distributed under the License is distributed on an "AS IS" BASIS,
+ ~ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ ~ See the License for the specific language governing permissions and
+ ~ limitations under the License.
+ -->
+
+<!-- This defines the format of the XML file used to store compat config overrides in
+ ~ /data/misc/appcompat/compat_framework_overrides.xml
+-->
+<xs:schema version="2.0" elementFormDefault="qualified"
+ xmlns:xs="http://www.w3.org/2001/XMLSchema">
+
+
+ <xs:complexType name="override-value">
+ <xs:attribute type="xs:string" name="packageName" use="required" />
+ <xs:attribute type="xs:boolean" name="enabled" use="required" />
+ </xs:complexType>
+
+ <xs:complexType name="change-overrides">
+ <xs:attribute type="xs:long" name="changeId" use="required"/>
+ <xs:element name="validated">
+ <xs:complexType>
+ <xs:sequence>
+ <xs:element name="override-value" type="override-value" maxOccurs="unbounded" minOccurs="0" />
+ </xs:sequence>
+ </xs:complexType>
+ </xs:element>
+ <xs:element name="deferred">
+ <xs:complexType>
+ <xs:sequence>
+ <xs:element name="override-value" type="override-value" maxOccurs="unbounded" minOccurs="0" />
+ </xs:sequence>
+ </xs:complexType>
+ </xs:element>
+ </xs:complexType>
+
+ <xs:element name="overrides">
+ <xs:complexType>
+ <xs:sequence>
+ <xs:element name="change-overrides" type="change-overrides" maxOccurs="unbounded" minOccurs="0" />
+ </xs:sequence>
+ </xs:complexType>
+ </xs:element>
+</xs:schema>
diff --git a/services/core/xsd/platform-compat/overrides/schema/current.txt b/services/core/xsd/platform-compat/overrides/schema/current.txt
new file mode 100644
index 000000000000..08b82072747b
--- /dev/null
+++ b/services/core/xsd/platform-compat/overrides/schema/current.txt
@@ -0,0 +1,51 @@
+// Signature format: 2.0
+package com.android.server.compat.overrides {
+
+ public class ChangeOverrides {
+ ctor public ChangeOverrides();
+ method public long getChangeId();
+ method public com.android.server.compat.overrides.ChangeOverrides.Deferred getDeferred();
+ method public com.android.server.compat.overrides.ChangeOverrides.Validated getValidated();
+ method public void setChangeId(long);
+ method public void setDeferred(com.android.server.compat.overrides.ChangeOverrides.Deferred);
+ method public void setValidated(com.android.server.compat.overrides.ChangeOverrides.Validated);
+ }
+
+ public static class ChangeOverrides.Deferred {
+ ctor public ChangeOverrides.Deferred();
+ method public java.util.List<com.android.server.compat.overrides.OverrideValue> getOverrideValue();
+ }
+
+ public static class ChangeOverrides.Validated {
+ ctor public ChangeOverrides.Validated();
+ method public java.util.List<com.android.server.compat.overrides.OverrideValue> getOverrideValue();
+ }
+
+ public class OverrideValue {
+ ctor public OverrideValue();
+ method public boolean getEnabled();
+ method public String getPackageName();
+ method public void setEnabled(boolean);
+ method public void setPackageName(String);
+ }
+
+ public class Overrides {
+ ctor public Overrides();
+ method public java.util.List<com.android.server.compat.overrides.ChangeOverrides> getChangeOverrides();
+ }
+
+ public class XmlParser {
+ ctor public XmlParser();
+ method public static com.android.server.compat.overrides.Overrides read(java.io.InputStream) throws javax.xml.datatype.DatatypeConfigurationException, java.io.IOException, org.xmlpull.v1.XmlPullParserException;
+ method public static String readText(org.xmlpull.v1.XmlPullParser) throws java.io.IOException, org.xmlpull.v1.XmlPullParserException;
+ method public static void skip(org.xmlpull.v1.XmlPullParser) throws java.io.IOException, org.xmlpull.v1.XmlPullParserException;
+ }
+
+ public class XmlWriter implements java.io.Closeable {
+ ctor public XmlWriter(java.io.PrintWriter);
+ method public void close();
+ method public static void write(com.android.server.compat.overrides.XmlWriter, com.android.server.compat.overrides.Overrides) throws java.io.IOException;
+ }
+
+}
+
diff --git a/services/core/xsd/platform-compat/overrides/schema/last_current.txt b/services/core/xsd/platform-compat/overrides/schema/last_current.txt
new file mode 100644
index 000000000000..e69de29bb2d1
--- /dev/null
+++ b/services/core/xsd/platform-compat/overrides/schema/last_current.txt
diff --git a/services/core/xsd/platform-compat/overrides/schema/last_removed.txt b/services/core/xsd/platform-compat/overrides/schema/last_removed.txt
new file mode 100644
index 000000000000..e69de29bb2d1
--- /dev/null
+++ b/services/core/xsd/platform-compat/overrides/schema/last_removed.txt
diff --git a/services/core/xsd/platform-compat/overrides/schema/removed.txt b/services/core/xsd/platform-compat/overrides/schema/removed.txt
new file mode 100644
index 000000000000..d802177e249b
--- /dev/null
+++ b/services/core/xsd/platform-compat/overrides/schema/removed.txt
@@ -0,0 +1 @@
+// Signature format: 2.0
diff --git a/services/java/com/android/server/SystemServer.java b/services/java/com/android/server/SystemServer.java
index 516c64217177..6089a52ae0bb 100644
--- a/services/java/com/android/server/SystemServer.java
+++ b/services/java/com/android/server/SystemServer.java
@@ -97,6 +97,7 @@ import com.android.internal.util.FrameworkStatsLog;
import com.android.internal.widget.ILockSettings;
import com.android.server.am.ActivityManagerService;
import com.android.server.appbinding.AppBindingService;
+import com.android.server.apphibernation.AppHibernationService;
import com.android.server.attention.AttentionManagerService;
import com.android.server.audio.AudioService;
import com.android.server.biometrics.AuthService;
@@ -220,6 +221,8 @@ public final class SystemServer {
"com.android.server.appwidget.AppWidgetService";
private static final String VOICE_RECOGNITION_MANAGER_SERVICE_CLASS =
"com.android.server.voiceinteraction.VoiceInteractionManagerService";
+ private static final String APP_HIBERNATION_SERVICE_CLASS =
+ "com.android.server.apphibernation.AppHibernationService";
private static final String PRINT_MANAGER_SERVICE_CLASS =
"com.android.server.print.PrintManagerService";
private static final String COMPANION_DEVICE_MANAGER_SERVICE_CLASS =
@@ -457,7 +460,7 @@ public final class SystemServer {
}
try {
- Thread.sleep(checkInterval);
+ Thread.sleep(checkInterval * 1000);
} catch (InterruptedException ex) {
continue;
}
@@ -1863,6 +1866,12 @@ public final class SystemServer {
mSystemServiceManager.startService(VOICE_RECOGNITION_MANAGER_SERVICE_CLASS);
t.traceEnd();
+ if (AppHibernationService.isAppHibernationEnabled()) {
+ t.traceBegin("StartAppHibernationService");
+ mSystemServiceManager.startService(APP_HIBERNATION_SERVICE_CLASS);
+ t.traceEnd();
+ }
+
if (GestureLauncherService.isGestureLauncherEnabled(context.getResources())) {
t.traceBegin("StartGestureLauncher");
mSystemServiceManager.startService(GestureLauncherService.class);
diff --git a/services/tests/servicestests/src/com/android/server/apphibernation/AppHibernationServiceTest.java b/services/tests/servicestests/src/com/android/server/apphibernation/AppHibernationServiceTest.java
new file mode 100644
index 000000000000..d0370b6c25e9
--- /dev/null
+++ b/services/tests/servicestests/src/com/android/server/apphibernation/AppHibernationServiceTest.java
@@ -0,0 +1,168 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server.apphibernation;
+
+import static org.junit.Assert.assertTrue;
+import static org.mockito.AdditionalAnswers.returnsArgAt;
+import static org.mockito.ArgumentMatchers.any;
+import static org.mockito.ArgumentMatchers.anyBoolean;
+import static org.mockito.ArgumentMatchers.anyInt;
+import static org.mockito.ArgumentMatchers.eq;
+import static org.mockito.Mockito.doAnswer;
+import static org.mockito.Mockito.doReturn;
+import static org.mockito.Mockito.verify;
+import static org.mockito.internal.verification.VerificationModeFactory.times;
+
+import android.app.IActivityManager;
+import android.content.BroadcastReceiver;
+import android.content.Context;
+import android.content.Intent;
+import android.content.pm.IPackageManager;
+import android.content.pm.PackageInfo;
+import android.content.pm.ParceledListSlice;
+import android.content.pm.UserInfo;
+import android.net.Uri;
+import android.os.RemoteException;
+import android.os.UserManager;
+
+import androidx.test.filters.SmallTest;
+
+import com.android.server.SystemService;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.mockito.ArgumentCaptor;
+import org.mockito.Captor;
+import org.mockito.Mock;
+import org.mockito.MockitoAnnotations;
+
+import java.util.ArrayList;
+import java.util.List;
+
+/**
+ * Tests for {@link com.android.server.apphibernation.AppHibernationService}
+ */
+@SmallTest
+public final class AppHibernationServiceTest {
+ private static final String PACKAGE_SCHEME = "package";
+ private static final String PACKAGE_NAME_1 = "package1";
+ private static final String PACKAGE_NAME_2 = "package2";
+ private static final int USER_ID_1 = 1;
+ private static final int USER_ID_2 = 2;
+
+ private AppHibernationService mAppHibernationService;
+ private BroadcastReceiver mBroadcastReceiver;
+ @Mock
+ private Context mContext;
+ @Mock
+ private IPackageManager mIPackageManager;
+ @Mock
+ private IActivityManager mIActivityManager;
+ @Mock
+ private UserManager mUserManager;
+ @Captor
+ private ArgumentCaptor<BroadcastReceiver> mReceiverCaptor;
+
+ @Before
+ public void setUp() throws RemoteException {
+ MockitoAnnotations.initMocks(this);
+ doReturn(mContext).when(mContext).createContextAsUser(any(), anyInt());
+
+ mAppHibernationService = new AppHibernationService(mContext, mIPackageManager,
+ mIActivityManager, mUserManager);
+
+ verify(mContext, times(2)).registerReceiver(mReceiverCaptor.capture(), any());
+ mBroadcastReceiver = mReceiverCaptor.getValue();
+
+ List<UserInfo> userList = new ArrayList<>();
+ userList.add(new UserInfo(USER_ID_1, "user 1", 0 /* flags */));
+ doReturn(userList).when(mUserManager).getUsers();
+
+ List<PackageInfo> userPackages = new ArrayList<>();
+ userPackages.add(makePackageInfo(PACKAGE_NAME_1));
+
+ doReturn(new ParceledListSlice<>(userPackages)).when(mIPackageManager)
+ .getInstalledPackages(anyInt(), eq(USER_ID_1));
+
+ doAnswer(returnsArgAt(2)).when(mIActivityManager).handleIncomingUser(anyInt(), anyInt(),
+ anyInt(), anyBoolean(), anyBoolean(), any(), any());
+
+ mAppHibernationService.onBootPhase(SystemService.PHASE_BOOT_COMPLETED);
+ }
+
+ @Test
+ public void testSetHibernating_packageIsHibernating() {
+ // WHEN we hibernate a package for a user
+ mAppHibernationService.setHibernating(PACKAGE_NAME_1, USER_ID_1, true);
+
+ // THEN the package is marked hibernating for the user
+ assertTrue(mAppHibernationService.isHibernating(PACKAGE_NAME_1, USER_ID_1));
+ }
+
+ @Test
+ public void testSetHibernating_newPackageAdded_packageIsHibernating() {
+ // WHEN a new package is added and it is hibernated
+ Intent intent = new Intent(Intent.ACTION_PACKAGE_ADDED,
+ Uri.fromParts(PACKAGE_SCHEME, PACKAGE_NAME_2, null /* fragment */));
+ intent.putExtra(Intent.EXTRA_USER_HANDLE, USER_ID_1);
+ mBroadcastReceiver.onReceive(mContext, intent);
+
+ mAppHibernationService.setHibernating(PACKAGE_NAME_2, USER_ID_1, true);
+
+ // THEN the new package is hibernated
+ assertTrue(mAppHibernationService.isHibernating(PACKAGE_NAME_2, USER_ID_1));
+ }
+
+ @Test
+ public void testSetHibernating_newUserAdded_packageIsHibernating() throws RemoteException {
+ // WHEN a new user is added and a package from the user is hibernated
+ List<PackageInfo> userPackages = new ArrayList<>();
+ userPackages.add(makePackageInfo(PACKAGE_NAME_1));
+ doReturn(new ParceledListSlice<>(userPackages)).when(mIPackageManager)
+ .getInstalledPackages(anyInt(), eq(USER_ID_2));
+ Intent intent = new Intent(Intent.ACTION_USER_ADDED);
+ intent.putExtra(Intent.EXTRA_USER_HANDLE, USER_ID_2);
+ mBroadcastReceiver.onReceive(mContext, intent);
+
+ mAppHibernationService.setHibernating(PACKAGE_NAME_1, USER_ID_2, true);
+
+ // THEN the new user's package is hibernated
+ assertTrue(mAppHibernationService.isHibernating(PACKAGE_NAME_1, USER_ID_2));
+ }
+
+ @Test
+ public void testIsHibernating_packageReplaced_stillReturnsHibernating() {
+ // GIVEN a package is currently hibernated
+ mAppHibernationService.setHibernating(PACKAGE_NAME_1, USER_ID_1, true);
+
+ // WHEN the package is removed but marked as replacing
+ Intent intent = new Intent(Intent.ACTION_PACKAGE_REMOVED,
+ Uri.fromParts(PACKAGE_SCHEME, PACKAGE_NAME_2, null /* fragment */));
+ intent.putExtra(Intent.EXTRA_USER_HANDLE, USER_ID_1);
+ intent.putExtra(Intent.EXTRA_REPLACING, true);
+ mBroadcastReceiver.onReceive(mContext, intent);
+
+ // THEN the package is still hibernating
+ assertTrue(mAppHibernationService.isHibernating(PACKAGE_NAME_1, USER_ID_1));
+ }
+
+ private static PackageInfo makePackageInfo(String packageName) {
+ PackageInfo pkg = new PackageInfo();
+ pkg.packageName = packageName;
+ return pkg;
+ }
+}
diff --git a/services/tests/servicestests/src/com/android/server/compat/CompatConfigTest.java b/services/tests/servicestests/src/com/android/server/compat/CompatConfigTest.java
index ac8dc341999a..a53ff9bc7fdc 100644
--- a/services/tests/servicestests/src/com/android/server/compat/CompatConfigTest.java
+++ b/services/tests/servicestests/src/com/android/server/compat/CompatConfigTest.java
@@ -44,6 +44,8 @@ import java.io.File;
import java.io.FileOutputStream;
import java.io.IOException;
import java.io.OutputStream;
+import java.nio.file.Files;
+import java.nio.file.Paths;
import java.util.UUID;
@RunWith(AndroidJUnit4.class)
@@ -69,6 +71,10 @@ public class CompatConfigTest {
os.close();
}
+ private String readFile(File file) throws IOException {
+ return new String(Files.readAllBytes(Paths.get(file.toURI())));
+ }
+
@Before
public void setUp() throws Exception {
MockitoAnnotations.initMocks(this);
@@ -499,4 +505,86 @@ public class CompatConfigTest {
assertThat(compatConfig.isChangeEnabled(1236L,
ApplicationInfoBuilder.create().withTargetSdk(1).build())).isTrue();
}
+
+ @Test
+ public void testSaveOverrides() throws Exception {
+ File overridesFile = new File(createTempDir(), "overrides.xml");
+ CompatConfig compatConfig = CompatConfigBuilder.create(mBuildClassifier, mContext)
+ .addDisabledChangeWithId(1L)
+ .addEnableSinceSdkChangeWithId(2, 2L)
+ .build();
+ compatConfig.forceNonDebuggableFinalForTest(true);
+ compatConfig.initOverrides(overridesFile);
+ when(mPackageManager.getApplicationInfo(eq("foo.bar"), anyInt()))
+ .thenReturn(ApplicationInfoBuilder.create()
+ .withPackageName("foo.bar")
+ .debuggable()
+ .build());
+ when(mPackageManager.getApplicationInfo(eq("bar.baz"), anyInt()))
+ .thenThrow(new NameNotFoundException());
+
+ compatConfig.addOverride(1L, "foo.bar", true);
+ compatConfig.addOverride(2L, "bar.baz", false);
+
+ assertThat(readFile(overridesFile)).isEqualTo("<?xml version=\"1.0\" encoding=\"utf-8\"?>\n"
+ + "<overrides>\n"
+ + " <change-overrides changeId=\"1\">\n"
+ + " <validated>\n"
+ + " <override-value packageName=\"foo.bar\" enabled=\"true\">\n"
+ + " </override-value>\n"
+ + " </validated>\n"
+ + " <deferred>\n"
+ + " </deferred>\n"
+ + " </change-overrides>\n"
+ + " <change-overrides changeId=\"2\">\n"
+ + " <validated>\n"
+ + " </validated>\n"
+ + " <deferred>\n"
+ + " <override-value packageName=\"bar.baz\" enabled=\"false\">\n"
+ + " </override-value>\n"
+ + " </deferred>\n"
+ + " </change-overrides>\n"
+ + "</overrides>\n");
+ }
+
+ @Test
+ public void testLoadOverrides() throws Exception {
+ File tempDir = createTempDir();
+ File overridesFile = new File(tempDir, "overrides.xml");
+ // Change 1 is enabled for foo.bar (validated)
+ // Change 2 is disabled for bar.baz (deferred)
+ String xmlData = "<?xml version=\"1.0\" encoding=\"utf-8\"?>"
+ + "<overrides>"
+ + "<change-overrides changeId=\"1\">"
+ + "<deferred/>"
+ + "<validated>"
+ + "<override-value packageName=\"foo.bar\" enabled=\"true\"/>"
+ + "</validated>"
+ + "</change-overrides>"
+ + "<change-overrides changeId=\"2\">"
+ + "<deferred>"
+ + "<override-value packageName=\"bar.baz\" enabled=\"false\"/>"
+ + "</deferred>"
+ + "<validated/>"
+ + "</change-overrides>"
+ + "</overrides>";
+ writeToFile(tempDir, "overrides.xml", xmlData);
+ CompatConfig compatConfig = CompatConfigBuilder.create(mBuildClassifier, mContext)
+ .addDisabledChangeWithId(1L)
+ .addEnableSinceSdkChangeWithId(2, 2L)
+ .build();
+ compatConfig.forceNonDebuggableFinalForTest(true);
+ compatConfig.initOverrides(overridesFile);
+ ApplicationInfo applicationInfo = ApplicationInfoBuilder.create()
+ .withPackageName("foo.bar")
+ .debuggable()
+ .build();
+ when(mPackageManager.getApplicationInfo(eq("foo.bar"), anyInt()))
+ .thenReturn(applicationInfo);
+ when(mPackageManager.getApplicationInfo(eq("bar.baz"), anyInt()))
+ .thenThrow(new NameNotFoundException());
+
+ assertThat(compatConfig.isChangeEnabled(1L, applicationInfo)).isTrue();
+ assertThat(compatConfig.willChangeBeEnabled(2L, "bar.baz")).isFalse();
+ }
}
diff --git a/services/tests/servicestests/src/com/android/server/devicepolicy/DevicePolicyManagerTest.java b/services/tests/servicestests/src/com/android/server/devicepolicy/DevicePolicyManagerTest.java
index 6786f6014f2d..5d06da78fe80 100644
--- a/services/tests/servicestests/src/com/android/server/devicepolicy/DevicePolicyManagerTest.java
+++ b/services/tests/servicestests/src/com/android/server/devicepolicy/DevicePolicyManagerTest.java
@@ -30,6 +30,7 @@ import static android.app.admin.DevicePolicyManager.PASSWORD_COMPLEXITY_NONE;
import static android.app.admin.DevicePolicyManager.WIPE_EUICC;
import static android.app.admin.PasswordMetrics.computeForPassword;
import static android.content.pm.ApplicationInfo.PRIVATE_FLAG_DIRECT_BOOT_AWARE;
+import static android.net.InetAddresses.parseNumericAddress;
import static com.android.internal.widget.LockPatternUtils.CREDENTIAL_TYPE_NONE;
import static com.android.internal.widget.LockPatternUtils.EscrowTokenStateChangeCallback;
@@ -65,6 +66,8 @@ import static org.mockito.Mockito.when;
import static org.mockito.hamcrest.MockitoHamcrest.argThat;
import static org.testng.Assert.assertThrows;
+import static java.util.Collections.emptyList;
+
import android.Manifest.permission;
import android.app.Activity;
import android.app.AppOpsManager;
@@ -118,6 +121,8 @@ import org.mockito.internal.util.collections.Sets;
import org.mockito.stubbing.Answer;
import java.io.File;
+import java.net.InetSocketAddress;
+import java.net.Proxy;
import java.util.ArrayList;
import java.util.Arrays;
import java.util.Collections;
@@ -2246,6 +2251,48 @@ public class DevicePolicyManagerTest extends DpmTestBase {
assertThat(actualAccounts).containsExactlyElementsIn(expectedAccounts);
}
+ public void testGetProxyParameters() throws Exception {
+ assertThat(dpm.getProxyParameters(inetAddrProxy("192.0.2.1", 1234), emptyList()))
+ .isEqualTo(new Pair<>("192.0.2.1:1234", ""));
+ assertThat(dpm.getProxyParameters(inetAddrProxy("192.0.2.1", 1234),
+ listOf("one.example.com ", " two.example.com ")))
+ .isEqualTo(new Pair<>("192.0.2.1:1234", "one.example.com,two.example.com"));
+ assertThat(dpm.getProxyParameters(hostnameProxy("proxy.example.com", 1234), emptyList()))
+ .isEqualTo(new Pair<>("proxy.example.com:1234", ""));
+ assertThat(dpm.getProxyParameters(hostnameProxy("proxy.example.com", 1234),
+ listOf("excluded.example.com")))
+ .isEqualTo(new Pair<>("proxy.example.com:1234", "excluded.example.com"));
+
+ assertThrows(IllegalArgumentException.class, () -> dpm.getProxyParameters(
+ inetAddrProxy("192.0.2.1", 0), emptyList()));
+ assertThrows(IllegalArgumentException.class, () -> dpm.getProxyParameters(
+ hostnameProxy("", 1234), emptyList()));
+ assertThrows(IllegalArgumentException.class, () -> dpm.getProxyParameters(
+ hostnameProxy("", 0), emptyList()));
+ assertThrows(IllegalArgumentException.class, () -> dpm.getProxyParameters(
+ hostnameProxy("invalid! hostname", 1234), emptyList()));
+ assertThrows(IllegalArgumentException.class, () -> dpm.getProxyParameters(
+ hostnameProxy("proxy.example.com", 1234), listOf("invalid exclusion")));
+ assertThrows(IllegalArgumentException.class, () -> dpm.getProxyParameters(
+ hostnameProxy("proxy.example.com", -1), emptyList()));
+ assertThrows(IllegalArgumentException.class, () -> dpm.getProxyParameters(
+ hostnameProxy("proxy.example.com", 0xFFFF + 1), emptyList()));
+ }
+
+ private static Proxy inetAddrProxy(String inetAddr, int port) {
+ return new Proxy(
+ Proxy.Type.HTTP, new InetSocketAddress(parseNumericAddress(inetAddr), port));
+ }
+
+ private static Proxy hostnameProxy(String hostname, int port) {
+ return new Proxy(
+ Proxy.Type.HTTP, InetSocketAddress.createUnresolved(hostname, port));
+ }
+
+ private static List<String> listOf(String... args) {
+ return Arrays.asList(args);
+ }
+
public void testSetKeyguardDisabledFeaturesWithDO() throws Exception {
mContext.binder.callingUid = DpmMockContext.CALLER_SYSTEM_USER_UID;
setupDeviceOwner();
@@ -5156,7 +5203,7 @@ public class DevicePolicyManagerTest extends DpmTestBase {
// Attempt to set to empty list (which means no listener is allowlisted)
mContext.binder.callingUid = adminUid;
assertFalse(dpms.setPermittedCrossProfileNotificationListeners(
- admin1, Collections.emptyList()));
+ admin1, emptyList()));
assertNull(dpms.getPermittedCrossProfileNotificationListeners(admin1));
mContext.binder.callingUid = DpmMockContext.SYSTEM_UID;
@@ -5248,7 +5295,7 @@ public class DevicePolicyManagerTest extends DpmTestBase {
// Setting an empty allowlist - only system listeners allowed
mContext.binder.callingUid = MANAGED_PROFILE_ADMIN_UID;
assertTrue(dpms.setPermittedCrossProfileNotificationListeners(
- admin1, Collections.emptyList()));
+ admin1, emptyList()));
assertEquals(0, dpms.getPermittedCrossProfileNotificationListeners(admin1).size());
mContext.binder.callingUid = DpmMockContext.SYSTEM_UID;
@@ -5312,7 +5359,7 @@ public class DevicePolicyManagerTest extends DpmTestBase {
// all allowed in primary profile
mContext.binder.callingUid = MANAGED_PROFILE_ADMIN_UID;
assertTrue(dpms.setPermittedCrossProfileNotificationListeners(
- admin1, Collections.emptyList()));
+ admin1, emptyList()));
assertEquals(0, dpms.getPermittedCrossProfileNotificationListeners(admin1).size());
mContext.binder.callingUid = DpmMockContext.SYSTEM_UID;
diff --git a/services/tests/servicestests/src/com/android/server/hdmi/HdmiCecLocalDeviceAudioSystemTest.java b/services/tests/servicestests/src/com/android/server/hdmi/HdmiCecLocalDeviceAudioSystemTest.java
index dd98c4b09b78..09dd3e3e50db 100644
--- a/services/tests/servicestests/src/com/android/server/hdmi/HdmiCecLocalDeviceAudioSystemTest.java
+++ b/services/tests/servicestests/src/com/android/server/hdmi/HdmiCecLocalDeviceAudioSystemTest.java
@@ -538,6 +538,15 @@ public class HdmiCecLocalDeviceAudioSystemTest {
}
@Test
+ public void setArcStatus() {
+ mHdmiCecLocalDeviceAudioSystem.setArcStatus(true);
+ assertThat(mHdmiCecLocalDeviceAudioSystem.isArcEnabled()).isTrue();
+
+ mHdmiCecLocalDeviceAudioSystem.setArcStatus(false);
+ assertThat(mHdmiCecLocalDeviceAudioSystem.isArcEnabled()).isFalse();
+ }
+
+ @Test
@Ignore("b/151150320")
public void handleSystemAudioModeRequest_fromNonTV_tVNotSupport() {
HdmiCecMessage message =
diff --git a/services/tests/servicestests/src/com/android/server/locksettings/LockSettingsStorageTestable.java b/services/tests/servicestests/src/com/android/server/locksettings/LockSettingsStorageTestable.java
index 1581d9ac1811..691d174f55f8 100644
--- a/services/tests/servicestests/src/com/android/server/locksettings/LockSettingsStorageTestable.java
+++ b/services/tests/servicestests/src/com/android/server/locksettings/LockSettingsStorageTestable.java
@@ -82,6 +82,11 @@ public class LockSettingsStorageTestable extends LockSettingsStorage {
}
@Override
+ String getRebootEscrowServerBlob() {
+ return makeDirs(mStorageDir, super.getRebootEscrowServerBlob()).getAbsolutePath();
+ }
+
+ @Override
protected File getSyntheticPasswordDirectoryForUser(int userId) {
return makeDirs(mStorageDir, super.getSyntheticPasswordDirectoryForUser(
userId).getAbsolutePath());
diff --git a/services/tests/servicestests/src/com/android/server/locksettings/RebootEscrowManagerTests.java b/services/tests/servicestests/src/com/android/server/locksettings/RebootEscrowManagerTests.java
index f74e45b6e59b..a4ba4c86a8fd 100644
--- a/services/tests/servicestests/src/com/android/server/locksettings/RebootEscrowManagerTests.java
+++ b/services/tests/servicestests/src/com/android/server/locksettings/RebootEscrowManagerTests.java
@@ -26,6 +26,7 @@ import static org.junit.Assert.assertNotNull;
import static org.junit.Assert.assertTrue;
import static org.mockito.ArgumentMatchers.any;
import static org.mockito.ArgumentMatchers.anyBoolean;
+import static org.mockito.ArgumentMatchers.anyLong;
import static org.mockito.ArgumentMatchers.eq;
import static org.mockito.Mockito.clearInvocations;
import static org.mockito.Mockito.doNothing;
@@ -52,6 +53,7 @@ import androidx.test.filters.SmallTest;
import androidx.test.runner.AndroidJUnit4;
import com.android.internal.widget.RebootEscrowListener;
+import com.android.server.locksettings.ResumeOnRebootServiceProvider.ResumeOnRebootServiceConnection;
import org.junit.Before;
import org.junit.Test;
@@ -92,6 +94,7 @@ public class RebootEscrowManagerTests {
private UserManager mUserManager;
private RebootEscrowManager.Callbacks mCallbacks;
private IRebootEscrow mRebootEscrow;
+ private ResumeOnRebootServiceConnection mServiceConnection;
private RebootEscrowKeyStoreManager mKeyStoreManager;
LockSettingsStorageTestable mStorage;
@@ -108,6 +111,7 @@ public class RebootEscrowManagerTests {
static class MockInjector extends RebootEscrowManager.Injector {
private final IRebootEscrow mRebootEscrow;
+ private final ResumeOnRebootServiceConnection mServiceConnection;
private final RebootEscrowProviderInterface mRebootEscrowProvider;
private final UserManager mUserManager;
private final MockableRebootEscrowInjected mInjected;
@@ -116,10 +120,11 @@ public class RebootEscrowManagerTests {
MockInjector(Context context, UserManager userManager,
IRebootEscrow rebootEscrow,
RebootEscrowKeyStoreManager keyStoreManager,
+ LockSettingsStorageTestable storage,
MockableRebootEscrowInjected injected) {
- super(context);
+ super(context, storage);
mRebootEscrow = rebootEscrow;
-
+ mServiceConnection = null;
RebootEscrowProviderHalImpl.Injector halInjector =
new RebootEscrowProviderHalImpl.Injector() {
@Override
@@ -133,6 +138,22 @@ public class RebootEscrowManagerTests {
mInjected = injected;
}
+ MockInjector(Context context, UserManager userManager,
+ ResumeOnRebootServiceConnection serviceConnection,
+ RebootEscrowKeyStoreManager keyStoreManager,
+ LockSettingsStorageTestable storage,
+ MockableRebootEscrowInjected injected) {
+ super(context, storage);
+ mServiceConnection = serviceConnection;
+ mRebootEscrow = null;
+ RebootEscrowProviderServerBasedImpl.Injector injector =
+ new RebootEscrowProviderServerBasedImpl.Injector(serviceConnection);
+ mRebootEscrowProvider = new RebootEscrowProviderServerBasedImpl(storage, injector);
+ mUserManager = userManager;
+ mKeyStoreManager = keyStoreManager;
+ mInjected = injected;
+ }
+
@Override
public UserManager getUserManager() {
return mUserManager;
@@ -165,6 +186,7 @@ public class RebootEscrowManagerTests {
mUserManager = mock(UserManager.class);
mCallbacks = mock(RebootEscrowManager.Callbacks.class);
mRebootEscrow = mock(IRebootEscrow.class);
+ mServiceConnection = mock(ResumeOnRebootServiceConnection.class);
mKeyStoreManager = mock(RebootEscrowKeyStoreManager.class);
mAesKey = new SecretKeySpec(TEST_AES_KEY, "AES");
@@ -186,7 +208,12 @@ public class RebootEscrowManagerTests {
when(mCallbacks.isUserSecure(SECURE_SECONDARY_USER_ID)).thenReturn(true);
mInjected = mock(MockableRebootEscrowInjected.class);
mService = new RebootEscrowManager(new MockInjector(mContext, mUserManager, mRebootEscrow,
- mKeyStoreManager, mInjected), mCallbacks, mStorage);
+ mKeyStoreManager, mStorage, mInjected), mCallbacks, mStorage);
+ }
+
+ private void setServerBasedRebootEscrowProvider() throws Exception {
+ mService = new RebootEscrowManager(new MockInjector(mContext, mUserManager,
+ mServiceConnection, mKeyStoreManager, mStorage, mInjected), mCallbacks, mStorage);
}
@Test
@@ -202,6 +229,19 @@ public class RebootEscrowManagerTests {
}
@Test
+ public void prepareRebootEscrowServerBased_Success() throws Exception {
+ setServerBasedRebootEscrowProvider();
+ RebootEscrowListener mockListener = mock(RebootEscrowListener.class);
+ mService.setRebootEscrowListener(mockListener);
+ mService.prepareRebootEscrow();
+
+ mService.callToRebootEscrowIfNeeded(PRIMARY_USER_ID, FAKE_SP_VERSION, FAKE_AUTH_TOKEN);
+ verify(mockListener).onPreparedForReboot(eq(true));
+ verify(mServiceConnection, never()).wrapBlob(any(), anyLong(), anyLong());
+ assertFalse(mStorage.hasRebootEscrowServerBlob());
+ }
+
+ @Test
public void prepareRebootEscrow_ClearCredentials_Success() throws Exception {
RebootEscrowListener mockListener = mock(RebootEscrowListener.class);
mService.setRebootEscrowListener(mockListener);
@@ -246,6 +286,28 @@ public class RebootEscrowManagerTests {
}
@Test
+ public void armServiceServerBased_Success() throws Exception {
+ setServerBasedRebootEscrowProvider();
+ RebootEscrowListener mockListener = mock(RebootEscrowListener.class);
+ mService.setRebootEscrowListener(mockListener);
+ mService.prepareRebootEscrow();
+
+ clearInvocations(mServiceConnection);
+ mService.callToRebootEscrowIfNeeded(PRIMARY_USER_ID, FAKE_SP_VERSION, FAKE_AUTH_TOKEN);
+ verify(mockListener).onPreparedForReboot(eq(true));
+ verify(mServiceConnection, never()).wrapBlob(any(), anyLong(), anyLong());
+
+ when(mServiceConnection.wrapBlob(any(), anyLong(), anyLong()))
+ .thenAnswer(invocation -> invocation.getArgument(0));
+ assertTrue(mService.armRebootEscrowIfNeeded());
+ verify(mServiceConnection).wrapBlob(any(), anyLong(), anyLong());
+
+ assertTrue(mStorage.hasRebootEscrow(PRIMARY_USER_ID));
+ assertFalse(mStorage.hasRebootEscrow(NONSECURE_SECONDARY_USER_ID));
+ assertTrue(mStorage.hasRebootEscrowServerBlob());
+ }
+
+ @Test
public void armService_HalFailure_NonFatal() throws Exception {
RebootEscrowListener mockListener = mock(RebootEscrowListener.class);
mService.setRebootEscrowListener(mockListener);
@@ -346,6 +408,40 @@ public class RebootEscrowManagerTests {
}
@Test
+ public void loadRebootEscrowDataIfAvailable_ServerBased_Success() throws Exception {
+ setServerBasedRebootEscrowProvider();
+
+ when(mInjected.getBootCount()).thenReturn(0);
+ RebootEscrowListener mockListener = mock(RebootEscrowListener.class);
+ mService.setRebootEscrowListener(mockListener);
+ mService.prepareRebootEscrow();
+
+ clearInvocations(mServiceConnection);
+ mService.callToRebootEscrowIfNeeded(PRIMARY_USER_ID, FAKE_SP_VERSION, FAKE_AUTH_TOKEN);
+ verify(mockListener).onPreparedForReboot(eq(true));
+ verify(mServiceConnection, never()).wrapBlob(any(), anyLong(), anyLong());
+
+ // Use x -> x for both wrap & unwrap functions.
+ when(mServiceConnection.wrapBlob(any(), anyLong(), anyLong()))
+ .thenAnswer(invocation -> invocation.getArgument(0));
+ assertTrue(mService.armRebootEscrowIfNeeded());
+ verify(mServiceConnection).wrapBlob(any(), anyLong(), anyLong());
+ assertTrue(mStorage.hasRebootEscrowServerBlob());
+
+ // pretend reboot happens here
+ when(mInjected.getBootCount()).thenReturn(1);
+ ArgumentCaptor<Boolean> metricsSuccessCaptor = ArgumentCaptor.forClass(Boolean.class);
+ doNothing().when(mInjected).reportMetric(metricsSuccessCaptor.capture());
+
+ when(mServiceConnection.unwrap(any(), anyLong()))
+ .thenAnswer(invocation -> invocation.getArgument(0));
+ mService.loadRebootEscrowDataIfAvailable();
+ verify(mServiceConnection).unwrap(any(), anyLong());
+ assertTrue(metricsSuccessCaptor.getValue());
+ verify(mKeyStoreManager).clearKeyStoreEncryptionKey();
+ }
+
+ @Test
public void loadRebootEscrowDataIfAvailable_TooManyBootsInBetween_NoMetrics() throws Exception {
when(mInjected.getBootCount()).thenReturn(0);
diff --git a/services/tests/servicestests/src/com/android/server/locksettings/RebootEscrowProviderServerBasedImplTests.java b/services/tests/servicestests/src/com/android/server/locksettings/RebootEscrowProviderServerBasedImplTests.java
new file mode 100644
index 000000000000..bc1e025dd99f
--- /dev/null
+++ b/services/tests/servicestests/src/com/android/server/locksettings/RebootEscrowProviderServerBasedImplTests.java
@@ -0,0 +1,145 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server.locksettings;
+
+import static org.hamcrest.CoreMatchers.is;
+import static org.junit.Assert.assertFalse;
+import static org.junit.Assert.assertNotEquals;
+import static org.junit.Assert.assertNull;
+import static org.junit.Assert.assertThat;
+import static org.junit.Assert.assertTrue;
+import static org.mockito.ArgumentMatchers.any;
+import static org.mockito.ArgumentMatchers.anyLong;
+import static org.mockito.Mockito.doThrow;
+import static org.mockito.Mockito.mock;
+import static org.mockito.Mockito.when;
+
+import android.content.Context;
+import android.content.ContextWrapper;
+import android.platform.test.annotations.Presubmit;
+
+import androidx.test.InstrumentationRegistry;
+import androidx.test.filters.SmallTest;
+import androidx.test.runner.AndroidJUnit4;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.junit.runner.RunWith;
+import org.mockito.stubbing.Answer;
+
+import java.io.File;
+import java.io.IOException;
+
+import javax.crypto.SecretKey;
+import javax.crypto.spec.SecretKeySpec;
+
+@SmallTest
+@Presubmit
+@RunWith(AndroidJUnit4.class)
+public class RebootEscrowProviderServerBasedImplTests {
+ private SecretKey mKeyStoreEncryptionKey;
+ private RebootEscrowKey mRebootEscrowKey;
+ private ResumeOnRebootServiceProvider.ResumeOnRebootServiceConnection mServiceConnection;
+ private LockSettingsStorageTestable mStorage;
+ private RebootEscrowProviderServerBasedImpl mRebootEscrowProvider;
+ private Answer<byte[]> mFakeEncryption;
+
+ private static final byte[] TEST_AES_KEY = new byte[] {
+ 0x48, 0x19, 0x12, 0x54, 0x13, 0x13, 0x52, 0x31,
+ 0x44, 0x74, 0x61, 0x54, 0x29, 0x74, 0x37, 0x61,
+ 0x70, 0x70, 0x75, 0x25, 0x27, 0x31, 0x49, 0x09,
+ 0x26, 0x52, 0x72, 0x63, 0x63, 0x61, 0x78, 0x23,
+ };
+
+ @Before
+ public void setUp() throws Exception {
+ mKeyStoreEncryptionKey = new SecretKeySpec(TEST_AES_KEY, "AES");
+ mRebootEscrowKey = RebootEscrowKey.generate();
+ mServiceConnection = mock(
+ ResumeOnRebootServiceProvider.ResumeOnRebootServiceConnection.class);
+
+ Context context = new ContextWrapper(InstrumentationRegistry.getContext());
+ mStorage = new LockSettingsStorageTestable(context,
+ new File(InstrumentationRegistry.getContext().getFilesDir(), "locksettings"));
+ mRebootEscrowProvider = new RebootEscrowProviderServerBasedImpl(mStorage,
+ new RebootEscrowProviderServerBasedImpl.Injector(mServiceConnection));
+
+ mFakeEncryption = invocation -> {
+ byte[] secret = invocation.getArgument(0);
+ for (int i = 0; i < secret.length; i++) {
+ secret[i] = (byte) (secret[i] ^ 0xf);
+ }
+ return secret;
+ };
+ }
+
+ @Test
+ public void getAndClearRebootEscrowKey_loopback_success() throws Exception {
+ when(mServiceConnection.wrapBlob(any(), anyLong(), anyLong())).thenAnswer(mFakeEncryption);
+ when(mServiceConnection.unwrap(any(), anyLong())).thenAnswer(mFakeEncryption);
+
+ assertTrue(mRebootEscrowProvider.hasRebootEscrowSupport());
+ mRebootEscrowProvider.storeRebootEscrowKey(mRebootEscrowKey, mKeyStoreEncryptionKey);
+ assertTrue(mStorage.hasRebootEscrowServerBlob());
+
+
+ RebootEscrowKey ks = mRebootEscrowProvider.getAndClearRebootEscrowKey(
+ mKeyStoreEncryptionKey);
+ assertThat(ks.getKeyBytes(), is(mRebootEscrowKey.getKeyBytes()));
+ assertFalse(mStorage.hasRebootEscrowServerBlob());
+ }
+
+ @Test
+ public void getAndClearRebootEscrowKey_WrongDecryptionMethod_failure() throws Exception {
+ when(mServiceConnection.wrapBlob(any(), anyLong(), anyLong())).thenAnswer(mFakeEncryption);
+ when(mServiceConnection.unwrap(any(), anyLong())).thenAnswer(
+ invocation -> {
+ byte[] secret = invocation.getArgument(0);
+ for (int i = 0; i < secret.length; i++) {
+ secret[i] = (byte) (secret[i] ^ 0xe);
+ }
+ return secret;
+ }
+ );
+
+ assertTrue(mRebootEscrowProvider.hasRebootEscrowSupport());
+ mRebootEscrowProvider.storeRebootEscrowKey(mRebootEscrowKey, mKeyStoreEncryptionKey);
+ assertTrue(mStorage.hasRebootEscrowServerBlob());
+
+ // Expect to get wrong key bytes
+ RebootEscrowKey ks = mRebootEscrowProvider.getAndClearRebootEscrowKey(
+ mKeyStoreEncryptionKey);
+ assertNotEquals(ks.getKeyBytes(), mRebootEscrowKey.getKeyBytes());
+ assertFalse(mStorage.hasRebootEscrowServerBlob());
+ }
+
+ @Test
+ public void getAndClearRebootEscrowKey_ServiceConnectionException_failure() throws Exception {
+ when(mServiceConnection.wrapBlob(any(), anyLong(), anyLong())).thenAnswer(mFakeEncryption);
+ doThrow(IOException.class).when(mServiceConnection).unwrap(any(), anyLong());
+
+ assertTrue(mRebootEscrowProvider.hasRebootEscrowSupport());
+ mRebootEscrowProvider.storeRebootEscrowKey(mRebootEscrowKey, mKeyStoreEncryptionKey);
+ assertTrue(mStorage.hasRebootEscrowServerBlob());
+
+ // Expect to get null key bytes when the server service fails to unwrap the blob.
+ RebootEscrowKey ks = mRebootEscrowProvider.getAndClearRebootEscrowKey(
+ mKeyStoreEncryptionKey);
+ assertNull(ks);
+ assertFalse(mStorage.hasRebootEscrowServerBlob());
+ }
+}
diff --git a/services/tests/servicestests/src/com/android/server/locksettings/ResumeOnRebootServiceProviderTests.java b/services/tests/servicestests/src/com/android/server/locksettings/ResumeOnRebootServiceProviderTests.java
new file mode 100644
index 000000000000..b9af82b64c02
--- /dev/null
+++ b/services/tests/servicestests/src/com/android/server/locksettings/ResumeOnRebootServiceProviderTests.java
@@ -0,0 +1,111 @@
+/*
+ * Copyright (C) 2021 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server.locksettings;
+
+import static com.google.common.truth.Truth.assertThat;
+
+import static org.mockito.ArgumentMatchers.any;
+import static org.mockito.ArgumentMatchers.eq;
+import static org.mockito.Mockito.verify;
+import static org.mockito.Mockito.when;
+
+import android.Manifest;
+import android.content.ComponentName;
+import android.content.Context;
+import android.content.Intent;
+import android.content.pm.PackageManager;
+import android.content.pm.ResolveInfo;
+import android.content.pm.ServiceInfo;
+import android.service.resumeonreboot.ResumeOnRebootService;
+
+import androidx.test.filters.SmallTest;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.junit.runner.RunWith;
+import org.junit.runners.JUnit4;
+import org.mockito.ArgumentCaptor;
+import org.mockito.Captor;
+import org.mockito.Mock;
+import org.mockito.MockitoAnnotations;
+
+import java.util.ArrayList;
+
+@SmallTest
+@RunWith(JUnit4.class)
+public class ResumeOnRebootServiceProviderTests {
+
+ @Mock
+ Context mMockContext;
+ @Mock
+ PackageManager mMockPackageManager;
+ @Mock
+ ResolveInfo mMockResolvedInfo;
+ @Mock
+ ServiceInfo mMockServiceInfo;
+ @Mock
+ ComponentName mMockComponentName;
+ @Captor
+ ArgumentCaptor<Intent> mIntentArgumentCaptor;
+
+ @Before
+ public void setUp() {
+ MockitoAnnotations.initMocks(this);
+ when(mMockContext.getUserId()).thenReturn(0);
+ when(mMockResolvedInfo.serviceInfo).thenReturn(mMockServiceInfo);
+ when(mMockServiceInfo.getComponentName()).thenReturn(mMockComponentName);
+ }
+
+ @Test
+ public void noServiceFound() throws Exception {
+ when(mMockPackageManager.queryIntentServices(any(),
+ eq(PackageManager.MATCH_SYSTEM_ONLY))).thenReturn(
+ null);
+ assertThat(new ResumeOnRebootServiceProvider(mMockContext,
+ mMockPackageManager).getServiceConnection()).isNull();
+ }
+
+ @Test
+ public void serviceNotGuardedWithPermission() throws Exception {
+ ArrayList<ResolveInfo> resultList = new ArrayList<>();
+ when(mMockServiceInfo.permission).thenReturn("");
+ resultList.add(mMockResolvedInfo);
+ when(mMockPackageManager.queryIntentServices(any(), any())).thenReturn(
+ resultList);
+ assertThat(new ResumeOnRebootServiceProvider(mMockContext,
+ mMockPackageManager).getServiceConnection()).isNull();
+ }
+
+ @Test
+ public void serviceResolved() throws Exception {
+ ArrayList<ResolveInfo> resultList = new ArrayList<>();
+ resultList.add(mMockResolvedInfo);
+ when(mMockServiceInfo.permission).thenReturn(
+ Manifest.permission.BIND_RESUME_ON_REBOOT_SERVICE);
+ when(mMockPackageManager.queryIntentServices(any(),
+ eq(PackageManager.MATCH_SYSTEM_ONLY))).thenReturn(
+ resultList);
+
+ assertThat(new ResumeOnRebootServiceProvider(mMockContext,
+ mMockPackageManager).getServiceConnection()).isNotNull();
+
+ verify(mMockPackageManager).queryIntentServices(mIntentArgumentCaptor.capture(),
+ eq(PackageManager.MATCH_SYSTEM_ONLY));
+ assertThat(mIntentArgumentCaptor.getValue().getAction()).isEqualTo(
+ ResumeOnRebootService.SERVICE_INTERFACE);
+ }
+}
diff --git a/services/tests/servicestests/src/com/android/server/net/NetworkPolicyManagerServiceTest.java b/services/tests/servicestests/src/com/android/server/net/NetworkPolicyManagerServiceTest.java
index 4db7ce2e6ef5..df19aeb13707 100644
--- a/services/tests/servicestests/src/com/android/server/net/NetworkPolicyManagerServiceTest.java
+++ b/services/tests/servicestests/src/com/android/server/net/NetworkPolicyManagerServiceTest.java
@@ -2051,6 +2051,7 @@ public class NetworkPolicyManagerServiceTest {
final LinkProperties prop = new LinkProperties();
prop.setInterfaceName(TEST_IFACE);
final NetworkCapabilities networkCapabilities = new NetworkCapabilities();
+ networkCapabilities.setSSID(TEST_SSID);
return new NetworkState(info, prop, networkCapabilities, null, null, TEST_SSID);
}
diff --git a/services/tests/shortcutmanagerutils/OWNERS b/services/tests/shortcutmanagerutils/OWNERS
new file mode 100644
index 000000000000..d825dfd7cf00
--- /dev/null
+++ b/services/tests/shortcutmanagerutils/OWNERS
@@ -0,0 +1 @@
+include /services/core/java/com/android/server/pm/OWNERS
diff --git a/telephony/java/android/telephony/CarrierConfigManager.java b/telephony/java/android/telephony/CarrierConfigManager.java
index e3eb0b582b1c..3a9896a5a91d 100644
--- a/telephony/java/android/telephony/CarrierConfigManager.java
+++ b/telephony/java/android/telephony/CarrierConfigManager.java
@@ -2774,6 +2774,30 @@ public class CarrierConfigManager {
public static final String IMSI_KEY_DOWNLOAD_URL_STRING = "imsi_key_download_url_string";
/**
+ * String representation of a carrier's public key used for IMSI encryption for ePDG. If this
+ * is provided, the device will use it as a fallback when no key exists on device, but the key
+ * download will still initiate.
+ * Example string:
+ * "-----BEGIN CERTIFICATE-----\nabcde12345abcde12345abcde12345abcde1234
+ * 5abcde12345abcde12345\nabcde12345abcde12345abcde12345abcde12345a\n-----END CERTIFICATE-----"
+ * @hide
+ */
+ public static final String IMSI_CARRIER_PUBLIC_KEY_EPDG_STRING =
+ "imsi_carrier_public_key_epdg_string";
+
+ /**
+ * String representation of a carrier's public key used for IMSI encryption for WLAN. If this
+ * is provided, the device will use it as a fallback when no key exists on device, but the key
+ * download will still initiate.
+ * Example string:
+ * "-----BEGIN CERTIFICATE-----\nabcde12345abcde12345abcde12345abcde1234
+ * 5abcde12345abcde12345\nabcde12345abcde12345abcde12345abcde12345a\n-----END CERTIFICATE-----"
+ * @hide
+ */
+ public static final String IMSI_CARRIER_PUBLIC_KEY_WLAN_STRING =
+ "imsi_carrier_public_key_wlan_string";
+
+ /**
* Identifies if the key is available for WLAN or EPDG or both. The value is a bitmask.
* 0 indicates that neither EPDG or WLAN is enabled.
* 1 indicates that key type TelephonyManager#KEY_TYPE_EPDG is enabled.
@@ -4089,6 +4113,12 @@ public class CarrierConfigManager {
"default_rtt_mode_int";
/**
+ * Indicates whether RTT is supported while roaming.
+ */
+ public static final String KEY_RTT_SUPPORTED_WHILE_ROAMING_BOOL =
+ "rtt_supported_while_roaming_bool";
+
+ /**
* Indicates if auto-configuration server is used for the RCS config
* Reference: GSMA RCC.14
*/
@@ -4445,6 +4475,8 @@ public class CarrierConfigManager {
sDefaults.putBoolean(KEY_DISABLE_VOICE_BARRING_NOTIFICATION_BOOL, false);
sDefaults.putInt(IMSI_KEY_AVAILABILITY_INT, 0);
sDefaults.putString(IMSI_KEY_DOWNLOAD_URL_STRING, null);
+ sDefaults.putString(IMSI_CARRIER_PUBLIC_KEY_EPDG_STRING, null);
+ sDefaults.putString(IMSI_CARRIER_PUBLIC_KEY_WLAN_STRING, null);
sDefaults.putBoolean(KEY_CONVERT_CDMA_CALLER_ID_MMI_CODES_WHILE_ROAMING_ON_3GPP_BOOL,
false);
sDefaults.putStringArray(KEY_NON_ROAMING_OPERATOR_STRING_ARRAY, null);
@@ -4453,6 +4485,7 @@ public class CarrierConfigManager {
sDefaults.putBoolean(KEY_RTT_SUPPORTED_BOOL, false);
sDefaults.putBoolean(KEY_TTY_SUPPORTED_BOOL, true);
sDefaults.putBoolean(KEY_HIDE_TTY_HCO_VCO_WITH_RTT_BOOL, false);
+ sDefaults.putBoolean(KEY_RTT_SUPPORTED_WHILE_ROAMING_BOOL, false);
sDefaults.putBoolean(KEY_DISABLE_CHARGE_INDICATION_BOOL, false);
sDefaults.putBoolean(KEY_SUPPORT_NO_REPLY_TIMER_FOR_CFNRY_BOOL, true);
sDefaults.putStringArray(KEY_FEATURE_ACCESS_CODES_STRING_ARRAY, null);
diff --git a/telephony/java/android/telephony/DataFailCause.java b/telephony/java/android/telephony/DataFailCause.java
index d502da9fb9ec..99a77ae5d133 100644
--- a/telephony/java/android/telephony/DataFailCause.java
+++ b/telephony/java/android/telephony/DataFailCause.java
@@ -915,6 +915,8 @@ public final class DataFailCause {
public static final int IPV6_PREFIX_UNAVAILABLE = 0x8CA;
/** System preference change back to SRAT during handoff */
public static final int HANDOFF_PREFERENCE_CHANGED = 0x8CB;
+ /** Data call fail due to the slice not being allowed for the data call. */
+ public static final int SLICE_REJECTED = 0x8CC;
//IKE error notifications message as specified in 3GPP TS 24.302 (Section 8.1.2.2).
@@ -985,7 +987,7 @@ public final class DataFailCause {
* the authentication failed.
*/
public static final int IWLAN_IKEV2_AUTH_FAILURE = 0x4001;
- /** IKE message timeout, tunnel setup failed due to no response from EPDG */
+ /** IKE message timeout, tunnel setup failed due to no response from EPDG */
public static final int IWLAN_IKEV2_MSG_TIMEOUT = 0x4002;
/** IKE Certification validation failure */
public static final int IWLAN_IKEV2_CERT_INVALID = 0x4003;
@@ -1419,6 +1421,7 @@ public final class DataFailCause {
sFailCauseMap.put(VSNCP_RECONNECT_NOT_ALLOWED, "VSNCP_RECONNECT_NOT_ALLOWED");
sFailCauseMap.put(IPV6_PREFIX_UNAVAILABLE, "IPV6_PREFIX_UNAVAILABLE");
sFailCauseMap.put(HANDOFF_PREFERENCE_CHANGED, "HANDOFF_PREFERENCE_CHANGED");
+ sFailCauseMap.put(SLICE_REJECTED, "SLICE_REJECTED");
sFailCauseMap.put(IWLAN_PDN_CONNECTION_REJECTION, "IWLAN_PDN_CONNECTION_REJECTION");
sFailCauseMap.put(IWLAN_MAX_CONNECTION_REACHED, "IWLAN_MAX_CONNECTION_REACHED");
sFailCauseMap.put(IWLAN_SEMANTIC_ERROR_IN_THE_TFT_OPERATION,
diff --git a/telephony/java/android/telephony/ImsiEncryptionInfo.java b/telephony/java/android/telephony/ImsiEncryptionInfo.java
index 75a79d62d2aa..4978692d3964 100644
--- a/telephony/java/android/telephony/ImsiEncryptionInfo.java
+++ b/telephony/java/android/telephony/ImsiEncryptionInfo.java
@@ -163,8 +163,8 @@ public final class ImsiEncryptionInfo implements Parcelable {
public String toString(){
return "[ImsiEncryptionInfo "
+ "mcc=" + mcc
- + "mnc=" + mnc
- + "publicKey=" + publicKey
+ + " mnc=" + mnc
+ + " publicKey=" + publicKey
+ ", keyIdentifier=" + keyIdentifier
+ ", keyType=" + keyType
+ ", expirationTime=" + expirationTime
diff --git a/telephony/java/android/telephony/PreciseDisconnectCause.java b/telephony/java/android/telephony/PreciseDisconnectCause.java
index 250d9e8b212e..3b4cf75e7919 100644
--- a/telephony/java/android/telephony/PreciseDisconnectCause.java
+++ b/telephony/java/android/telephony/PreciseDisconnectCause.java
@@ -121,7 +121,7 @@ public final class PreciseDisconnectCause {
public static final int BEARER_CAPABILITY_NOT_AUTHORIZED = 57;
/** The requested bearer capability is not available at this time. */
public static final int BEARER_NOT_AVAIL = 58;
- /** The service option is not availble at this time. */
+ /** The service option is not available at this time. */
public static final int SERVICE_OPTION_NOT_AVAILABLE = 63;
/** The equipment sending this cause does not support the bearer capability requested. */
public static final int BEARER_SERVICE_NOT_IMPLEMENTED = 65;
diff --git a/telephony/java/android/telephony/RadioInterfaceCapabilities.java b/telephony/java/android/telephony/RadioInterfaceCapabilities.java
new file mode 100644
index 000000000000..7c7eb9fbbeb2
--- /dev/null
+++ b/telephony/java/android/telephony/RadioInterfaceCapabilities.java
@@ -0,0 +1,53 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.telephony;
+
+import android.util.ArraySet;
+
+/**
+ * Contains the set of supported capabilities that the Radio Interface supports on this device.
+ *
+ * @hide
+ */
+public class RadioInterfaceCapabilities {
+
+ private final ArraySet<String> mSupportedCapabilities;
+
+
+ public RadioInterfaceCapabilities() {
+ mSupportedCapabilities = new ArraySet<>();
+ }
+
+ /**
+ * Marks a capability as supported
+ *
+ * @param capabilityName the name of the capability
+ */
+ public void addSupportedCapability(
+ @TelephonyManager.RadioInterfaceCapability String capabilityName) {
+ mSupportedCapabilities.add(capabilityName);
+ }
+
+ /**
+ * Whether the capability is supported
+ *
+ * @param capabilityName the name of the capability
+ */
+ public boolean isSupported(String capabilityName) {
+ return mSupportedCapabilities.contains(capabilityName);
+ }
+}
diff --git a/telephony/java/android/telephony/TelephonyManager.java b/telephony/java/android/telephony/TelephonyManager.java
index f018f2fffc3a..646744da5336 100644
--- a/telephony/java/android/telephony/TelephonyManager.java
+++ b/telephony/java/android/telephony/TelephonyManager.java
@@ -14344,6 +14344,40 @@ public class TelephonyManager {
return Collections.emptyList();
}
+ /** @hide */
+ @IntDef(prefix = {"RADIO_INTERFACE_CAPABILITY_"},
+ value = {})
+ public @interface RadioInterfaceCapability {}
+
+ /**
+ * Whether the device supports a given capability on the radio interface.
+ *
+ * If the capability is not in the set of radio interface capabilities, false is returned.
+ *
+ * @param capability the name of the capability to check for
+ * @return the availability of the capability
+ *
+ * @hide
+ */
+ public boolean isRadioInterfaceCapabilitySupported(
+ @NonNull @RadioInterfaceCapability String capability) {
+ try {
+ if (capability == null) return false;
+
+ ITelephony telephony = getITelephony();
+ if (telephony != null) {
+ return telephony.isRadioInterfaceCapabilitySupported(capability);
+ } else {
+ throw new IllegalStateException("telephony service is null.");
+ }
+ } catch (RemoteException ex) {
+ if (!isSystemProcess()) {
+ ex.rethrowAsRuntimeException();
+ }
+ }
+ return false;
+ }
+
/**
* Indicates that the thermal mitigation request was completed successfully.
*
diff --git a/telephony/java/android/telephony/data/DataCallResponse.java b/telephony/java/android/telephony/data/DataCallResponse.java
index 8348502586a5..46ec4a39fd21 100644
--- a/telephony/java/android/telephony/data/DataCallResponse.java
+++ b/telephony/java/android/telephony/data/DataCallResponse.java
@@ -136,6 +136,7 @@ public final class DataCallResponse implements Parcelable {
private final int mPduSessionId;
private final Qos mDefaultQos;
private final List<QosSession> mQosSessions;
+ private final SliceInfo mSliceInfo;
/**
* @param cause Data call fail cause. {@link DataFailCause#NONE} indicates no error.
@@ -186,6 +187,7 @@ public final class DataCallResponse implements Parcelable {
mPduSessionId = PDU_SESSION_ID_NOT_SET;
mDefaultQos = null;
mQosSessions = new ArrayList<>();
+ mSliceInfo = null;
}
private DataCallResponse(@DataFailureCause int cause, long suggestedRetryTime, int id,
@@ -194,7 +196,8 @@ public final class DataCallResponse implements Parcelable {
@Nullable List<InetAddress> dnsAddresses, @Nullable List<InetAddress> gatewayAddresses,
@Nullable List<InetAddress> pcscfAddresses, int mtu, int mtuV4, int mtuV6,
@HandoverFailureMode int handoverFailureMode, int pduSessionId,
- @Nullable Qos defaultQos, @Nullable List<QosSession> qosSessions) {
+ @Nullable Qos defaultQos, @Nullable List<QosSession> qosSessions,
+ @Nullable SliceInfo sliceInfo) {
mCause = cause;
mSuggestedRetryTime = suggestedRetryTime;
mId = id;
@@ -216,6 +219,7 @@ public final class DataCallResponse implements Parcelable {
mPduSessionId = pduSessionId;
mDefaultQos = defaultQos;
mQosSessions = qosSessions;
+ mSliceInfo = sliceInfo;
}
/** @hide */
@@ -243,6 +247,7 @@ public final class DataCallResponse implements Parcelable {
mDefaultQos = source.readParcelable(Qos.class.getClassLoader());
mQosSessions = new ArrayList<>();
source.readList(mQosSessions, QosSession.class.getClassLoader());
+ mSliceInfo = source.readParcelable(SliceInfo.class.getClassLoader());
}
/**
@@ -368,7 +373,7 @@ public final class DataCallResponse implements Parcelable {
}
/**
- * @return default QOS of the data call received from the network
+ * @return default QOS of the data connection received from the network
*
* @hide
*/
@@ -379,16 +384,24 @@ public final class DataCallResponse implements Parcelable {
}
/**
- * @return All the dedicated bearer QOS sessions of the data call received from the network
+ * @return All the dedicated bearer QOS sessions of the data connection received from the
+ * network.
*
* @hide
*/
-
@NonNull
public List<QosSession> getQosSessions() {
return mQosSessions;
}
+ /**
+ * @return The slice info related to this data connection.
+ */
+ @Nullable
+ public SliceInfo getSliceInfo() {
+ return mSliceInfo;
+ }
+
@NonNull
@Override
public String toString() {
@@ -411,6 +424,7 @@ public final class DataCallResponse implements Parcelable {
.append(" pduSessionId=").append(getPduSessionId())
.append(" defaultQos=").append(mDefaultQos)
.append(" qosSessions=").append(mQosSessions)
+ .append(" sliceInfo=").append(mSliceInfo)
.append("}");
return sb.toString();
}
@@ -454,7 +468,8 @@ public final class DataCallResponse implements Parcelable {
&& mHandoverFailureMode == other.mHandoverFailureMode
&& mPduSessionId == other.mPduSessionId
&& isQosSame
- && isQosSessionsSame;
+ && isQosSessionsSame
+ && Objects.equals(mSliceInfo, other.mSliceInfo);
}
@Override
@@ -462,7 +477,7 @@ public final class DataCallResponse implements Parcelable {
return Objects.hash(mCause, mSuggestedRetryTime, mId, mLinkStatus, mProtocolType,
mInterfaceName, mAddresses, mDnsAddresses, mGatewayAddresses, mPcscfAddresses,
mMtu, mMtuV4, mMtuV6, mHandoverFailureMode, mPduSessionId, mDefaultQos,
- mQosSessions);
+ mQosSessions, mSliceInfo);
}
@Override
@@ -493,6 +508,7 @@ public final class DataCallResponse implements Parcelable {
dest.writeParcelable((NrQos)mDefaultQos, flags);
}
dest.writeList(mQosSessions);
+ dest.writeParcelable(mSliceInfo, flags);
}
public static final @android.annotation.NonNull Parcelable.Creator<DataCallResponse> CREATOR =
@@ -576,6 +592,8 @@ public final class DataCallResponse implements Parcelable {
private List<QosSession> mQosSessions = new ArrayList<>();
+ private SliceInfo mSliceInfo;
+
/**
* Default constructor for Builder.
*/
@@ -799,6 +817,21 @@ public final class DataCallResponse implements Parcelable {
}
/**
+ * The Slice used for this data connection.
+ * <p/>
+ * If a handover occurs from EPDG to 5G,
+ * this is the {@link SliceInfo} used in {@link DataService#setupDataCall}.
+ *
+ * @param sliceInfo the slice info for the data call
+ *
+ * @return The same instance of the builder.
+ */
+ public @NonNull Builder setSliceInfo(@Nullable SliceInfo sliceInfo) {
+ mSliceInfo = sliceInfo;
+ return this;
+ }
+
+ /**
* Build the DataCallResponse.
*
* @return the DataCallResponse object.
@@ -807,7 +840,7 @@ public final class DataCallResponse implements Parcelable {
return new DataCallResponse(mCause, mSuggestedRetryTime, mId, mLinkStatus,
mProtocolType, mInterfaceName, mAddresses, mDnsAddresses, mGatewayAddresses,
mPcscfAddresses, mMtu, mMtuV4, mMtuV6, mHandoverFailureMode, mPduSessionId,
- mDefaultQos, mQosSessions);
+ mDefaultQos, mQosSessions, mSliceInfo);
}
}
}
diff --git a/telephony/java/android/telephony/data/DataService.java b/telephony/java/android/telephony/data/DataService.java
index 2ec965101930..03c2ef9d9baa 100644
--- a/telephony/java/android/telephony/data/DataService.java
+++ b/telephony/java/android/telephony/data/DataService.java
@@ -194,13 +194,19 @@ public abstract class DataService extends Service {
* The standard range of values are 1-15 while 0 means no pdu session id
* was attached to this call. Reference: 3GPP TS 24.007 section
* 11.2.3.1b.
+ * @param sliceInfo used within the data connection when a handover occurs from EPDG to 5G.
+ * The value is null unless the access network is
+ * {@link android.telephony.AccessNetworkConstants.AccessNetworkType#NGRAN} and a
+ * handover is occurring from EPDG to 5G. If the slice passed is rejected, then
+ * {@link DataCallResponse#getCause()} is
+ * {@link android.telephony.DataFailCause#SLICE_REJECTED}.
* @param callback The result callback for this request.
*/
public void setupDataCall(int accessNetworkType, @NonNull DataProfile dataProfile,
boolean isRoaming, boolean allowRoaming,
@SetupDataReason int reason,
@Nullable LinkProperties linkProperties,
- @IntRange(from = 0, to = 15) int pduSessionId,
+ @IntRange(from = 0, to = 15) int pduSessionId, @Nullable SliceInfo sliceInfo,
@NonNull DataServiceCallback callback) {
/* Call the old version since the new version isn't supported */
setupDataCall(accessNetworkType, dataProfile, isRoaming, allowRoaming, reason,
@@ -392,10 +398,11 @@ public abstract class DataService extends Service {
public final int reason;
public final LinkProperties linkProperties;
public final int pduSessionId;
+ public final SliceInfo sliceInfo;
public final IDataServiceCallback callback;
SetupDataCallRequest(int accessNetworkType, DataProfile dataProfile, boolean isRoaming,
boolean allowRoaming, int reason, LinkProperties linkProperties,
- int pduSessionId, IDataServiceCallback callback) {
+ int pduSessionId, SliceInfo sliceInfo, IDataServiceCallback callback) {
this.accessNetworkType = accessNetworkType;
this.dataProfile = dataProfile;
this.isRoaming = isRoaming;
@@ -403,6 +410,7 @@ public abstract class DataService extends Service {
this.linkProperties = linkProperties;
this.reason = reason;
this.pduSessionId = pduSessionId;
+ this.sliceInfo = sliceInfo;
this.callback = callback;
}
}
@@ -513,6 +521,7 @@ public abstract class DataService extends Service {
setupDataCallRequest.dataProfile, setupDataCallRequest.isRoaming,
setupDataCallRequest.allowRoaming, setupDataCallRequest.reason,
setupDataCallRequest.linkProperties, setupDataCallRequest.pduSessionId,
+ setupDataCallRequest.sliceInfo,
(setupDataCallRequest.callback != null)
? new DataServiceCallback(setupDataCallRequest.callback)
: null);
@@ -676,10 +685,12 @@ public abstract class DataService extends Service {
@Override
public void setupDataCall(int slotIndex, int accessNetworkType, DataProfile dataProfile,
boolean isRoaming, boolean allowRoaming, int reason,
- LinkProperties linkProperties, int pduSessionId, IDataServiceCallback callback) {
+ LinkProperties linkProperties, int pduSessionId, SliceInfo sliceInfo,
+ IDataServiceCallback callback) {
mHandler.obtainMessage(DATA_SERVICE_REQUEST_SETUP_DATA_CALL, slotIndex, 0,
new SetupDataCallRequest(accessNetworkType, dataProfile, isRoaming,
- allowRoaming, reason, linkProperties, pduSessionId, callback))
+ allowRoaming, reason, linkProperties, pduSessionId, sliceInfo,
+ callback))
.sendToTarget();
}
diff --git a/telephony/java/android/telephony/data/EpsBearerQosSessionAttributes.aidl b/telephony/java/android/telephony/data/EpsBearerQosSessionAttributes.aidl
new file mode 100644
index 000000000000..da31f9864cf1
--- /dev/null
+++ b/telephony/java/android/telephony/data/EpsBearerQosSessionAttributes.aidl
@@ -0,0 +1,19 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+ package android.telephony.data;
+
+ parcelable EpsBearerQosSessionAttributes; \ No newline at end of file
diff --git a/telephony/java/android/telephony/data/EpsBearerQosSessionAttributes.java b/telephony/java/android/telephony/data/EpsBearerQosSessionAttributes.java
new file mode 100644
index 000000000000..041edc00c4d2
--- /dev/null
+++ b/telephony/java/android/telephony/data/EpsBearerQosSessionAttributes.java
@@ -0,0 +1,234 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.telephony.data;
+
+import android.annotation.NonNull;
+import android.annotation.SystemApi;
+import android.net.QosSessionAttributes;
+import android.os.Parcel;
+import android.os.Parcelable;
+import android.util.Log;
+
+import java.net.InetAddress;
+import java.net.InetSocketAddress;
+import java.net.UnknownHostException;
+import java.util.ArrayList;
+import java.util.Collections;
+import java.util.List;
+import java.util.Objects;
+
+/**
+ * Provides Qos attributes of an EPS bearer.
+ *
+ * {@hide}
+ */
+@SystemApi
+public final class EpsBearerQosSessionAttributes implements Parcelable, QosSessionAttributes {
+ private static final String TAG = EpsBearerQosSessionAttributes.class.getSimpleName();
+ private final int mQci;
+ private final long mMaxUplinkBitRate;
+ private final long mMaxDownlinkBitRate;
+ private final long mGuaranteedUplinkBitRate;
+ private final long mGuaranteedDownlinkBitRate;
+ @NonNull private final List<InetSocketAddress> mRemoteAddresses;
+
+ /**
+ * Quality of Service Class Identifier (QCI), see 3GPP TS 23.203 and 29.212.
+ * The allowed values are standard values(1-9, 65-68, 69-70, 75, 79-80, 82-85)
+ * defined in the spec and operator specific values in the range 128-254.
+ *
+ * @return the qci of the session
+ */
+ public int getQci() {
+ return mQci;
+ }
+
+ /**
+ * Minimum bit rate in kbps that is guaranteed to be provided by the network on the uplink.
+ *
+ * see 3GPP TS 23.107 section 6.4.3.1
+ *
+ * Note: The Qos Session may be shared with OTHER applications besides yours.
+ *
+ * @return the guaranteed bit rate in kbps
+ */
+ public long getGuaranteedUplinkBitRate() {
+ return mGuaranteedUplinkBitRate;
+ }
+
+ /**
+ * Minimum bit rate in kbps that is guaranteed to be provided by the network on the downlink.
+ *
+ * see 3GPP TS 23.107 section 6.4.3.1
+ *
+ * Note: The Qos Session may be shared with OTHER applications besides yours.
+ *
+ * @return the guaranteed bit rate in kbps
+ */
+ public long getGuaranteedDownlinkBitRate() {
+ return mGuaranteedDownlinkBitRate;
+ }
+
+ /**
+ * The maximum kbps that the network will accept.
+ *
+ * see 3GPP TS 23.107 section 6.4.3.1
+ *
+ * Note: The Qos Session may be shared with OTHER applications besides yours.
+ *
+ * @return the max uplink bit rate in kbps
+ */
+ public long getMaxUplinkBitRate() {
+ return mMaxUplinkBitRate;
+ }
+
+ /**
+ * The maximum kbps that the network can provide.
+ *
+ * see 3GPP TS 23.107 section 6.4.3.1
+ *
+ * Note: The Qos Session may be shared with OTHER applications besides yours.
+ *
+ * @return the max downlink bit rate in kbps
+ */
+ public long getMaxDownlinkBitRate() {
+ return mMaxDownlinkBitRate;
+ }
+
+ /**
+ * List of remote addresses associated with the Qos Session. The given uplink bit rates apply
+ * to this given list of remote addresses.
+ *
+ * Note: In the event that the list is empty, it is assumed that the uplink bit rates apply to
+ * all remote addresses that are not contained in a different set of attributes.
+ *
+ * @return list of remote socket addresses that the attributes apply to
+ */
+ @NonNull
+ public List<InetSocketAddress> getRemoteAddresses() {
+ return mRemoteAddresses;
+ }
+
+ /**
+ * ..ctor for attributes
+ *
+ * @param qci quality class indicator
+ * @param maxDownlinkBitRate the max downlink bit rate in kbps
+ * @param maxUplinkBitRate the max uplink bit rate in kbps
+ * @param guaranteedDownlinkBitRate the guaranteed downlink bit rate in kbps
+ * @param guaranteedUplinkBitRate the guaranteed uplink bit rate in kbps
+ * @param remoteAddresses the remote addresses that the uplink bit rates apply to
+ *
+ * @hide
+ */
+ public EpsBearerQosSessionAttributes(final int qci,
+ final long maxDownlinkBitRate, final long maxUplinkBitRate,
+ final long guaranteedDownlinkBitRate, final long guaranteedUplinkBitRate,
+ @NonNull final List<InetSocketAddress> remoteAddresses) {
+ Objects.requireNonNull(remoteAddresses, "remoteAddress must be non-null");
+ mQci = qci;
+ mMaxDownlinkBitRate = maxDownlinkBitRate;
+ mMaxUplinkBitRate = maxUplinkBitRate;
+ mGuaranteedDownlinkBitRate = guaranteedDownlinkBitRate;
+ mGuaranteedUplinkBitRate = guaranteedUplinkBitRate;
+
+ final List<InetSocketAddress> remoteAddressesTemp = copySocketAddresses(remoteAddresses);
+ mRemoteAddresses = Collections.unmodifiableList(remoteAddressesTemp);
+ }
+
+ private static List<InetSocketAddress> copySocketAddresses(
+ @NonNull final List<InetSocketAddress> remoteAddresses) {
+ final List<InetSocketAddress> remoteAddressesTemp = new ArrayList<>();
+ for (final InetSocketAddress socketAddress : remoteAddresses) {
+ if (socketAddress != null && socketAddress.getAddress() != null) {
+ remoteAddressesTemp.add(socketAddress);
+ }
+ }
+ return remoteAddressesTemp;
+ }
+
+ private EpsBearerQosSessionAttributes(@NonNull final Parcel in) {
+ mQci = in.readInt();
+ mMaxDownlinkBitRate = in.readLong();
+ mMaxUplinkBitRate = in.readLong();
+ mGuaranteedDownlinkBitRate = in.readLong();
+ mGuaranteedUplinkBitRate = in.readLong();
+
+ final int size = in.readInt();
+ final List<InetSocketAddress> remoteAddresses = new ArrayList<>(size);
+ for (int i = 0; i < size; i++) {
+ final byte[] addressBytes = in.createByteArray();
+ final int port = in.readInt();
+ try {
+ remoteAddresses.add(
+ new InetSocketAddress(InetAddress.getByAddress(addressBytes), port));
+ } catch (final UnknownHostException e) {
+ // Impossible case since we filter out null values in the ..ctor
+ Log.e(TAG, "unable to unparcel remote address at index: " + i, e);
+ }
+ }
+ mRemoteAddresses = Collections.unmodifiableList(remoteAddresses);
+ }
+
+ /**
+ * Creates attributes based off of a parcel
+ * @param in the parcel
+ * @return the attributes
+ */
+ @NonNull
+ public static EpsBearerQosSessionAttributes create(@NonNull final Parcel in) {
+ return new EpsBearerQosSessionAttributes(in);
+ }
+
+ @Override
+ public int describeContents() {
+ return 0;
+ }
+
+ @Override
+ public void writeToParcel(@NonNull final Parcel dest, final int flags) {
+ dest.writeInt(mQci);
+ dest.writeLong(mMaxDownlinkBitRate);
+ dest.writeLong(mMaxUplinkBitRate);
+ dest.writeLong(mGuaranteedDownlinkBitRate);
+ dest.writeLong(mGuaranteedUplinkBitRate);
+
+ final int size = mRemoteAddresses.size();
+ dest.writeInt(size);
+ for (int i = 0; i < size; i++) {
+ final InetSocketAddress address = mRemoteAddresses.get(i);
+ dest.writeByteArray(address.getAddress().getAddress());
+ dest.writeInt(address.getPort());
+ }
+ }
+
+ @NonNull
+ public static final Creator<EpsBearerQosSessionAttributes> CREATOR =
+ new Creator<EpsBearerQosSessionAttributes>() {
+ @NonNull
+ @Override
+ public EpsBearerQosSessionAttributes createFromParcel(@NonNull final Parcel in) {
+ return new EpsBearerQosSessionAttributes(in);
+ }
+
+ @NonNull
+ @Override
+ public EpsBearerQosSessionAttributes[] newArray(final int size) {
+ return new EpsBearerQosSessionAttributes[size];
+ }
+ };
+}
diff --git a/telephony/java/android/telephony/data/IDataService.aidl b/telephony/java/android/telephony/data/IDataService.aidl
index 3f1f033d6f11..e0b9a1a9bb5a 100644
--- a/telephony/java/android/telephony/data/IDataService.aidl
+++ b/telephony/java/android/telephony/data/IDataService.aidl
@@ -19,6 +19,7 @@ package android.telephony.data;
import android.net.LinkProperties;
import android.telephony.data.DataProfile;
import android.telephony.data.IDataServiceCallback;
+import android.telephony.data.SliceInfo;
/**
* {@hide}
@@ -29,7 +30,7 @@ oneway interface IDataService
void removeDataServiceProvider(int slotId);
void setupDataCall(int slotId, int accessNetwork, in DataProfile dataProfile, boolean isRoaming,
boolean allowRoaming, int reason, in LinkProperties linkProperties,
- int pduSessionId, IDataServiceCallback callback);
+ int pduSessionId, in SliceInfo sliceInfo, IDataServiceCallback callback);
void deactivateDataCall(int slotId, int cid, int reason, IDataServiceCallback callback);
void setInitialAttachApn(int slotId, in DataProfile dataProfile, boolean isRoaming,
IDataServiceCallback callback);
diff --git a/telephony/java/android/telephony/data/SliceInfo.aidl b/telephony/java/android/telephony/data/SliceInfo.aidl
new file mode 100644
index 000000000000..286ea5e4f8c7
--- /dev/null
+++ b/telephony/java/android/telephony/data/SliceInfo.aidl
@@ -0,0 +1,20 @@
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/** @hide */
+package android.telephony.data;
+
+parcelable SliceInfo;
diff --git a/telephony/java/android/telephony/data/SliceInfo.java b/telephony/java/android/telephony/data/SliceInfo.java
new file mode 100644
index 000000000000..51857a7b4908
--- /dev/null
+++ b/telephony/java/android/telephony/data/SliceInfo.java
@@ -0,0 +1,342 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.telephony.data;
+
+import android.annotation.IntDef;
+import android.annotation.IntRange;
+import android.annotation.NonNull;
+import android.annotation.SuppressLint;
+import android.annotation.SystemApi;
+import android.os.Parcel;
+import android.os.Parcelable;
+
+import java.lang.annotation.Retention;
+import java.lang.annotation.RetentionPolicy;
+import java.util.Objects;
+
+/**
+ * Represents a S-NSSAI as defined in 3GPP TS 24.501.
+ *
+ * @hide
+ */
+@SystemApi
+public final class SliceInfo implements Parcelable {
+ /**
+ * When set on a Slice Differentiator, this value indicates that there is no corresponding
+ * Slice.
+ */
+ public static final int SLICE_DIFFERENTIATOR_NO_SLICE = -1;
+
+ /**
+ * Indicates that the service type is not present.
+ */
+ public static final int SLICE_SERVICE_TYPE_NONE = 0;
+
+ /**
+ * Slice suitable for the handling of 5G enhanced Mobile Broadband.
+ */
+ public static final int SLICE_SERVICE_TYPE_EMBB = 1;
+
+ /**
+ * Slice suitable for the handling of ultra-reliable low latency communications.
+ */
+ public static final int SLICE_SERVICE_TYPE_URLLC = 2;
+
+ /**
+ * Slice suitable for the handling of massive IoT.
+ */
+ public static final int SLICE_SERVICE_TYPE_MIOT = 3;
+
+ /**
+ * The min acceptable value for a Slice Differentiator
+ */
+ @SuppressLint("MinMaxConstant")
+ public static final int MIN_SLICE_DIFFERENTIATOR = -1;
+
+ /**
+ * The max acceptable value for a Slice Differentiator
+ */
+ @SuppressLint("MinMaxConstant")
+ public static final int MAX_SLICE_DIFFERENTIATOR = 0xFFFFFE;
+
+ /** @hide */
+ @IntDef(prefix = { "SLICE_SERVICE_TYPE_" }, value = {
+ SLICE_SERVICE_TYPE_NONE,
+ SLICE_SERVICE_TYPE_EMBB,
+ SLICE_SERVICE_TYPE_URLLC,
+ SLICE_SERVICE_TYPE_MIOT,
+ })
+ @Retention(RetentionPolicy.SOURCE)
+ public @interface SliceServiceType {}
+
+
+ @SliceServiceType
+ private final int mSliceServiceType;
+ @IntRange(from = MIN_SLICE_DIFFERENTIATOR, to = MAX_SLICE_DIFFERENTIATOR)
+ private final int mSliceDifferentiator;
+ @SliceServiceType
+ private final int mMappedHplmnSliceServiceType;
+ @IntRange(from = MIN_SLICE_DIFFERENTIATOR, to = MAX_SLICE_DIFFERENTIATOR)
+ private final int mMappedHplmnSliceDifferentiator;
+
+ private SliceInfo(@SliceServiceType int sliceServiceType,
+ int sliceDifferentiator, int mappedHplmnSliceServiceType,
+ int mappedHplmnSliceDifferentiator) {
+ mSliceServiceType = sliceServiceType;
+ mSliceDifferentiator = sliceDifferentiator;
+ mMappedHplmnSliceDifferentiator = mappedHplmnSliceDifferentiator;
+ mMappedHplmnSliceServiceType = mappedHplmnSliceServiceType;
+ }
+
+ /**
+ * The type of service provided by the slice.
+ * <p/>
+ * see: 3GPP TS 24.501 Section 9.11.2.8.
+ */
+ @SliceServiceType
+ public int getSliceServiceType() {
+ return mSliceServiceType;
+ }
+
+ /**
+ * Identifies the slice from others with the same Slice Service Type.
+ * <p/>
+ * Returns {@link #SLICE_DIFFERENTIATOR_NO_SLICE} if {@link #getSliceServiceType} returns
+ * {@link #SLICE_SERVICE_TYPE_NONE}.
+ * <p/>
+ * see: 3GPP TS 24.501 Section 9.11.2.8.
+ */
+ @IntRange(from = MIN_SLICE_DIFFERENTIATOR, to = MAX_SLICE_DIFFERENTIATOR)
+ public int getSliceDifferentiator() {
+ return mSliceDifferentiator;
+ }
+
+ /**
+ * Corresponds to a Slice Info (S-NSSAI) of the HPLMN.
+ * <p/>
+ * see: 3GPP TS 24.501 Section 9.11.2.8.
+ */
+ @SliceServiceType
+ public int getMappedHplmnSliceServiceType() {
+ return mMappedHplmnSliceServiceType;
+ }
+
+ /**
+ * This Slice Differentiator corresponds to a {@link SliceInfo} (S-NSSAI) of the HPLMN;
+ * {@link #getSliceDifferentiator()} is mapped to this value.
+ * <p/>
+ * Returns {@link #SLICE_DIFFERENTIATOR_NO_SLICE} if either of the following are true:
+ * <ul>
+ * <li>{@link #getSliceDifferentiator()} returns {@link #SLICE_DIFFERENTIATOR_NO_SLICE}</li>
+ * <li>{@link #getMappedHplmnSliceServiceType()} returns {@link #SLICE_SERVICE_TYPE_NONE}</li>
+ * </ul>
+ * <p/>
+ * see: 3GPP TS 24.501 Section 9.11.2.8.
+ */
+ @IntRange(from = MIN_SLICE_DIFFERENTIATOR, to = MAX_SLICE_DIFFERENTIATOR)
+ public int getMappedHplmnSliceDifferentiator() {
+ return mMappedHplmnSliceDifferentiator;
+ }
+
+ private SliceInfo(@NonNull Parcel in) {
+ mSliceServiceType = in.readInt();
+ mSliceDifferentiator = in.readInt();
+ mMappedHplmnSliceServiceType = in.readInt();
+ mMappedHplmnSliceDifferentiator = in.readInt();
+ }
+
+ @Override
+ public int describeContents() {
+ return 0;
+ }
+
+ @Override
+ public void writeToParcel(@NonNull Parcel dest, int flags) {
+ dest.writeInt(mSliceServiceType);
+ dest.writeInt(mSliceDifferentiator);
+ dest.writeInt(mMappedHplmnSliceServiceType);
+ dest.writeInt(mMappedHplmnSliceDifferentiator);
+ }
+
+ public static final @android.annotation.NonNull Parcelable.Creator<SliceInfo> CREATOR =
+ new Parcelable.Creator<SliceInfo>() {
+ @Override
+ @NonNull
+ public SliceInfo createFromParcel(@NonNull Parcel source) {
+ return new SliceInfo(source);
+ }
+
+ @Override
+ @NonNull
+ public SliceInfo[] newArray(int size) {
+ return new SliceInfo[size];
+ }
+ };
+
+ @Override
+ public String toString() {
+ return "SliceInfo{"
+ + "mSliceServiceType=" + sliceServiceTypeToString(mSliceServiceType)
+ + ", mSliceDifferentiator=" + mSliceDifferentiator
+ + ", mMappedHplmnSliceServiceType="
+ + sliceServiceTypeToString(mMappedHplmnSliceServiceType)
+ + ", mMappedHplmnSliceDifferentiator=" + mMappedHplmnSliceDifferentiator
+ + '}';
+ }
+
+ private static String sliceServiceTypeToString(@SliceServiceType int sliceServiceType) {
+ switch(sliceServiceType) {
+ case SLICE_SERVICE_TYPE_NONE:
+ return "NONE";
+ case SLICE_SERVICE_TYPE_EMBB:
+ return "EMBB";
+ case SLICE_SERVICE_TYPE_URLLC:
+ return "URLLC";
+ case SLICE_SERVICE_TYPE_MIOT:
+ return "MIOT";
+ default:
+ return Integer.toString(sliceServiceType);
+ }
+ }
+
+ @Override
+ public boolean equals(Object o) {
+ if (this == o) return true;
+ if (o == null || getClass() != o.getClass()) return false;
+ SliceInfo sliceInfo = (SliceInfo) o;
+ return mSliceServiceType == sliceInfo.mSliceServiceType
+ && mSliceDifferentiator == sliceInfo.mSliceDifferentiator
+ && mMappedHplmnSliceServiceType == sliceInfo.mMappedHplmnSliceServiceType
+ && mMappedHplmnSliceDifferentiator == sliceInfo.mMappedHplmnSliceDifferentiator;
+ }
+
+ @Override
+ public int hashCode() {
+ return Objects.hash(mSliceServiceType, mSliceDifferentiator, mMappedHplmnSliceServiceType,
+ mMappedHplmnSliceDifferentiator);
+ }
+
+ /**
+ * Provides a convenient way to set the fields of a {@link SliceInfo} when creating a
+ * new instance.
+ *
+ * <p>The example below shows how you might create a new {@code SliceInfo}:
+ *
+ * <pre><code>
+ *
+ * SliceInfo response = new SliceInfo.Builder()
+ * .setSliceServiceType(SLICE_SERVICE_TYPE_URLLC)
+ * .build();
+ * </code></pre>
+ */
+ public static final class Builder {
+ @SliceServiceType
+ private int mSliceServiceType = SLICE_SERVICE_TYPE_NONE;
+ @IntRange(from = MIN_SLICE_DIFFERENTIATOR, to = MAX_SLICE_DIFFERENTIATOR)
+ private int mSliceDifferentiator = SLICE_DIFFERENTIATOR_NO_SLICE;
+ @SliceServiceType
+ private int mMappedHplmnSliceServiceType = SLICE_SERVICE_TYPE_NONE;
+ @IntRange(from = MIN_SLICE_DIFFERENTIATOR, to = MAX_SLICE_DIFFERENTIATOR)
+ private int mMappedHplmnSliceDifferentiator = SLICE_DIFFERENTIATOR_NO_SLICE;
+
+ /**
+ * Default constructor for Builder.
+ */
+ public Builder() {
+ }
+
+ /**
+ * Set the Slice Service Type.
+ *
+ * @return The same instance of the builder.
+ */
+ @NonNull
+ public Builder setSliceServiceType(@SliceServiceType int mSliceServiceType) {
+ this.mSliceServiceType = mSliceServiceType;
+ return this;
+ }
+
+ /**
+ * Set the Slice Differentiator.
+ * <p/>
+ * A value of {@link #SLICE_DIFFERENTIATOR_NO_SLICE} indicates that there is no
+ * corresponding Slice.
+ *
+ * @throws IllegalArgumentException if the parameter is not between
+ * {@link #MIN_SLICE_DIFFERENTIATOR} and {@link #MAX_SLICE_DIFFERENTIATOR}.
+ *
+ * @return The same instance of the builder.
+ */
+ @NonNull
+ public Builder setSliceDifferentiator(
+ @IntRange(from = MIN_SLICE_DIFFERENTIATOR, to = MAX_SLICE_DIFFERENTIATOR)
+ int sliceDifferentiator) {
+ if (sliceDifferentiator < MIN_SLICE_DIFFERENTIATOR
+ || sliceDifferentiator > MAX_SLICE_DIFFERENTIATOR) {
+ throw new IllegalArgumentException("The slice diffentiator value is out of range");
+ }
+ this.mSliceDifferentiator = sliceDifferentiator;
+ return this;
+ }
+
+ /**
+ * Set the HPLMN Slice Service Type.
+ *
+ * @return The same instance of the builder.
+ */
+ @NonNull
+ public Builder setMappedHplmnSliceServiceType(
+ @SliceServiceType int mappedHplmnSliceServiceType) {
+ this.mMappedHplmnSliceServiceType = mappedHplmnSliceServiceType;
+ return this;
+ }
+
+ /**
+ * Set the HPLMN Slice Differentiator.
+ * <p/>
+ * A value of {@link #SLICE_DIFFERENTIATOR_NO_SLICE} indicates that there is no
+ * corresponding Slice of the HPLMN.
+ *
+ * @throws IllegalArgumentException if the parameter is not between
+ * {@link #MIN_SLICE_DIFFERENTIATOR} and {@link #MAX_SLICE_DIFFERENTIATOR}.
+ *
+ * @return The same instance of the builder.
+ */
+ @NonNull
+ public Builder setMappedHplmnSliceDifferentiator(
+ @IntRange(from = MIN_SLICE_DIFFERENTIATOR, to = MAX_SLICE_DIFFERENTIATOR)
+ int mappedHplmnSliceDifferentiator) {
+ if (mappedHplmnSliceDifferentiator < MIN_SLICE_DIFFERENTIATOR
+ || mappedHplmnSliceDifferentiator > MAX_SLICE_DIFFERENTIATOR) {
+ throw new IllegalArgumentException("The slice diffentiator value is out of range");
+ }
+ this.mMappedHplmnSliceDifferentiator = mappedHplmnSliceDifferentiator;
+ return this;
+ }
+
+ /**
+ * Build the {@link SliceInfo}.
+ *
+ * @return the {@link SliceInfo} object.
+ */
+ @NonNull
+ public SliceInfo build() {
+ return new SliceInfo(this.mSliceServiceType, this.mSliceDifferentiator,
+ this.mMappedHplmnSliceServiceType, this.mMappedHplmnSliceDifferentiator);
+ }
+ }
+}
diff --git a/telephony/java/android/telephony/ims/SipMessage.java b/telephony/java/android/telephony/ims/SipMessage.java
index 006cca84e44b..9cfa640fce18 100644
--- a/telephony/java/android/telephony/ims/SipMessage.java
+++ b/telephony/java/android/telephony/ims/SipMessage.java
@@ -16,6 +16,8 @@
package android.telephony.ims;
+import static java.nio.charset.StandardCharsets.UTF_8;
+
import android.annotation.NonNull;
import android.annotation.SystemApi;
import android.os.Build;
@@ -39,6 +41,7 @@ import java.util.Objects;
public final class SipMessage implements Parcelable {
// Should not be set to true for production!
private static final boolean IS_DEBUGGING = Build.IS_ENG;
+ private static final String CRLF = "\r\n";
private final String mStartLine;
private final String mHeaderSection;
@@ -165,4 +168,19 @@ public final class SipMessage implements Parcelable {
result = 31 * result + Arrays.hashCode(mContent);
return result;
}
+
+ /**
+ * @return the UTF-8 encoded SIP message.
+ */
+ public @NonNull byte[] getEncodedMessage() {
+ byte[] header = new StringBuilder()
+ .append(mStartLine)
+ .append(mHeaderSection)
+ .append(CRLF)
+ .toString().getBytes(UTF_8);
+ byte[] sipMessage = new byte[header.length + mContent.length];
+ System.arraycopy(header, 0, sipMessage, 0, header.length);
+ System.arraycopy(mContent, 0, sipMessage, header.length, mContent.length);
+ return sipMessage;
+ }
}
diff --git a/telephony/java/com/android/internal/telephony/ITelephony.aidl b/telephony/java/com/android/internal/telephony/ITelephony.aidl
index f5662692d84b..e556664bb323 100644
--- a/telephony/java/com/android/internal/telephony/ITelephony.aidl
+++ b/telephony/java/com/android/internal/telephony/ITelephony.aidl
@@ -2280,6 +2280,14 @@ interface ITelephony {
CarrierBandwidth getCarrierBandwidth(int subId);
/**
+ * Checks whether the device supports the given capability on the radio interface.
+ *
+ * @param capability the name of the capability
+ * @return the availability of the capability
+ */
+ boolean isRadioInterfaceCapabilitySupported(String capability);
+
+ /**
* Thermal mitigation request to control functionalities at modem.
*
* @param subId the id of the subscription
@@ -2359,6 +2367,11 @@ interface ITelephony {
boolean setCarrierSingleRegistrationEnabledOverride(int subId, String enabled);
/**
+ * Sends a device to device message; only for use through shell.
+ */
+ void sendDeviceToDeviceMessage(int message, int value);
+
+ /**
* Gets the config of RCS VoLTE single registration enabled for the carrier/subscription.
*/
boolean getCarrierSingleRegistrationEnabled(int subId);
diff --git a/telephony/java/com/android/internal/telephony/RILConstants.java b/telephony/java/com/android/internal/telephony/RILConstants.java
index 52f263fad695..76243a5799c3 100644
--- a/telephony/java/com/android/internal/telephony/RILConstants.java
+++ b/telephony/java/com/android/internal/telephony/RILConstants.java
@@ -520,6 +520,7 @@ public interface RILConstants {
int RIL_REQUEST_START_HANDOVER = 217;
int RIL_REQUEST_CANCEL_HANDOVER = 218;
int RIL_REQUEST_GET_SYSTEM_SELECTION_CHANNELS = 219;
+ int RIL_REQUEST_GET_HAL_DEVICE_CAPABILITIES = 220;
int RIL_REQUEST_SET_DATA_THROTTLING = 221;
int RIL_REQUEST_SET_ALLOWED_NETWORK_TYPE_BITMAP = 222;
int RIL_REQUEST_GET_ALLOWED_NETWORK_TYPE_BITMAP = 223;
diff --git a/test-mock/api/current.txt b/test-mock/api/current.txt
index 1110790c373f..d1a68d4e9cb2 100644
--- a/test-mock/api/current.txt
+++ b/test-mock/api/current.txt
@@ -117,6 +117,7 @@ package android.test.mock {
method public void sendOrderedBroadcast(android.content.Intent, String, android.content.BroadcastReceiver, android.os.Handler, int, String, android.os.Bundle);
method public void sendOrderedBroadcastAsUser(android.content.Intent, android.os.UserHandle, String, android.content.BroadcastReceiver, android.os.Handler, int, String, android.os.Bundle);
method public void sendStickyBroadcast(android.content.Intent);
+ method public void sendStickyBroadcast(android.content.Intent, android.os.Bundle);
method public void sendStickyBroadcastAsUser(android.content.Intent, android.os.UserHandle);
method public void sendStickyOrderedBroadcast(android.content.Intent, android.content.BroadcastReceiver, android.os.Handler, int, String, android.os.Bundle);
method public void sendStickyOrderedBroadcastAsUser(android.content.Intent, android.os.UserHandle, android.content.BroadcastReceiver, android.os.Handler, int, String, android.os.Bundle);
diff --git a/test-mock/src/android/test/mock/MockContext.java b/test-mock/src/android/test/mock/MockContext.java
index cf3b03cae72e..6046d78240b6 100644
--- a/test-mock/src/android/test/mock/MockContext.java
+++ b/test-mock/src/android/test/mock/MockContext.java
@@ -493,6 +493,11 @@ public class MockContext extends Context {
}
@Override
+ public void sendStickyBroadcast(Intent intent, Bundle options) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
public void sendStickyOrderedBroadcast(Intent intent,
BroadcastReceiver resultReceiver, Handler scheduler, int initialCode, String initialData,
Bundle initialExtras) {
diff --git a/tests/PlatformCompatGating/src/com/android/tests/gating/PlatformCompatCommandNotInstalledTest.kt b/tests/PlatformCompatGating/src/com/android/tests/gating/PlatformCompatCommandNotInstalledTest.kt
index e9227e94da98..eb04f6907748 100644
--- a/tests/PlatformCompatGating/src/com/android/tests/gating/PlatformCompatCommandNotInstalledTest.kt
+++ b/tests/PlatformCompatGating/src/com/android/tests/gating/PlatformCompatCommandNotInstalledTest.kt
@@ -131,6 +131,10 @@ class PlatformCompatCommandNotInstalledTest {
assertThat(platformCompat.isChangeEnabled(TEST_CHANGE_ID, appInfo)).isEqualTo(params.result)
}
- private fun command(command: String) =
- FileReader(uiAutomation.executeShellCommand(command).fileDescriptor).readText()
+ private fun command(command: String): String {
+ val fileDescriptor = uiAutomation.executeShellCommand(command)
+ return String(ParcelFileDescriptor.AutoCloseInputStream(fileDescriptor).use {
+ inputStream -> inputStream.readBytes()
+ })
+ }
}
diff --git a/tests/net/integration/src/com/android/server/net/integrationtests/ConnectivityServiceIntegrationTest.kt b/tests/net/integration/src/com/android/server/net/integrationtests/ConnectivityServiceIntegrationTest.kt
index 16c486562f53..083c8c8741da 100644
--- a/tests/net/integration/src/com/android/server/net/integrationtests/ConnectivityServiceIntegrationTest.kt
+++ b/tests/net/integration/src/com/android/server/net/integrationtests/ConnectivityServiceIntegrationTest.kt
@@ -38,6 +38,7 @@ import android.net.metrics.IpConnectivityLog
import android.os.ConditionVariable
import android.os.IBinder
import android.os.INetworkManagementService
+import android.os.UserHandle
import android.testing.TestableContext
import android.util.Log
import androidx.test.ext.junit.runners.AndroidJUnit4
@@ -55,10 +56,13 @@ import org.junit.Before
import org.junit.BeforeClass
import org.junit.Test
import org.junit.runner.RunWith
+import org.mockito.AdditionalAnswers
import org.mockito.Mock
import org.mockito.Mockito.any
+import org.mockito.Mockito.anyInt
import org.mockito.Mockito.doNothing
import org.mockito.Mockito.doReturn
+import org.mockito.Mockito.eq
import org.mockito.Mockito.mock
import org.mockito.Mockito.spy
import org.mockito.MockitoAnnotations
@@ -143,7 +147,10 @@ class ConnectivityServiceIntegrationTest {
@Before
fun setUp() {
MockitoAnnotations.initMocks(this)
- doNothing().`when`(context).sendStickyBroadcastAsUser(any(), any(), any())
+ val asUserCtx = mock(Context::class.java, AdditionalAnswers.delegatesTo<Context>(context))
+ doReturn(UserHandle.ALL).`when`(asUserCtx).user
+ doReturn(asUserCtx).`when`(context).createContextAsUser(eq(UserHandle.ALL), anyInt())
+ doNothing().`when`(context).sendStickyBroadcast(any(), any())
networkStackClient = TestNetworkStackClient(realContext)
networkStackClient.init()
diff --git a/tests/net/integration/util/com/android/server/NetworkAgentWrapper.java b/tests/net/integration/util/com/android/server/NetworkAgentWrapper.java
index 3d4dc4d67dcc..dc9e587332cb 100644
--- a/tests/net/integration/util/com/android/server/NetworkAgentWrapper.java
+++ b/tests/net/integration/util/com/android/server/NetworkAgentWrapper.java
@@ -31,6 +31,7 @@ import static junit.framework.Assert.assertTrue;
import static org.junit.Assert.assertEquals;
import static org.junit.Assert.fail;
+import android.annotation.NonNull;
import android.content.Context;
import android.net.ConnectivityManager;
import android.net.LinkProperties;
@@ -40,6 +41,7 @@ import android.net.NetworkAgentConfig;
import android.net.NetworkCapabilities;
import android.net.NetworkProvider;
import android.net.NetworkSpecifier;
+import android.net.QosFilter;
import android.net.SocketKeepalive;
import android.net.UidRange;
import android.os.ConditionVariable;
@@ -47,10 +49,12 @@ import android.os.HandlerThread;
import android.os.Message;
import android.util.Log;
+import com.android.net.module.util.ArrayTrackRecord;
import com.android.server.connectivity.ConnectivityConstants;
import com.android.testutils.HandlerUtils;
import com.android.testutils.TestableNetworkCallback;
+import java.util.Objects;
import java.util.Set;
import java.util.concurrent.atomic.AtomicBoolean;
@@ -71,6 +75,8 @@ public class NetworkAgentWrapper implements TestableNetworkCallback.HasNetwork {
// start/stop. Useful when simulate KeepaliveTracker is waiting for response from modem.
private long mKeepaliveResponseDelay = 0L;
private Integer mExpectedKeepaliveSlot = null;
+ private final ArrayTrackRecord<CallbackType>.ReadHead mCallbackHistory =
+ new ArrayTrackRecord<CallbackType>().newReadHead();
public NetworkAgentWrapper(int transport, LinkProperties linkProperties,
NetworkCapabilities ncTemplate, Context context) throws Exception {
@@ -157,6 +163,20 @@ public class NetworkAgentWrapper implements TestableNetworkCallback.HasNetwork {
}
@Override
+ public void onQosCallbackRegistered(final int qosCallbackId,
+ final @NonNull QosFilter filter) {
+ Log.i(mWrapper.mLogTag, "onQosCallbackRegistered");
+ mWrapper.mCallbackHistory.add(
+ new CallbackType.OnQosCallbackRegister(qosCallbackId, filter));
+ }
+
+ @Override
+ public void onQosCallbackUnregistered(final int qosCallbackId) {
+ Log.i(mWrapper.mLogTag, "onQosCallbackUnregistered");
+ mWrapper.mCallbackHistory.add(new CallbackType.OnQosCallbackUnregister(qosCallbackId));
+ }
+
+ @Override
protected void preventAutomaticReconnect() {
mWrapper.mPreventReconnectReceived.open();
}
@@ -279,7 +299,60 @@ public class NetworkAgentWrapper implements TestableNetworkCallback.HasNetwork {
return mNetworkCapabilities;
}
+ public @NonNull ArrayTrackRecord<CallbackType>.ReadHead getCallbackHistory() {
+ return mCallbackHistory;
+ }
+
public void waitForIdle(long timeoutMs) {
HandlerUtils.waitForIdle(mHandlerThread, timeoutMs);
}
+
+ abstract static class CallbackType {
+ final int mQosCallbackId;
+
+ protected CallbackType(final int qosCallbackId) {
+ mQosCallbackId = qosCallbackId;
+ }
+
+ static class OnQosCallbackRegister extends CallbackType {
+ final QosFilter mFilter;
+ OnQosCallbackRegister(final int qosCallbackId, final QosFilter filter) {
+ super(qosCallbackId);
+ mFilter = filter;
+ }
+
+ @Override
+ public boolean equals(final Object o) {
+ if (this == o) return true;
+ if (o == null || getClass() != o.getClass()) return false;
+ final OnQosCallbackRegister that = (OnQosCallbackRegister) o;
+ return mQosCallbackId == that.mQosCallbackId
+ && Objects.equals(mFilter, that.mFilter);
+ }
+
+ @Override
+ public int hashCode() {
+ return Objects.hash(mQosCallbackId, mFilter);
+ }
+ }
+
+ static class OnQosCallbackUnregister extends CallbackType {
+ OnQosCallbackUnregister(final int qosCallbackId) {
+ super(qosCallbackId);
+ }
+
+ @Override
+ public boolean equals(final Object o) {
+ if (this == o) return true;
+ if (o == null || getClass() != o.getClass()) return false;
+ final OnQosCallbackUnregister that = (OnQosCallbackUnregister) o;
+ return mQosCallbackId == that.mQosCallbackId;
+ }
+
+ @Override
+ public int hashCode() {
+ return Objects.hash(mQosCallbackId);
+ }
+ }
+ }
}
diff --git a/tests/net/java/android/net/NetworkTemplateTest.kt b/tests/net/java/android/net/NetworkTemplateTest.kt
index 9ba56e44fe88..91fcbc0fd5d7 100644
--- a/tests/net/java/android/net/NetworkTemplateTest.kt
+++ b/tests/net/java/android/net/NetworkTemplateTest.kt
@@ -67,6 +67,7 @@ class NetworkTemplateTest {
val caps = NetworkCapabilities().apply {
setCapability(NetworkCapabilities.NET_CAPABILITY_NOT_METERED, false)
setCapability(NetworkCapabilities.NET_CAPABILITY_NOT_ROAMING, true)
+ setSSID(ssid)
}
return NetworkState(info, lp, caps, mock(Network::class.java), subscriberId, ssid)
}
diff --git a/tests/net/java/android/net/QosSocketFilterTest.java b/tests/net/java/android/net/QosSocketFilterTest.java
new file mode 100644
index 000000000000..ad58960eaadd
--- /dev/null
+++ b/tests/net/java/android/net/QosSocketFilterTest.java
@@ -0,0 +1,75 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.net;
+
+import static junit.framework.Assert.assertFalse;
+import static junit.framework.Assert.assertTrue;
+
+import androidx.test.runner.AndroidJUnit4;
+
+import org.junit.Test;
+import org.junit.runner.RunWith;
+
+import java.net.InetAddress;
+import java.net.InetSocketAddress;
+
+@RunWith(AndroidJUnit4.class)
+@androidx.test.filters.SmallTest
+public class QosSocketFilterTest {
+
+ @Test
+ public void testPortExactMatch() {
+ final InetAddress addressA = InetAddresses.parseNumericAddress("1.2.3.4");
+ final InetAddress addressB = InetAddresses.parseNumericAddress("1.2.3.4");
+ assertTrue(QosSocketFilter.matchesLocalAddress(
+ new InetSocketAddress(addressA, 10), addressB, 10, 10));
+
+ }
+
+ @Test
+ public void testPortLessThanStart() {
+ final InetAddress addressA = InetAddresses.parseNumericAddress("1.2.3.4");
+ final InetAddress addressB = InetAddresses.parseNumericAddress("1.2.3.4");
+ assertFalse(QosSocketFilter.matchesLocalAddress(
+ new InetSocketAddress(addressA, 8), addressB, 10, 10));
+ }
+
+ @Test
+ public void testPortGreaterThanEnd() {
+ final InetAddress addressA = InetAddresses.parseNumericAddress("1.2.3.4");
+ final InetAddress addressB = InetAddresses.parseNumericAddress("1.2.3.4");
+ assertFalse(QosSocketFilter.matchesLocalAddress(
+ new InetSocketAddress(addressA, 18), addressB, 10, 10));
+ }
+
+ @Test
+ public void testPortBetweenStartAndEnd() {
+ final InetAddress addressA = InetAddresses.parseNumericAddress("1.2.3.4");
+ final InetAddress addressB = InetAddresses.parseNumericAddress("1.2.3.4");
+ assertTrue(QosSocketFilter.matchesLocalAddress(
+ new InetSocketAddress(addressA, 10), addressB, 8, 18));
+ }
+
+ @Test
+ public void testAddressesDontMatch() {
+ final InetAddress addressA = InetAddresses.parseNumericAddress("1.2.3.4");
+ final InetAddress addressB = InetAddresses.parseNumericAddress("1.2.3.5");
+ assertFalse(QosSocketFilter.matchesLocalAddress(
+ new InetSocketAddress(addressA, 10), addressB, 10, 10));
+ }
+}
+
diff --git a/tests/net/java/com/android/server/ConnectivityServiceTest.java b/tests/net/java/com/android/server/ConnectivityServiceTest.java
index 37307a46b8ac..ca736898065a 100644
--- a/tests/net/java/com/android/server/ConnectivityServiceTest.java
+++ b/tests/net/java/com/android/server/ConnectivityServiceTest.java
@@ -167,6 +167,7 @@ import android.net.INetworkMonitor;
import android.net.INetworkMonitorCallbacks;
import android.net.INetworkPolicyListener;
import android.net.INetworkStatsService;
+import android.net.IQosCallback;
import android.net.InetAddresses;
import android.net.InterfaceConfigurationParcel;
import android.net.IpPrefix;
@@ -190,6 +191,9 @@ import android.net.NetworkStackClient;
import android.net.NetworkState;
import android.net.NetworkTestResultParcelable;
import android.net.ProxyInfo;
+import android.net.QosCallbackException;
+import android.net.QosFilter;
+import android.net.QosSession;
import android.net.ResolverParamsParcel;
import android.net.RouteInfo;
import android.net.RouteInfoParcel;
@@ -197,6 +201,7 @@ import android.net.SocketKeepalive;
import android.net.UidRange;
import android.net.UidRangeParcel;
import android.net.Uri;
+import android.net.VpnInfo;
import android.net.VpnManager;
import android.net.metrics.IpConnectivityLog;
import android.net.shared.NetworkMonitorUtils;
@@ -218,6 +223,7 @@ import android.os.ParcelFileDescriptor;
import android.os.Parcelable;
import android.os.Process;
import android.os.RemoteException;
+import android.os.ServiceSpecificException;
import android.os.SystemClock;
import android.os.UserHandle;
import android.os.UserManager;
@@ -226,10 +232,12 @@ import android.security.Credentials;
import android.security.KeyStore;
import android.system.Os;
import android.telephony.TelephonyManager;
+import android.telephony.data.EpsBearerQosSessionAttributes;
import android.test.mock.MockContentResolver;
import android.text.TextUtils;
import android.util.ArraySet;
import android.util.Log;
+import android.util.Pair;
import android.util.SparseArray;
import androidx.test.InstrumentationRegistry;
@@ -238,7 +246,6 @@ import androidx.test.runner.AndroidJUnit4;
import com.android.internal.app.IBatteryStats;
import com.android.internal.net.VpnConfig;
-import com.android.internal.net.VpnInfo;
import com.android.internal.net.VpnProfile;
import com.android.internal.util.ArrayUtils;
import com.android.internal.util.WakeupMessage;
@@ -251,6 +258,7 @@ import com.android.server.connectivity.Nat464Xlat;
import com.android.server.connectivity.NetworkAgentInfo;
import com.android.server.connectivity.NetworkNotificationManager.NotificationType;
import com.android.server.connectivity.ProxyTracker;
+import com.android.server.connectivity.QosCallbackTracker;
import com.android.server.connectivity.Vpn;
import com.android.server.net.NetworkPinner;
import com.android.server.net.NetworkPolicyManagerInternal;
@@ -368,6 +376,8 @@ public class ConnectivityServiceTest {
private WrappedMultinetworkPolicyTracker mPolicyTracker;
private HandlerThread mAlarmManagerThread;
private TestNetIdManager mNetIdManager;
+ private QosCallbackMockHelper mQosCallbackMockHelper;
+ private QosCallbackTracker mQosCallbackTracker;
@Mock DeviceIdleInternal mDeviceIdleInternal;
@Mock INetworkManagementService mNetworkManagementService;
@@ -1395,6 +1405,7 @@ public class ConnectivityServiceTest {
mService.systemReadyInternal();
mockVpn(Process.myUid());
mCm.bindProcessToNetwork(null);
+ mQosCallbackTracker = mock(QosCallbackTracker.class);
// Ensure that the default setting for Captive Portals is used for most tests
setCaptivePortalMode(Settings.Global.CAPTIVE_PORTAL_MODE_PROMPT);
@@ -1470,6 +1481,11 @@ public class ConnectivityServiceTest {
mEthernetNetworkAgent.disconnect();
mEthernetNetworkAgent = null;
}
+
+ if (mQosCallbackMockHelper != null) {
+ mQosCallbackMockHelper.tearDown();
+ mQosCallbackMockHelper = null;
+ }
mMockVpn.disconnect();
waitForIdle();
@@ -4379,7 +4395,7 @@ public class ConnectivityServiceTest {
}
private Network connectKeepaliveNetwork(LinkProperties lp) throws Exception {
- // Ensure the network is disconnected before we do anything.
+ // Ensure the network is disconnected before anything else occurs
if (mWiFiNetworkAgent != null) {
assertNull(mCm.getNetworkCapabilities(mWiFiNetworkAgent.getNetwork()));
}
@@ -8307,8 +8323,7 @@ public class ConnectivityServiceTest {
assertVpnUidRangesUpdated(true, vpnRange, vpnOwnerUid);
mMockVpn.setVpnType(vpnType);
- final VpnInfo vpnInfo = new VpnInfo();
- vpnInfo.ownerUid = vpnOwnerUid;
+ final VpnInfo vpnInfo = new VpnInfo(vpnOwnerUid, null, null);
mMockVpn.setVpnInfo(vpnInfo);
}
@@ -8512,7 +8527,7 @@ public class ConnectivityServiceTest {
TelephonyManager.getNetworkTypeName(TelephonyManager.NETWORK_TYPE_LTE));
return new NetworkAgentInfo(null, new Network(NET_ID), info, new LinkProperties(),
nc, 0, mServiceContext, null, new NetworkAgentConfig(), mService, null, null, null,
- 0, INVALID_UID);
+ 0, INVALID_UID, mQosCallbackTracker);
}
@Test
@@ -8890,7 +8905,7 @@ public class ConnectivityServiceTest {
@Test
public void testInvalidRequestTypes() {
- final int[] invalidReqTypeInts = new int[] {-1, NetworkRequest.Type.NONE.ordinal(),
+ final int[] invalidReqTypeInts = new int[]{-1, NetworkRequest.Type.NONE.ordinal(),
NetworkRequest.Type.LISTEN.ordinal(), NetworkRequest.Type.values().length};
final NetworkCapabilities nc = new NetworkCapabilities().addTransportType(TRANSPORT_WIFI);
@@ -8903,4 +8918,151 @@ public class ConnectivityServiceTest {
);
}
}
+
+ private class QosCallbackMockHelper {
+ @NonNull public final QosFilter mFilter;
+ @NonNull public final IQosCallback mCallback;
+ @NonNull public final TestNetworkAgentWrapper mAgentWrapper;
+ @NonNull private final List<IQosCallback> mCallbacks = new ArrayList();
+
+ QosCallbackMockHelper() throws Exception {
+ Log.d(TAG, "QosCallbackMockHelper: ");
+ mFilter = mock(QosFilter.class);
+
+ // Ensure the network is disconnected before anything else occurs
+ assertNull(mCellNetworkAgent);
+
+ mCellNetworkAgent = new TestNetworkAgentWrapper(TRANSPORT_CELLULAR);
+ mCellNetworkAgent.connect(true);
+
+ verifyActiveNetwork(TRANSPORT_CELLULAR);
+ waitForIdle();
+ final Network network = mCellNetworkAgent.getNetwork();
+
+ final Pair<IQosCallback, IBinder> pair = createQosCallback();
+ mCallback = pair.first;
+
+ when(mFilter.getNetwork()).thenReturn(network);
+ when(mFilter.validate()).thenReturn(QosCallbackException.EX_TYPE_FILTER_NONE);
+ mAgentWrapper = mCellNetworkAgent;
+ }
+
+ void registerQosCallback(@NonNull final QosFilter filter,
+ @NonNull final IQosCallback callback) {
+ mCallbacks.add(callback);
+ final NetworkAgentInfo nai =
+ mService.getNetworkAgentInfoForNetwork(filter.getNetwork());
+ mService.registerQosCallbackInternal(filter, callback, nai);
+ }
+
+ void tearDown() {
+ for (int i = 0; i < mCallbacks.size(); i++) {
+ mService.unregisterQosCallback(mCallbacks.get(i));
+ }
+ }
+ }
+
+ private Pair<IQosCallback, IBinder> createQosCallback() {
+ final IQosCallback callback = mock(IQosCallback.class);
+ final IBinder binder = mock(Binder.class);
+ when(callback.asBinder()).thenReturn(binder);
+ when(binder.isBinderAlive()).thenReturn(true);
+ return new Pair<>(callback, binder);
+ }
+
+
+ @Test
+ public void testQosCallbackRegistration() throws Exception {
+ mQosCallbackMockHelper = new QosCallbackMockHelper();
+ final NetworkAgentWrapper wrapper = mQosCallbackMockHelper.mAgentWrapper;
+
+ when(mQosCallbackMockHelper.mFilter.validate())
+ .thenReturn(QosCallbackException.EX_TYPE_FILTER_NONE);
+ mQosCallbackMockHelper.registerQosCallback(
+ mQosCallbackMockHelper.mFilter, mQosCallbackMockHelper.mCallback);
+
+ final NetworkAgentWrapper.CallbackType.OnQosCallbackRegister cbRegister1 =
+ (NetworkAgentWrapper.CallbackType.OnQosCallbackRegister)
+ wrapper.getCallbackHistory().poll(1000, x -> true);
+ assertNotNull(cbRegister1);
+
+ final int registerCallbackId = cbRegister1.mQosCallbackId;
+ mService.unregisterQosCallback(mQosCallbackMockHelper.mCallback);
+ final NetworkAgentWrapper.CallbackType.OnQosCallbackUnregister cbUnregister;
+ cbUnregister = (NetworkAgentWrapper.CallbackType.OnQosCallbackUnregister)
+ wrapper.getCallbackHistory().poll(1000, x -> true);
+ assertNotNull(cbUnregister);
+ assertEquals(registerCallbackId, cbUnregister.mQosCallbackId);
+ assertNull(wrapper.getCallbackHistory().poll(200, x -> true));
+ }
+
+ @Test
+ public void testQosCallbackNoRegistrationOnValidationError() throws Exception {
+ mQosCallbackMockHelper = new QosCallbackMockHelper();
+
+ when(mQosCallbackMockHelper.mFilter.validate())
+ .thenReturn(QosCallbackException.EX_TYPE_FILTER_NETWORK_RELEASED);
+ mQosCallbackMockHelper.registerQosCallback(
+ mQosCallbackMockHelper.mFilter, mQosCallbackMockHelper.mCallback);
+ waitForIdle();
+ verify(mQosCallbackMockHelper.mCallback)
+ .onError(eq(QosCallbackException.EX_TYPE_FILTER_NETWORK_RELEASED));
+ }
+
+ @Test
+ public void testQosCallbackAvailableAndLost() throws Exception {
+ mQosCallbackMockHelper = new QosCallbackMockHelper();
+ final int sessionId = 10;
+ final int qosCallbackId = 1;
+
+ when(mQosCallbackMockHelper.mFilter.validate())
+ .thenReturn(QosCallbackException.EX_TYPE_FILTER_NONE);
+ mQosCallbackMockHelper.registerQosCallback(
+ mQosCallbackMockHelper.mFilter, mQosCallbackMockHelper.mCallback);
+ waitForIdle();
+
+ final EpsBearerQosSessionAttributes attributes = new EpsBearerQosSessionAttributes(
+ 1, 2, 3, 4, 5, new ArrayList<>());
+ mQosCallbackMockHelper.mAgentWrapper.getNetworkAgent()
+ .sendQosSessionAvailable(qosCallbackId, sessionId, attributes);
+ waitForIdle();
+
+ verify(mQosCallbackMockHelper.mCallback).onQosEpsBearerSessionAvailable(argThat(session ->
+ session.getSessionId() == sessionId
+ && session.getSessionType() == QosSession.TYPE_EPS_BEARER), eq(attributes));
+
+ mQosCallbackMockHelper.mAgentWrapper.getNetworkAgent()
+ .sendQosSessionLost(qosCallbackId, sessionId);
+ waitForIdle();
+ verify(mQosCallbackMockHelper.mCallback).onQosSessionLost(argThat(session ->
+ session.getSessionId() == sessionId
+ && session.getSessionType() == QosSession.TYPE_EPS_BEARER));
+ }
+
+ @Test
+ public void testQosCallbackTooManyRequests() throws Exception {
+ mQosCallbackMockHelper = new QosCallbackMockHelper();
+
+ when(mQosCallbackMockHelper.mFilter.validate())
+ .thenReturn(QosCallbackException.EX_TYPE_FILTER_NONE);
+ for (int i = 0; i < 100; i++) {
+ final Pair<IQosCallback, IBinder> pair = createQosCallback();
+
+ try {
+ mQosCallbackMockHelper.registerQosCallback(
+ mQosCallbackMockHelper.mFilter, pair.first);
+ } catch (ServiceSpecificException e) {
+ assertEquals(e.errorCode, ConnectivityManager.Errors.TOO_MANY_REQUESTS);
+ if (i < 50) {
+ fail("TOO_MANY_REQUESTS thrown too early, the count is " + i);
+ }
+
+ // As long as there is at least 50 requests, it is safe to assume it works.
+ // Note: The count isn't being tested precisely against 100 because the counter
+ // is shared with request network.
+ return;
+ }
+ }
+ fail("TOO_MANY_REQUESTS never thrown");
+ }
}
diff --git a/tests/net/java/com/android/server/connectivity/LingerMonitorTest.java b/tests/net/java/com/android/server/connectivity/LingerMonitorTest.java
index 4d151afecd63..52cb836e19c8 100644
--- a/tests/net/java/com/android/server/connectivity/LingerMonitorTest.java
+++ b/tests/net/java/com/android/server/connectivity/LingerMonitorTest.java
@@ -78,6 +78,7 @@ public class LingerMonitorTest {
@Mock Context mCtx;
@Mock NetworkNotificationManager mNotifier;
@Mock Resources mResources;
+ @Mock QosCallbackTracker mQosCallbackTracker;
@Before
public void setUp() {
@@ -358,7 +359,7 @@ public class LingerMonitorTest {
NetworkAgentInfo nai = new NetworkAgentInfo(null, new Network(netId), info,
new LinkProperties(), caps, 50, mCtx, null, new NetworkAgentConfig() /* config */,
mConnService, mNetd, mDnsResolver, mNMS, NetworkProvider.ID_NONE,
- Binder.getCallingUid());
+ Binder.getCallingUid(), mQosCallbackTracker);
nai.everValidated = true;
return nai;
}
diff --git a/tests/net/java/com/android/server/net/NetworkStatsBaseTest.java b/tests/net/java/com/android/server/net/NetworkStatsBaseTest.java
index 3aafe0b075f2..1b33930e96a9 100644
--- a/tests/net/java/com/android/server/net/NetworkStatsBaseTest.java
+++ b/tests/net/java/com/android/server/net/NetworkStatsBaseTest.java
@@ -33,8 +33,7 @@ import static android.net.NetworkStats.TAG_NONE;
import static org.junit.Assert.assertEquals;
import android.net.NetworkStats;
-
-import com.android.internal.net.VpnInfo;
+import android.net.VpnInfo;
/** Superclass with utilities for NetworkStats(Service|Factory)Test */
abstract class NetworkStatsBaseTest {
@@ -113,10 +112,6 @@ abstract class NetworkStatsBaseTest {
}
static VpnInfo createVpnInfo(String vpnIface, String[] underlyingIfaces) {
- VpnInfo info = new VpnInfo();
- info.ownerUid = UID_VPN;
- info.vpnIface = vpnIface;
- info.underlyingIfaces = underlyingIfaces;
- return info;
+ return new VpnInfo(UID_VPN, vpnIface, underlyingIfaces);
}
}
diff --git a/tests/net/java/com/android/server/net/NetworkStatsFactoryTest.java b/tests/net/java/com/android/server/net/NetworkStatsFactoryTest.java
index e4996d981fac..76647a69de33 100644
--- a/tests/net/java/com/android/server/net/NetworkStatsFactoryTest.java
+++ b/tests/net/java/com/android/server/net/NetworkStatsFactoryTest.java
@@ -36,13 +36,13 @@ import static org.junit.Assert.fail;
import android.content.res.Resources;
import android.net.NetworkStats;
import android.net.TrafficStats;
+import android.net.VpnInfo;
import androidx.test.InstrumentationRegistry;
import androidx.test.filters.SmallTest;
import androidx.test.runner.AndroidJUnit4;
import com.android.frameworks.tests.net.R;
-import com.android.internal.net.VpnInfo;
import libcore.io.IoUtils;
import libcore.io.Streams;
diff --git a/tests/net/java/com/android/server/net/NetworkStatsServiceTest.java b/tests/net/java/com/android/server/net/NetworkStatsServiceTest.java
index c7836297df75..b4e37de2267f 100644
--- a/tests/net/java/com/android/server/net/NetworkStatsServiceTest.java
+++ b/tests/net/java/com/android/server/net/NetworkStatsServiceTest.java
@@ -21,7 +21,6 @@ import static android.content.Intent.EXTRA_UID;
import static android.net.ConnectivityManager.TYPE_MOBILE;
import static android.net.ConnectivityManager.TYPE_VPN;
import static android.net.ConnectivityManager.TYPE_WIFI;
-import static android.net.ConnectivityManager.TYPE_WIMAX;
import static android.net.NetworkStats.DEFAULT_NETWORK_ALL;
import static android.net.NetworkStats.DEFAULT_NETWORK_NO;
import static android.net.NetworkStats.DEFAULT_NETWORK_YES;
@@ -44,6 +43,7 @@ import static android.net.NetworkStatsHistory.FIELD_ALL;
import static android.net.NetworkTemplate.NETWORK_TYPE_ALL;
import static android.net.NetworkTemplate.buildTemplateMobileAll;
import static android.net.NetworkTemplate.buildTemplateMobileWithRatType;
+import static android.net.NetworkTemplate.buildTemplateWifi;
import static android.net.NetworkTemplate.buildTemplateWifiWildcard;
import static android.net.TrafficStats.MB_IN_BYTES;
import static android.net.TrafficStats.UID_REMOVED;
@@ -86,6 +86,7 @@ import android.net.NetworkState;
import android.net.NetworkStats;
import android.net.NetworkStatsHistory;
import android.net.NetworkTemplate;
+import android.net.VpnInfo;
import android.net.netstats.provider.INetworkStatsProviderCallback;
import android.os.ConditionVariable;
import android.os.Handler;
@@ -104,7 +105,6 @@ import androidx.test.InstrumentationRegistry;
import androidx.test.filters.SmallTest;
import androidx.test.runner.AndroidJUnit4;
-import com.android.internal.net.VpnInfo;
import com.android.internal.util.ArrayUtils;
import com.android.internal.util.test.BroadcastInterceptingContext;
import com.android.server.net.NetworkStatsService.NetworkStatsSettings;
@@ -146,7 +146,7 @@ public class NetworkStatsServiceTest extends NetworkStatsBaseTest {
private static final String IMSI_2 = "310260";
private static final String TEST_SSID = "AndroidAP";
- private static NetworkTemplate sTemplateWifi = buildTemplateWifiWildcard();
+ private static NetworkTemplate sTemplateWifi = buildTemplateWifi(TEST_SSID);
private static NetworkTemplate sTemplateImsi1 = buildTemplateMobileAll(IMSI_1);
private static NetworkTemplate sTemplateImsi2 = buildTemplateMobileAll(IMSI_2);
@@ -291,7 +291,6 @@ public class NetworkStatsServiceTest extends NetworkStatsBaseTest {
// verify service has empty history for wifi
assertNetworkTotal(sTemplateWifi, 0L, 0L, 0L, 0L, 0);
-
// modify some number on wifi, and trigger poll event
incrementCurrentTime(HOUR_IN_MILLIS);
expectDefaultSettings();
@@ -567,61 +566,6 @@ public class NetworkStatsServiceTest extends NetworkStatsBaseTest {
}
@Test
- public void testUid3gWimaxCombinedByTemplate() throws Exception {
- // pretend that network comes online
- expectDefaultSettings();
- NetworkState[] states = new NetworkState[] {buildMobile3gState(IMSI_1)};
- expectNetworkStatsSummary(buildEmptyStats());
- expectNetworkStatsUidDetail(buildEmptyStats());
-
- mService.forceUpdateIfaces(NETWORKS_MOBILE, states, getActiveIface(states), new VpnInfo[0]);
-
- // create some traffic
- incrementCurrentTime(HOUR_IN_MILLIS);
- expectDefaultSettings();
- expectNetworkStatsSummary(buildEmptyStats());
- expectNetworkStatsUidDetail(new NetworkStats(getElapsedRealtime(), 1)
- .insertEntry(TEST_IFACE, UID_RED, SET_DEFAULT, TAG_NONE, 1024L, 8L, 1024L, 8L, 0L)
- .insertEntry(TEST_IFACE, UID_RED, SET_DEFAULT, 0xF00D, 512L, 4L, 512L, 4L, 0L));
- mService.incrementOperationCount(UID_RED, 0xF00D, 5);
-
- forcePollAndWaitForIdle();
-
- // verify service recorded history
- assertUidTotal(sTemplateImsi1, UID_RED, 1024L, 8L, 1024L, 8L, 5);
-
-
- // now switch over to wimax network
- incrementCurrentTime(HOUR_IN_MILLIS);
- expectDefaultSettings();
- states = new NetworkState[] {buildWimaxState(TEST_IFACE2)};
- expectNetworkStatsSummary(buildEmptyStats());
- expectNetworkStatsUidDetail(new NetworkStats(getElapsedRealtime(), 1)
- .insertEntry(TEST_IFACE, UID_RED, SET_DEFAULT, TAG_NONE, 1024L, 8L, 1024L, 8L, 0L)
- .insertEntry(TEST_IFACE, UID_RED, SET_DEFAULT, 0xF00D, 512L, 4L, 512L, 4L, 0L));
-
- mService.forceUpdateIfaces(NETWORKS_MOBILE, states, getActiveIface(states), new VpnInfo[0]);
- forcePollAndWaitForIdle();
-
-
- // create traffic on second network
- incrementCurrentTime(HOUR_IN_MILLIS);
- expectDefaultSettings();
- expectNetworkStatsSummary(buildEmptyStats());
- expectNetworkStatsUidDetail(new NetworkStats(getElapsedRealtime(), 1)
- .insertEntry(TEST_IFACE, UID_RED, SET_DEFAULT, TAG_NONE, 1024L, 8L, 1024L, 8L, 0L)
- .insertEntry(TEST_IFACE, UID_RED, SET_DEFAULT, 0xF00D, 512L, 4L, 512L, 4L, 0L)
- .insertEntry(TEST_IFACE2, UID_RED, SET_DEFAULT, TAG_NONE, 512L, 4L, 256L, 2L, 0L)
- .insertEntry(TEST_IFACE2, UID_RED, SET_DEFAULT, 0xFAAD, 512L, 4L, 256L, 2L, 0L));
- mService.incrementOperationCount(UID_RED, 0xFAAD, 5);
-
- forcePollAndWaitForIdle();
-
- // verify that ALL_MOBILE template combines both
- assertUidTotal(sTemplateImsi1, UID_RED, 1536L, 12L, 1280L, 10L, 10);
- }
-
- @Test
public void testMobileStatsByRatType() throws Exception {
final NetworkTemplate template3g =
buildTemplateMobileWithRatType(null, TelephonyManager.NETWORK_TYPE_UMTS);
@@ -1503,6 +1447,7 @@ public class NetworkStatsServiceTest extends NetworkStatsBaseTest {
capabilities.setCapability(NetworkCapabilities.NET_CAPABILITY_NOT_METERED, !isMetered);
capabilities.setCapability(NetworkCapabilities.NET_CAPABILITY_NOT_ROAMING, true);
capabilities.addTransportType(NetworkCapabilities.TRANSPORT_WIFI);
+ capabilities.setSSID(TEST_SSID);
return new NetworkState(info, prop, capabilities, WIFI_NETWORK, null, TEST_SSID);
}
@@ -1524,17 +1469,6 @@ public class NetworkStatsServiceTest extends NetworkStatsBaseTest {
return new NetworkState(info, prop, capabilities, MOBILE_NETWORK, subscriberId, null);
}
- private static NetworkState buildWimaxState(@NonNull String iface) {
- final NetworkInfo info = new NetworkInfo(TYPE_WIMAX, 0, null, null);
- info.setDetailedState(DetailedState.CONNECTED, null, null);
- final LinkProperties prop = new LinkProperties();
- prop.setInterfaceName(iface);
- final NetworkCapabilities capabilities = new NetworkCapabilities();
- capabilities.setCapability(NetworkCapabilities.NET_CAPABILITY_NOT_METERED, false);
- capabilities.setCapability(NetworkCapabilities.NET_CAPABILITY_NOT_ROAMING, true);
- return new NetworkState(info, prop, capabilities, MOBILE_NETWORK, null, null);
- }
-
private NetworkStats buildEmptyStats() {
return new NetworkStats(getElapsedRealtime(), 0);
}
diff --git a/tests/utils/testutils/java/com/android/internal/util/test/BroadcastInterceptingContext.java b/tests/utils/testutils/java/com/android/internal/util/test/BroadcastInterceptingContext.java
index 25bd7c06be49..1102624da031 100644
--- a/tests/utils/testutils/java/com/android/internal/util/test/BroadcastInterceptingContext.java
+++ b/tests/utils/testutils/java/com/android/internal/util/test/BroadcastInterceptingContext.java
@@ -29,7 +29,6 @@ import java.util.ArrayList;
import java.util.Iterator;
import java.util.List;
import java.util.concurrent.ExecutionException;
-import java.util.concurrent.Future;
import java.util.concurrent.FutureTask;
import java.util.concurrent.TimeUnit;
import java.util.concurrent.TimeoutException;
@@ -197,6 +196,11 @@ public class BroadcastInterceptingContext extends ContextWrapper {
}
@Override
+ public void sendStickyBroadcast(Intent intent, Bundle options) {
+ sendBroadcast(intent);
+ }
+
+ @Override
public void sendStickyBroadcastAsUser(Intent intent, UserHandle user) {
sendBroadcast(intent);
}
diff --git a/tests/vcn/java/android/net/vcn/VcnGatewayConnectionConfigTest.java b/tests/vcn/java/android/net/vcn/VcnGatewayConnectionConfigTest.java
index dfd0c8a75172..86a15912b6b4 100644
--- a/tests/vcn/java/android/net/vcn/VcnGatewayConnectionConfigTest.java
+++ b/tests/vcn/java/android/net/vcn/VcnGatewayConnectionConfigTest.java
@@ -28,6 +28,7 @@ import androidx.test.runner.AndroidJUnit4;
import org.junit.Test;
import org.junit.runner.RunWith;
+import java.util.Arrays;
import java.util.concurrent.TimeUnit;
@RunWith(AndroidJUnit4.class)
@@ -39,6 +40,12 @@ public class VcnGatewayConnectionConfigTest {
NetworkCapabilities.NET_CAPABILITY_INTERNET, NetworkCapabilities.NET_CAPABILITY_MMS
};
public static final int[] UNDERLYING_CAPS = new int[] {NetworkCapabilities.NET_CAPABILITY_DUN};
+
+ static {
+ Arrays.sort(EXPOSED_CAPS);
+ Arrays.sort(UNDERLYING_CAPS);
+ }
+
public static final long[] RETRY_INTERVALS_MS =
new long[] {
TimeUnit.SECONDS.toMillis(5),
@@ -124,12 +131,13 @@ public class VcnGatewayConnectionConfigTest {
public void testBuilderAndGetters() {
final VcnGatewayConnectionConfig config = buildTestConfig();
- for (int cap : EXPOSED_CAPS) {
- config.hasExposedCapability(cap);
- }
- for (int cap : UNDERLYING_CAPS) {
- config.requiresUnderlyingCapability(cap);
- }
+ int[] exposedCaps = config.getExposedCapabilities();
+ Arrays.sort(exposedCaps);
+ assertArrayEquals(EXPOSED_CAPS, exposedCaps);
+
+ int[] underlyingCaps = config.getRequiredUnderlyingCapabilities();
+ Arrays.sort(underlyingCaps);
+ assertArrayEquals(UNDERLYING_CAPS, underlyingCaps);
assertArrayEquals(RETRY_INTERVALS_MS, config.getRetryIntervalsMs());
assertEquals(MAX_MTU, config.getMaxMtu());
diff --git a/tests/vcn/java/com/android/server/VcnManagementServiceTest.java b/tests/vcn/java/com/android/server/VcnManagementServiceTest.java
index 696110f01869..f0cdde33f822 100644
--- a/tests/vcn/java/com/android/server/VcnManagementServiceTest.java
+++ b/tests/vcn/java/com/android/server/VcnManagementServiceTest.java
@@ -18,15 +18,21 @@ package com.android.server;
import static com.android.server.vcn.TelephonySubscriptionTracker.TelephonySubscriptionSnapshot;
import static com.android.server.vcn.TelephonySubscriptionTracker.TelephonySubscriptionTrackerCallback;
+import static com.android.server.vcn.VcnTestUtils.setupSystemService;
import static org.junit.Assert.assertEquals;
import static org.junit.Assert.assertNull;
import static org.junit.Assert.assertTrue;
import static org.junit.Assert.fail;
+import static org.mockito.ArgumentMatchers.any;
+import static org.mockito.ArgumentMatchers.anyInt;
+import static org.mockito.ArgumentMatchers.eq;
import static org.mockito.Mockito.any;
import static org.mockito.Mockito.argThat;
import static org.mockito.Mockito.doAnswer;
+import static org.mockito.Mockito.doNothing;
import static org.mockito.Mockito.doReturn;
+import static org.mockito.Mockito.doThrow;
import static org.mockito.Mockito.eq;
import static org.mockito.Mockito.mock;
import static org.mockito.Mockito.never;
@@ -35,8 +41,10 @@ import static org.mockito.Mockito.verify;
import android.app.AppOpsManager;
import android.content.Context;
import android.net.ConnectivityManager;
+import android.net.vcn.IVcnUnderlyingNetworkPolicyListener;
import android.net.vcn.VcnConfig;
import android.net.vcn.VcnConfigTest;
+import android.os.IBinder;
import android.os.ParcelUuid;
import android.os.PersistableBundle;
import android.os.Process;
@@ -126,12 +134,21 @@ public class VcnManagementServiceTest {
private final VcnManagementService mVcnMgmtSvc;
+ private final IVcnUnderlyingNetworkPolicyListener mMockPolicyListener =
+ mock(IVcnUnderlyingNetworkPolicyListener.class);
+ private final IBinder mMockIBinder = mock(IBinder.class);
+
public VcnManagementServiceTest() throws Exception {
- setupSystemService(mConnMgr, Context.CONNECTIVITY_SERVICE, ConnectivityManager.class);
- setupSystemService(mTelMgr, Context.TELEPHONY_SERVICE, TelephonyManager.class);
setupSystemService(
- mSubMgr, Context.TELEPHONY_SUBSCRIPTION_SERVICE, SubscriptionManager.class);
- setupSystemService(mAppOpsMgr, Context.APP_OPS_SERVICE, AppOpsManager.class);
+ mMockContext, mConnMgr, Context.CONNECTIVITY_SERVICE, ConnectivityManager.class);
+ setupSystemService(
+ mMockContext, mTelMgr, Context.TELEPHONY_SERVICE, TelephonyManager.class);
+ setupSystemService(
+ mMockContext,
+ mSubMgr,
+ Context.TELEPHONY_SUBSCRIPTION_SERVICE,
+ SubscriptionManager.class);
+ setupSystemService(mMockContext, mAppOpsMgr, Context.APP_OPS_SERVICE, AppOpsManager.class);
doReturn(TEST_PACKAGE_NAME).when(mMockContext).getOpPackageName();
@@ -169,15 +186,12 @@ public class VcnManagementServiceTest {
setupMockedCarrierPrivilege(true);
mVcnMgmtSvc = new VcnManagementService(mMockContext, mMockDeps);
+ doReturn(mMockIBinder).when(mMockPolicyListener).asBinder();
+
// Make sure the profiles are loaded.
mTestLooper.dispatchAll();
}
- private void setupSystemService(Object service, String name, Class<?> serviceClass) {
- doReturn(name).when(mMockContext).getSystemServiceName(serviceClass);
- doReturn(service).when(mMockContext).getSystemService(name);
- }
-
private void setupMockedCarrierPrivilege(boolean isPrivileged) {
doReturn(Collections.singletonList(TEST_SUBSCRIPTION_INFO))
.when(mSubMgr)
@@ -438,4 +452,40 @@ public class VcnManagementServiceTest {
mVcnMgmtSvc.clearVcnConfig(TEST_UUID_2);
verify(vcnInstance).teardownAsynchronously();
}
+
+ @Test
+ public void testAddVcnUnderlyingNetworkPolicyListener() throws Exception {
+ doNothing()
+ .when(mMockContext)
+ .enforceCallingPermission(eq(android.Manifest.permission.NETWORK_FACTORY), any());
+
+ mVcnMgmtSvc.addVcnUnderlyingNetworkPolicyListener(mMockPolicyListener);
+
+ verify(mMockIBinder).linkToDeath(any(), anyInt());
+ }
+
+ @Test(expected = SecurityException.class)
+ public void testAddVcnUnderlyingNetworkPolicyListenerInvalidPermission() {
+ doThrow(new SecurityException())
+ .when(mMockContext)
+ .enforceCallingPermission(eq(android.Manifest.permission.NETWORK_FACTORY), any());
+
+ mVcnMgmtSvc.addVcnUnderlyingNetworkPolicyListener(mMockPolicyListener);
+ }
+
+ @Test
+ public void testRemoveVcnUnderlyingNetworkPolicyListener() {
+ // verify listener added
+ doNothing()
+ .when(mMockContext)
+ .enforceCallingPermission(eq(android.Manifest.permission.NETWORK_FACTORY), any());
+ mVcnMgmtSvc.addVcnUnderlyingNetworkPolicyListener(mMockPolicyListener);
+
+ mVcnMgmtSvc.removeVcnUnderlyingNetworkPolicyListener(mMockPolicyListener);
+ }
+
+ @Test
+ public void testRemoveVcnUnderlyingNetworkPolicyListenerNeverRegistered() {
+ mVcnMgmtSvc.removeVcnUnderlyingNetworkPolicyListener(mMockPolicyListener);
+ }
}
diff --git a/tests/vcn/java/com/android/server/vcn/VcnGatewayConnectionDisconnectedStateTest.java b/tests/vcn/java/com/android/server/vcn/VcnGatewayConnectionDisconnectedStateTest.java
new file mode 100644
index 000000000000..4ecd21503165
--- /dev/null
+++ b/tests/vcn/java/com/android/server/vcn/VcnGatewayConnectionDisconnectedStateTest.java
@@ -0,0 +1,84 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server.vcn;
+
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertNull;
+import static org.mockito.ArgumentMatchers.any;
+import static org.mockito.ArgumentMatchers.eq;
+import static org.mockito.Mockito.verify;
+
+import androidx.test.filters.SmallTest;
+import androidx.test.runner.AndroidJUnit4;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.junit.runner.RunWith;
+
+/** Tests for VcnGatewayConnection.DisconnectedState */
+@RunWith(AndroidJUnit4.class)
+@SmallTest
+public class VcnGatewayConnectionDisconnectedStateTest extends VcnGatewayConnectionTestBase {
+ @Before
+ public void setUp() throws Exception {
+ super.setUp();
+
+ mGatewayConnection.transitionTo(mGatewayConnection.mDisconnectedState);
+ mTestLooper.dispatchAll();
+ }
+
+ @Test
+ public void testEnterWhileNotRunningTriggersQuit() throws Exception {
+ final VcnGatewayConnection vgc =
+ new VcnGatewayConnection(mVcnContext, TEST_SUB_GRP, mConfig, mDeps);
+
+ vgc.setIsRunning(false);
+ vgc.transitionTo(vgc.mDisconnectedState);
+ mTestLooper.dispatchAll();
+
+ assertNull(vgc.getCurrentState());
+ }
+
+ @Test
+ public void testNetworkChangesTriggerStateTransitions() throws Exception {
+ mGatewayConnection
+ .getUnderlyingNetworkTrackerCallback()
+ .onSelectedUnderlyingNetworkChanged(TEST_UNDERLYING_NETWORK_RECORD_1);
+ mTestLooper.dispatchAll();
+
+ assertEquals(mGatewayConnection.mConnectingState, mGatewayConnection.getCurrentState());
+ }
+
+ @Test
+ public void testNullNetworkDoesNotTriggerStateTransition() throws Exception {
+ mGatewayConnection
+ .getUnderlyingNetworkTrackerCallback()
+ .onSelectedUnderlyingNetworkChanged(null);
+ mTestLooper.dispatchAll();
+
+ assertEquals(mGatewayConnection.mDisconnectedState, mGatewayConnection.getCurrentState());
+ }
+
+ @Test
+ public void testTeardown() throws Exception {
+ mGatewayConnection.teardownAsynchronously();
+ mTestLooper.dispatchAll();
+
+ assertNull(mGatewayConnection.getCurrentState());
+ verify(mIpSecSvc).deleteTunnelInterface(eq(TEST_IPSEC_TUNNEL_RESOURCE_ID), any());
+ }
+}
diff --git a/tests/vcn/java/com/android/server/vcn/VcnGatewayConnectionDisconnectingStateTest.java b/tests/vcn/java/com/android/server/vcn/VcnGatewayConnectionDisconnectingStateTest.java
new file mode 100644
index 000000000000..d0fec55a6827
--- /dev/null
+++ b/tests/vcn/java/com/android/server/vcn/VcnGatewayConnectionDisconnectingStateTest.java
@@ -0,0 +1,71 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server.vcn;
+
+import static com.android.server.vcn.VcnGatewayConnection.TEARDOWN_TIMEOUT_SECONDS;
+
+import static org.junit.Assert.assertEquals;
+import static org.mockito.Mockito.verify;
+
+import androidx.test.filters.SmallTest;
+import androidx.test.runner.AndroidJUnit4;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.junit.runner.RunWith;
+
+import java.util.concurrent.TimeUnit;
+
+/** Tests for VcnGatewayConnection.DisconnectedState */
+@RunWith(AndroidJUnit4.class)
+@SmallTest
+public class VcnGatewayConnectionDisconnectingStateTest extends VcnGatewayConnectionTestBase {
+ @Before
+ public void setUp() throws Exception {
+ super.setUp();
+
+ mGatewayConnection.setIkeSession(mGatewayConnection.buildIkeSession());
+
+ mGatewayConnection.transitionTo(mGatewayConnection.mDisconnectingState);
+ mTestLooper.dispatchAll();
+ }
+
+ @Test
+ public void testIkeSessionClosed() throws Exception {
+ getIkeSessionCallback().onClosed();
+ mTestLooper.dispatchAll();
+
+ assertEquals(mGatewayConnection.mDisconnectedState, mGatewayConnection.getCurrentState());
+ }
+
+ @Test
+ public void testTimeoutExpired() throws Exception {
+ mTestLooper.moveTimeForward(TimeUnit.SECONDS.toMillis(TEARDOWN_TIMEOUT_SECONDS));
+ mTestLooper.dispatchAll();
+
+ verify(mMockIkeSession).kill();
+ }
+
+ @Test
+ public void testTeardown() throws Exception {
+ mGatewayConnection.teardownAsynchronously();
+ mTestLooper.dispatchAll();
+
+ // Should do nothing; already tearing down.
+ assertEquals(mGatewayConnection.mDisconnectingState, mGatewayConnection.getCurrentState());
+ }
+}
diff --git a/tests/vcn/java/com/android/server/vcn/VcnGatewayConnectionTestBase.java b/tests/vcn/java/com/android/server/vcn/VcnGatewayConnectionTestBase.java
new file mode 100644
index 000000000000..346785907fcf
--- /dev/null
+++ b/tests/vcn/java/com/android/server/vcn/VcnGatewayConnectionTestBase.java
@@ -0,0 +1,120 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server.vcn;
+
+import static com.android.server.vcn.UnderlyingNetworkTracker.UnderlyingNetworkRecord;
+import static com.android.server.vcn.VcnGatewayConnection.VcnIkeSession;
+import static com.android.server.vcn.VcnTestUtils.setupIpSecManager;
+
+import static org.mockito.Matchers.any;
+import static org.mockito.Mockito.doReturn;
+import static org.mockito.Mockito.mock;
+import static org.mockito.Mockito.verify;
+
+import android.annotation.NonNull;
+import android.content.Context;
+import android.net.IpSecManager;
+import android.net.IpSecTunnelInterfaceResponse;
+import android.net.LinkProperties;
+import android.net.Network;
+import android.net.NetworkCapabilities;
+import android.net.ipsec.ike.IkeSessionCallback;
+import android.net.vcn.VcnGatewayConnectionConfig;
+import android.net.vcn.VcnGatewayConnectionConfigTest;
+import android.os.ParcelUuid;
+import android.os.test.TestLooper;
+
+import com.android.server.IpSecService;
+
+import org.junit.Before;
+import org.mockito.ArgumentCaptor;
+
+import java.util.UUID;
+
+public class VcnGatewayConnectionTestBase {
+ protected static final ParcelUuid TEST_SUB_GRP = new ParcelUuid(UUID.randomUUID());
+ protected static final int TEST_IPSEC_TUNNEL_RESOURCE_ID = 1;
+ protected static final String TEST_IPSEC_TUNNEL_IFACE = "IPSEC_IFACE";
+ protected static final UnderlyingNetworkRecord TEST_UNDERLYING_NETWORK_RECORD_1 =
+ new UnderlyingNetworkRecord(
+ new Network(0),
+ new NetworkCapabilities(),
+ new LinkProperties(),
+ false /* blocked */);
+ protected static final UnderlyingNetworkRecord TEST_UNDERLYING_NETWORK_RECORD_2 =
+ new UnderlyingNetworkRecord(
+ new Network(1),
+ new NetworkCapabilities(),
+ new LinkProperties(),
+ false /* blocked */);
+
+ @NonNull protected final Context mContext;
+ @NonNull protected final TestLooper mTestLooper;
+ @NonNull protected final VcnNetworkProvider mVcnNetworkProvider;
+ @NonNull protected final VcnContext mVcnContext;
+ @NonNull protected final VcnGatewayConnectionConfig mConfig;
+ @NonNull protected final VcnGatewayConnection.Dependencies mDeps;
+ @NonNull protected final UnderlyingNetworkTracker mUnderlyingNetworkTracker;
+
+ @NonNull protected final IpSecService mIpSecSvc;
+
+ protected VcnIkeSession mMockIkeSession;
+ protected VcnGatewayConnection mGatewayConnection;
+
+ public VcnGatewayConnectionTestBase() {
+ mContext = mock(Context.class);
+ mTestLooper = new TestLooper();
+ mVcnNetworkProvider = mock(VcnNetworkProvider.class);
+ mVcnContext = mock(VcnContext.class);
+ mConfig = VcnGatewayConnectionConfigTest.buildTestConfig();
+ mDeps = mock(VcnGatewayConnection.Dependencies.class);
+ mUnderlyingNetworkTracker = mock(UnderlyingNetworkTracker.class);
+
+ mIpSecSvc = mock(IpSecService.class);
+ setupIpSecManager(mContext, mIpSecSvc);
+
+ doReturn(mContext).when(mVcnContext).getContext();
+ doReturn(mTestLooper.getLooper()).when(mVcnContext).getLooper();
+ doReturn(mVcnNetworkProvider).when(mVcnContext).getVcnNetworkProvider();
+
+ doReturn(mUnderlyingNetworkTracker)
+ .when(mDeps)
+ .newUnderlyingNetworkTracker(any(), any(), any());
+ }
+
+ @Before
+ public void setUp() throws Exception {
+ IpSecTunnelInterfaceResponse resp =
+ new IpSecTunnelInterfaceResponse(
+ IpSecManager.Status.OK,
+ TEST_IPSEC_TUNNEL_RESOURCE_ID,
+ TEST_IPSEC_TUNNEL_IFACE);
+ doReturn(resp).when(mIpSecSvc).createTunnelInterface(any(), any(), any(), any(), any());
+
+ mMockIkeSession = mock(VcnIkeSession.class);
+ doReturn(mMockIkeSession).when(mDeps).newIkeSession(any(), any(), any(), any(), any());
+
+ mGatewayConnection = new VcnGatewayConnection(mVcnContext, TEST_SUB_GRP, mConfig, mDeps);
+ }
+
+ protected IkeSessionCallback getIkeSessionCallback() {
+ ArgumentCaptor<IkeSessionCallback> captor =
+ ArgumentCaptor.forClass(IkeSessionCallback.class);
+ verify(mDeps).newIkeSession(any(), any(), any(), captor.capture(), any());
+ return captor.getValue();
+ }
+}
diff --git a/tests/vcn/java/com/android/server/vcn/VcnTestUtils.java b/tests/vcn/java/com/android/server/vcn/VcnTestUtils.java
new file mode 100644
index 000000000000..2b1080650d6d
--- /dev/null
+++ b/tests/vcn/java/com/android/server/vcn/VcnTestUtils.java
@@ -0,0 +1,44 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server.vcn;
+
+import static org.mockito.Mockito.doReturn;
+
+import android.content.Context;
+import android.net.IpSecManager;
+
+import com.android.server.IpSecService;
+
+public class VcnTestUtils {
+ /** Mock system services by directly mocking the *Manager interface. */
+ public static void setupSystemService(
+ Context mockContext, Object service, String name, Class<?> serviceClass) {
+ doReturn(name).when(mockContext).getSystemServiceName(serviceClass);
+ doReturn(service).when(mockContext).getSystemService(name);
+ }
+
+ /** Mock IpSecService by mocking the underlying service binder. */
+ public static IpSecManager setupIpSecManager(Context mockContext, IpSecService service) {
+ doReturn(Context.IPSEC_SERVICE).when(mockContext).getSystemServiceName(IpSecManager.class);
+
+ final IpSecManager ipSecMgr = new IpSecManager(mockContext, service);
+ doReturn(ipSecMgr).when(mockContext).getSystemService(Context.IPSEC_SERVICE);
+
+ // Return to ensure this doesn't get reaped.
+ return ipSecMgr;
+ }
+}
diff --git a/tools/stringslint/stringslint.py b/tools/stringslint/stringslint.py
index afe91cda37b0..15088fc81e88 100644
--- a/tools/stringslint/stringslint.py
+++ b/tools/stringslint/stringslint.py
@@ -1,4 +1,5 @@
-#!/usr/bin/env python
+#!/usr/bin/env python3
+#-*- coding: utf-8 -*-
# Copyright (C) 2018 The Android Open Source Project
#
@@ -33,9 +34,6 @@ In general:
import re, sys, codecs
import lxml.etree as ET
-reload(sys)
-sys.setdefaultencoding('utf8')
-
BLACK, RED, GREEN, YELLOW, BLUE, MAGENTA, CYAN, WHITE = range(8)
def format(fg=None, bg=None, bright=False, bold=False, dim=False, reset=False):
@@ -118,7 +116,7 @@ def lint(path):
raw = f.read()
if len(raw.strip()) == 0:
return warnings
- tree = ET.fromstring(raw)
+ tree = ET.fromstring(bytes(raw, encoding='utf-8'))
root = tree #tree.getroot()
last_comment = None
@@ -231,6 +229,6 @@ for b in before:
if len(after) > 0:
for a in sorted(after.keys()):
- print after[a]
- print
+ print(after[a])
+ print()
sys.exit(1)
diff --git a/tools/stringslint/stringslint_sha.sh b/tools/stringslint/stringslint_sha.sh
index bd80bb4e6f3f..bd0569873197 100755
--- a/tools/stringslint/stringslint_sha.sh
+++ b/tools/stringslint/stringslint_sha.sh
@@ -1,5 +1,5 @@
#!/bin/bash
LOCAL_DIR="$( dirname ${BASH_SOURCE} )"
git show --name-only --pretty=format: $1 | grep values/strings.xml | while read file; do
- python $LOCAL_DIR/stringslint.py <(git show $1:$file) <(git show $1^:$file)
+ python3 $LOCAL_DIR/stringslint.py <(git show $1:$file) <(git show $1^:$file)
done